").append(a).html())):c?Sa.clone.call(a):a;if(k)for(var l in k)d.data("$"+l+"Controller",k[l].instance);da.$$addScopeInfo(d,b);c&&
+c(d,b);g&&g(b,d,d,h);c||(a=g=null);return d}}function Ua(a,b,c,d,e,g){function f(a,c,d,e){var g,k,l,m,p,n,G;if(t)for(G=Array(c.length),m=0;m
s.priority)break;if(w=s.scope)s.templateUrl||(B(w)?(aa("new/isolated scope",J||t,s,v),J=s):aa("new/isolated scope",J,s,v)),t=t||s;R=s.name;if(!u&&(s.replace&&(s.templateUrl||s.template)||s.transclude&&!s.$$tlb)){for(w=Da+1;u=a[w++];)if(u.transclude&&!u.$$tlb||u.replace&&(u.templateUrl||u.template)){Ib=!0;break}u=!0}!s.templateUrl&&s.controller&&(H=H||S(),aa("'"+R+"' controller",H[R],s,v),H[R]=s);if(w=s.transclude)if(ba=!0,
+s.$$tlb||(aa("transclusion",y,s,v),y=s),"element"===w)T=!0,n=s.priority,P=v,v=d.$$element=z(da.$$createComment(R,d[R])),b=v[0],ma(g,xa.call(P,0),b),P[0].$$parentNode=P[0].parentNode,q=W(Ib,P,e,n,f&&f.name,{nonTlbTranscludeDirective:y});else{var na=S();if(B(w)){P=[];var Ua=S(),Ma=S();r(w,function(a,b){var c="?"===a.charAt(0);a=c?a.substring(1):a;Ua[a]=b;na[b]=null;Ma[b]=c});r(v.contents(),function(a){var b=Ua[Ea(ya(a))];b?(Ma[b]=!0,na[b]=na[b]||[],na[b].push(a)):P.push(a)});r(Ma,function(a,b){if(!a)throw ca("reqslot",
+b);});for(var L in na)na[L]&&(na[L]=W(Ib,na[L],e))}else P=z(nc(b)).contents();v.empty();q=W(Ib,P,e,void 0,void 0,{needsNewScope:s.$$isolateScope||s.$$newScope});q.$$slots=na}if(s.template)if(M=!0,aa("template",A,s,v),A=s,w=C(s.template)?s.template(v,d):s.template,w=Ia(w),s.replace){f=s;P=kc.test(w)?qd(ka(s.templateNamespace,Q(w))):[];b=P[0];if(1!==P.length||1!==b.nodeType)throw ca("tplrt",R,"");ma(g,v,b);D={$attr:{}};w=K(b,[],D);var rc=a.splice(Da+1,a.length-(Da+1));(J||t)&&Z(w,J,t);a=a.concat(w).concat(rc);
+fa(d,D);D=a.length}else v.html(w);if(s.templateUrl)M=!0,aa("template",A,s,v),A=s,s.replace&&(f=s),p=ja(a.splice(Da,a.length-Da),v,d,g,ba&&q,h,k,{controllerDirectives:H,newScopeDirective:t!==s&&t,newIsolateScopeDirective:J,templateDirective:A,nonTlbTranscludeDirective:y}),D=a.length;else if(s.compile)try{N=s.compile(v,d,q);var U=s.$$originalDirective||s;C(N)?m(null,Ra(U,N),Ta,E):N&&m(Ra(U,N.pre),Ra(U,N.post),Ta,E)}catch($){c($,za(v))}s.terminal&&(p.terminal=!0,n=Math.max(n,s.priority))}p.scope=t&&
+!0===t.scope;p.transcludeOnThisElement=ba;p.templateOnThisElement=M;p.transclude=q;l.hasElementTranscludeDirective=T;return p}function X(a,b,c,d){var e;if(E(b)){var g=b.match(l);b=b.substring(g[0].length);var f=g[1]||g[3],g="?"===g[2];"^^"===f?c=c.parent():e=(e=d&&d[b])&&e.instance;if(!e){var h="$"+b+"Controller";e=f?c.inheritedData(h):c.data(h)}if(!e&&!g)throw ca("ctreq",b,a);}else if(I(b))for(e=[],f=0,g=b.length;fc.priority)&&-1!==c.restrict.indexOf(e)){k&&(c=$b(c,{$$start:k,$$end:l}));if(!c.$$bindings){var t=m=c,G=c.name,H={isolateScope:null,bindToController:null};B(t.scope)&&(!0===t.bindToController?(H.bindToController=d(t.scope,G,!0),H.isolateScope={}):H.isolateScope=d(t.scope,G,!1));B(t.bindToController)&&(H.bindToController=d(t.bindToController,G,!0));if(H.bindToController&&!t.controller)throw ca("noctrl",G);m=m.$$bindings=H;B(m.isolateScope)&&(c.$$isolateBindings=m.isolateScope)}b.push(c);
+m=c}}return m}function $(b){if(f.hasOwnProperty(b))for(var c=a.get(b+"Directive"),d=0,e=c.length;d"+b+"";return c.childNodes[0].childNodes;default:return b}}function ua(a,b){if("srcdoc"===b)return T.HTML;var c=ya(a);if("src"===b||"ngSrc"===b){if(-1===["img","video","audio","source","track"].indexOf(c))return T.RESOURCE_URL}else if("xlinkHref"===b||"form"===c&&"action"===b||"link"===c&&"href"===b)return T.RESOURCE_URL}function wa(a,c,d,e,g){var f=ua(a,e),h=k[e]||g,l=b(d,!g,f,h);if(l){if("multiple"===e&&"select"===ya(a))throw ca("selmulti",
+za(a));if(m.test(e))throw ca("nodomevents");c.push({priority:100,compile:function(){return{pre:function(a,c,g){c=g.$$observers||(g.$$observers=S());var k=g[e];k!==d&&(l=k&&b(k,!0,f,h),d=k);l&&(g[e]=l(a),(c[e]||(c[e]=[])).$$inter=!0,(g.$$observers&&g.$$observers[e].$$scope||a).$watch(l,function(a,b){"class"===e&&a!==b?g.$updateClass(a,b):g.$set(e,a)}))}}}})}}function ma(a,b,c){var d=b[0],e=b.length,g=d.parentNode,f,h;if(a)for(f=0,h=a.length;f=b)return a;for(;b--;){var d=a[b];(8===d.nodeType||d.nodeType===Oa&&""===d.nodeValue.trim())&&ug.call(a,b,1)}return a}function sg(a,b){if(b&&E(b))return b;if(E(a)){var d=td.exec(a);if(d)return d[3]}}function yf(){var a={},b=!1;this.has=function(b){return a.hasOwnProperty(b)};this.register=function(b,
+c){Ia(b,"controller");B(b)?O(a,b):a[b]=c};this.allowGlobals=function(){b=!0};this.$get=["$injector","$window",function(d,c){function e(a,b,c,d){if(!a||!B(a.$scope))throw K("$controller")("noscp",d,b);a.$scope[b]=c}return function(f,g,h,k){var l,m,p;h=!0===h;k&&E(k)&&(p=k);if(E(f)){k=f.match(td);if(!k)throw ud("ctrlfmt",f);m=k[1];p=p||k[3];f=a.hasOwnProperty(m)?a[m]:Xc(g.$scope,m,!0)||(b?Xc(c,m,!0):void 0);if(!f)throw ud("ctrlreg",m);sb(f,m,!0)}if(h)return h=(I(f)?f[f.length-1]:f).prototype,l=Object.create(h||
+null),p&&e(g,p,l,m||f.name),O(function(){var a=d.invoke(f,l,g,m);a!==l&&(B(a)||C(a))&&(l=a,p&&e(g,p,l,m||f.name));return l},{instance:l,identifier:p});l=d.instantiate(f,g,m);p&&e(g,p,l,m||f.name);return l}}]}function zf(){this.$get=["$window",function(a){return z(a.document)}]}function Af(){this.$get=["$document","$rootScope",function(a,b){function d(){e=c.hidden}var c=a[0],e=c&&c.hidden;a.on("visibilitychange",d);b.$on("$destroy",function(){a.off("visibilitychange",d)});return function(){return e}}]}
+function Bf(){this.$get=["$log",function(a){return function(b,d){a.error.apply(a,arguments)}}]}function tc(a){return B(a)?fa(a)?a.toISOString():eb(a):a}function Gf(){this.$get=function(){return function(a){if(!a)return"";var b=[];Oc(a,function(a,c){null===a||x(a)||C(a)||(I(a)?r(a,function(a){b.push(ja(c)+"="+ja(tc(a)))}):b.push(ja(c)+"="+ja(tc(a))))});return b.join("&")}}}function Hf(){this.$get=function(){return function(a){function b(a,e,f){null===a||x(a)||(I(a)?r(a,function(a,c){b(a,e+"["+(B(a)?
+c:"")+"]")}):B(a)&&!fa(a)?Oc(a,function(a,c){b(a,e+(f?"":"[")+c+(f?"":"]"))}):d.push(ja(e)+"="+ja(tc(a))))}if(!a)return"";var d=[];b(a,"",!0);return d.join("&")}}}function uc(a,b){if(E(a)){var d=a.replace(vg,"").trim();if(d){var c=b("Content-Type"),c=c&&0===c.indexOf(vd),e;(e=c)||(e=(e=d.match(wg))&&xg[e[0]].test(d));if(e)try{a=Rc(d)}catch(f){if(!c)return a;throw Kb("baddata",a,f);}}}return a}function wd(a){var b=S(),d;E(a)?r(a.split("\n"),function(a){d=a.indexOf(":");var e=L(Q(a.substr(0,d)));a=
+Q(a.substr(d+1));e&&(b[e]=b[e]?b[e]+", "+a:a)}):B(a)&&r(a,function(a,d){var f=L(d),g=Q(a);f&&(b[f]=b[f]?b[f]+", "+g:g)});return b}function xd(a){var b;return function(d){b||(b=wd(a));return d?(d=b[L(d)],void 0===d&&(d=null),d):b}}function yd(a,b,d,c){if(C(c))return c(a,b,d);r(c,function(c){a=c(a,b,d)});return a}function Ff(){var a=this.defaults={transformResponse:[uc],transformRequest:[function(a){return B(a)&&"[object File]"!==ia.call(a)&&"[object Blob]"!==ia.call(a)&&"[object FormData]"!==ia.call(a)?
+eb(a):a}],headers:{common:{Accept:"application/json, text/plain, */*"},post:ka(vc),put:ka(vc),patch:ka(vc)},xsrfCookieName:"XSRF-TOKEN",xsrfHeaderName:"X-XSRF-TOKEN",paramSerializer:"$httpParamSerializer",jsonpCallbackParam:"callback"},b=!1;this.useApplyAsync=function(a){return u(a)?(b=!!a,this):b};var d=this.interceptors=[];this.$get=["$browser","$httpBackend","$$cookieReader","$cacheFactory","$rootScope","$q","$injector","$sce",function(c,e,f,g,h,k,l,m){function p(b){function d(a,b){for(var c=0,
+e=b.length;ca?b:k.reject(b)}if(!B(b))throw K("$http")("badreq",b);if(!E(m.valueOf(b.url)))throw K("$http")("badreq",b.url);var f=O({method:"get",transformRequest:a.transformRequest,transformResponse:a.transformResponse,paramSerializer:a.paramSerializer,
+jsonpCallbackParam:a.jsonpCallbackParam},b);f.headers=function(b){var c=a.headers,d=O({},b.headers),g,f,h,c=O({},c.common,c[L(b.method)]);a:for(g in c){f=L(g);for(h in d)if(L(h)===f)continue a;d[g]=c[g]}return e(d,ka(b))}(b);f.method=ub(f.method);f.paramSerializer=E(f.paramSerializer)?l.get(f.paramSerializer):f.paramSerializer;c.$$incOutstandingRequestCount();var h=[],p=[];b=k.resolve(f);r(y,function(a){(a.request||a.requestError)&&h.unshift(a.request,a.requestError);(a.response||a.responseError)&&
+p.push(a.response,a.responseError)});b=d(b,h);b=b.then(function(b){var c=b.headers,d=yd(b.data,xd(c),void 0,b.transformRequest);x(d)&&r(c,function(a,b){"content-type"===L(b)&&delete c[b]});x(b.withCredentials)&&!x(a.withCredentials)&&(b.withCredentials=a.withCredentials);return n(b,d).then(g,g)});b=d(b,p);return b=b.finally(function(){c.$$completeOutstandingRequest(D)})}function n(c,d){function g(a){if(a){var c={};r(a,function(a,d){c[d]=function(c){function d(){a(c)}b?h.$applyAsync(d):h.$$phase?d():
+h.$apply(d)}});return c}}function l(a,c,d,e,g){function f(){n(c,a,d,e,g)}M&&(200<=a&&300>a?M.put(N,[a,c,wd(d),e,g]):M.remove(N));b?h.$applyAsync(f):(f(),h.$$phase||h.$apply())}function n(a,b,d,e,g){b=-1<=b?b:0;(200<=b&&300>b?J.resolve:J.reject)({data:a,status:b,headers:xd(d),config:c,statusText:e,xhrStatus:g})}function G(a){n(a.data,a.status,ka(a.headers()),a.statusText,a.xhrStatus)}function y(){var a=p.pendingRequests.indexOf(c);-1!==a&&p.pendingRequests.splice(a,1)}var J=k.defer(),R=J.promise,M,
+T,P=c.headers,q="jsonp"===L(c.method),N=c.url;q?N=m.getTrustedResourceUrl(N):E(N)||(N=m.valueOf(N));N=F(N,c.paramSerializer(c.params));q&&(N=s(N,c.jsonpCallbackParam));p.pendingRequests.push(c);R.then(y,y);!c.cache&&!a.cache||!1===c.cache||"GET"!==c.method&&"JSONP"!==c.method||(M=B(c.cache)?c.cache:B(a.cache)?a.cache:v);M&&(T=M.get(N),u(T)?T&&C(T.then)?T.then(G,G):I(T)?n(T[1],T[0],ka(T[2]),T[3],T[4]):n(T,200,{},"OK","complete"):M.put(N,R));x(T)&&((T=zd(c.url)?f()[c.xsrfCookieName||a.xsrfCookieName]:
+void 0)&&(P[c.xsrfHeaderName||a.xsrfHeaderName]=T),e(c.method,N,d,l,P,c.timeout,c.withCredentials,c.responseType,g(c.eventHandlers),g(c.uploadEventHandlers)));return R}function F(a,b){0=l&&(r.resolve(y),v(q.$$intervalId),delete g[q.$$intervalId]);t||a.$apply()},k);g[q.$$intervalId]=r;return q}
+var g={};f.cancel=function(a){return a&&a.$$intervalId in g?(g[a.$$intervalId].promise.$$state.pur=!0,g[a.$$intervalId].reject("canceled"),b.clearInterval(a.$$intervalId),delete g[a.$$intervalId],!0):!1};return f}]}function wc(a){a=a.split("/");for(var b=a.length;b--;)a[b]=fb(a[b].replace(/%2F/g,"/"));return a.join("/")}function Ad(a,b){var d=ta(a);b.$$protocol=d.protocol;b.$$host=d.hostname;b.$$port=Z(d.port)||zg[d.protocol]||null}function Bd(a,b,d){if(Ag.test(a))throw kb("badpath",a);var c="/"!==
+a.charAt(0);c&&(a="/"+a);a=ta(a);for(var c=(c&&"/"===a.pathname.charAt(0)?a.pathname.substring(1):a.pathname).split("/"),e=c.length;e--;)c[e]=decodeURIComponent(c[e]),d&&(c[e]=c[e].replace(/\//g,"%2F"));d=c.join("/");b.$$path=d;b.$$search=ec(a.search);b.$$hash=decodeURIComponent(a.hash);b.$$path&&"/"!==b.$$path.charAt(0)&&(b.$$path="/"+b.$$path)}function xc(a,b){return a.slice(0,b.length)===b}function ua(a,b){if(xc(b,a))return b.substr(a.length)}function La(a){var b=a.indexOf("#");return-1===b?a:
+a.substr(0,b)}function lb(a){return a.replace(/(#.+)|#$/,"$1")}function yc(a,b,d){this.$$html5=!0;d=d||"";Ad(a,this);this.$$parse=function(a){var d=ua(b,a);if(!E(d))throw kb("ipthprfx",a,b);Bd(d,this,!0);this.$$path||(this.$$path="/");this.$$compose()};this.$$compose=function(){var a=fc(this.$$search),d=this.$$hash?"#"+fb(this.$$hash):"";this.$$url=wc(this.$$path)+(a?"?"+a:"")+d;this.$$absUrl=b+this.$$url.substr(1);this.$$urlUpdatedByLocation=!0};this.$$parseLinkUrl=function(c,e){if(e&&"#"===e[0])return this.hash(e.slice(1)),
+!0;var f,g;u(f=ua(a,c))?(g=f,g=d&&u(f=ua(d,f))?b+(ua("/",f)||f):a+g):u(f=ua(b,c))?g=b+f:b===c+"/"&&(g=b);g&&this.$$parse(g);return!!g}}function zc(a,b,d){Ad(a,this);this.$$parse=function(c){var e=ua(a,c)||ua(b,c),f;x(e)||"#"!==e.charAt(0)?this.$$html5?f=e:(f="",x(e)&&(a=c,this.replace())):(f=ua(d,e),x(f)&&(f=e));Bd(f,this,!1);c=this.$$path;var e=a,g=/^\/[A-Z]:(\/.*)/;xc(f,e)&&(f=f.replace(e,""));g.exec(f)||(c=(f=g.exec(c))?f[1]:c);this.$$path=c;this.$$compose()};this.$$compose=function(){var b=fc(this.$$search),
+e=this.$$hash?"#"+fb(this.$$hash):"";this.$$url=wc(this.$$path)+(b?"?"+b:"")+e;this.$$absUrl=a+(this.$$url?d+this.$$url:"");this.$$urlUpdatedByLocation=!0};this.$$parseLinkUrl=function(b,d){return La(a)===La(b)?(this.$$parse(b),!0):!1}}function Cd(a,b,d){this.$$html5=!0;zc.apply(this,arguments);this.$$parseLinkUrl=function(c,e){if(e&&"#"===e[0])return this.hash(e.slice(1)),!0;var f,g;a===La(c)?f=c:(g=ua(b,c))?f=a+d+g:b===c+"/"&&(f=b);f&&this.$$parse(f);return!!f};this.$$compose=function(){var b=fc(this.$$search),
+e=this.$$hash?"#"+fb(this.$$hash):"";this.$$url=wc(this.$$path)+(b?"?"+b:"")+e;this.$$absUrl=a+d+this.$$url;this.$$urlUpdatedByLocation=!0}}function Lb(a){return function(){return this[a]}}function Dd(a,b){return function(d){if(x(d))return this[a];this[a]=b(d);this.$$compose();return this}}function Lf(){var a="!",b={enabled:!1,requireBase:!0,rewriteLinks:!0};this.hashPrefix=function(b){return u(b)?(a=b,this):a};this.html5Mode=function(a){if(Na(a))return b.enabled=a,this;if(B(a)){Na(a.enabled)&&(b.enabled=
+a.enabled);Na(a.requireBase)&&(b.requireBase=a.requireBase);if(Na(a.rewriteLinks)||E(a.rewriteLinks))b.rewriteLinks=a.rewriteLinks;return this}return b};this.$get=["$rootScope","$browser","$sniffer","$rootElement","$window",function(d,c,e,f,g){function h(a,b,d){var e=l.url(),g=l.$$state;try{c.url(a,b,d),l.$$state=c.state()}catch(f){throw l.url(e),l.$$state=g,f;}}function k(a,b){d.$broadcast("$locationChangeSuccess",l.absUrl(),a,l.$$state,b)}var l,m;m=c.baseHref();var p=c.url(),n;if(b.enabled){if(!m&&
+b.requireBase)throw kb("nobase");n=p.substring(0,p.indexOf("/",p.indexOf("//")+2))+(m||"/");m=e.history?yc:Cd}else n=La(p),m=zc;var F=n.substr(0,La(n).lastIndexOf("/")+1);l=new m(n,F,"#"+a);l.$$parseLinkUrl(p,p);l.$$state=c.state();var s=/^\s*(javascript|mailto):/i;f.on("click",function(a){var e=b.rewriteLinks;if(e&&!a.ctrlKey&&!a.metaKey&&!a.shiftKey&&2!==a.which&&2!==a.button){for(var h=z(a.target);"a"!==ya(h[0]);)if(h[0]===f[0]||!(h=h.parent())[0])return;if(!E(e)||!x(h.attr(e))){var e=h.prop("href"),
+k=h.attr("href")||h.attr("xlink:href");B(e)&&"[object SVGAnimatedString]"===e.toString()&&(e=ta(e.animVal).href);s.test(e)||!e||h.attr("target")||a.isDefaultPrevented()||!l.$$parseLinkUrl(e,k)||(a.preventDefault(),l.absUrl()!==c.url()&&(d.$apply(),g.angular["ff-684208-preventDefault"]=!0))}}});lb(l.absUrl())!==lb(p)&&c.url(l.absUrl(),!0);var v=!0;c.onUrlChange(function(a,b){xc(a,F)?(d.$evalAsync(function(){var c=l.absUrl(),e=l.$$state,g;a=lb(a);l.$$parse(a);l.$$state=b;g=d.$broadcast("$locationChangeStart",
+a,c,b,e).defaultPrevented;l.absUrl()===a&&(g?(l.$$parse(c),l.$$state=e,h(c,!1,e)):(v=!1,k(c,e)))}),d.$$phase||d.$digest()):g.location.href=a});d.$watch(function(){if(v||l.$$urlUpdatedByLocation){l.$$urlUpdatedByLocation=!1;var a=lb(c.url()),b=lb(l.absUrl()),g=c.state(),f=l.$$replace,m=a!==b||l.$$html5&&e.history&&g!==l.$$state;if(v||m)v=!1,d.$evalAsync(function(){var b=l.absUrl(),c=d.$broadcast("$locationChangeStart",b,a,l.$$state,g).defaultPrevented;l.absUrl()===b&&(c?(l.$$parse(a),l.$$state=g):
+(m&&h(b,f,g===l.$$state?null:l.$$state),k(a,g)))})}l.$$replace=!1});return l}]}function Mf(){var a=!0,b=this;this.debugEnabled=function(b){return u(b)?(a=b,this):a};this.$get=["$window",function(d){function c(a){bc(a)&&(a.stack&&f?a=a.message&&-1===a.stack.indexOf(a.message)?"Error: "+a.message+"\n"+a.stack:a.stack:a.sourceURL&&(a=a.message+"\n"+a.sourceURL+":"+a.line));return a}function e(a){var b=d.console||{},e=b[a]||b.log||D;return function(){var a=[];r(arguments,function(b){a.push(c(b))});return Function.prototype.apply.call(e,
+b,a)}}var f=Ca||/\bEdge\//.test(d.navigator&&d.navigator.userAgent);return{log:e("log"),info:e("info"),warn:e("warn"),error:e("error"),debug:function(){var c=e("debug");return function(){a&&c.apply(b,arguments)}}()}}]}function Bg(a){return a+""}function Cg(a,b){return"undefined"!==typeof a?a:b}function Ed(a,b){return"undefined"===typeof a?b:"undefined"===typeof b?a:a+b}function Dg(a,b){switch(a.type){case q.MemberExpression:if(a.computed)return!1;break;case q.UnaryExpression:return 1;case q.BinaryExpression:return"+"!==
+a.operator?1:!1;case q.CallExpression:return!1}return void 0===b?Fd:b}function W(a,b,d){var c,e,f=a.isPure=Dg(a,d);switch(a.type){case q.Program:c=!0;r(a.body,function(a){W(a.expression,b,f);c=c&&a.expression.constant});a.constant=c;break;case q.Literal:a.constant=!0;a.toWatch=[];break;case q.UnaryExpression:W(a.argument,b,f);a.constant=a.argument.constant;a.toWatch=a.argument.toWatch;break;case q.BinaryExpression:W(a.left,b,f);W(a.right,b,f);a.constant=a.left.constant&&a.right.constant;a.toWatch=
+a.left.toWatch.concat(a.right.toWatch);break;case q.LogicalExpression:W(a.left,b,f);W(a.right,b,f);a.constant=a.left.constant&&a.right.constant;a.toWatch=a.constant?[]:[a];break;case q.ConditionalExpression:W(a.test,b,f);W(a.alternate,b,f);W(a.consequent,b,f);a.constant=a.test.constant&&a.alternate.constant&&a.consequent.constant;a.toWatch=a.constant?[]:[a];break;case q.Identifier:a.constant=!1;a.toWatch=[a];break;case q.MemberExpression:W(a.object,b,f);a.computed&&W(a.property,b,f);a.constant=a.object.constant&&
+(!a.computed||a.property.constant);a.toWatch=a.constant?[]:[a];break;case q.CallExpression:c=d=a.filter?!b(a.callee.name).$stateful:!1;e=[];r(a.arguments,function(a){W(a,b,f);c=c&&a.constant;e.push.apply(e,a.toWatch)});a.constant=c;a.toWatch=d?e:[a];break;case q.AssignmentExpression:W(a.left,b,f);W(a.right,b,f);a.constant=a.left.constant&&a.right.constant;a.toWatch=[a];break;case q.ArrayExpression:c=!0;e=[];r(a.elements,function(a){W(a,b,f);c=c&&a.constant;e.push.apply(e,a.toWatch)});a.constant=c;
+a.toWatch=e;break;case q.ObjectExpression:c=!0;e=[];r(a.properties,function(a){W(a.value,b,f);c=c&&a.value.constant;e.push.apply(e,a.value.toWatch);a.computed&&(W(a.key,b,!1),c=c&&a.key.constant,e.push.apply(e,a.key.toWatch))});a.constant=c;a.toWatch=e;break;case q.ThisExpression:a.constant=!1;a.toWatch=[];break;case q.LocalsExpression:a.constant=!1,a.toWatch=[]}}function Gd(a){if(1===a.length){a=a[0].expression;var b=a.toWatch;return 1!==b.length?b:b[0]!==a?b:void 0}}function Hd(a){return a.type===
+q.Identifier||a.type===q.MemberExpression}function Id(a){if(1===a.body.length&&Hd(a.body[0].expression))return{type:q.AssignmentExpression,left:a.body[0].expression,right:{type:q.NGValueParameter},operator:"="}}function Jd(a){this.$filter=a}function Kd(a){this.$filter=a}function Mb(a,b,d){this.ast=new q(a,d);this.astCompiler=d.csp?new Kd(b):new Jd(b)}function Ac(a){return C(a.valueOf)?a.valueOf():Eg.call(a)}function Nf(){var a=S(),b={"true":!0,"false":!1,"null":null,undefined:void 0},d,c;this.addLiteral=
+function(a,c){b[a]=c};this.setIdentifierFns=function(a,b){d=a;c=b;return this};this.$get=["$filter",function(e){function f(b,c){var d,g;switch(typeof b){case "string":return g=b=b.trim(),d=a[g],d||(d=new Nb(n),d=(new Mb(d,e,n)).parse(b),d.constant?d.$$watchDelegate=m:d.oneTime?d.$$watchDelegate=d.literal?l:k:d.inputs&&(d.$$watchDelegate=h),a[g]=d),p(d,c);case "function":return p(b,c);default:return p(D,c)}}function g(a,b,c){return null==a||null==b?a===b:"object"!==typeof a||(a=Ac(a),"object"!==typeof a||
+c)?a===b||a!==a&&b!==b:!1}function h(a,b,c,d,e){var f=d.inputs,h;if(1===f.length){var k=g,f=f[0];return a.$watch(function(a){var b=f(a);g(b,k,f.isPure)||(h=d(a,void 0,void 0,[b]),k=b&&Ac(b));return h},b,c,e)}for(var l=[],m=[],p=0,n=f.length;p=c.$$state.status&&e&&e.length&&a(function(){for(var a,c,g=0,f=e.length;ga)for(b in l++,f)ra.call(e,b)||(t--,delete f[b])}else f!==e&&(f=e,l++);return l}}c.$stateful=!0;var d=this,e,f,h,k=1F&&(y=4-F,A[y]||(A[y]=[]),A[y].push({msg:C(a.exp)?"fn: "+(a.exp.name||a.exp.toString()):
+a.exp,newVal:g,oldVal:k}));else if(a===c){r=!1;break a}}catch(D){f(D)}if(!(n=q.$$watchersCount&&q.$$childHead||q!==this&&q.$$nextSibling))for(;q!==this&&!(n=q.$$nextSibling);)q=q.$parent}while(q=n);if((r||u.length)&&!F--)throw t.$$phase=null,d("infdig",b,A);}while(r||u.length);for(t.$$phase=null;HCa)throw va("iequirks");var c=ka(oa);c.isEnabled=function(){return a};c.trustAs=
+d.trustAs;c.getTrusted=d.getTrusted;c.valueOf=d.valueOf;a||(c.trustAs=c.getTrusted=function(a,b){return b},c.valueOf=ab);c.parseAs=function(a,d){var e=b(d);return e.literal&&e.constant?e:b(d,function(b){return c.getTrusted(a,b)})};var e=c.parseAs,f=c.getTrusted,g=c.trustAs;r(oa,function(a,b){var d=L(b);c[("parse_as_"+d).replace(Bc,wb)]=function(b){return e(a,b)};c[("get_trusted_"+d).replace(Bc,wb)]=function(b){return f(a,b)};c[("trust_as_"+d).replace(Bc,wb)]=function(b){return g(a,b)}});return c}]}
+function Tf(){this.$get=["$window","$document",function(a,b){var d={},c=!((!a.nw||!a.nw.process)&&a.chrome&&(a.chrome.app&&a.chrome.app.runtime||!a.chrome.app&&a.chrome.runtime&&a.chrome.runtime.id))&&a.history&&a.history.pushState,e=Z((/android (\d+)/.exec(L((a.navigator||{}).userAgent))||[])[1]),f=/Boxee/i.test((a.navigator||{}).userAgent),g=b[0]||{},h=g.body&&g.body.style,k=!1,l=!1;h&&(k=!!("transition"in h||"webkitTransition"in h),l=!!("animation"in h||"webkitAnimation"in h));return{history:!(!c||
+4>e||f),hasEvent:function(a){if("input"===a&&Ca)return!1;if(x(d[a])){var b=g.createElement("div");d[a]="on"+a in b}return d[a]},csp:Ja(),transitions:k,animations:l,android:e}}]}function Vf(){var a;this.httpOptions=function(b){return b?(a=b,this):a};this.$get=["$exceptionHandler","$templateCache","$http","$q","$sce",function(b,d,c,e,f){function g(h,k){g.totalPendingRequests++;if(!E(h)||x(d.get(h)))h=f.getTrustedResourceUrl(h);var l=c.defaults&&c.defaults.transformResponse;I(l)?l=l.filter(function(a){return a!==
+uc}):l===uc&&(l=null);return c.get(h,O({cache:d,transformResponse:l},a)).finally(function(){g.totalPendingRequests--}).then(function(a){d.put(h,a.data);return a.data},function(a){k||(a=Gg("tpload",h,a.status,a.statusText),b(a));return e.reject(a)})}g.totalPendingRequests=0;return g}]}function Wf(){this.$get=["$rootScope","$browser","$location",function(a,b,d){return{findBindings:function(a,b,d){a=a.getElementsByClassName("ng-binding");var g=[];r(a,function(a){var c=$.element(a).data("$binding");c&&
+r(c,function(c){d?(new RegExp("(^|\\s)"+Md(b)+"(\\s|\\||$)")).test(c)&&g.push(a):-1!==c.indexOf(b)&&g.push(a)})});return g},findModels:function(a,b,d){for(var g=["ng-","data-ng-","ng\\:"],h=0;hc&&(c=e),c+=+a.slice(e+1),a=a.substring(0,e)):0>c&&(c=a.length);for(e=0;a.charAt(e)===Dc;e++);if(e===(g=a.length))d=[0],c=1;else{for(g--;a.charAt(g)===Dc;)g--;c-=e;d=[];for(f=0;e<=g;e++,f++)d[f]=+a.charAt(e)}c>Wd&&(d=d.splice(0,Wd-1),b=c-1,c=1);return{d:d,e:b,i:c}}function Og(a,b,d,c){var e=a.d,f=e.length-a.i;b=x(b)?Math.min(Math.max(d,f),c):+b;d=
+b+a.i;c=e[d];if(0d-1){for(c=0;c>d;c--)e.unshift(0),a.i++;e.unshift(1);a.i++}else e[d-1]++;for(;fh;)k.unshift(0),h++;0=b.lgSize&&h.unshift(k.splice(-b.lgSize,k.length).join(""));k.length>b.gSize;)h.unshift(k.splice(-b.gSize,k.length).join(""));k.length&&h.unshift(k.join(""));k=h.join(d);f.length&&(k+=c+f.join(""));e&&(k+="e+"+e)}return 0>a&&!g?b.negPre+k+b.negSuf:b.posPre+k+b.posSuf}function Ob(a,b,d,c){var e="";if(0>a||c&&0>=
+a)c?a=-a+1:(a=-a,e="-");for(a=""+a;a.length-d)f+=d;0===f&&-12===d&&(f=12);return Ob(f,b,c,e)}}function mb(a,b,d){return function(c,e){var f=c["get"+a](),g=ub((d?"STANDALONE":"")+(b?"SHORT":"")+a);return e[g][f]}}function Xd(a){var b=(new Date(a,0,1)).getDay();return new Date(a,0,(4>=b?5:12)-b)}function Yd(a){return function(b){var d=Xd(b.getFullYear());b=+new Date(b.getFullYear(),
+b.getMonth(),b.getDate()+(4-b.getDay()))-+d;b=1+Math.round(b/6048E5);return Ob(b,a)}}function Ec(a,b){return 0>=a.getFullYear()?b.ERAS[0]:b.ERAS[1]}function Rd(a){function b(a){var b;if(b=a.match(d)){a=new Date(0);var f=0,g=0,h=b[8]?a.setUTCFullYear:a.setFullYear,k=b[8]?a.setUTCHours:a.setHours;b[9]&&(f=Z(b[9]+b[10]),g=Z(b[9]+b[11]));h.call(a,Z(b[1]),Z(b[2])-1,Z(b[3]));f=Z(b[4]||0)-f;g=Z(b[5]||0)-g;h=Z(b[6]||0);b=Math.round(1E3*parseFloat("0."+(b[7]||0)));k.call(a,f,g,h,b)}return a}var d=/^(\d{4})-?(\d\d)-?(\d\d)(?:T(\d\d)(?::?(\d\d)(?::?(\d\d)(?:\.(\d+))?)?)?(Z|([+-])(\d\d):?(\d\d))?)?$/;
+return function(c,d,f){var g="",h=[],k,l;d=d||"mediumDate";d=a.DATETIME_FORMATS[d]||d;E(c)&&(c=Pg.test(c)?Z(c):b(c));Y(c)&&(c=new Date(c));if(!fa(c)||!isFinite(c.getTime()))return c;for(;d;)(l=Qg.exec(d))?(h=db(h,l,1),d=h.pop()):(h.push(d),d=null);var m=c.getTimezoneOffset();f&&(m=Sc(f,m),c=dc(c,f,!0));r(h,function(b){k=Rg[b];g+=k?k(c,a.DATETIME_FORMATS,m):"''"===b?"'":b.replace(/(^'|'$)/g,"").replace(/''/g,"'")});return g}}function Ig(){return function(a,b){x(b)&&(b=2);return eb(a,b)}}function Jg(){return function(a,
+b,d){b=Infinity===Math.abs(Number(b))?Number(b):Z(b);if(U(b))return a;Y(a)&&(a=a.toString());if(!wa(a))return a;d=!d||isNaN(d)?0:Z(d);d=0>d?Math.max(0,a.length+d):d;return 0<=b?Fc(a,d,d+b):0===d?Fc(a,b,a.length):Fc(a,Math.max(0,d+b),d)}}function Fc(a,b,d){return E(a)?a.slice(b,d):xa.call(a,b,d)}function Td(a){function b(b){return b.map(function(b){var c=1,d=ab;if(C(b))d=b;else if(E(b)){if("+"===b.charAt(0)||"-"===b.charAt(0))c="-"===b.charAt(0)?-1:1,b=b.substring(1);if(""!==b&&(d=a(b),d.constant))var e=
+d(),d=function(a){return a[e]}}return{get:d,descending:c}})}function d(a){switch(typeof a){case "number":case "boolean":case "string":return!0;default:return!1}}function c(a,b){var c=0,d=a.type,k=b.type;if(d===k){var k=a.value,l=b.value;"string"===d?(k=k.toLowerCase(),l=l.toLowerCase()):"object"===d&&(B(k)&&(k=a.index),B(l)&&(l=b.index));k!==l&&(c=kb||37<=b&&40>=b||m(a,this,this.value)});if(e.hasEvent("paste"))b.on("paste cut drop",m)}b.on("change",l);if(ce[g]&&c.$$hasNativeValidators&&g===d.type)b.on("keydown wheel mousedown",function(a){if(!k){var b=this.validity,c=b.badInput,d=b.typeMismatch;k=f.defer(function(){k=null;b.badInput===c&&
+b.typeMismatch===d||l(a)})}});c.$render=function(){var a=c.$isEmpty(c.$viewValue)?"":c.$viewValue;b.val()!==a&&b.val(a)}}function Rb(a,b){return function(d,c){var e,f;if(fa(d))return d;if(E(d)){'"'===d.charAt(0)&&'"'===d.charAt(d.length-1)&&(d=d.substring(1,d.length-1));if(Sg.test(d))return new Date(d);a.lastIndex=0;if(e=a.exec(d))return e.shift(),f=c?{yyyy:c.getFullYear(),MM:c.getMonth()+1,dd:c.getDate(),HH:c.getHours(),mm:c.getMinutes(),ss:c.getSeconds(),sss:c.getMilliseconds()/1E3}:{yyyy:1970,
+MM:1,dd:1,HH:0,mm:0,ss:0,sss:0},r(e,function(a,c){c=q};g.$observe("min",function(a){q=n(a);h.$validate()})}if(u(g.max)||g.ngMax){var y;h.$validators.max=function(a){return!p(a)||x(y)||d(a)<=y};g.$observe("max",function(a){y=n(a);h.$validate()})}}}function Hc(a,b,d,c){(c.$$hasNativeValidators=B(b[0].validity))&&c.$parsers.push(function(a){var c=
+b.prop("validity")||{};return c.badInput||c.typeMismatch?void 0:a})}function de(a){a.$$parserName="number";a.$parsers.push(function(b){if(a.$isEmpty(b))return null;if(Tg.test(b))return parseFloat(b)});a.$formatters.push(function(b){if(!a.$isEmpty(b)){if(!Y(b))throw pb("numfmt",b);b=b.toString()}return b})}function Wa(a){u(a)&&!Y(a)&&(a=parseFloat(a));return U(a)?void 0:a}function Ic(a){var b=a.toString(),d=b.indexOf(".");return-1===d?-1a&&(a=/e-(\d+)$/.exec(b))?Number(a[1]):0:b.length-d-1}function ee(a,
+b,d){a=Number(a);var c=(a|0)!==a,e=(b|0)!==b,f=(d|0)!==d;if(c||e||f){var g=c?Ic(a):0,h=e?Ic(b):0,k=f?Ic(d):0,g=Math.max(g,h,k),g=Math.pow(10,g);a*=g;b*=g;d*=g;c&&(a=Math.round(a));e&&(b=Math.round(b));f&&(d=Math.round(d))}return 0===(a-b)%d}function fe(a,b,d,c,e){if(u(c)){a=a(c);if(!a.constant)throw pb("constexpr",d,c);return a(b)}return e}function Jc(a,b){function d(a,b){if(!a||!a.length)return[];if(!b||!b.length)return a;var c=[],d=0;a:for(;d(?:<\/\1>|)$/,kc=/<|&#?\w+;/,dg=/<([\w:-]+)/,eg=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:-]+)[^>]*)\/>/gi,aa={option:[1,'',
+" "],thead:[1,""],col:[2,""],tr:[2,""],td:[3,""],_default:[0,"",""]};aa.optgroup=aa.option;aa.tbody=aa.tfoot=aa.colgroup=aa.caption=aa.thead;aa.th=aa.td;var lg=w.Node.prototype.contains||function(a){return!!(this.compareDocumentPosition(a)&16)},Sa=V.prototype={ready:gd,toString:function(){var a=[];r(this,function(b){a.push(""+b)});return"["+a.join(", ")+"]"},
+eq:function(a){return 0<=a?z(this[a]):z(this[this.length+a])},length:0,push:Wg,sort:[].sort,splice:[].splice},Gb={};r("multiple selected checked disabled readOnly required open".split(" "),function(a){Gb[L(a)]=a});var ld={};r("input select option textarea button form details".split(" "),function(a){ld[a]=!0});var sd={ngMinlength:"minlength",ngMaxlength:"maxlength",ngMin:"min",ngMax:"max",ngPattern:"pattern",ngStep:"step"};r({data:pc,removeData:oc,hasData:function(a){for(var b in ib[a.ng339])return!0;
+return!1},cleanData:function(a){for(var b=0,d=a.length;b/,og=/^[^(]*\(\s*([^)]*)\)/m,
+Zg=/,/,$g=/^\s*(_?)(\S+?)\1\s*$/,mg=/((\/\/.*$)|(\/\*[\s\S]*?\*\/))/mg,Ba=K("$injector");gb.$$annotate=function(a,b,d){var c;if("function"===typeof a){if(!(c=a.$inject)){c=[];if(a.length){if(b)throw E(d)&&d||(d=a.name||pg(a)),Ba("strictdi",d);b=nd(a);r(b[1].split(Zg),function(a){a.replace($g,function(a,b,d){c.push(d)})})}a.$inject=c}}else I(a)?(b=a.length-1,sb(a[b],"fn"),c=a.slice(0,b)):sb(a,"fn",!0);return c};var he=K("$animate"),sf=function(){this.$get=D},tf=function(){var a=new Hb,b=[];this.$get=
+["$$AnimateRunner","$rootScope",function(d,c){function e(a,b,c){var d=!1;b&&(b=E(b)?b.split(" "):I(b)?b:[],r(b,function(b){b&&(d=!0,a[b]=c)}));return d}function f(){r(b,function(b){var c=a.get(b);if(c){var d=qg(b.attr("class")),e="",f="";r(c,function(a,b){a!==!!d[b]&&(a?e+=(e.length?" ":"")+b:f+=(f.length?" ":"")+b)});r(b,function(a){e&&Db(a,e);f&&Cb(a,f)});a.delete(b)}});b.length=0}return{enabled:D,on:D,off:D,pin:D,push:function(g,h,k,l){l&&l();k=k||{};k.from&&g.css(k.from);k.to&&g.css(k.to);if(k.addClass||
+k.removeClass)if(h=k.addClass,l=k.removeClass,k=a.get(g)||{},h=e(k,h,!0),l=e(k,l,!1),h||l)a.set(g,k),b.push(g),1===b.length&&c.$$postDigest(f);g=new d;g.complete();return g}}}]},qf=["$provide",function(a){var b=this,d=null,c=null;this.$$registeredAnimations=Object.create(null);this.register=function(c,d){if(c&&"."!==c.charAt(0))throw he("notcsel",c);var g=c+"-animation";b.$$registeredAnimations[c.substr(1)]=g;a.factory(g,d)};this.customFilter=function(a){1===arguments.length&&(c=C(a)?a:null);return c};
+this.classNameFilter=function(a){if(1===arguments.length&&(d=a instanceof RegExp?a:null)&&/[(\s|\/)]ng-animate[(\s|\/)]/.test(d.toString()))throw d=null,he("nongcls","ng-animate");return d};this.$get=["$$animateQueue",function(a){function b(a,c,d){if(d){var e;a:{for(e=0;e <= >= && || ! = |".split(" "),function(a){Ub[a]=!0});var ch={n:"\n",f:"\f",r:"\r",t:"\t",v:"\v","'":"'",'"':'"'},Nb=function(a){this.options=a};Nb.prototype={constructor:Nb,lex:function(a){this.text=a;this.index=0;for(this.tokens=[];this.index=a&&"string"===typeof a},isWhitespace:function(a){return" "===a||"\r"===a||"\t"===a||"\n"===a||"\v"===a||"\u00a0"===a},isIdentifierStart:function(a){return this.options.isIdentifierStart?this.options.isIdentifierStart(a,this.codePointAt(a)):this.isValidIdentifierStart(a)},isValidIdentifierStart:function(a){return"a"<=a&&"z">=a||"A"<=a&&"Z">=a||"_"===a||"$"===a},isIdentifierContinue:function(a){return this.options.isIdentifierContinue?
+this.options.isIdentifierContinue(a,this.codePointAt(a)):this.isValidIdentifierContinue(a)},isValidIdentifierContinue:function(a,b){return this.isValidIdentifierStart(a,b)||this.isNumber(a)},codePointAt:function(a){return 1===a.length?a.charCodeAt(0):(a.charCodeAt(0)<<10)+a.charCodeAt(1)-56613888},peekMultichar:function(){var a=this.text.charAt(this.index),b=this.peek();if(!b)return a;var d=a.charCodeAt(0),c=b.charCodeAt(0);return 55296<=d&&56319>=d&&56320<=c&&57343>=c?a+b:a},isExpOperator:function(a){return"-"===
+a||"+"===a||this.isNumber(a)},throwError:function(a,b,d){d=d||this.index;b=u(b)?"s "+b+"-"+this.index+" ["+this.text.substring(b,d)+"]":" "+d;throw Xa("lexerr",a,b,this.text);},readNumber:function(){for(var a="",b=this.index;this.index","<=",">=");)a={type:q.BinaryExpression,operator:b.text,left:a,right:this.additive()};return a},additive:function(){for(var a=this.multiplicative(),b;b=this.expect("+","-");)a={type:q.BinaryExpression,operator:b.text,left:a,right:this.multiplicative()};return a},multiplicative:function(){for(var a=this.unary(),b;b=this.expect("*","/","%");)a={type:q.BinaryExpression,operator:b.text,left:a,right:this.unary()};return a},
+unary:function(){var a;return(a=this.expect("+","-","!"))?{type:q.UnaryExpression,operator:a.text,prefix:!0,argument:this.unary()}:this.primary()},primary:function(){var a;this.expect("(")?(a=this.filterChain(),this.consume(")")):this.expect("[")?a=this.arrayDeclaration():this.expect("{")?a=this.object():this.selfReferential.hasOwnProperty(this.peek().text)?a=pa(this.selfReferential[this.consume().text]):this.options.literals.hasOwnProperty(this.peek().text)?a={type:q.Literal,value:this.options.literals[this.consume().text]}:
+this.peek().identifier?a=this.identifier():this.peek().constant?a=this.constant():this.throwError("not a primary expression",this.peek());for(var b;b=this.expect("(","[",".");)"("===b.text?(a={type:q.CallExpression,callee:a,arguments:this.parseArguments()},this.consume(")")):"["===b.text?(a={type:q.MemberExpression,object:a,property:this.expression(),computed:!0},this.consume("]")):"."===b.text?a={type:q.MemberExpression,object:a,property:this.identifier(),computed:!1}:this.throwError("IMPOSSIBLE");
+return a},filter:function(a){a=[a];for(var b={type:q.CallExpression,callee:this.identifier(),arguments:a,filter:!0};this.expect(":");)a.push(this.expression());return b},parseArguments:function(){var a=[];if(")"!==this.peekToken().text){do a.push(this.filterChain());while(this.expect(","))}return a},identifier:function(){var a=this.consume();a.identifier||this.throwError("is not a valid identifier",a);return{type:q.Identifier,name:a.text}},constant:function(){return{type:q.Literal,value:this.consume().value}},
+arrayDeclaration:function(){var a=[];if("]"!==this.peekToken().text){do{if(this.peek("]"))break;a.push(this.expression())}while(this.expect(","))}this.consume("]");return{type:q.ArrayExpression,elements:a}},object:function(){var a=[],b;if("}"!==this.peekToken().text){do{if(this.peek("}"))break;b={type:q.Property,kind:"init"};this.peek().constant?(b.key=this.constant(),b.computed=!1,this.consume(":"),b.value=this.expression()):this.peek().identifier?(b.key=this.identifier(),b.computed=!1,this.peek(":")?
+(this.consume(":"),b.value=this.expression()):b.value=b.key):this.peek("[")?(this.consume("["),b.key=this.expression(),this.consume("]"),b.computed=!0,this.consume(":"),b.value=this.expression()):this.throwError("invalid key",this.peek());a.push(b)}while(this.expect(","))}this.consume("}");return{type:q.ObjectExpression,properties:a}},throwError:function(a,b){throw Xa("syntax",b.text,a,b.index+1,this.text,this.text.substring(b.index));},consume:function(a){if(0===this.tokens.length)throw Xa("ueoe",
+this.text);var b=this.expect(a);b||this.throwError("is unexpected, expecting ["+a+"]",this.peek());return b},peekToken:function(){if(0===this.tokens.length)throw Xa("ueoe",this.text);return this.tokens[0]},peek:function(a,b,d,c){return this.peekAhead(0,a,b,d,c)},peekAhead:function(a,b,d,c,e){if(this.tokens.length>a){a=this.tokens[a];var f=a.text;if(f===b||f===d||f===c||f===e||!(b||d||c||e))return a}return!1},expect:function(a,b,d,c){return(a=this.peek(a,b,d,c))?(this.tokens.shift(),a):!1},selfReferential:{"this":{type:q.ThisExpression},
+$locals:{type:q.LocalsExpression}}};var Fd=2;Jd.prototype={compile:function(a){var b=this;this.state={nextId:0,filters:{},fn:{vars:[],body:[],own:{}},assign:{vars:[],body:[],own:{}},inputs:[]};W(a,b.$filter);var d="",c;this.stage="assign";if(c=Id(a))this.state.computing="assign",d=this.nextId(),this.recurse(c,d),this.return_(d),d="fn.assign="+this.generateFunction("assign","s,v,l");c=Gd(a.body);b.stage="inputs";r(c,function(a,c){var d="fn"+c;b.state[d]={vars:[],body:[],own:{}};b.state.computing=d;
+var h=b.nextId();b.recurse(a,h);b.return_(h);b.state.inputs.push({name:d,isPure:a.isPure});a.watchId=c});this.state.computing="fn";this.stage="main";this.recurse(a);a='"'+this.USE+" "+this.STRICT+'";\n'+this.filterPrefix()+"var fn="+this.generateFunction("fn","s,l,a,i")+d+this.watchFns()+"return fn;";a=(new Function("$filter","getStringValue","ifDefined","plus",a))(this.$filter,Bg,Cg,Ed);this.state=this.stage=void 0;return a},USE:"use",STRICT:"strict",watchFns:function(){var a=[],b=this.state.inputs,
+d=this;r(b,function(b){a.push("var "+b.name+"="+d.generateFunction(b.name,"s"));b.isPure&&a.push(b.name,".isPure="+JSON.stringify(b.isPure)+";")});b.length&&a.push("fn.inputs=["+b.map(function(a){return a.name}).join(",")+"];");return a.join("")},generateFunction:function(a,b){return"function("+b+"){"+this.varsPrefix(a)+this.body(a)+"};"},filterPrefix:function(){var a=[],b=this;r(this.state.filters,function(d,c){a.push(d+"=$filter("+b.escape(c)+")")});return a.length?"var "+a.join(",")+";":""},varsPrefix:function(a){return this.state[a].vars.length?
+"var "+this.state[a].vars.join(",")+";":""},body:function(a){return this.state[a].body.join("")},recurse:function(a,b,d,c,e,f){var g,h,k=this,l,m,p;c=c||D;if(!f&&u(a.watchId))b=b||this.nextId(),this.if_("i",this.lazyAssign(b,this.computedMember("i",a.watchId)),this.lazyRecurse(a,b,d,c,e,!0));else switch(a.type){case q.Program:r(a.body,function(b,c){k.recurse(b.expression,void 0,void 0,function(a){h=a});c!==a.body.length-1?k.current().body.push(h,";"):k.return_(h)});break;case q.Literal:m=this.escape(a.value);
+this.assign(b,m);c(b||m);break;case q.UnaryExpression:this.recurse(a.argument,void 0,void 0,function(a){h=a});m=a.operator+"("+this.ifDefined(h,0)+")";this.assign(b,m);c(m);break;case q.BinaryExpression:this.recurse(a.left,void 0,void 0,function(a){g=a});this.recurse(a.right,void 0,void 0,function(a){h=a});m="+"===a.operator?this.plus(g,h):"-"===a.operator?this.ifDefined(g,0)+a.operator+this.ifDefined(h,0):"("+g+")"+a.operator+"("+h+")";this.assign(b,m);c(m);break;case q.LogicalExpression:b=b||this.nextId();
+k.recurse(a.left,b);k.if_("&&"===a.operator?b:k.not(b),k.lazyRecurse(a.right,b));c(b);break;case q.ConditionalExpression:b=b||this.nextId();k.recurse(a.test,b);k.if_(b,k.lazyRecurse(a.alternate,b),k.lazyRecurse(a.consequent,b));c(b);break;case q.Identifier:b=b||this.nextId();d&&(d.context="inputs"===k.stage?"s":this.assign(this.nextId(),this.getHasOwnProperty("l",a.name)+"?l:s"),d.computed=!1,d.name=a.name);k.if_("inputs"===k.stage||k.not(k.getHasOwnProperty("l",a.name)),function(){k.if_("inputs"===
+k.stage||"s",function(){e&&1!==e&&k.if_(k.isNull(k.nonComputedMember("s",a.name)),k.lazyAssign(k.nonComputedMember("s",a.name),"{}"));k.assign(b,k.nonComputedMember("s",a.name))})},b&&k.lazyAssign(b,k.nonComputedMember("l",a.name)));c(b);break;case q.MemberExpression:g=d&&(d.context=this.nextId())||this.nextId();b=b||this.nextId();k.recurse(a.object,g,void 0,function(){k.if_(k.notNull(g),function(){a.computed?(h=k.nextId(),k.recurse(a.property,h),k.getStringValue(h),e&&1!==e&&k.if_(k.not(k.computedMember(g,
+h)),k.lazyAssign(k.computedMember(g,h),"{}")),m=k.computedMember(g,h),k.assign(b,m),d&&(d.computed=!0,d.name=h)):(e&&1!==e&&k.if_(k.isNull(k.nonComputedMember(g,a.property.name)),k.lazyAssign(k.nonComputedMember(g,a.property.name),"{}")),m=k.nonComputedMember(g,a.property.name),k.assign(b,m),d&&(d.computed=!1,d.name=a.property.name))},function(){k.assign(b,"undefined")});c(b)},!!e);break;case q.CallExpression:b=b||this.nextId();a.filter?(h=k.filter(a.callee.name),l=[],r(a.arguments,function(a){var b=
+k.nextId();k.recurse(a,b);l.push(b)}),m=h+"("+l.join(",")+")",k.assign(b,m),c(b)):(h=k.nextId(),g={},l=[],k.recurse(a.callee,h,g,function(){k.if_(k.notNull(h),function(){r(a.arguments,function(b){k.recurse(b,a.constant?void 0:k.nextId(),void 0,function(a){l.push(a)})});m=g.name?k.member(g.context,g.name,g.computed)+"("+l.join(",")+")":h+"("+l.join(",")+")";k.assign(b,m)},function(){k.assign(b,"undefined")});c(b)}));break;case q.AssignmentExpression:h=this.nextId();g={};this.recurse(a.left,void 0,
+g,function(){k.if_(k.notNull(g.context),function(){k.recurse(a.right,h);m=k.member(g.context,g.name,g.computed)+a.operator+h;k.assign(b,m);c(b||m)})},1);break;case q.ArrayExpression:l=[];r(a.elements,function(b){k.recurse(b,a.constant?void 0:k.nextId(),void 0,function(a){l.push(a)})});m="["+l.join(",")+"]";this.assign(b,m);c(b||m);break;case q.ObjectExpression:l=[];p=!1;r(a.properties,function(a){a.computed&&(p=!0)});p?(b=b||this.nextId(),this.assign(b,"{}"),r(a.properties,function(a){a.computed?
+(g=k.nextId(),k.recurse(a.key,g)):g=a.key.type===q.Identifier?a.key.name:""+a.key.value;h=k.nextId();k.recurse(a.value,h);k.assign(k.member(b,g,a.computed),h)})):(r(a.properties,function(b){k.recurse(b.value,a.constant?void 0:k.nextId(),void 0,function(a){l.push(k.escape(b.key.type===q.Identifier?b.key.name:""+b.key.value)+":"+a)})}),m="{"+l.join(",")+"}",this.assign(b,m));c(b||m);break;case q.ThisExpression:this.assign(b,"s");c(b||"s");break;case q.LocalsExpression:this.assign(b,"l");c(b||"l");break;
+case q.NGValueParameter:this.assign(b,"v"),c(b||"v")}},getHasOwnProperty:function(a,b){var d=a+"."+b,c=this.current().own;c.hasOwnProperty(d)||(c[d]=this.nextId(!1,a+"&&("+this.escape(b)+" in "+a+")"));return c[d]},assign:function(a,b){if(a)return this.current().body.push(a,"=",b,";"),a},filter:function(a){this.state.filters.hasOwnProperty(a)||(this.state.filters[a]=this.nextId(!0));return this.state.filters[a]},ifDefined:function(a,b){return"ifDefined("+a+","+this.escape(b)+")"},plus:function(a,
+b){return"plus("+a+","+b+")"},return_:function(a){this.current().body.push("return ",a,";")},if_:function(a,b,d){if(!0===a)b();else{var c=this.current().body;c.push("if(",a,"){");b();c.push("}");d&&(c.push("else{"),d(),c.push("}"))}},not:function(a){return"!("+a+")"},isNull:function(a){return a+"==null"},notNull:function(a){return a+"!=null"},nonComputedMember:function(a,b){var d=/[^$_a-zA-Z0-9]/g;return/^[$_a-zA-Z][$_a-zA-Z0-9]*$/.test(b)?a+"."+b:a+'["'+b.replace(d,this.stringEscapeFn)+'"]'},computedMember:function(a,
+b){return a+"["+b+"]"},member:function(a,b,d){return d?this.computedMember(a,b):this.nonComputedMember(a,b)},getStringValue:function(a){this.assign(a,"getStringValue("+a+")")},lazyRecurse:function(a,b,d,c,e,f){var g=this;return function(){g.recurse(a,b,d,c,e,f)}},lazyAssign:function(a,b){var d=this;return function(){d.assign(a,b)}},stringEscapeRegex:/[^ a-zA-Z0-9]/g,stringEscapeFn:function(a){return"\\u"+("0000"+a.charCodeAt(0).toString(16)).slice(-4)},escape:function(a){if(E(a))return"'"+a.replace(this.stringEscapeRegex,
+this.stringEscapeFn)+"'";if(Y(a))return a.toString();if(!0===a)return"true";if(!1===a)return"false";if(null===a)return"null";if("undefined"===typeof a)return"undefined";throw Xa("esc");},nextId:function(a,b){var d="v"+this.state.nextId++;a||this.current().vars.push(d+(b?"="+b:""));return d},current:function(){return this.state[this.state.computing]}};Kd.prototype={compile:function(a){var b=this;W(a,b.$filter);var d,c;if(d=Id(a))c=this.recurse(d);d=Gd(a.body);var e;d&&(e=[],r(d,function(a,c){var d=
+b.recurse(a);d.isPure=a.isPure;a.input=d;e.push(d);a.watchId=c}));var f=[];r(a.body,function(a){f.push(b.recurse(a.expression))});a=0===a.body.length?D:1===a.body.length?f[0]:function(a,b){var c;r(f,function(d){c=d(a,b)});return c};c&&(a.assign=function(a,b,d){return c(a,d,b)});e&&(a.inputs=e);return a},recurse:function(a,b,d){var c,e,f=this,g;if(a.input)return this.inputs(a.input,a.watchId);switch(a.type){case q.Literal:return this.value(a.value,b);case q.UnaryExpression:return e=this.recurse(a.argument),
+this["unary"+a.operator](e,b);case q.BinaryExpression:return c=this.recurse(a.left),e=this.recurse(a.right),this["binary"+a.operator](c,e,b);case q.LogicalExpression:return c=this.recurse(a.left),e=this.recurse(a.right),this["binary"+a.operator](c,e,b);case q.ConditionalExpression:return this["ternary?:"](this.recurse(a.test),this.recurse(a.alternate),this.recurse(a.consequent),b);case q.Identifier:return f.identifier(a.name,b,d);case q.MemberExpression:return c=this.recurse(a.object,!1,!!d),a.computed||
+(e=a.property.name),a.computed&&(e=this.recurse(a.property)),a.computed?this.computedMember(c,e,b,d):this.nonComputedMember(c,e,b,d);case q.CallExpression:return g=[],r(a.arguments,function(a){g.push(f.recurse(a))}),a.filter&&(e=this.$filter(a.callee.name)),a.filter||(e=this.recurse(a.callee,!0)),a.filter?function(a,c,d,f){for(var p=[],n=0;n":function(a,b,d){return function(c,e,f,g){c=a(c,e,f,g)>b(c,e,f,g);return d?{value:c}:c}},"binary<=":function(a,b,d){return function(c,e,f,g){c=a(c,e,f,
+g)<=b(c,e,f,g);return d?{value:c}:c}},"binary>=":function(a,b,d){return function(c,e,f,g){c=a(c,e,f,g)>=b(c,e,f,g);return d?{value:c}:c}},"binary&&":function(a,b,d){return function(c,e,f,g){c=a(c,e,f,g)&&b(c,e,f,g);return d?{value:c}:c}},"binary||":function(a,b,d){return function(c,e,f,g){c=a(c,e,f,g)||b(c,e,f,g);return d?{value:c}:c}},"ternary?:":function(a,b,d,c){return function(e,f,g,h){e=a(e,f,g,h)?b(e,f,g,h):d(e,f,g,h);return c?{value:e}:e}},value:function(a,b){return function(){return b?{context:void 0,
+name:void 0,value:a}:a}},identifier:function(a,b,d){return function(c,e,f,g){c=e&&a in e?e:c;d&&1!==d&&c&&null==c[a]&&(c[a]={});e=c?c[a]:void 0;return b?{context:c,name:a,value:e}:e}},computedMember:function(a,b,d,c){return function(e,f,g,h){var k=a(e,f,g,h),l,m;null!=k&&(l=b(e,f,g,h),l+="",c&&1!==c&&k&&!k[l]&&(k[l]={}),m=k[l]);return d?{context:k,name:l,value:m}:m}},nonComputedMember:function(a,b,d,c){return function(e,f,g,h){e=a(e,f,g,h);c&&1!==c&&e&&null==e[b]&&(e[b]={});f=null!=e?e[b]:void 0;
+return d?{context:e,name:b,value:f}:f}},inputs:function(a,b){return function(d,c,e,f){return f?f[b]:a(d,c,e)}}};Mb.prototype={constructor:Mb,parse:function(a){a=this.getAst(a);var b=this.astCompiler.compile(a.ast),d=a.ast;b.literal=0===d.body.length||1===d.body.length&&(d.body[0].expression.type===q.Literal||d.body[0].expression.type===q.ArrayExpression||d.body[0].expression.type===q.ObjectExpression);b.constant=a.ast.constant;b.oneTime=a.oneTime;return b},getAst:function(a){var b=!1;a=a.trim();":"===
+a.charAt(0)&&":"===a.charAt(1)&&(b=!0,a=a.substring(2));return{ast:this.ast.ast(a),oneTime:b}}};var va=K("$sce"),oa={HTML:"html",CSS:"css",URL:"url",RESOURCE_URL:"resourceUrl",JS:"js"},Bc=/_([a-z])/g,Gg=K("$compile"),X=w.document.createElement("a"),Od=ta(w.location.href);Pd.$inject=["$document"];ed.$inject=["$provide"];var Wd=22,Vd=".",Dc="0";Qd.$inject=["$locale"];Sd.$inject=["$locale"];var Rg={yyyy:ea("FullYear",4,0,!1,!0),yy:ea("FullYear",2,0,!0,!0),y:ea("FullYear",1,0,!1,!0),MMMM:mb("Month"),
+MMM:mb("Month",!0),MM:ea("Month",2,1),M:ea("Month",1,1),LLLL:mb("Month",!1,!0),dd:ea("Date",2),d:ea("Date",1),HH:ea("Hours",2),H:ea("Hours",1),hh:ea("Hours",2,-12),h:ea("Hours",1,-12),mm:ea("Minutes",2),m:ea("Minutes",1),ss:ea("Seconds",2),s:ea("Seconds",1),sss:ea("Milliseconds",3),EEEE:mb("Day"),EEE:mb("Day",!0),a:function(a,b){return 12>a.getHours()?b.AMPMS[0]:b.AMPMS[1]},Z:function(a,b,d){a=-1*d;return a=(0<=a?"+":"")+(Ob(Math[0=a.getFullYear()?b.ERANAMES[0]:b.ERANAMES[1]}},Qg=/((?:[^yMLdHhmsaZEwG']+)|(?:'(?:[^']|'')*')|(?:E+|y+|M+|L+|d+|H+|h+|m+|s+|a|Z|G+|w+))([\s\S]*)/,Pg=/^-?\d+$/;Rd.$inject=["$locale"];var Kg=la(L),Lg=la(ub);Td.$inject=["$parse"];var He=la({restrict:"E",compile:function(a,b){if(!b.href&&!b.xlinkHref)return function(a,b){if("a"===b[0].nodeName.toLowerCase()){var e="[object SVGAnimatedString]"===ia.call(b.prop("href"))?"xlink:href":"href";b.on("click",function(a){b.attr(e)||
+a.preventDefault()})}}}}),vb={};r(Gb,function(a,b){function d(a,d,e){a.$watch(e[c],function(a){e.$set(b,!!a)})}if("multiple"!==a){var c=Ea("ng-"+b),e=d;"checked"===a&&(e=function(a,b,e){e.ngModel!==e[c]&&d(a,b,e)});vb[c]=function(){return{restrict:"A",priority:100,link:e}}}});r(sd,function(a,b){vb[b]=function(){return{priority:100,link:function(a,c,e){if("ngPattern"===b&&"/"===e.ngPattern.charAt(0)&&(c=e.ngPattern.match(Vg))){e.$set("ngPattern",new RegExp(c[1],c[2]));return}a.$watch(e[b],function(a){e.$set(b,
+a)})}}}});r(["src","srcset","href"],function(a){var b=Ea("ng-"+a);vb[b]=function(){return{priority:99,link:function(d,c,e){var f=a,g=a;"href"===a&&"[object SVGAnimatedString]"===ia.call(c.prop("href"))&&(g="xlinkHref",e.$attr[g]="xlink:href",f=null);e.$observe(b,function(b){b?(e.$set(g,b),Ca&&f&&c.prop(f,e[g])):"href"===a&&e.$set(g,null)})}}}});var Qb={$addControl:D,$$renameControl:function(a,b){a.$name=b},$removeControl:D,$setValidity:D,$setDirty:D,$setPristine:D,$setSubmitted:D};Pb.$inject=["$element",
+"$attrs","$scope","$animate","$interpolate"];Pb.prototype={$rollbackViewValue:function(){r(this.$$controls,function(a){a.$rollbackViewValue()})},$commitViewValue:function(){r(this.$$controls,function(a){a.$commitViewValue()})},$addControl:function(a){Ia(a.$name,"input");this.$$controls.push(a);a.$name&&(this[a.$name]=a);a.$$parentForm=this},$$renameControl:function(a,b){var d=a.$name;this[d]===a&&delete this[d];this[b]=a;a.$name=b},$removeControl:function(a){a.$name&&this[a.$name]===a&&delete this[a.$name];
+r(this.$pending,function(b,d){this.$setValidity(d,null,a)},this);r(this.$error,function(b,d){this.$setValidity(d,null,a)},this);r(this.$$success,function(b,d){this.$setValidity(d,null,a)},this);cb(this.$$controls,a);a.$$parentForm=Qb},$setDirty:function(){this.$$animate.removeClass(this.$$element,Ya);this.$$animate.addClass(this.$$element,Vb);this.$dirty=!0;this.$pristine=!1;this.$$parentForm.$setDirty()},$setPristine:function(){this.$$animate.setClass(this.$$element,Ya,Vb+" ng-submitted");this.$dirty=
+!1;this.$pristine=!0;this.$submitted=!1;r(this.$$controls,function(a){a.$setPristine()})},$setUntouched:function(){r(this.$$controls,function(a){a.$setUntouched()})},$setSubmitted:function(){this.$$animate.addClass(this.$$element,"ng-submitted");this.$submitted=!0;this.$$parentForm.$setSubmitted()}};ae({clazz:Pb,set:function(a,b,d){var c=a[b];c?-1===c.indexOf(d)&&c.push(d):a[b]=[d]},unset:function(a,b,d){var c=a[b];c&&(cb(c,d),0===c.length&&delete a[b])}});var ie=function(a){return["$timeout","$parse",
+function(b,d){function c(a){return""===a?d('this[""]').assign:d(a).assign||D}return{name:"form",restrict:a?"EAC":"E",require:["form","^^?form"],controller:Pb,compile:function(d,f){d.addClass(Ya).addClass(nb);var g=f.name?"name":a&&f.ngForm?"ngForm":!1;return{pre:function(a,d,e,f){var p=f[0];if(!("action"in e)){var n=function(b){a.$apply(function(){p.$commitViewValue();p.$setSubmitted()});b.preventDefault()};d[0].addEventListener("submit",n);d.on("$destroy",function(){b(function(){d[0].removeEventListener("submit",
+n)},0,!1)})}(f[1]||p.$$parentForm).$addControl(p);var r=g?c(p.$name):D;g&&(r(a,p),e.$observe(g,function(b){p.$name!==b&&(r(a,void 0),p.$$parentForm.$$renameControl(p,b),r=c(p.$name),r(a,p))}));d.on("$destroy",function(){p.$$parentForm.$removeControl(p);r(a,void 0);O(p,Qb)})}}}}}]},Ie=ie(),Ue=ie(!0),Sg=/^\d{4,}-[01]\d-[0-3]\dT[0-2]\d:[0-5]\d:[0-5]\d\.\d+(?:[+-][0-2]\d:[0-5]\d|Z)$/,dh=/^[a-z][a-z\d.+-]*:\/*(?:[^:@]+(?::[^@]+)?@)?(?:[^\s:/?#]+|\[[a-f\d:]+])(?::\d+)?(?:\/[^?#]*)?(?:\?[^#]*)?(?:#.*)?$/i,
+eh=/^(?=.{1,254}$)(?=.{1,64}@)[-!#$%&'*+/0-9=?A-Z^_`a-z{|}~]+(\.[-!#$%&'*+/0-9=?A-Z^_`a-z{|}~]+)*@[A-Za-z0-9]([A-Za-z0-9-]{0,61}[A-Za-z0-9])?(\.[A-Za-z0-9]([A-Za-z0-9-]{0,61}[A-Za-z0-9])?)*$/,Tg=/^\s*(-|\+)?(\d+|(\d*(\.\d*)))([eE][+-]?\d+)?\s*$/,je=/^(\d{4,})-(\d{2})-(\d{2})$/,ke=/^(\d{4,})-(\d\d)-(\d\d)T(\d\d):(\d\d)(?::(\d\d)(\.\d{1,3})?)?$/,Lc=/^(\d{4,})-W(\d\d)$/,le=/^(\d{4,})-(\d\d)$/,me=/^(\d\d):(\d\d)(?::(\d\d)(\.\d{1,3})?)?$/,ce=S();r(["date","datetime-local","month","time","week"],function(a){ce[a]=
+!0});var ne={text:function(a,b,d,c,e,f){Va(a,b,d,c,e,f);Gc(c)},date:ob("date",je,Rb(je,["yyyy","MM","dd"]),"yyyy-MM-dd"),"datetime-local":ob("datetimelocal",ke,Rb(ke,"yyyy MM dd HH mm ss sss".split(" ")),"yyyy-MM-ddTHH:mm:ss.sss"),time:ob("time",me,Rb(me,["HH","mm","ss","sss"]),"HH:mm:ss.sss"),week:ob("week",Lc,function(a,b){if(fa(a))return a;if(E(a)){Lc.lastIndex=0;var d=Lc.exec(a);if(d){var c=+d[1],e=+d[2],f=d=0,g=0,h=0,k=Xd(c),e=7*(e-1);b&&(d=b.getHours(),f=b.getMinutes(),g=b.getSeconds(),h=b.getMilliseconds());
+return new Date(c,0,k.getDate()+e,d,f,g,h)}}return NaN},"yyyy-Www"),month:ob("month",le,Rb(le,["yyyy","MM"]),"yyyy-MM"),number:function(a,b,d,c,e,f){Hc(a,b,d,c);de(c);Va(a,b,d,c,e,f);var g,h;if(u(d.min)||d.ngMin)c.$validators.min=function(a){return c.$isEmpty(a)||x(g)||a>=g},d.$observe("min",function(a){g=Wa(a);c.$validate()});if(u(d.max)||d.ngMax)c.$validators.max=function(a){return c.$isEmpty(a)||x(h)||a<=h},d.$observe("max",function(a){h=Wa(a);c.$validate()});if(u(d.step)||d.ngStep){var k;c.$validators.step=
+function(a,b){return c.$isEmpty(b)||x(k)||ee(b,g||0,k)};d.$observe("step",function(a){k=Wa(a);c.$validate()})}},url:function(a,b,d,c,e,f){Va(a,b,d,c,e,f);Gc(c);c.$$parserName="url";c.$validators.url=function(a,b){var d=a||b;return c.$isEmpty(d)||dh.test(d)}},email:function(a,b,d,c,e,f){Va(a,b,d,c,e,f);Gc(c);c.$$parserName="email";c.$validators.email=function(a,b){var d=a||b;return c.$isEmpty(d)||eh.test(d)}},radio:function(a,b,d,c){var e=!d.ngTrim||"false"!==Q(d.ngTrim);x(d.name)&&b.attr("name",++qb);
+b.on("click",function(a){var g;b[0].checked&&(g=d.value,e&&(g=Q(g)),c.$setViewValue(g,a&&a.type))});c.$render=function(){var a=d.value;e&&(a=Q(a));b[0].checked=a===c.$viewValue};d.$observe("value",c.$render)},range:function(a,b,d,c,e,f){function g(a,c){b.attr(a,d[a]);d.$observe(a,c)}function h(a){p=Wa(a);U(c.$modelValue)||(m?(a=b.val(),p>a&&(a=p,b.val(a)),c.$setViewValue(a)):c.$validate())}function k(a){n=Wa(a);U(c.$modelValue)||(m?(a=b.val(),n=p},g("min",h));e&&
+(c.$validators.max=m?function(){return!0}:function(a,b){return c.$isEmpty(b)||x(n)||b<=n},g("max",k));f&&(c.$validators.step=m?function(){return!q.stepMismatch}:function(a,b){return c.$isEmpty(b)||x(r)||ee(b,p||0,r)},g("step",l))},checkbox:function(a,b,d,c,e,f,g,h){var k=fe(h,a,"ngTrueValue",d.ngTrueValue,!0),l=fe(h,a,"ngFalseValue",d.ngFalseValue,!1);b.on("click",function(a){c.$setViewValue(b[0].checked,a&&a.type)});c.$render=function(){b[0].checked=c.$viewValue};c.$isEmpty=function(a){return!1===
+a};c.$formatters.push(function(a){return sa(a,k)});c.$parsers.push(function(a){return a?k:l})},hidden:D,button:D,submit:D,reset:D,file:D},Zc=["$browser","$sniffer","$filter","$parse",function(a,b,d,c){return{restrict:"E",require:["?ngModel"],link:{pre:function(e,f,g,h){h[0]&&(ne[L(g.type)]||ne.text)(e,f,g,h[0],b,a,d,c)}}}}],fh=/^(true|false|\d+)$/,mf=function(){function a(a,d,c){var e=u(c)?c:9===Ca?"":null;a.prop("value",e);d.$set("value",c)}return{restrict:"A",priority:100,compile:function(b,d){return fh.test(d.ngValue)?
+function(b,d,f){b=b.$eval(f.ngValue);a(d,f,b)}:function(b,d,f){b.$watch(f.ngValue,function(b){a(d,f,b)})}}}},Me=["$compile",function(a){return{restrict:"AC",compile:function(b){a.$$addBindingClass(b);return function(b,c,e){a.$$addBindingInfo(c,e.ngBind);c=c[0];b.$watch(e.ngBind,function(a){c.textContent=gc(a)})}}}}],Oe=["$interpolate","$compile",function(a,b){return{compile:function(d){b.$$addBindingClass(d);return function(c,d,f){c=a(d.attr(f.$attr.ngBindTemplate));b.$$addBindingInfo(d,c.expressions);
+d=d[0];f.$observe("ngBindTemplate",function(a){d.textContent=x(a)?"":a})}}}}],Ne=["$sce","$parse","$compile",function(a,b,d){return{restrict:"A",compile:function(c,e){var f=b(e.ngBindHtml),g=b(e.ngBindHtml,function(b){return a.valueOf(b)});d.$$addBindingClass(c);return function(b,c,e){d.$$addBindingInfo(c,e.ngBindHtml);b.$watch(g,function(){var d=f(b);c.html(a.getTrustedHtml(d)||"")})}}}}],lf=la({restrict:"A",require:"ngModel",link:function(a,b,d,c){c.$viewChangeListeners.push(function(){a.$eval(d.ngChange)})}}),
+Pe=Jc("",!0),Re=Jc("Odd",0),Qe=Jc("Even",1),Se=Qa({compile:function(a,b){b.$set("ngCloak",void 0);a.removeClass("ng-cloak")}}),Te=[function(){return{restrict:"A",scope:!0,controller:"@",priority:500}}],dd={},gh={blur:!0,focus:!0};r("click dblclick mousedown mouseup mouseover mouseout mousemove mouseenter mouseleave keydown keyup keypress submit focus blur copy cut paste".split(" "),function(a){var b=Ea("ng-"+a);dd[b]=["$parse","$rootScope",function(d,c){return{restrict:"A",compile:function(e,f){var g=
+d(f[b]);return function(b,d){d.on(a,function(d){var e=function(){g(b,{$event:d})};gh[a]&&c.$$phase?b.$evalAsync(e):b.$apply(e)})}}}}]});var We=["$animate","$compile",function(a,b){return{multiElement:!0,transclude:"element",priority:600,terminal:!0,restrict:"A",$$tlb:!0,link:function(d,c,e,f,g){var h,k,l;d.$watch(e.ngIf,function(d){d?k||g(function(d,f){k=f;d[d.length++]=b.$$createComment("end ngIf",e.ngIf);h={clone:d};a.enter(d,c.parent(),c)}):(l&&(l.remove(),l=null),k&&(k.$destroy(),k=null),h&&(l=
+tb(h.clone),a.leave(l).done(function(a){!1!==a&&(l=null)}),h=null))})}}}],Xe=["$templateRequest","$anchorScroll","$animate",function(a,b,d){return{restrict:"ECA",priority:400,terminal:!0,transclude:"element",controller:$.noop,compile:function(c,e){var f=e.ngInclude||e.src,g=e.onload||"",h=e.autoscroll;return function(c,e,m,p,n){var r=0,q,v,y,t=function(){v&&(v.remove(),v=null);q&&(q.$destroy(),q=null);y&&(d.leave(y).done(function(a){!1!==a&&(v=null)}),v=y,y=null)};c.$watch(f,function(f){var m=function(a){!1===
+a||!u(h)||h&&!c.$eval(h)||b()},v=++r;f?(a(f,!0).then(function(a){if(!c.$$destroyed&&v===r){var b=c.$new();p.template=a;a=n(b,function(a){t();d.enter(a,null,e).done(m)});q=b;y=a;q.$emit("$includeContentLoaded",f);c.$eval(g)}},function(){c.$$destroyed||v!==r||(t(),c.$emit("$includeContentError",f))}),c.$emit("$includeContentRequested",f)):(t(),p.template=null)})}}}}],of=["$compile",function(a){return{restrict:"ECA",priority:-400,require:"ngInclude",link:function(b,d,c,e){ia.call(d[0]).match(/SVG/)?
+(d.empty(),a(fd(e.template,w.document).childNodes)(b,function(a){d.append(a)},{futureParentElement:d})):(d.html(e.template),a(d.contents())(b))}}}],Ye=Qa({priority:450,compile:function(){return{pre:function(a,b,d){a.$eval(d.ngInit)}}}}),kf=function(){return{restrict:"A",priority:100,require:"ngModel",link:function(a,b,d,c){var e=d.ngList||", ",f="false"!==d.ngTrim,g=f?Q(e):e;c.$parsers.push(function(a){if(!x(a)){var b=[];a&&r(a.split(g),function(a){a&&b.push(f?Q(a):a)});return b}});c.$formatters.push(function(a){if(I(a))return a.join(e)});
+c.$isEmpty=function(a){return!a||!a.length}}}},nb="ng-valid",$d="ng-invalid",Ya="ng-pristine",Vb="ng-dirty",pb=K("ngModel");Sb.$inject="$scope $exceptionHandler $attrs $element $parse $animate $timeout $q $interpolate".split(" ");Sb.prototype={$$initGetterSetters:function(){if(this.$options.getOption("getterSetter")){var a=this.$$parse(this.$$attr.ngModel+"()"),b=this.$$parse(this.$$attr.ngModel+"($$$p)");this.$$ngModelGet=function(b){var c=this.$$parsedNgModel(b);C(c)&&(c=a(b));return c};this.$$ngModelSet=
+function(a,c){C(this.$$parsedNgModel(a))?b(a,{$$$p:c}):this.$$parsedNgModelAssign(a,c)}}else if(!this.$$parsedNgModel.assign)throw pb("nonassign",this.$$attr.ngModel,za(this.$$element));},$render:D,$isEmpty:function(a){return x(a)||""===a||null===a||a!==a},$$updateEmptyClasses:function(a){this.$isEmpty(a)?(this.$$animate.removeClass(this.$$element,"ng-not-empty"),this.$$animate.addClass(this.$$element,"ng-empty")):(this.$$animate.removeClass(this.$$element,"ng-empty"),this.$$animate.addClass(this.$$element,
+"ng-not-empty"))},$setPristine:function(){this.$dirty=!1;this.$pristine=!0;this.$$animate.removeClass(this.$$element,Vb);this.$$animate.addClass(this.$$element,Ya)},$setDirty:function(){this.$dirty=!0;this.$pristine=!1;this.$$animate.removeClass(this.$$element,Ya);this.$$animate.addClass(this.$$element,Vb);this.$$parentForm.$setDirty()},$setUntouched:function(){this.$touched=!1;this.$untouched=!0;this.$$animate.setClass(this.$$element,"ng-untouched","ng-touched")},$setTouched:function(){this.$touched=
+!0;this.$untouched=!1;this.$$animate.setClass(this.$$element,"ng-touched","ng-untouched")},$rollbackViewValue:function(){this.$$timeout.cancel(this.$$pendingDebounce);this.$viewValue=this.$$lastCommittedViewValue;this.$render()},$validate:function(){if(!U(this.$modelValue)){var a=this.$$lastCommittedViewValue,b=this.$$rawModelValue,d=this.$valid,c=this.$modelValue,e=this.$options.getOption("allowInvalid"),f=this;this.$$runValidators(b,a,function(a){e||d===a||(f.$modelValue=a?b:void 0,f.$modelValue!==
+c&&f.$$writeModelToScope())})}},$$runValidators:function(a,b,d){function c(){var c=!0;r(k.$validators,function(d,e){var g=Boolean(d(a,b));c=c&&g;f(e,g)});return c?!0:(r(k.$asyncValidators,function(a,b){f(b,null)}),!1)}function e(){var c=[],d=!0;r(k.$asyncValidators,function(e,g){var k=e(a,b);if(!k||!C(k.then))throw pb("nopromise",k);f(g,void 0);c.push(k.then(function(){f(g,!0)},function(){d=!1;f(g,!1)}))});c.length?k.$$q.all(c).then(function(){g(d)},D):g(!0)}function f(a,b){h===k.$$currentValidationRunId&&
+k.$setValidity(a,b)}function g(a){h===k.$$currentValidationRunId&&d(a)}this.$$currentValidationRunId++;var h=this.$$currentValidationRunId,k=this;(function(){var a=k.$$parserName||"parse";if(x(k.$$parserValid))f(a,null);else return k.$$parserValid||(r(k.$validators,function(a,b){f(b,null)}),r(k.$asyncValidators,function(a,b){f(b,null)})),f(a,k.$$parserValid),k.$$parserValid;return!0})()?c()?e():g(!1):g(!1)},$commitViewValue:function(){var a=this.$viewValue;this.$$timeout.cancel(this.$$pendingDebounce);
+if(this.$$lastCommittedViewValue!==a||""===a&&this.$$hasNativeValidators)this.$$updateEmptyClasses(a),this.$$lastCommittedViewValue=a,this.$pristine&&this.$setDirty(),this.$$parseAndValidate()},$$parseAndValidate:function(){var a=this.$$lastCommittedViewValue,b=this;if(this.$$parserValid=x(a)?void 0:!0)for(var d=0;de||c.$isEmpty(b)||b.length<=e}}}}},bd=function(){return{restrict:"A",require:"?ngModel",link:function(a,b,d,c){if(c){var e=0;d.$observe("minlength",function(a){e=Z(a)||0;c.$validate()});c.$validators.minlength=function(a,b){return c.$isEmpty(b)||b.length>=e}}}}};w.angular.bootstrap?w.console&&console.log("WARNING: Tried to load AngularJS more than once."):
+(Be(),Ee($),$.module("ngLocale",[],["$provide",function(a){function b(a){a+="";var b=a.indexOf(".");return-1==b?0:a.length-b-1}a.value("$locale",{DATETIME_FORMATS:{AMPMS:["AM","PM"],DAY:"Sunday Monday Tuesday Wednesday Thursday Friday Saturday".split(" "),ERANAMES:["Before Christ","Anno Domini"],ERAS:["BC","AD"],FIRSTDAYOFWEEK:6,MONTH:"January February March April May June July August September October November December".split(" "),SHORTDAY:"Sun Mon Tue Wed Thu Fri Sat".split(" "),SHORTMONTH:"Jan Feb Mar Apr May Jun Jul Aug Sep Oct Nov Dec".split(" "),
+STANDALONEMONTH:"January February March April May June July August September October November December".split(" "),WEEKENDRANGE:[5,6],fullDate:"EEEE, MMMM d, y",longDate:"MMMM d, y",medium:"MMM d, y h:mm:ss a",mediumDate:"MMM d, y",mediumTime:"h:mm:ss a","short":"M/d/yy h:mm a",shortDate:"M/d/yy",shortTime:"h:mm a"},NUMBER_FORMATS:{CURRENCY_SYM:"$",DECIMAL_SEP:".",GROUP_SEP:",",PATTERNS:[{gSize:3,lgSize:3,maxFrac:3,minFrac:0,minInt:1,negPre:"-",negSuf:"",posPre:"",posSuf:""},{gSize:3,lgSize:3,maxFrac:2,
+minFrac:2,minInt:1,negPre:"-\u00a4",negSuf:"",posPre:"\u00a4",posSuf:""}]},id:"en-us",localeID:"en_US",pluralCat:function(a,c){var e=a|0,f=c;void 0===f&&(f=Math.min(b(a),3));Math.pow(10,f);return 1==e&&0==f?"one":"other"}})}]),z(function(){we(w.document,Uc)}))})(window);!window.angular.$$csp().noInlineStyle&&window.angular.element(document.head).prepend('');
+//# sourceMappingURL=angular.min.js.map
diff --git a/Restaurant/js/scrutinizer.js b/Restaurant/js/scrutinizer.js
new file mode 100644
index 0000000..4913246
--- /dev/null
+++ b/Restaurant/js/scrutinizer.js
@@ -0,0 +1,141 @@
+var aaharvihar = angular.module('restaurent',["ngRoute"]);
+
+aaharvihar.config(function($routeProvider){
+ $routeProvider
+ .when("/",{
+ templateUrl:"main.html"
+ })
+ .when("/login",{
+ templateUrl :"login.html"
+ })
+ .when("/signup",{
+ templateUrl:"signup.html"
+ })
+ .when("/foodItems",{
+ templateUrl:"homepage.html"
+ })
+ .when("/main",{
+ templateUrl:"table.html"
+ })
+ .when("/Analytics6",{
+ templateUrl:"Analytics.html"
+ })
+});
+
+
+aaharvihar.controller('onlineOrder',function($scope,$http,$window,AaharViharService,$rootScope){
+
+ // $scope.newMessage =AaharViharService.setMessage("Helllo i am the user");
+ $scope.welcome_Msg = AaharViharService.getWelcomeMsg();
+
+
+ $scope.login = function(){
+ alert('entering to login ');
+ $window.location.href="#!login";
+ };
+
+ $scope.signup = function(){
+ alert('entering to signup');
+ $window.location.href="#!signup";
+ };
+ $scope.search = function(){
+ alert('table');
+ $window.location.href="#!userInfo"
+ };
+ $scope.search = function(){
+ alert('Analytics6');
+ $window.location.herf="#!Analytics6"
+ };
+
+
+
+});
+
+aaharvihar.controller('security',function($scope,$http,$window,AaharViharService,$rootScope){
+ $scope.submit= function(){
+ if($scope.emailid != undefined && $scope.password != undefined){
+ $http.get('http://localhost:4001/login?emailid=' +$scope.emailid+ '&password='+$scope.password)
+ .then(function(res){
+ if(res.data.code==200){
+ alert('order your food');
+ AaharViharService.getData().then(function(res,req){
+ if(res!=null){
+ $rootScope.myData = res.data;
+ $window.location.href="#!foodItems";
+ }
+ }).catch(function(err){
+ console.log("Error");
+ })
+
+ //$window.location.href="#!main";
+ }
+ else{
+ alert('please enter correct details');
+ }
+ })
+ .catch(function(err){
+ alert('you dont have account on this userid or number')
+ alert('please create a new account')
+ $window.location.href="#!signup";
+
+ })
+ }
+ else{
+ alert('please enter the details');
+ }
+ }
+
+
+ $scope.enter=function(){
+
+ if($scope.username != undefined && $scope.emailid != undefined && $scope.mobilenumber != undefined && $scope.password == $scope.repassword){
+
+ $http.post('http://localhost:4001/signup',{
+ "username":$scope.username,
+ "emailid":$scope.emailid,
+ "mobilenumber":$scope.mobilenumber,
+ "password":$scope.password
+ })
+ .then(function(response){
+ console.log(response)
+ if(response.data.code==200){
+ alert('sucess fully stored')
+ alert('order your tasty food ');
+ /** document.getElementById("emailid").value = "";
+ document.getElementById("password").value = ""; **/
+ }
+ else{
+ alert('check your mongodb')
+ }
+ })
+ .catch(function(error){
+ console.log(error);
+ alert('sever problem')
+ })
+ }
+ else
+ {
+ alert('please enter all details')
+ }
+ }
+});
+
+
+
+
+
+
+
+aaharvihar.factory('AaharViharService',function($http,$q){
+ return {
+ getWelcomeMsg: function() {
+ return "Welcome to ML Labs";
+ },
+ getData: function(){
+ console.log("Getdata");
+ return $http.get('http://localhost:4001/userInfo');
+ }
+ }
+});
+
+
diff --git a/Restaurant/node_modules/.bin/mime b/Restaurant/node_modules/.bin/mime
new file mode 100644
index 0000000..91e5e16
--- /dev/null
+++ b/Restaurant/node_modules/.bin/mime
@@ -0,0 +1,15 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ "$basedir/node" "$basedir/../mime/cli.js" "$@"
+ ret=$?
+else
+ node "$basedir/../mime/cli.js" "$@"
+ ret=$?
+fi
+exit $ret
diff --git a/Restaurant/node_modules/.bin/mime.cmd b/Restaurant/node_modules/.bin/mime.cmd
new file mode 100644
index 0000000..678bc6b
--- /dev/null
+++ b/Restaurant/node_modules/.bin/mime.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+"%_prog%" "%dp0%\..\mime\cli.js" %*
+ENDLOCAL
+EXIT /b %errorlevel%
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
diff --git a/Restaurant/node_modules/.bin/mime.ps1 b/Restaurant/node_modules/.bin/mime.ps1
new file mode 100644
index 0000000..a6f6f47
--- /dev/null
+++ b/Restaurant/node_modules/.bin/mime.ps1
@@ -0,0 +1,18 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ & "$basedir/node$exe" "$basedir/../mime/cli.js" $args
+ $ret=$LASTEXITCODE
+} else {
+ & "node$exe" "$basedir/../mime/cli.js" $args
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/Restaurant/node_modules/.bin/semver b/Restaurant/node_modules/.bin/semver
new file mode 100644
index 0000000..10497aa
--- /dev/null
+++ b/Restaurant/node_modules/.bin/semver
@@ -0,0 +1,15 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ "$basedir/node" "$basedir/../semver/bin/semver" "$@"
+ ret=$?
+else
+ node "$basedir/../semver/bin/semver" "$@"
+ ret=$?
+fi
+exit $ret
diff --git a/Restaurant/node_modules/.bin/semver.cmd b/Restaurant/node_modules/.bin/semver.cmd
new file mode 100644
index 0000000..f6c4ad4
--- /dev/null
+++ b/Restaurant/node_modules/.bin/semver.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+"%_prog%" "%dp0%\..\semver\bin\semver" %*
+ENDLOCAL
+EXIT /b %errorlevel%
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
diff --git a/Restaurant/node_modules/.bin/semver.ps1 b/Restaurant/node_modules/.bin/semver.ps1
new file mode 100644
index 0000000..a3315ff
--- /dev/null
+++ b/Restaurant/node_modules/.bin/semver.ps1
@@ -0,0 +1,18 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ & "$basedir/node$exe" "$basedir/../semver/bin/semver" $args
+ $ret=$LASTEXITCODE
+} else {
+ & "node$exe" "$basedir/../semver/bin/semver" $args
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/Restaurant/node_modules/accepts/HISTORY.md b/Restaurant/node_modules/accepts/HISTORY.md
new file mode 100644
index 0000000..0bf0417
--- /dev/null
+++ b/Restaurant/node_modules/accepts/HISTORY.md
@@ -0,0 +1,236 @@
+1.3.7 / 2019-04-29
+==================
+
+ * deps: negotiator@0.6.2
+ - Fix sorting charset, encoding, and language with extra parameters
+
+1.3.6 / 2019-04-28
+==================
+
+ * deps: mime-types@~2.1.24
+ - deps: mime-db@~1.40.0
+
+1.3.5 / 2018-02-28
+==================
+
+ * deps: mime-types@~2.1.18
+ - deps: mime-db@~1.33.0
+
+1.3.4 / 2017-08-22
+==================
+
+ * deps: mime-types@~2.1.16
+ - deps: mime-db@~1.29.0
+
+1.3.3 / 2016-05-02
+==================
+
+ * deps: mime-types@~2.1.11
+ - deps: mime-db@~1.23.0
+ * deps: negotiator@0.6.1
+ - perf: improve `Accept` parsing speed
+ - perf: improve `Accept-Charset` parsing speed
+ - perf: improve `Accept-Encoding` parsing speed
+ - perf: improve `Accept-Language` parsing speed
+
+1.3.2 / 2016-03-08
+==================
+
+ * deps: mime-types@~2.1.10
+ - Fix extension of `application/dash+xml`
+ - Update primary extension for `audio/mp4`
+ - deps: mime-db@~1.22.0
+
+1.3.1 / 2016-01-19
+==================
+
+ * deps: mime-types@~2.1.9
+ - deps: mime-db@~1.21.0
+
+1.3.0 / 2015-09-29
+==================
+
+ * deps: mime-types@~2.1.7
+ - deps: mime-db@~1.19.0
+ * deps: negotiator@0.6.0
+ - Fix including type extensions in parameters in `Accept` parsing
+ - Fix parsing `Accept` parameters with quoted equals
+ - Fix parsing `Accept` parameters with quoted semicolons
+ - Lazy-load modules from main entry point
+ - perf: delay type concatenation until needed
+ - perf: enable strict mode
+ - perf: hoist regular expressions
+ - perf: remove closures getting spec properties
+ - perf: remove a closure from media type parsing
+ - perf: remove property delete from media type parsing
+
+1.2.13 / 2015-09-06
+===================
+
+ * deps: mime-types@~2.1.6
+ - deps: mime-db@~1.18.0
+
+1.2.12 / 2015-07-30
+===================
+
+ * deps: mime-types@~2.1.4
+ - deps: mime-db@~1.16.0
+
+1.2.11 / 2015-07-16
+===================
+
+ * deps: mime-types@~2.1.3
+ - deps: mime-db@~1.15.0
+
+1.2.10 / 2015-07-01
+===================
+
+ * deps: mime-types@~2.1.2
+ - deps: mime-db@~1.14.0
+
+1.2.9 / 2015-06-08
+==================
+
+ * deps: mime-types@~2.1.1
+ - perf: fix deopt during mapping
+
+1.2.8 / 2015-06-07
+==================
+
+ * deps: mime-types@~2.1.0
+ - deps: mime-db@~1.13.0
+ * perf: avoid argument reassignment & argument slice
+ * perf: avoid negotiator recursive construction
+ * perf: enable strict mode
+ * perf: remove unnecessary bitwise operator
+
+1.2.7 / 2015-05-10
+==================
+
+ * deps: negotiator@0.5.3
+ - Fix media type parameter matching to be case-insensitive
+
+1.2.6 / 2015-05-07
+==================
+
+ * deps: mime-types@~2.0.11
+ - deps: mime-db@~1.9.1
+ * deps: negotiator@0.5.2
+ - Fix comparing media types with quoted values
+ - Fix splitting media types with quoted commas
+
+1.2.5 / 2015-03-13
+==================
+
+ * deps: mime-types@~2.0.10
+ - deps: mime-db@~1.8.0
+
+1.2.4 / 2015-02-14
+==================
+
+ * Support Node.js 0.6
+ * deps: mime-types@~2.0.9
+ - deps: mime-db@~1.7.0
+ * deps: negotiator@0.5.1
+ - Fix preference sorting to be stable for long acceptable lists
+
+1.2.3 / 2015-01-31
+==================
+
+ * deps: mime-types@~2.0.8
+ - deps: mime-db@~1.6.0
+
+1.2.2 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.7
+ - deps: mime-db@~1.5.0
+
+1.2.1 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.5
+ - deps: mime-db@~1.3.1
+
+1.2.0 / 2014-12-19
+==================
+
+ * deps: negotiator@0.5.0
+ - Fix list return order when large accepted list
+ - Fix missing identity encoding when q=0 exists
+ - Remove dynamic building of Negotiator class
+
+1.1.4 / 2014-12-10
+==================
+
+ * deps: mime-types@~2.0.4
+ - deps: mime-db@~1.3.0
+
+1.1.3 / 2014-11-09
+==================
+
+ * deps: mime-types@~2.0.3
+ - deps: mime-db@~1.2.0
+
+1.1.2 / 2014-10-14
+==================
+
+ * deps: negotiator@0.4.9
+ - Fix error when media type has invalid parameter
+
+1.1.1 / 2014-09-28
+==================
+
+ * deps: mime-types@~2.0.2
+ - deps: mime-db@~1.1.0
+ * deps: negotiator@0.4.8
+ - Fix all negotiations to be case-insensitive
+ - Stable sort preferences of same quality according to client order
+
+1.1.0 / 2014-09-02
+==================
+
+ * update `mime-types`
+
+1.0.7 / 2014-07-04
+==================
+
+ * Fix wrong type returned from `type` when match after unknown extension
+
+1.0.6 / 2014-06-24
+==================
+
+ * deps: negotiator@0.4.7
+
+1.0.5 / 2014-06-20
+==================
+
+ * fix crash when unknown extension given
+
+1.0.4 / 2014-06-19
+==================
+
+ * use `mime-types`
+
+1.0.3 / 2014-06-11
+==================
+
+ * deps: negotiator@0.4.6
+ - Order by specificity when quality is the same
+
+1.0.2 / 2014-05-29
+==================
+
+ * Fix interpretation when header not in request
+ * deps: pin negotiator@0.4.5
+
+1.0.1 / 2014-01-18
+==================
+
+ * Identity encoding isn't always acceptable
+ * deps: negotiator@~0.4.0
+
+1.0.0 / 2013-12-27
+==================
+
+ * Genesis
diff --git a/Restaurant/node_modules/accepts/LICENSE b/Restaurant/node_modules/accepts/LICENSE
new file mode 100644
index 0000000..0616607
--- /dev/null
+++ b/Restaurant/node_modules/accepts/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/Restaurant/node_modules/accepts/README.md b/Restaurant/node_modules/accepts/README.md
new file mode 100644
index 0000000..66a2f54
--- /dev/null
+++ b/Restaurant/node_modules/accepts/README.md
@@ -0,0 +1,142 @@
+# accepts
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator).
+Extracted from [koa](https://www.npmjs.com/package/koa) for general use.
+
+In addition to negotiator, it allows:
+
+- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])`
+ as well as `('text/html', 'application/json')`.
+- Allows type shorthands such as `json`.
+- Returns `false` when no types match
+- Treats non-existent headers as `*`
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install accepts
+```
+
+## API
+
+
+
+```js
+var accepts = require('accepts')
+```
+
+### accepts(req)
+
+Create a new `Accepts` object for the given `req`.
+
+#### .charset(charsets)
+
+Return the first accepted charset. If nothing in `charsets` is accepted,
+then `false` is returned.
+
+#### .charsets()
+
+Return the charsets that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .encoding(encodings)
+
+Return the first accepted encoding. If nothing in `encodings` is accepted,
+then `false` is returned.
+
+#### .encodings()
+
+Return the encodings that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .language(languages)
+
+Return the first accepted language. If nothing in `languages` is accepted,
+then `false` is returned.
+
+#### .languages()
+
+Return the languages that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .type(types)
+
+Return the first accepted type (and it is returned as the same text as what
+appears in the `types` array). If nothing in `types` is accepted, then `false`
+is returned.
+
+The `types` array can contain full MIME types or file extensions. Any value
+that is not a full MIME types is passed to `require('mime-types').lookup`.
+
+#### .types()
+
+Return the types that the request accepts, in the order of the client's
+preference (most preferred first).
+
+## Examples
+
+### Simple type negotiation
+
+This simple example shows how to use `accepts` to return a different typed
+respond body based on what the client wants to accept. The server lists it's
+preferences in order and will get back the best match between the client and
+server.
+
+```js
+var accepts = require('accepts')
+var http = require('http')
+
+function app (req, res) {
+ var accept = accepts(req)
+
+ // the order of this list is significant; should be server preferred order
+ switch (accept.type(['json', 'html'])) {
+ case 'json':
+ res.setHeader('Content-Type', 'application/json')
+ res.write('{"hello":"world!"}')
+ break
+ case 'html':
+ res.setHeader('Content-Type', 'text/html')
+ res.write('hello, world! ')
+ break
+ default:
+ // the fallback is text/plain, so no need to specify it above
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('hello, world!')
+ break
+ }
+
+ res.end()
+}
+
+http.createServer(app).listen(3000)
+```
+
+You can test this out with the cURL program:
+```sh
+curl -I -H'Accept: text/html' http://localhost:3000/
+```
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master
+[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master
+[node-version-image]: https://badgen.net/npm/node/accepts
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/accepts
+[npm-url]: https://npmjs.org/package/accepts
+[npm-version-image]: https://badgen.net/npm/v/accepts
+[travis-image]: https://badgen.net/travis/jshttp/accepts/master
+[travis-url]: https://travis-ci.org/jshttp/accepts
diff --git a/Restaurant/node_modules/accepts/index.js b/Restaurant/node_modules/accepts/index.js
new file mode 100644
index 0000000..e9b2f63
--- /dev/null
+++ b/Restaurant/node_modules/accepts/index.js
@@ -0,0 +1,238 @@
+/*!
+ * accepts
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var Negotiator = require('negotiator')
+var mime = require('mime-types')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = Accepts
+
+/**
+ * Create a new Accepts object for the given req.
+ *
+ * @param {object} req
+ * @public
+ */
+
+function Accepts (req) {
+ if (!(this instanceof Accepts)) {
+ return new Accepts(req)
+ }
+
+ this.headers = req.headers
+ this.negotiator = new Negotiator(req)
+}
+
+/**
+ * Check if the given `type(s)` is acceptable, returning
+ * the best match when true, otherwise `undefined`, in which
+ * case you should respond with 406 "Not Acceptable".
+ *
+ * The `type` value may be a single mime type string
+ * such as "application/json", the extension name
+ * such as "json" or an array `["json", "html", "text/plain"]`. When a list
+ * or array is given the _best_ match, if any is returned.
+ *
+ * Examples:
+ *
+ * // Accept: text/html
+ * this.types('html');
+ * // => "html"
+ *
+ * // Accept: text/*, application/json
+ * this.types('html');
+ * // => "html"
+ * this.types('text/html');
+ * // => "text/html"
+ * this.types('json', 'text');
+ * // => "json"
+ * this.types('application/json');
+ * // => "application/json"
+ *
+ * // Accept: text/*, application/json
+ * this.types('image/png');
+ * this.types('png');
+ * // => undefined
+ *
+ * // Accept: text/*;q=.5, application/json
+ * this.types(['html', 'json']);
+ * this.types('html', 'json');
+ * // => "json"
+ *
+ * @param {String|Array} types...
+ * @return {String|Array|Boolean}
+ * @public
+ */
+
+Accepts.prototype.type =
+Accepts.prototype.types = function (types_) {
+ var types = types_
+
+ // support flattened arguments
+ if (types && !Array.isArray(types)) {
+ types = new Array(arguments.length)
+ for (var i = 0; i < types.length; i++) {
+ types[i] = arguments[i]
+ }
+ }
+
+ // no types, return all requested types
+ if (!types || types.length === 0) {
+ return this.negotiator.mediaTypes()
+ }
+
+ // no accept header, return first given type
+ if (!this.headers.accept) {
+ return types[0]
+ }
+
+ var mimes = types.map(extToMime)
+ var accepts = this.negotiator.mediaTypes(mimes.filter(validMime))
+ var first = accepts[0]
+
+ return first
+ ? types[mimes.indexOf(first)]
+ : false
+}
+
+/**
+ * Return accepted encodings or best fit based on `encodings`.
+ *
+ * Given `Accept-Encoding: gzip, deflate`
+ * an array sorted by quality is returned:
+ *
+ * ['gzip', 'deflate']
+ *
+ * @param {String|Array} encodings...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.encoding =
+Accepts.prototype.encodings = function (encodings_) {
+ var encodings = encodings_
+
+ // support flattened arguments
+ if (encodings && !Array.isArray(encodings)) {
+ encodings = new Array(arguments.length)
+ for (var i = 0; i < encodings.length; i++) {
+ encodings[i] = arguments[i]
+ }
+ }
+
+ // no encodings, return all requested encodings
+ if (!encodings || encodings.length === 0) {
+ return this.negotiator.encodings()
+ }
+
+ return this.negotiator.encodings(encodings)[0] || false
+}
+
+/**
+ * Return accepted charsets or best fit based on `charsets`.
+ *
+ * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5`
+ * an array sorted by quality is returned:
+ *
+ * ['utf-8', 'utf-7', 'iso-8859-1']
+ *
+ * @param {String|Array} charsets...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.charset =
+Accepts.prototype.charsets = function (charsets_) {
+ var charsets = charsets_
+
+ // support flattened arguments
+ if (charsets && !Array.isArray(charsets)) {
+ charsets = new Array(arguments.length)
+ for (var i = 0; i < charsets.length; i++) {
+ charsets[i] = arguments[i]
+ }
+ }
+
+ // no charsets, return all requested charsets
+ if (!charsets || charsets.length === 0) {
+ return this.negotiator.charsets()
+ }
+
+ return this.negotiator.charsets(charsets)[0] || false
+}
+
+/**
+ * Return accepted languages or best fit based on `langs`.
+ *
+ * Given `Accept-Language: en;q=0.8, es, pt`
+ * an array sorted by quality is returned:
+ *
+ * ['es', 'pt', 'en']
+ *
+ * @param {String|Array} langs...
+ * @return {Array|String}
+ * @public
+ */
+
+Accepts.prototype.lang =
+Accepts.prototype.langs =
+Accepts.prototype.language =
+Accepts.prototype.languages = function (languages_) {
+ var languages = languages_
+
+ // support flattened arguments
+ if (languages && !Array.isArray(languages)) {
+ languages = new Array(arguments.length)
+ for (var i = 0; i < languages.length; i++) {
+ languages[i] = arguments[i]
+ }
+ }
+
+ // no languages, return all requested languages
+ if (!languages || languages.length === 0) {
+ return this.negotiator.languages()
+ }
+
+ return this.negotiator.languages(languages)[0] || false
+}
+
+/**
+ * Convert extnames to mime.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function extToMime (type) {
+ return type.indexOf('/') === -1
+ ? mime.lookup(type)
+ : type
+}
+
+/**
+ * Check if mime is valid.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function validMime (type) {
+ return typeof type === 'string'
+}
diff --git a/Restaurant/node_modules/accepts/package.json b/Restaurant/node_modules/accepts/package.json
new file mode 100644
index 0000000..a76a199
--- /dev/null
+++ b/Restaurant/node_modules/accepts/package.json
@@ -0,0 +1,86 @@
+{
+ "_from": "accepts@~1.3.7",
+ "_id": "accepts@1.3.7",
+ "_inBundle": false,
+ "_integrity": "sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA==",
+ "_location": "/accepts",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "accepts@~1.3.7",
+ "name": "accepts",
+ "escapedName": "accepts",
+ "rawSpec": "~1.3.7",
+ "saveSpec": null,
+ "fetchSpec": "~1.3.7"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz",
+ "_shasum": "531bc726517a3b2b41f850021c6cc15eaab507cd",
+ "_spec": "accepts@~1.3.7",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "bugs": {
+ "url": "https://github.com/jshttp/accepts/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ }
+ ],
+ "dependencies": {
+ "mime-types": "~2.1.24",
+ "negotiator": "0.6.2"
+ },
+ "deprecated": false,
+ "description": "Higher-level content negotiation",
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "5.16.0",
+ "eslint-config-standard": "12.0.0",
+ "eslint-plugin-import": "2.17.2",
+ "eslint-plugin-markdown": "1.0.0",
+ "eslint-plugin-node": "8.0.1",
+ "eslint-plugin-promise": "4.1.1",
+ "eslint-plugin-standard": "4.0.0",
+ "mocha": "6.1.4",
+ "nyc": "14.0.0"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/accepts#readme",
+ "keywords": [
+ "content",
+ "negotiation",
+ "accept",
+ "accepts"
+ ],
+ "license": "MIT",
+ "name": "accepts",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/accepts.git"
+ },
+ "scripts": {
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "test-travis": "nyc --reporter=text npm test"
+ },
+ "version": "1.3.7"
+}
diff --git a/Restaurant/node_modules/array-flatten/LICENSE b/Restaurant/node_modules/array-flatten/LICENSE
new file mode 100644
index 0000000..983fbe8
--- /dev/null
+++ b/Restaurant/node_modules/array-flatten/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/Restaurant/node_modules/array-flatten/README.md b/Restaurant/node_modules/array-flatten/README.md
new file mode 100644
index 0000000..91fa5b6
--- /dev/null
+++ b/Restaurant/node_modules/array-flatten/README.md
@@ -0,0 +1,43 @@
+# Array Flatten
+
+[![NPM version][npm-image]][npm-url]
+[![NPM downloads][downloads-image]][downloads-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+
+> Flatten an array of nested arrays into a single flat array. Accepts an optional depth.
+
+## Installation
+
+```
+npm install array-flatten --save
+```
+
+## Usage
+
+```javascript
+var flatten = require('array-flatten')
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9])
+//=> [1, 2, 3, 4, 5, 6, 7, 8, 9]
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2)
+//=> [1, 2, 3, [4, [5], 6], 7, 8, 9]
+
+(function () {
+ flatten(arguments) //=> [1, 2, 3]
+})(1, [2, 3])
+```
+
+## License
+
+MIT
+
+[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat
+[npm-url]: https://npmjs.org/package/array-flatten
+[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat
+[downloads-url]: https://npmjs.org/package/array-flatten
+[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat
+[travis-url]: https://travis-ci.org/blakeembrey/array-flatten
+[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master
diff --git a/Restaurant/node_modules/array-flatten/array-flatten.js b/Restaurant/node_modules/array-flatten/array-flatten.js
new file mode 100644
index 0000000..089117b
--- /dev/null
+++ b/Restaurant/node_modules/array-flatten/array-flatten.js
@@ -0,0 +1,64 @@
+'use strict'
+
+/**
+ * Expose `arrayFlatten`.
+ */
+module.exports = arrayFlatten
+
+/**
+ * Recursive flatten function with depth.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @param {Number} depth
+ * @return {Array}
+ */
+function flattenWithDepth (array, result, depth) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (depth > 0 && Array.isArray(value)) {
+ flattenWithDepth(value, result, depth - 1)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Recursive flatten function. Omitting depth is slightly faster.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @return {Array}
+ */
+function flattenForever (array, result) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (Array.isArray(value)) {
+ flattenForever(value, result)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Flatten an array, with the ability to define a depth.
+ *
+ * @param {Array} array
+ * @param {Number} depth
+ * @return {Array}
+ */
+function arrayFlatten (array, depth) {
+ if (depth == null) {
+ return flattenForever(array, [])
+ }
+
+ return flattenWithDepth(array, [], depth)
+}
diff --git a/Restaurant/node_modules/array-flatten/package.json b/Restaurant/node_modules/array-flatten/package.json
new file mode 100644
index 0000000..ab6305e
--- /dev/null
+++ b/Restaurant/node_modules/array-flatten/package.json
@@ -0,0 +1,64 @@
+{
+ "_from": "array-flatten@1.1.1",
+ "_id": "array-flatten@1.1.1",
+ "_inBundle": false,
+ "_integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=",
+ "_location": "/array-flatten",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "array-flatten@1.1.1",
+ "name": "array-flatten",
+ "escapedName": "array-flatten",
+ "rawSpec": "1.1.1",
+ "saveSpec": null,
+ "fetchSpec": "1.1.1"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz",
+ "_shasum": "9a5f699051b1e7073328f2a008968b64ea2955d2",
+ "_spec": "array-flatten@1.1.1",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "author": {
+ "name": "Blake Embrey",
+ "email": "hello@blakeembrey.com",
+ "url": "http://blakeembrey.me"
+ },
+ "bugs": {
+ "url": "https://github.com/blakeembrey/array-flatten/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Flatten an array of nested arrays into a single flat array",
+ "devDependencies": {
+ "istanbul": "^0.3.13",
+ "mocha": "^2.2.4",
+ "pre-commit": "^1.0.7",
+ "standard": "^3.7.3"
+ },
+ "files": [
+ "array-flatten.js",
+ "LICENSE"
+ ],
+ "homepage": "https://github.com/blakeembrey/array-flatten",
+ "keywords": [
+ "array",
+ "flatten",
+ "arguments",
+ "depth"
+ ],
+ "license": "MIT",
+ "main": "array-flatten.js",
+ "name": "array-flatten",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/blakeembrey/array-flatten.git"
+ },
+ "scripts": {
+ "test": "istanbul cover _mocha -- -R spec"
+ },
+ "version": "1.1.1"
+}
diff --git a/Restaurant/node_modules/bluebird/LICENSE b/Restaurant/node_modules/bluebird/LICENSE
new file mode 100644
index 0000000..ae732d5
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2013-2017 Petka Antonov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/Restaurant/node_modules/bluebird/README.md b/Restaurant/node_modules/bluebird/README.md
new file mode 100644
index 0000000..ba82f73
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/README.md
@@ -0,0 +1,52 @@
+
+
+
+[](https://travis-ci.org/petkaantonov/bluebird)
+[](http://petkaantonov.github.io/bluebird/coverage/debug/index.html)
+
+**Got a question?** Join us on [stackoverflow](http://stackoverflow.com/questions/tagged/bluebird), the [mailing list](https://groups.google.com/forum/#!forum/bluebird-js) or chat on [IRC](https://webchat.freenode.net/?channels=#promises)
+
+# Introduction
+
+Bluebird is a fully featured promise library with focus on innovative features and performance
+
+See the [**bluebird website**](http://bluebirdjs.com/docs/getting-started.html) for further documentation, references and instructions. See the [**API reference**](http://bluebirdjs.com/docs/api-reference.html) here.
+
+For bluebird 2.x documentation and files, see the [2.x tree](https://github.com/petkaantonov/bluebird/tree/2.x).
+
+# Questions and issues
+
+The [github issue tracker](https://github.com/petkaantonov/bluebird/issues) is **_only_** for bug reports and feature requests. Anything else, such as questions for help in using the library, should be posted in [StackOverflow](http://stackoverflow.com/questions/tagged/bluebird) under tags `promise` and `bluebird`.
+
+
+
+## Thanks
+
+Thanks to BrowserStack for providing us with a free account which lets us support old browsers like IE8.
+
+# License
+
+The MIT License (MIT)
+
+Copyright (c) 2013-2017 Petka Antonov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
+
diff --git a/Restaurant/node_modules/bluebird/changelog.md b/Restaurant/node_modules/bluebird/changelog.md
new file mode 100644
index 0000000..73b2eb6
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/changelog.md
@@ -0,0 +1 @@
+[http://bluebirdjs.com/docs/changelog.html](http://bluebirdjs.com/docs/changelog.html)
diff --git a/Restaurant/node_modules/bluebird/js/browser/bluebird.core.js b/Restaurant/node_modules/bluebird/js/browser/bluebird.core.js
new file mode 100644
index 0000000..85b7791
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/browser/bluebird.core.js
@@ -0,0 +1,3781 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2013-2017 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 3.5.1
+ * Features enabled: core
+ * Features disabled: race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, using, timers, filter, any, each
+*/
+!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var f;"undefined"!=typeof window?f=window:"undefined"!=typeof global?f=global:"undefined"!=typeof self&&(f=self),f.Promise=e()}}(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof _dereq_=="function"&&_dereq_;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof _dereq_=="function"&&_dereq_;for(var o=0;o 0) {
+ var fn = queue.shift();
+ if (typeof fn !== "function") {
+ fn._settlePromises();
+ continue;
+ }
+ var receiver = queue.shift();
+ var arg = queue.shift();
+ fn.call(receiver, arg);
+ }
+};
+
+Async.prototype._drainQueues = function () {
+ this._drainQueue(this._normalQueue);
+ this._reset();
+ this._haveDrainedQueues = true;
+ this._drainQueue(this._lateQueue);
+};
+
+Async.prototype._queueTick = function () {
+ if (!this._isTickUsed) {
+ this._isTickUsed = true;
+ this._schedule(this.drainQueues);
+ }
+};
+
+Async.prototype._reset = function () {
+ this._isTickUsed = false;
+};
+
+module.exports = Async;
+module.exports.firstLineError = firstLineError;
+
+},{"./queue":17,"./schedule":18,"./util":21}],2:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise, debug) {
+var calledBind = false;
+var rejectThis = function(_, e) {
+ this._reject(e);
+};
+
+var targetRejected = function(e, context) {
+ context.promiseRejectionQueued = true;
+ context.bindingPromise._then(rejectThis, rejectThis, null, this, e);
+};
+
+var bindingResolved = function(thisArg, context) {
+ if (((this._bitField & 50397184) === 0)) {
+ this._resolveCallback(context.target);
+ }
+};
+
+var bindingRejected = function(e, context) {
+ if (!context.promiseRejectionQueued) this._reject(e);
+};
+
+Promise.prototype.bind = function (thisArg) {
+ if (!calledBind) {
+ calledBind = true;
+ Promise.prototype._propagateFrom = debug.propagateFromFunction();
+ Promise.prototype._boundValue = debug.boundValueFunction();
+ }
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+ ret._propagateFrom(this, 1);
+ var target = this._target();
+ ret._setBoundTo(maybePromise);
+ if (maybePromise instanceof Promise) {
+ var context = {
+ promiseRejectionQueued: false,
+ promise: ret,
+ target: target,
+ bindingPromise: maybePromise
+ };
+ target._then(INTERNAL, targetRejected, undefined, ret, context);
+ maybePromise._then(
+ bindingResolved, bindingRejected, undefined, ret, context);
+ ret._setOnCancel(maybePromise);
+ } else {
+ ret._resolveCallback(target);
+ }
+ return ret;
+};
+
+Promise.prototype._setBoundTo = function (obj) {
+ if (obj !== undefined) {
+ this._bitField = this._bitField | 2097152;
+ this._boundTo = obj;
+ } else {
+ this._bitField = this._bitField & (~2097152);
+ }
+};
+
+Promise.prototype._isBound = function () {
+ return (this._bitField & 2097152) === 2097152;
+};
+
+Promise.bind = function (thisArg, value) {
+ return Promise.resolve(value).bind(thisArg);
+};
+};
+
+},{}],3:[function(_dereq_,module,exports){
+"use strict";
+var old;
+if (typeof Promise !== "undefined") old = Promise;
+function noConflict() {
+ try { if (Promise === bluebird) Promise = old; }
+ catch (e) {}
+ return bluebird;
+}
+var bluebird = _dereq_("./promise")();
+bluebird.noConflict = noConflict;
+module.exports = bluebird;
+
+},{"./promise":15}],4:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, PromiseArray, apiRejection, debug) {
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+Promise.prototype["break"] = Promise.prototype.cancel = function() {
+ if (!debug.cancellation()) return this._warn("cancellation is disabled");
+
+ var promise = this;
+ var child = promise;
+ while (promise._isCancellable()) {
+ if (!promise._cancelBy(child)) {
+ if (child._isFollowing()) {
+ child._followee().cancel();
+ } else {
+ child._cancelBranched();
+ }
+ break;
+ }
+
+ var parent = promise._cancellationParent;
+ if (parent == null || !parent._isCancellable()) {
+ if (promise._isFollowing()) {
+ promise._followee().cancel();
+ } else {
+ promise._cancelBranched();
+ }
+ break;
+ } else {
+ if (promise._isFollowing()) promise._followee().cancel();
+ promise._setWillBeCancelled();
+ child = promise;
+ promise = parent;
+ }
+ }
+};
+
+Promise.prototype._branchHasCancelled = function() {
+ this._branchesRemainingToCancel--;
+};
+
+Promise.prototype._enoughBranchesHaveCancelled = function() {
+ return this._branchesRemainingToCancel === undefined ||
+ this._branchesRemainingToCancel <= 0;
+};
+
+Promise.prototype._cancelBy = function(canceller) {
+ if (canceller === this) {
+ this._branchesRemainingToCancel = 0;
+ this._invokeOnCancel();
+ return true;
+ } else {
+ this._branchHasCancelled();
+ if (this._enoughBranchesHaveCancelled()) {
+ this._invokeOnCancel();
+ return true;
+ }
+ }
+ return false;
+};
+
+Promise.prototype._cancelBranched = function() {
+ if (this._enoughBranchesHaveCancelled()) {
+ this._cancel();
+ }
+};
+
+Promise.prototype._cancel = function() {
+ if (!this._isCancellable()) return;
+ this._setCancelled();
+ async.invoke(this._cancelPromises, this, undefined);
+};
+
+Promise.prototype._cancelPromises = function() {
+ if (this._length() > 0) this._settlePromises();
+};
+
+Promise.prototype._unsetOnCancel = function() {
+ this._onCancelField = undefined;
+};
+
+Promise.prototype._isCancellable = function() {
+ return this.isPending() && !this._isCancelled();
+};
+
+Promise.prototype.isCancellable = function() {
+ return this.isPending() && !this.isCancelled();
+};
+
+Promise.prototype._doInvokeOnCancel = function(onCancelCallback, internalOnly) {
+ if (util.isArray(onCancelCallback)) {
+ for (var i = 0; i < onCancelCallback.length; ++i) {
+ this._doInvokeOnCancel(onCancelCallback[i], internalOnly);
+ }
+ } else if (onCancelCallback !== undefined) {
+ if (typeof onCancelCallback === "function") {
+ if (!internalOnly) {
+ var e = tryCatch(onCancelCallback).call(this._boundValue());
+ if (e === errorObj) {
+ this._attachExtraTrace(e.e);
+ async.throwLater(e.e);
+ }
+ }
+ } else {
+ onCancelCallback._resultCancelled(this);
+ }
+ }
+};
+
+Promise.prototype._invokeOnCancel = function() {
+ var onCancelCallback = this._onCancel();
+ this._unsetOnCancel();
+ async.invoke(this._doInvokeOnCancel, this, onCancelCallback);
+};
+
+Promise.prototype._invokeInternalOnCancel = function() {
+ if (this._isCancellable()) {
+ this._doInvokeOnCancel(this._onCancel(), true);
+ this._unsetOnCancel();
+ }
+};
+
+Promise.prototype._resultCancelled = function() {
+ this.cancel();
+};
+
+};
+
+},{"./util":21}],5:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(NEXT_FILTER) {
+var util = _dereq_("./util");
+var getKeys = _dereq_("./es5").keys;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function catchFilter(instances, cb, promise) {
+ return function(e) {
+ var boundTo = promise._boundValue();
+ predicateLoop: for (var i = 0; i < instances.length; ++i) {
+ var item = instances[i];
+
+ if (item === Error ||
+ (item != null && item.prototype instanceof Error)) {
+ if (e instanceof item) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (typeof item === "function") {
+ var matchesPredicate = tryCatch(item).call(boundTo, e);
+ if (matchesPredicate === errorObj) {
+ return matchesPredicate;
+ } else if (matchesPredicate) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (util.isObject(e)) {
+ var keys = getKeys(item);
+ for (var j = 0; j < keys.length; ++j) {
+ var key = keys[j];
+ if (item[key] != e[key]) {
+ continue predicateLoop;
+ }
+ }
+ return tryCatch(cb).call(boundTo, e);
+ }
+ }
+ return NEXT_FILTER;
+ };
+}
+
+return catchFilter;
+};
+
+},{"./es5":10,"./util":21}],6:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var longStackTraces = false;
+var contextStack = [];
+
+Promise.prototype._promiseCreated = function() {};
+Promise.prototype._pushContext = function() {};
+Promise.prototype._popContext = function() {return null;};
+Promise._peekContext = Promise.prototype._peekContext = function() {};
+
+function Context() {
+ this._trace = new Context.CapturedTrace(peekContext());
+}
+Context.prototype._pushContext = function () {
+ if (this._trace !== undefined) {
+ this._trace._promiseCreated = null;
+ contextStack.push(this._trace);
+ }
+};
+
+Context.prototype._popContext = function () {
+ if (this._trace !== undefined) {
+ var trace = contextStack.pop();
+ var ret = trace._promiseCreated;
+ trace._promiseCreated = null;
+ return ret;
+ }
+ return null;
+};
+
+function createContext() {
+ if (longStackTraces) return new Context();
+}
+
+function peekContext() {
+ var lastIndex = contextStack.length - 1;
+ if (lastIndex >= 0) {
+ return contextStack[lastIndex];
+ }
+ return undefined;
+}
+Context.CapturedTrace = null;
+Context.create = createContext;
+Context.deactivateLongStackTraces = function() {};
+Context.activateLongStackTraces = function() {
+ var Promise_pushContext = Promise.prototype._pushContext;
+ var Promise_popContext = Promise.prototype._popContext;
+ var Promise_PeekContext = Promise._peekContext;
+ var Promise_peekContext = Promise.prototype._peekContext;
+ var Promise_promiseCreated = Promise.prototype._promiseCreated;
+ Context.deactivateLongStackTraces = function() {
+ Promise.prototype._pushContext = Promise_pushContext;
+ Promise.prototype._popContext = Promise_popContext;
+ Promise._peekContext = Promise_PeekContext;
+ Promise.prototype._peekContext = Promise_peekContext;
+ Promise.prototype._promiseCreated = Promise_promiseCreated;
+ longStackTraces = false;
+ };
+ longStackTraces = true;
+ Promise.prototype._pushContext = Context.prototype._pushContext;
+ Promise.prototype._popContext = Context.prototype._popContext;
+ Promise._peekContext = Promise.prototype._peekContext = peekContext;
+ Promise.prototype._promiseCreated = function() {
+ var ctx = this._peekContext();
+ if (ctx && ctx._promiseCreated == null) ctx._promiseCreated = this;
+ };
+};
+return Context;
+};
+
+},{}],7:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, Context) {
+var getDomain = Promise._getDomain;
+var async = Promise._async;
+var Warning = _dereq_("./errors").Warning;
+var util = _dereq_("./util");
+var canAttachTrace = util.canAttachTrace;
+var unhandledRejectionHandled;
+var possiblyUnhandledRejection;
+var bluebirdFramePattern =
+ /[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/;
+var nodeFramePattern = /\((?:timers\.js):\d+:\d+\)/;
+var parseLinePattern = /[\/<\(](.+?):(\d+):(\d+)\)?\s*$/;
+var stackFramePattern = null;
+var formatStack = null;
+var indentStackFrames = false;
+var printWarning;
+var debugging = !!(util.env("BLUEBIRD_DEBUG") != 0 &&
+ (true ||
+ util.env("BLUEBIRD_DEBUG") ||
+ util.env("NODE_ENV") === "development"));
+
+var warnings = !!(util.env("BLUEBIRD_WARNINGS") != 0 &&
+ (debugging || util.env("BLUEBIRD_WARNINGS")));
+
+var longStackTraces = !!(util.env("BLUEBIRD_LONG_STACK_TRACES") != 0 &&
+ (debugging || util.env("BLUEBIRD_LONG_STACK_TRACES")));
+
+var wForgottenReturn = util.env("BLUEBIRD_W_FORGOTTEN_RETURN") != 0 &&
+ (warnings || !!util.env("BLUEBIRD_W_FORGOTTEN_RETURN"));
+
+Promise.prototype.suppressUnhandledRejections = function() {
+ var target = this._target();
+ target._bitField = ((target._bitField & (~1048576)) |
+ 524288);
+};
+
+Promise.prototype._ensurePossibleRejectionHandled = function () {
+ if ((this._bitField & 524288) !== 0) return;
+ this._setRejectionIsUnhandled();
+ var self = this;
+ setTimeout(function() {
+ self._notifyUnhandledRejection();
+ }, 1);
+};
+
+Promise.prototype._notifyUnhandledRejectionIsHandled = function () {
+ fireRejectionEvent("rejectionHandled",
+ unhandledRejectionHandled, undefined, this);
+};
+
+Promise.prototype._setReturnedNonUndefined = function() {
+ this._bitField = this._bitField | 268435456;
+};
+
+Promise.prototype._returnedNonUndefined = function() {
+ return (this._bitField & 268435456) !== 0;
+};
+
+Promise.prototype._notifyUnhandledRejection = function () {
+ if (this._isRejectionUnhandled()) {
+ var reason = this._settledValue();
+ this._setUnhandledRejectionIsNotified();
+ fireRejectionEvent("unhandledRejection",
+ possiblyUnhandledRejection, reason, this);
+ }
+};
+
+Promise.prototype._setUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField | 262144;
+};
+
+Promise.prototype._unsetUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField & (~262144);
+};
+
+Promise.prototype._isUnhandledRejectionNotified = function () {
+ return (this._bitField & 262144) > 0;
+};
+
+Promise.prototype._setRejectionIsUnhandled = function () {
+ this._bitField = this._bitField | 1048576;
+};
+
+Promise.prototype._unsetRejectionIsUnhandled = function () {
+ this._bitField = this._bitField & (~1048576);
+ if (this._isUnhandledRejectionNotified()) {
+ this._unsetUnhandledRejectionIsNotified();
+ this._notifyUnhandledRejectionIsHandled();
+ }
+};
+
+Promise.prototype._isRejectionUnhandled = function () {
+ return (this._bitField & 1048576) > 0;
+};
+
+Promise.prototype._warn = function(message, shouldUseOwnTrace, promise) {
+ return warn(message, shouldUseOwnTrace, promise || this);
+};
+
+Promise.onPossiblyUnhandledRejection = function (fn) {
+ var domain = getDomain();
+ possiblyUnhandledRejection =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+Promise.onUnhandledRejectionHandled = function (fn) {
+ var domain = getDomain();
+ unhandledRejectionHandled =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+var disableLongStackTraces = function() {};
+Promise.longStackTraces = function () {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (!config.longStackTraces && longStackTracesIsSupported()) {
+ var Promise_captureStackTrace = Promise.prototype._captureStackTrace;
+ var Promise_attachExtraTrace = Promise.prototype._attachExtraTrace;
+ config.longStackTraces = true;
+ disableLongStackTraces = function() {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ Promise.prototype._captureStackTrace = Promise_captureStackTrace;
+ Promise.prototype._attachExtraTrace = Promise_attachExtraTrace;
+ Context.deactivateLongStackTraces();
+ async.enableTrampoline();
+ config.longStackTraces = false;
+ };
+ Promise.prototype._captureStackTrace = longStackTracesCaptureStackTrace;
+ Promise.prototype._attachExtraTrace = longStackTracesAttachExtraTrace;
+ Context.activateLongStackTraces();
+ async.disableTrampolineIfNecessary();
+ }
+};
+
+Promise.hasLongStackTraces = function () {
+ return config.longStackTraces && longStackTracesIsSupported();
+};
+
+var fireDomEvent = (function() {
+ try {
+ if (typeof CustomEvent === "function") {
+ var event = new CustomEvent("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new CustomEvent(name.toLowerCase(), {
+ detail: event,
+ cancelable: true
+ });
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else if (typeof Event === "function") {
+ var event = new Event("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new Event(name.toLowerCase(), {
+ cancelable: true
+ });
+ domEvent.detail = event;
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else {
+ var event = document.createEvent("CustomEvent");
+ event.initCustomEvent("testingtheevent", false, true, {});
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = document.createEvent("CustomEvent");
+ domEvent.initCustomEvent(name.toLowerCase(), false, true,
+ event);
+ return !util.global.dispatchEvent(domEvent);
+ };
+ }
+ } catch (e) {}
+ return function() {
+ return false;
+ };
+})();
+
+var fireGlobalEvent = (function() {
+ if (util.isNode) {
+ return function() {
+ return process.emit.apply(process, arguments);
+ };
+ } else {
+ if (!util.global) {
+ return function() {
+ return false;
+ };
+ }
+ return function(name) {
+ var methodName = "on" + name.toLowerCase();
+ var method = util.global[methodName];
+ if (!method) return false;
+ method.apply(util.global, [].slice.call(arguments, 1));
+ return true;
+ };
+ }
+})();
+
+function generatePromiseLifecycleEventObject(name, promise) {
+ return {promise: promise};
+}
+
+var eventToObjectGenerator = {
+ promiseCreated: generatePromiseLifecycleEventObject,
+ promiseFulfilled: generatePromiseLifecycleEventObject,
+ promiseRejected: generatePromiseLifecycleEventObject,
+ promiseResolved: generatePromiseLifecycleEventObject,
+ promiseCancelled: generatePromiseLifecycleEventObject,
+ promiseChained: function(name, promise, child) {
+ return {promise: promise, child: child};
+ },
+ warning: function(name, warning) {
+ return {warning: warning};
+ },
+ unhandledRejection: function (name, reason, promise) {
+ return {reason: reason, promise: promise};
+ },
+ rejectionHandled: generatePromiseLifecycleEventObject
+};
+
+var activeFireEvent = function (name) {
+ var globalEventFired = false;
+ try {
+ globalEventFired = fireGlobalEvent.apply(null, arguments);
+ } catch (e) {
+ async.throwLater(e);
+ globalEventFired = true;
+ }
+
+ var domEventFired = false;
+ try {
+ domEventFired = fireDomEvent(name,
+ eventToObjectGenerator[name].apply(null, arguments));
+ } catch (e) {
+ async.throwLater(e);
+ domEventFired = true;
+ }
+
+ return domEventFired || globalEventFired;
+};
+
+Promise.config = function(opts) {
+ opts = Object(opts);
+ if ("longStackTraces" in opts) {
+ if (opts.longStackTraces) {
+ Promise.longStackTraces();
+ } else if (!opts.longStackTraces && Promise.hasLongStackTraces()) {
+ disableLongStackTraces();
+ }
+ }
+ if ("warnings" in opts) {
+ var warningsOption = opts.warnings;
+ config.warnings = !!warningsOption;
+ wForgottenReturn = config.warnings;
+
+ if (util.isObject(warningsOption)) {
+ if ("wForgottenReturn" in warningsOption) {
+ wForgottenReturn = !!warningsOption.wForgottenReturn;
+ }
+ }
+ }
+ if ("cancellation" in opts && opts.cancellation && !config.cancellation) {
+ if (async.haveItemsQueued()) {
+ throw new Error(
+ "cannot enable cancellation after promises are in use");
+ }
+ Promise.prototype._clearCancellationData =
+ cancellationClearCancellationData;
+ Promise.prototype._propagateFrom = cancellationPropagateFrom;
+ Promise.prototype._onCancel = cancellationOnCancel;
+ Promise.prototype._setOnCancel = cancellationSetOnCancel;
+ Promise.prototype._attachCancellationCallback =
+ cancellationAttachCancellationCallback;
+ Promise.prototype._execute = cancellationExecute;
+ propagateFromFunction = cancellationPropagateFrom;
+ config.cancellation = true;
+ }
+ if ("monitoring" in opts) {
+ if (opts.monitoring && !config.monitoring) {
+ config.monitoring = true;
+ Promise.prototype._fireEvent = activeFireEvent;
+ } else if (!opts.monitoring && config.monitoring) {
+ config.monitoring = false;
+ Promise.prototype._fireEvent = defaultFireEvent;
+ }
+ }
+ return Promise;
+};
+
+function defaultFireEvent() { return false; }
+
+Promise.prototype._fireEvent = defaultFireEvent;
+Promise.prototype._execute = function(executor, resolve, reject) {
+ try {
+ executor(resolve, reject);
+ } catch (e) {
+ return e;
+ }
+};
+Promise.prototype._onCancel = function () {};
+Promise.prototype._setOnCancel = function (handler) { ; };
+Promise.prototype._attachCancellationCallback = function(onCancel) {
+ ;
+};
+Promise.prototype._captureStackTrace = function () {};
+Promise.prototype._attachExtraTrace = function () {};
+Promise.prototype._clearCancellationData = function() {};
+Promise.prototype._propagateFrom = function (parent, flags) {
+ ;
+ ;
+};
+
+function cancellationExecute(executor, resolve, reject) {
+ var promise = this;
+ try {
+ executor(resolve, reject, function(onCancel) {
+ if (typeof onCancel !== "function") {
+ throw new TypeError("onCancel must be a function, got: " +
+ util.toString(onCancel));
+ }
+ promise._attachCancellationCallback(onCancel);
+ });
+ } catch (e) {
+ return e;
+ }
+}
+
+function cancellationAttachCancellationCallback(onCancel) {
+ if (!this._isCancellable()) return this;
+
+ var previousOnCancel = this._onCancel();
+ if (previousOnCancel !== undefined) {
+ if (util.isArray(previousOnCancel)) {
+ previousOnCancel.push(onCancel);
+ } else {
+ this._setOnCancel([previousOnCancel, onCancel]);
+ }
+ } else {
+ this._setOnCancel(onCancel);
+ }
+}
+
+function cancellationOnCancel() {
+ return this._onCancelField;
+}
+
+function cancellationSetOnCancel(onCancel) {
+ this._onCancelField = onCancel;
+}
+
+function cancellationClearCancellationData() {
+ this._cancellationParent = undefined;
+ this._onCancelField = undefined;
+}
+
+function cancellationPropagateFrom(parent, flags) {
+ if ((flags & 1) !== 0) {
+ this._cancellationParent = parent;
+ var branchesRemainingToCancel = parent._branchesRemainingToCancel;
+ if (branchesRemainingToCancel === undefined) {
+ branchesRemainingToCancel = 0;
+ }
+ parent._branchesRemainingToCancel = branchesRemainingToCancel + 1;
+ }
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+
+function bindingPropagateFrom(parent, flags) {
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+var propagateFromFunction = bindingPropagateFrom;
+
+function boundValueFunction() {
+ var ret = this._boundTo;
+ if (ret !== undefined) {
+ if (ret instanceof Promise) {
+ if (ret.isFulfilled()) {
+ return ret.value();
+ } else {
+ return undefined;
+ }
+ }
+ }
+ return ret;
+}
+
+function longStackTracesCaptureStackTrace() {
+ this._trace = new CapturedTrace(this._peekContext());
+}
+
+function longStackTracesAttachExtraTrace(error, ignoreSelf) {
+ if (canAttachTrace(error)) {
+ var trace = this._trace;
+ if (trace !== undefined) {
+ if (ignoreSelf) trace = trace._parent;
+ }
+ if (trace !== undefined) {
+ trace.attachExtraTrace(error);
+ } else if (!error.__stackCleaned__) {
+ var parsed = parseStackAndMessage(error);
+ util.notEnumerableProp(error, "stack",
+ parsed.message + "\n" + parsed.stack.join("\n"));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+ }
+ }
+}
+
+function checkForgottenReturns(returnValue, promiseCreated, name, promise,
+ parent) {
+ if (returnValue === undefined && promiseCreated !== null &&
+ wForgottenReturn) {
+ if (parent !== undefined && parent._returnedNonUndefined()) return;
+ if ((promise._bitField & 65535) === 0) return;
+
+ if (name) name = name + " ";
+ var handlerLine = "";
+ var creatorLine = "";
+ if (promiseCreated._trace) {
+ var traceLines = promiseCreated._trace.stack.split("\n");
+ var stack = cleanStack(traceLines);
+ for (var i = stack.length - 1; i >= 0; --i) {
+ var line = stack[i];
+ if (!nodeFramePattern.test(line)) {
+ var lineMatches = line.match(parseLinePattern);
+ if (lineMatches) {
+ handlerLine = "at " + lineMatches[1] +
+ ":" + lineMatches[2] + ":" + lineMatches[3] + " ";
+ }
+ break;
+ }
+ }
+
+ if (stack.length > 0) {
+ var firstUserLine = stack[0];
+ for (var i = 0; i < traceLines.length; ++i) {
+
+ if (traceLines[i] === firstUserLine) {
+ if (i > 0) {
+ creatorLine = "\n" + traceLines[i - 1];
+ }
+ break;
+ }
+ }
+
+ }
+ }
+ var msg = "a promise was created in a " + name +
+ "handler " + handlerLine + "but was not returned from it, " +
+ "see http://goo.gl/rRqMUw" +
+ creatorLine;
+ promise._warn(msg, true, promiseCreated);
+ }
+}
+
+function deprecated(name, replacement) {
+ var message = name +
+ " is deprecated and will be removed in a future version.";
+ if (replacement) message += " Use " + replacement + " instead.";
+ return warn(message);
+}
+
+function warn(message, shouldUseOwnTrace, promise) {
+ if (!config.warnings) return;
+ var warning = new Warning(message);
+ var ctx;
+ if (shouldUseOwnTrace) {
+ promise._attachExtraTrace(warning);
+ } else if (config.longStackTraces && (ctx = Promise._peekContext())) {
+ ctx.attachExtraTrace(warning);
+ } else {
+ var parsed = parseStackAndMessage(warning);
+ warning.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ }
+
+ if (!activeFireEvent("warning", warning)) {
+ formatAndLogError(warning, "", true);
+ }
+}
+
+function reconstructStack(message, stacks) {
+ for (var i = 0; i < stacks.length - 1; ++i) {
+ stacks[i].push("From previous event:");
+ stacks[i] = stacks[i].join("\n");
+ }
+ if (i < stacks.length) {
+ stacks[i] = stacks[i].join("\n");
+ }
+ return message + "\n" + stacks.join("\n");
+}
+
+function removeDuplicateOrEmptyJumps(stacks) {
+ for (var i = 0; i < stacks.length; ++i) {
+ if (stacks[i].length === 0 ||
+ ((i + 1 < stacks.length) && stacks[i][0] === stacks[i+1][0])) {
+ stacks.splice(i, 1);
+ i--;
+ }
+ }
+}
+
+function removeCommonRoots(stacks) {
+ var current = stacks[0];
+ for (var i = 1; i < stacks.length; ++i) {
+ var prev = stacks[i];
+ var currentLastIndex = current.length - 1;
+ var currentLastLine = current[currentLastIndex];
+ var commonRootMeetPoint = -1;
+
+ for (var j = prev.length - 1; j >= 0; --j) {
+ if (prev[j] === currentLastLine) {
+ commonRootMeetPoint = j;
+ break;
+ }
+ }
+
+ for (var j = commonRootMeetPoint; j >= 0; --j) {
+ var line = prev[j];
+ if (current[currentLastIndex] === line) {
+ current.pop();
+ currentLastIndex--;
+ } else {
+ break;
+ }
+ }
+ current = prev;
+ }
+}
+
+function cleanStack(stack) {
+ var ret = [];
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ var isTraceLine = " (No stack trace)" === line ||
+ stackFramePattern.test(line);
+ var isInternalFrame = isTraceLine && shouldIgnore(line);
+ if (isTraceLine && !isInternalFrame) {
+ if (indentStackFrames && line.charAt(0) !== " ") {
+ line = " " + line;
+ }
+ ret.push(line);
+ }
+ }
+ return ret;
+}
+
+function stackFramesAsArray(error) {
+ var stack = error.stack.replace(/\s+$/g, "").split("\n");
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ if (" (No stack trace)" === line || stackFramePattern.test(line)) {
+ break;
+ }
+ }
+ if (i > 0 && error.name != "SyntaxError") {
+ stack = stack.slice(i);
+ }
+ return stack;
+}
+
+function parseStackAndMessage(error) {
+ var stack = error.stack;
+ var message = error.toString();
+ stack = typeof stack === "string" && stack.length > 0
+ ? stackFramesAsArray(error) : [" (No stack trace)"];
+ return {
+ message: message,
+ stack: error.name == "SyntaxError" ? stack : cleanStack(stack)
+ };
+}
+
+function formatAndLogError(error, title, isSoft) {
+ if (typeof console !== "undefined") {
+ var message;
+ if (util.isObject(error)) {
+ var stack = error.stack;
+ message = title + formatStack(stack, error);
+ } else {
+ message = title + String(error);
+ }
+ if (typeof printWarning === "function") {
+ printWarning(message, isSoft);
+ } else if (typeof console.log === "function" ||
+ typeof console.log === "object") {
+ console.log(message);
+ }
+ }
+}
+
+function fireRejectionEvent(name, localHandler, reason, promise) {
+ var localEventFired = false;
+ try {
+ if (typeof localHandler === "function") {
+ localEventFired = true;
+ if (name === "rejectionHandled") {
+ localHandler(promise);
+ } else {
+ localHandler(reason, promise);
+ }
+ }
+ } catch (e) {
+ async.throwLater(e);
+ }
+
+ if (name === "unhandledRejection") {
+ if (!activeFireEvent(name, reason, promise) && !localEventFired) {
+ formatAndLogError(reason, "Unhandled rejection ");
+ }
+ } else {
+ activeFireEvent(name, promise);
+ }
+}
+
+function formatNonError(obj) {
+ var str;
+ if (typeof obj === "function") {
+ str = "[function " +
+ (obj.name || "anonymous") +
+ "]";
+ } else {
+ str = obj && typeof obj.toString === "function"
+ ? obj.toString() : util.toString(obj);
+ var ruselessToString = /\[object [a-zA-Z0-9$_]+\]/;
+ if (ruselessToString.test(str)) {
+ try {
+ var newStr = JSON.stringify(obj);
+ str = newStr;
+ }
+ catch(e) {
+
+ }
+ }
+ if (str.length === 0) {
+ str = "(empty array)";
+ }
+ }
+ return ("(<" + snip(str) + ">, no stack trace)");
+}
+
+function snip(str) {
+ var maxChars = 41;
+ if (str.length < maxChars) {
+ return str;
+ }
+ return str.substr(0, maxChars - 3) + "...";
+}
+
+function longStackTracesIsSupported() {
+ return typeof captureStackTrace === "function";
+}
+
+var shouldIgnore = function() { return false; };
+var parseLineInfoRegex = /[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;
+function parseLineInfo(line) {
+ var matches = line.match(parseLineInfoRegex);
+ if (matches) {
+ return {
+ fileName: matches[1],
+ line: parseInt(matches[2], 10)
+ };
+ }
+}
+
+function setBounds(firstLineError, lastLineError) {
+ if (!longStackTracesIsSupported()) return;
+ var firstStackLines = firstLineError.stack.split("\n");
+ var lastStackLines = lastLineError.stack.split("\n");
+ var firstIndex = -1;
+ var lastIndex = -1;
+ var firstFileName;
+ var lastFileName;
+ for (var i = 0; i < firstStackLines.length; ++i) {
+ var result = parseLineInfo(firstStackLines[i]);
+ if (result) {
+ firstFileName = result.fileName;
+ firstIndex = result.line;
+ break;
+ }
+ }
+ for (var i = 0; i < lastStackLines.length; ++i) {
+ var result = parseLineInfo(lastStackLines[i]);
+ if (result) {
+ lastFileName = result.fileName;
+ lastIndex = result.line;
+ break;
+ }
+ }
+ if (firstIndex < 0 || lastIndex < 0 || !firstFileName || !lastFileName ||
+ firstFileName !== lastFileName || firstIndex >= lastIndex) {
+ return;
+ }
+
+ shouldIgnore = function(line) {
+ if (bluebirdFramePattern.test(line)) return true;
+ var info = parseLineInfo(line);
+ if (info) {
+ if (info.fileName === firstFileName &&
+ (firstIndex <= info.line && info.line <= lastIndex)) {
+ return true;
+ }
+ }
+ return false;
+ };
+}
+
+function CapturedTrace(parent) {
+ this._parent = parent;
+ this._promisesCreated = 0;
+ var length = this._length = 1 + (parent === undefined ? 0 : parent._length);
+ captureStackTrace(this, CapturedTrace);
+ if (length > 32) this.uncycle();
+}
+util.inherits(CapturedTrace, Error);
+Context.CapturedTrace = CapturedTrace;
+
+CapturedTrace.prototype.uncycle = function() {
+ var length = this._length;
+ if (length < 2) return;
+ var nodes = [];
+ var stackToIndex = {};
+
+ for (var i = 0, node = this; node !== undefined; ++i) {
+ nodes.push(node);
+ node = node._parent;
+ }
+ length = this._length = i;
+ for (var i = length - 1; i >= 0; --i) {
+ var stack = nodes[i].stack;
+ if (stackToIndex[stack] === undefined) {
+ stackToIndex[stack] = i;
+ }
+ }
+ for (var i = 0; i < length; ++i) {
+ var currentStack = nodes[i].stack;
+ var index = stackToIndex[currentStack];
+ if (index !== undefined && index !== i) {
+ if (index > 0) {
+ nodes[index - 1]._parent = undefined;
+ nodes[index - 1]._length = 1;
+ }
+ nodes[i]._parent = undefined;
+ nodes[i]._length = 1;
+ var cycleEdgeNode = i > 0 ? nodes[i - 1] : this;
+
+ if (index < length - 1) {
+ cycleEdgeNode._parent = nodes[index + 1];
+ cycleEdgeNode._parent.uncycle();
+ cycleEdgeNode._length =
+ cycleEdgeNode._parent._length + 1;
+ } else {
+ cycleEdgeNode._parent = undefined;
+ cycleEdgeNode._length = 1;
+ }
+ var currentChildLength = cycleEdgeNode._length + 1;
+ for (var j = i - 2; j >= 0; --j) {
+ nodes[j]._length = currentChildLength;
+ currentChildLength++;
+ }
+ return;
+ }
+ }
+};
+
+CapturedTrace.prototype.attachExtraTrace = function(error) {
+ if (error.__stackCleaned__) return;
+ this.uncycle();
+ var parsed = parseStackAndMessage(error);
+ var message = parsed.message;
+ var stacks = [parsed.stack];
+
+ var trace = this;
+ while (trace !== undefined) {
+ stacks.push(cleanStack(trace.stack.split("\n")));
+ trace = trace._parent;
+ }
+ removeCommonRoots(stacks);
+ removeDuplicateOrEmptyJumps(stacks);
+ util.notEnumerableProp(error, "stack", reconstructStack(message, stacks));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+};
+
+var captureStackTrace = (function stackDetection() {
+ var v8stackFramePattern = /^\s*at\s*/;
+ var v8stackFormatter = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if (error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ if (typeof Error.stackTraceLimit === "number" &&
+ typeof Error.captureStackTrace === "function") {
+ Error.stackTraceLimit += 6;
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ var captureStackTrace = Error.captureStackTrace;
+
+ shouldIgnore = function(line) {
+ return bluebirdFramePattern.test(line);
+ };
+ return function(receiver, ignoreUntil) {
+ Error.stackTraceLimit += 6;
+ captureStackTrace(receiver, ignoreUntil);
+ Error.stackTraceLimit -= 6;
+ };
+ }
+ var err = new Error();
+
+ if (typeof err.stack === "string" &&
+ err.stack.split("\n")[0].indexOf("stackDetection@") >= 0) {
+ stackFramePattern = /@/;
+ formatStack = v8stackFormatter;
+ indentStackFrames = true;
+ return function captureStackTrace(o) {
+ o.stack = new Error().stack;
+ };
+ }
+
+ var hasStackAfterThrow;
+ try { throw new Error(); }
+ catch(e) {
+ hasStackAfterThrow = ("stack" in e);
+ }
+ if (!("stack" in err) && hasStackAfterThrow &&
+ typeof Error.stackTraceLimit === "number") {
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ return function captureStackTrace(o) {
+ Error.stackTraceLimit += 6;
+ try { throw new Error(); }
+ catch(e) { o.stack = e.stack; }
+ Error.stackTraceLimit -= 6;
+ };
+ }
+
+ formatStack = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if ((typeof error === "object" ||
+ typeof error === "function") &&
+ error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ return null;
+
+})([]);
+
+if (typeof console !== "undefined" && typeof console.warn !== "undefined") {
+ printWarning = function (message) {
+ console.warn(message);
+ };
+ if (util.isNode && process.stderr.isTTY) {
+ printWarning = function(message, isSoft) {
+ var color = isSoft ? "\u001b[33m" : "\u001b[31m";
+ console.warn(color + message + "\u001b[0m\n");
+ };
+ } else if (!util.isNode && typeof (new Error().stack) === "string") {
+ printWarning = function(message, isSoft) {
+ console.warn("%c" + message,
+ isSoft ? "color: darkorange" : "color: red");
+ };
+ }
+}
+
+var config = {
+ warnings: warnings,
+ longStackTraces: false,
+ cancellation: false,
+ monitoring: false
+};
+
+if (longStackTraces) Promise.longStackTraces();
+
+return {
+ longStackTraces: function() {
+ return config.longStackTraces;
+ },
+ warnings: function() {
+ return config.warnings;
+ },
+ cancellation: function() {
+ return config.cancellation;
+ },
+ monitoring: function() {
+ return config.monitoring;
+ },
+ propagateFromFunction: function() {
+ return propagateFromFunction;
+ },
+ boundValueFunction: function() {
+ return boundValueFunction;
+ },
+ checkForgottenReturns: checkForgottenReturns,
+ setBounds: setBounds,
+ warn: warn,
+ deprecated: deprecated,
+ CapturedTrace: CapturedTrace,
+ fireDomEvent: fireDomEvent,
+ fireGlobalEvent: fireGlobalEvent
+};
+};
+
+},{"./errors":9,"./util":21}],8:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function returner() {
+ return this.value;
+}
+function thrower() {
+ throw this.reason;
+}
+
+Promise.prototype["return"] =
+Promise.prototype.thenReturn = function (value) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ returner, undefined, undefined, {value: value}, undefined);
+};
+
+Promise.prototype["throw"] =
+Promise.prototype.thenThrow = function (reason) {
+ return this._then(
+ thrower, undefined, undefined, {reason: reason}, undefined);
+};
+
+Promise.prototype.catchThrow = function (reason) {
+ if (arguments.length <= 1) {
+ return this._then(
+ undefined, thrower, undefined, {reason: reason}, undefined);
+ } else {
+ var _reason = arguments[1];
+ var handler = function() {throw _reason;};
+ return this.caught(reason, handler);
+ }
+};
+
+Promise.prototype.catchReturn = function (value) {
+ if (arguments.length <= 1) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ undefined, returner, undefined, {value: value}, undefined);
+ } else {
+ var _value = arguments[1];
+ if (_value instanceof Promise) _value.suppressUnhandledRejections();
+ var handler = function() {return _value;};
+ return this.caught(value, handler);
+ }
+};
+};
+
+},{}],9:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5");
+var Objectfreeze = es5.freeze;
+var util = _dereq_("./util");
+var inherits = util.inherits;
+var notEnumerableProp = util.notEnumerableProp;
+
+function subError(nameProperty, defaultMessage) {
+ function SubError(message) {
+ if (!(this instanceof SubError)) return new SubError(message);
+ notEnumerableProp(this, "message",
+ typeof message === "string" ? message : defaultMessage);
+ notEnumerableProp(this, "name", nameProperty);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ Error.call(this);
+ }
+ }
+ inherits(SubError, Error);
+ return SubError;
+}
+
+var _TypeError, _RangeError;
+var Warning = subError("Warning", "warning");
+var CancellationError = subError("CancellationError", "cancellation error");
+var TimeoutError = subError("TimeoutError", "timeout error");
+var AggregateError = subError("AggregateError", "aggregate error");
+try {
+ _TypeError = TypeError;
+ _RangeError = RangeError;
+} catch(e) {
+ _TypeError = subError("TypeError", "type error");
+ _RangeError = subError("RangeError", "range error");
+}
+
+var methods = ("join pop push shift unshift slice filter forEach some " +
+ "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" ");
+
+for (var i = 0; i < methods.length; ++i) {
+ if (typeof Array.prototype[methods[i]] === "function") {
+ AggregateError.prototype[methods[i]] = Array.prototype[methods[i]];
+ }
+}
+
+es5.defineProperty(AggregateError.prototype, "length", {
+ value: 0,
+ configurable: false,
+ writable: true,
+ enumerable: true
+});
+AggregateError.prototype["isOperational"] = true;
+var level = 0;
+AggregateError.prototype.toString = function() {
+ var indent = Array(level * 4 + 1).join(" ");
+ var ret = "\n" + indent + "AggregateError of:" + "\n";
+ level++;
+ indent = Array(level * 4 + 1).join(" ");
+ for (var i = 0; i < this.length; ++i) {
+ var str = this[i] === this ? "[Circular AggregateError]" : this[i] + "";
+ var lines = str.split("\n");
+ for (var j = 0; j < lines.length; ++j) {
+ lines[j] = indent + lines[j];
+ }
+ str = lines.join("\n");
+ ret += str + "\n";
+ }
+ level--;
+ return ret;
+};
+
+function OperationalError(message) {
+ if (!(this instanceof OperationalError))
+ return new OperationalError(message);
+ notEnumerableProp(this, "name", "OperationalError");
+ notEnumerableProp(this, "message", message);
+ this.cause = message;
+ this["isOperational"] = true;
+
+ if (message instanceof Error) {
+ notEnumerableProp(this, "message", message.message);
+ notEnumerableProp(this, "stack", message.stack);
+ } else if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ }
+
+}
+inherits(OperationalError, Error);
+
+var errorTypes = Error["__BluebirdErrorTypes__"];
+if (!errorTypes) {
+ errorTypes = Objectfreeze({
+ CancellationError: CancellationError,
+ TimeoutError: TimeoutError,
+ OperationalError: OperationalError,
+ RejectionError: OperationalError,
+ AggregateError: AggregateError
+ });
+ es5.defineProperty(Error, "__BluebirdErrorTypes__", {
+ value: errorTypes,
+ writable: false,
+ enumerable: false,
+ configurable: false
+ });
+}
+
+module.exports = {
+ Error: Error,
+ TypeError: _TypeError,
+ RangeError: _RangeError,
+ CancellationError: errorTypes.CancellationError,
+ OperationalError: errorTypes.OperationalError,
+ TimeoutError: errorTypes.TimeoutError,
+ AggregateError: errorTypes.AggregateError,
+ Warning: Warning
+};
+
+},{"./es5":10,"./util":21}],10:[function(_dereq_,module,exports){
+var isES5 = (function(){
+ "use strict";
+ return this === undefined;
+})();
+
+if (isES5) {
+ module.exports = {
+ freeze: Object.freeze,
+ defineProperty: Object.defineProperty,
+ getDescriptor: Object.getOwnPropertyDescriptor,
+ keys: Object.keys,
+ names: Object.getOwnPropertyNames,
+ getPrototypeOf: Object.getPrototypeOf,
+ isArray: Array.isArray,
+ isES5: isES5,
+ propertyIsWritable: function(obj, prop) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop);
+ return !!(!descriptor || descriptor.writable || descriptor.set);
+ }
+ };
+} else {
+ var has = {}.hasOwnProperty;
+ var str = {}.toString;
+ var proto = {}.constructor.prototype;
+
+ var ObjectKeys = function (o) {
+ var ret = [];
+ for (var key in o) {
+ if (has.call(o, key)) {
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+
+ var ObjectGetDescriptor = function(o, key) {
+ return {value: o[key]};
+ };
+
+ var ObjectDefineProperty = function (o, key, desc) {
+ o[key] = desc.value;
+ return o;
+ };
+
+ var ObjectFreeze = function (obj) {
+ return obj;
+ };
+
+ var ObjectGetPrototypeOf = function (obj) {
+ try {
+ return Object(obj).constructor.prototype;
+ }
+ catch (e) {
+ return proto;
+ }
+ };
+
+ var ArrayIsArray = function (obj) {
+ try {
+ return str.call(obj) === "[object Array]";
+ }
+ catch(e) {
+ return false;
+ }
+ };
+
+ module.exports = {
+ isArray: ArrayIsArray,
+ keys: ObjectKeys,
+ names: ObjectKeys,
+ defineProperty: ObjectDefineProperty,
+ getDescriptor: ObjectGetDescriptor,
+ freeze: ObjectFreeze,
+ getPrototypeOf: ObjectGetPrototypeOf,
+ isES5: isES5,
+ propertyIsWritable: function() {
+ return true;
+ }
+ };
+}
+
+},{}],11:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, tryConvertToPromise, NEXT_FILTER) {
+var util = _dereq_("./util");
+var CancellationError = Promise.CancellationError;
+var errorObj = util.errorObj;
+var catchFilter = _dereq_("./catch_filter")(NEXT_FILTER);
+
+function PassThroughHandlerContext(promise, type, handler) {
+ this.promise = promise;
+ this.type = type;
+ this.handler = handler;
+ this.called = false;
+ this.cancelPromise = null;
+}
+
+PassThroughHandlerContext.prototype.isFinallyHandler = function() {
+ return this.type === 0;
+};
+
+function FinallyHandlerCancelReaction(finallyHandler) {
+ this.finallyHandler = finallyHandler;
+}
+
+FinallyHandlerCancelReaction.prototype._resultCancelled = function() {
+ checkCancel(this.finallyHandler);
+};
+
+function checkCancel(ctx, reason) {
+ if (ctx.cancelPromise != null) {
+ if (arguments.length > 1) {
+ ctx.cancelPromise._reject(reason);
+ } else {
+ ctx.cancelPromise._cancel();
+ }
+ ctx.cancelPromise = null;
+ return true;
+ }
+ return false;
+}
+
+function succeed() {
+ return finallyHandler.call(this, this.promise._target()._settledValue());
+}
+function fail(reason) {
+ if (checkCancel(this, reason)) return;
+ errorObj.e = reason;
+ return errorObj;
+}
+function finallyHandler(reasonOrValue) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ if (!this.called) {
+ this.called = true;
+ var ret = this.isFinallyHandler()
+ ? handler.call(promise._boundValue())
+ : handler.call(promise._boundValue(), reasonOrValue);
+ if (ret === NEXT_FILTER) {
+ return ret;
+ } else if (ret !== undefined) {
+ promise._setReturnedNonUndefined();
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ if (this.cancelPromise != null) {
+ if (maybePromise._isCancelled()) {
+ var reason =
+ new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ errorObj.e = reason;
+ return errorObj;
+ } else if (maybePromise.isPending()) {
+ maybePromise._attachCancellationCallback(
+ new FinallyHandlerCancelReaction(this));
+ }
+ }
+ return maybePromise._then(
+ succeed, fail, undefined, this, undefined);
+ }
+ }
+ }
+
+ if (promise.isRejected()) {
+ checkCancel(this);
+ errorObj.e = reasonOrValue;
+ return errorObj;
+ } else {
+ checkCancel(this);
+ return reasonOrValue;
+ }
+}
+
+Promise.prototype._passThrough = function(handler, type, success, fail) {
+ if (typeof handler !== "function") return this.then();
+ return this._then(success,
+ fail,
+ undefined,
+ new PassThroughHandlerContext(this, type, handler),
+ undefined);
+};
+
+Promise.prototype.lastly =
+Promise.prototype["finally"] = function (handler) {
+ return this._passThrough(handler,
+ 0,
+ finallyHandler,
+ finallyHandler);
+};
+
+
+Promise.prototype.tap = function (handler) {
+ return this._passThrough(handler, 1, finallyHandler);
+};
+
+Promise.prototype.tapCatch = function (handlerOrPredicate) {
+ var len = arguments.length;
+ if(len === 1) {
+ return this._passThrough(handlerOrPredicate,
+ 1,
+ undefined,
+ finallyHandler);
+ } else {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return Promise.reject(new TypeError(
+ "tapCatch statement predicate: "
+ + "expecting an object but got " + util.classString(item)
+ ));
+ }
+ }
+ catchInstances.length = j;
+ var handler = arguments[i];
+ return this._passThrough(catchFilter(catchInstances, handler, this),
+ 1,
+ undefined,
+ finallyHandler);
+ }
+
+};
+
+return PassThroughHandlerContext;
+};
+
+},{"./catch_filter":5,"./util":21}],12:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, PromiseArray, tryConvertToPromise, INTERNAL, async,
+ getDomain) {
+var util = _dereq_("./util");
+var canEvaluate = util.canEvaluate;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var reject;
+
+if (!true) {
+if (canEvaluate) {
+ var thenCallback = function(i) {
+ return new Function("value", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = value; \n\
+ holder.checkFulfillment(this); \n\
+ ".replace(/Index/g, i));
+ };
+
+ var promiseSetter = function(i) {
+ return new Function("promise", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = promise; \n\
+ ".replace(/Index/g, i));
+ };
+
+ var generateHolderClass = function(total) {
+ var props = new Array(total);
+ for (var i = 0; i < props.length; ++i) {
+ props[i] = "this.p" + (i+1);
+ }
+ var assignment = props.join(" = ") + " = null;";
+ var cancellationCode= "var promise;\n" + props.map(function(prop) {
+ return " \n\
+ promise = " + prop + "; \n\
+ if (promise instanceof Promise) { \n\
+ promise.cancel(); \n\
+ } \n\
+ ";
+ }).join("\n");
+ var passedArguments = props.join(", ");
+ var name = "Holder$" + total;
+
+
+ var code = "return function(tryCatch, errorObj, Promise, async) { \n\
+ 'use strict'; \n\
+ function [TheName](fn) { \n\
+ [TheProperties] \n\
+ this.fn = fn; \n\
+ this.asyncNeeded = true; \n\
+ this.now = 0; \n\
+ } \n\
+ \n\
+ [TheName].prototype._callFunction = function(promise) { \n\
+ promise._pushContext(); \n\
+ var ret = tryCatch(this.fn)([ThePassedArguments]); \n\
+ promise._popContext(); \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(ret.e, false); \n\
+ } else { \n\
+ promise._resolveCallback(ret); \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype.checkFulfillment = function(promise) { \n\
+ var now = ++this.now; \n\
+ if (now === [TheTotal]) { \n\
+ if (this.asyncNeeded) { \n\
+ async.invoke(this._callFunction, this, promise); \n\
+ } else { \n\
+ this._callFunction(promise); \n\
+ } \n\
+ \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype._resultCancelled = function() { \n\
+ [CancellationCode] \n\
+ }; \n\
+ \n\
+ return [TheName]; \n\
+ }(tryCatch, errorObj, Promise, async); \n\
+ ";
+
+ code = code.replace(/\[TheName\]/g, name)
+ .replace(/\[TheTotal\]/g, total)
+ .replace(/\[ThePassedArguments\]/g, passedArguments)
+ .replace(/\[TheProperties\]/g, assignment)
+ .replace(/\[CancellationCode\]/g, cancellationCode);
+
+ return new Function("tryCatch", "errorObj", "Promise", "async", code)
+ (tryCatch, errorObj, Promise, async);
+ };
+
+ var holderClasses = [];
+ var thenCallbacks = [];
+ var promiseSetters = [];
+
+ for (var i = 0; i < 8; ++i) {
+ holderClasses.push(generateHolderClass(i + 1));
+ thenCallbacks.push(thenCallback(i + 1));
+ promiseSetters.push(promiseSetter(i + 1));
+ }
+
+ reject = function (reason) {
+ this._reject(reason);
+ };
+}}
+
+Promise.join = function () {
+ var last = arguments.length - 1;
+ var fn;
+ if (last > 0 && typeof arguments[last] === "function") {
+ fn = arguments[last];
+ if (!true) {
+ if (last <= 8 && canEvaluate) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var HolderClass = holderClasses[last - 1];
+ var holder = new HolderClass(fn);
+ var callbacks = thenCallbacks;
+
+ for (var i = 0; i < last; ++i) {
+ var maybePromise = tryConvertToPromise(arguments[i], ret);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._then(callbacks[i], reject,
+ undefined, ret, holder);
+ promiseSetters[i](maybePromise, holder);
+ holder.asyncNeeded = false;
+ } else if (((bitField & 33554432) !== 0)) {
+ callbacks[i].call(ret,
+ maybePromise._value(), holder);
+ } else if (((bitField & 16777216) !== 0)) {
+ ret._reject(maybePromise._reason());
+ } else {
+ ret._cancel();
+ }
+ } else {
+ callbacks[i].call(ret, maybePromise, holder);
+ }
+ }
+
+ if (!ret._isFateSealed()) {
+ if (holder.asyncNeeded) {
+ var domain = getDomain();
+ if (domain !== null) {
+ holder.fn = util.domainBind(domain, holder.fn);
+ }
+ }
+ ret._setAsyncGuaranteed();
+ ret._setOnCancel(holder);
+ }
+ return ret;
+ }
+ }
+ }
+ var args = [].slice.call(arguments);;
+ if (fn) args.pop();
+ var ret = new PromiseArray(args).promise();
+ return fn !== undefined ? ret.spread(fn) : ret;
+};
+
+};
+
+},{"./util":21}],13:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, INTERNAL, tryConvertToPromise, apiRejection, debug) {
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+
+Promise.method = function (fn) {
+ if (typeof fn !== "function") {
+ throw new Promise.TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return function () {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = tryCatch(fn).apply(this, arguments);
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.method", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+ };
+};
+
+Promise.attempt = Promise["try"] = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value;
+ if (arguments.length > 1) {
+ debug.deprecated("calling Promise.try with more than 1 argument");
+ var arg = arguments[1];
+ var ctx = arguments[2];
+ value = util.isArray(arg) ? tryCatch(fn).apply(ctx, arg)
+ : tryCatch(fn).call(ctx, arg);
+ } else {
+ value = tryCatch(fn)();
+ }
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.try", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+};
+
+Promise.prototype._resolveFromSyncValue = function (value) {
+ if (value === util.errorObj) {
+ this._rejectCallback(value.e, false);
+ } else {
+ this._resolveCallback(value, true);
+ }
+};
+};
+
+},{"./util":21}],14:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util");
+var maybeWrapAsError = util.maybeWrapAsError;
+var errors = _dereq_("./errors");
+var OperationalError = errors.OperationalError;
+var es5 = _dereq_("./es5");
+
+function isUntypedError(obj) {
+ return obj instanceof Error &&
+ es5.getPrototypeOf(obj) === Error.prototype;
+}
+
+var rErrorKey = /^(?:name|message|stack|cause)$/;
+function wrapAsOperationalError(obj) {
+ var ret;
+ if (isUntypedError(obj)) {
+ ret = new OperationalError(obj);
+ ret.name = obj.name;
+ ret.message = obj.message;
+ ret.stack = obj.stack;
+ var keys = es5.keys(obj);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (!rErrorKey.test(key)) {
+ ret[key] = obj[key];
+ }
+ }
+ return ret;
+ }
+ util.markAsOriginatingFromRejection(obj);
+ return obj;
+}
+
+function nodebackForPromise(promise, multiArgs) {
+ return function(err, value) {
+ if (promise === null) return;
+ if (err) {
+ var wrapped = wrapAsOperationalError(maybeWrapAsError(err));
+ promise._attachExtraTrace(wrapped);
+ promise._reject(wrapped);
+ } else if (!multiArgs) {
+ promise._fulfill(value);
+ } else {
+ var args = [].slice.call(arguments, 1);;
+ promise._fulfill(args);
+ }
+ promise = null;
+ };
+}
+
+module.exports = nodebackForPromise;
+
+},{"./errors":9,"./es5":10,"./util":21}],15:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function() {
+var makeSelfResolutionError = function () {
+ return new TypeError("circular promise resolution chain\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var reflectHandler = function() {
+ return new Promise.PromiseInspection(this._target());
+};
+var apiRejection = function(msg) {
+ return Promise.reject(new TypeError(msg));
+};
+function Proxyable() {}
+var UNDEFINED_BINDING = {};
+var util = _dereq_("./util");
+
+var getDomain;
+if (util.isNode) {
+ getDomain = function() {
+ var ret = process.domain;
+ if (ret === undefined) ret = null;
+ return ret;
+ };
+} else {
+ getDomain = function() {
+ return null;
+ };
+}
+util.notEnumerableProp(Promise, "_getDomain", getDomain);
+
+var es5 = _dereq_("./es5");
+var Async = _dereq_("./async");
+var async = new Async();
+es5.defineProperty(Promise, "_async", {value: async});
+var errors = _dereq_("./errors");
+var TypeError = Promise.TypeError = errors.TypeError;
+Promise.RangeError = errors.RangeError;
+var CancellationError = Promise.CancellationError = errors.CancellationError;
+Promise.TimeoutError = errors.TimeoutError;
+Promise.OperationalError = errors.OperationalError;
+Promise.RejectionError = errors.OperationalError;
+Promise.AggregateError = errors.AggregateError;
+var INTERNAL = function(){};
+var APPLY = {};
+var NEXT_FILTER = {};
+var tryConvertToPromise = _dereq_("./thenables")(Promise, INTERNAL);
+var PromiseArray =
+ _dereq_("./promise_array")(Promise, INTERNAL,
+ tryConvertToPromise, apiRejection, Proxyable);
+var Context = _dereq_("./context")(Promise);
+ /*jshint unused:false*/
+var createContext = Context.create;
+var debug = _dereq_("./debuggability")(Promise, Context);
+var CapturedTrace = debug.CapturedTrace;
+var PassThroughHandlerContext =
+ _dereq_("./finally")(Promise, tryConvertToPromise, NEXT_FILTER);
+var catchFilter = _dereq_("./catch_filter")(NEXT_FILTER);
+var nodebackForPromise = _dereq_("./nodeback");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+function check(self, executor) {
+ if (self == null || self.constructor !== Promise) {
+ throw new TypeError("the promise constructor cannot be invoked directly\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (typeof executor !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(executor));
+ }
+
+}
+
+function Promise(executor) {
+ if (executor !== INTERNAL) {
+ check(this, executor);
+ }
+ this._bitField = 0;
+ this._fulfillmentHandler0 = undefined;
+ this._rejectionHandler0 = undefined;
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._resolveFromExecutor(executor);
+ this._promiseCreated();
+ this._fireEvent("promiseCreated", this);
+}
+
+Promise.prototype.toString = function () {
+ return "[object Promise]";
+};
+
+Promise.prototype.caught = Promise.prototype["catch"] = function (fn) {
+ var len = arguments.length;
+ if (len > 1) {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return apiRejection("Catch statement predicate: " +
+ "expecting an object but got " + util.classString(item));
+ }
+ }
+ catchInstances.length = j;
+ fn = arguments[i];
+ return this.then(undefined, catchFilter(catchInstances, fn, this));
+ }
+ return this.then(undefined, fn);
+};
+
+Promise.prototype.reflect = function () {
+ return this._then(reflectHandler,
+ reflectHandler, undefined, this, undefined);
+};
+
+Promise.prototype.then = function (didFulfill, didReject) {
+ if (debug.warnings() && arguments.length > 0 &&
+ typeof didFulfill !== "function" &&
+ typeof didReject !== "function") {
+ var msg = ".then() only accepts functions but was passed: " +
+ util.classString(didFulfill);
+ if (arguments.length > 1) {
+ msg += ", " + util.classString(didReject);
+ }
+ this._warn(msg);
+ }
+ return this._then(didFulfill, didReject, undefined, undefined, undefined);
+};
+
+Promise.prototype.done = function (didFulfill, didReject) {
+ var promise =
+ this._then(didFulfill, didReject, undefined, undefined, undefined);
+ promise._setIsFinal();
+};
+
+Promise.prototype.spread = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ return this.all()._then(fn, undefined, undefined, APPLY, undefined);
+};
+
+Promise.prototype.toJSON = function () {
+ var ret = {
+ isFulfilled: false,
+ isRejected: false,
+ fulfillmentValue: undefined,
+ rejectionReason: undefined
+ };
+ if (this.isFulfilled()) {
+ ret.fulfillmentValue = this.value();
+ ret.isFulfilled = true;
+ } else if (this.isRejected()) {
+ ret.rejectionReason = this.reason();
+ ret.isRejected = true;
+ }
+ return ret;
+};
+
+Promise.prototype.all = function () {
+ if (arguments.length > 0) {
+ this._warn(".all() was passed arguments but it does not take any");
+ }
+ return new PromiseArray(this).promise();
+};
+
+Promise.prototype.error = function (fn) {
+ return this.caught(util.originatesFromRejection, fn);
+};
+
+Promise.getNewLibraryCopy = module.exports;
+
+Promise.is = function (val) {
+ return val instanceof Promise;
+};
+
+Promise.fromNode = Promise.fromCallback = function(fn) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var multiArgs = arguments.length > 1 ? !!Object(arguments[1]).multiArgs
+ : false;
+ var result = tryCatch(fn)(nodebackForPromise(ret, multiArgs));
+ if (result === errorObj) {
+ ret._rejectCallback(result.e, true);
+ }
+ if (!ret._isFateSealed()) ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.all = function (promises) {
+ return new PromiseArray(promises).promise();
+};
+
+Promise.cast = function (obj) {
+ var ret = tryConvertToPromise(obj);
+ if (!(ret instanceof Promise)) {
+ ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._setFulfilled();
+ ret._rejectionHandler0 = obj;
+ }
+ return ret;
+};
+
+Promise.resolve = Promise.fulfilled = Promise.cast;
+
+Promise.reject = Promise.rejected = function (reason) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._rejectCallback(reason, true);
+ return ret;
+};
+
+Promise.setScheduler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return async.setScheduler(fn);
+};
+
+Promise.prototype._then = function (
+ didFulfill,
+ didReject,
+ _, receiver,
+ internalData
+) {
+ var haveInternalData = internalData !== undefined;
+ var promise = haveInternalData ? internalData : new Promise(INTERNAL);
+ var target = this._target();
+ var bitField = target._bitField;
+
+ if (!haveInternalData) {
+ promise._propagateFrom(this, 3);
+ promise._captureStackTrace();
+ if (receiver === undefined &&
+ ((this._bitField & 2097152) !== 0)) {
+ if (!((bitField & 50397184) === 0)) {
+ receiver = this._boundValue();
+ } else {
+ receiver = target === this ? undefined : this._boundTo;
+ }
+ }
+ this._fireEvent("promiseChained", this, promise);
+ }
+
+ var domain = getDomain();
+ if (!((bitField & 50397184) === 0)) {
+ var handler, value, settler = target._settlePromiseCtx;
+ if (((bitField & 33554432) !== 0)) {
+ value = target._rejectionHandler0;
+ handler = didFulfill;
+ } else if (((bitField & 16777216) !== 0)) {
+ value = target._fulfillmentHandler0;
+ handler = didReject;
+ target._unsetRejectionIsUnhandled();
+ } else {
+ settler = target._settlePromiseLateCancellationObserver;
+ value = new CancellationError("late cancellation observer");
+ target._attachExtraTrace(value);
+ handler = didReject;
+ }
+
+ async.invoke(settler, target, {
+ handler: domain === null ? handler
+ : (typeof handler === "function" &&
+ util.domainBind(domain, handler)),
+ promise: promise,
+ receiver: receiver,
+ value: value
+ });
+ } else {
+ target._addCallbacks(didFulfill, didReject, promise, receiver, domain);
+ }
+
+ return promise;
+};
+
+Promise.prototype._length = function () {
+ return this._bitField & 65535;
+};
+
+Promise.prototype._isFateSealed = function () {
+ return (this._bitField & 117506048) !== 0;
+};
+
+Promise.prototype._isFollowing = function () {
+ return (this._bitField & 67108864) === 67108864;
+};
+
+Promise.prototype._setLength = function (len) {
+ this._bitField = (this._bitField & -65536) |
+ (len & 65535);
+};
+
+Promise.prototype._setFulfilled = function () {
+ this._bitField = this._bitField | 33554432;
+ this._fireEvent("promiseFulfilled", this);
+};
+
+Promise.prototype._setRejected = function () {
+ this._bitField = this._bitField | 16777216;
+ this._fireEvent("promiseRejected", this);
+};
+
+Promise.prototype._setFollowing = function () {
+ this._bitField = this._bitField | 67108864;
+ this._fireEvent("promiseResolved", this);
+};
+
+Promise.prototype._setIsFinal = function () {
+ this._bitField = this._bitField | 4194304;
+};
+
+Promise.prototype._isFinal = function () {
+ return (this._bitField & 4194304) > 0;
+};
+
+Promise.prototype._unsetCancelled = function() {
+ this._bitField = this._bitField & (~65536);
+};
+
+Promise.prototype._setCancelled = function() {
+ this._bitField = this._bitField | 65536;
+ this._fireEvent("promiseCancelled", this);
+};
+
+Promise.prototype._setWillBeCancelled = function() {
+ this._bitField = this._bitField | 8388608;
+};
+
+Promise.prototype._setAsyncGuaranteed = function() {
+ if (async.hasCustomScheduler()) return;
+ this._bitField = this._bitField | 134217728;
+};
+
+Promise.prototype._receiverAt = function (index) {
+ var ret = index === 0 ? this._receiver0 : this[
+ index * 4 - 4 + 3];
+ if (ret === UNDEFINED_BINDING) {
+ return undefined;
+ } else if (ret === undefined && this._isBound()) {
+ return this._boundValue();
+ }
+ return ret;
+};
+
+Promise.prototype._promiseAt = function (index) {
+ return this[
+ index * 4 - 4 + 2];
+};
+
+Promise.prototype._fulfillmentHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 0];
+};
+
+Promise.prototype._rejectionHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 1];
+};
+
+Promise.prototype._boundValue = function() {};
+
+Promise.prototype._migrateCallback0 = function (follower) {
+ var bitField = follower._bitField;
+ var fulfill = follower._fulfillmentHandler0;
+ var reject = follower._rejectionHandler0;
+ var promise = follower._promise0;
+ var receiver = follower._receiverAt(0);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._migrateCallbackAt = function (follower, index) {
+ var fulfill = follower._fulfillmentHandlerAt(index);
+ var reject = follower._rejectionHandlerAt(index);
+ var promise = follower._promiseAt(index);
+ var receiver = follower._receiverAt(index);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._addCallbacks = function (
+ fulfill,
+ reject,
+ promise,
+ receiver,
+ domain
+) {
+ var index = this._length();
+
+ if (index >= 65535 - 4) {
+ index = 0;
+ this._setLength(0);
+ }
+
+ if (index === 0) {
+ this._promise0 = promise;
+ this._receiver0 = receiver;
+ if (typeof fulfill === "function") {
+ this._fulfillmentHandler0 =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this._rejectionHandler0 =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ } else {
+ var base = index * 4 - 4;
+ this[base + 2] = promise;
+ this[base + 3] = receiver;
+ if (typeof fulfill === "function") {
+ this[base + 0] =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this[base + 1] =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ }
+ this._setLength(index + 1);
+ return index;
+};
+
+Promise.prototype._proxy = function (proxyable, arg) {
+ this._addCallbacks(undefined, undefined, arg, proxyable, null);
+};
+
+Promise.prototype._resolveCallback = function(value, shouldBind) {
+ if (((this._bitField & 117506048) !== 0)) return;
+ if (value === this)
+ return this._rejectCallback(makeSelfResolutionError(), false);
+ var maybePromise = tryConvertToPromise(value, this);
+ if (!(maybePromise instanceof Promise)) return this._fulfill(value);
+
+ if (shouldBind) this._propagateFrom(maybePromise, 2);
+
+ var promise = maybePromise._target();
+
+ if (promise === this) {
+ this._reject(makeSelfResolutionError());
+ return;
+ }
+
+ var bitField = promise._bitField;
+ if (((bitField & 50397184) === 0)) {
+ var len = this._length();
+ if (len > 0) promise._migrateCallback0(this);
+ for (var i = 1; i < len; ++i) {
+ promise._migrateCallbackAt(this, i);
+ }
+ this._setFollowing();
+ this._setLength(0);
+ this._setFollowee(promise);
+ } else if (((bitField & 33554432) !== 0)) {
+ this._fulfill(promise._value());
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(promise._reason());
+ } else {
+ var reason = new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ this._reject(reason);
+ }
+};
+
+Promise.prototype._rejectCallback =
+function(reason, synchronous, ignoreNonErrorWarnings) {
+ var trace = util.ensureErrorObject(reason);
+ var hasStack = trace === reason;
+ if (!hasStack && !ignoreNonErrorWarnings && debug.warnings()) {
+ var message = "a promise was rejected with a non-error: " +
+ util.classString(reason);
+ this._warn(message, true);
+ }
+ this._attachExtraTrace(trace, synchronous ? hasStack : false);
+ this._reject(reason);
+};
+
+Promise.prototype._resolveFromExecutor = function (executor) {
+ if (executor === INTERNAL) return;
+ var promise = this;
+ this._captureStackTrace();
+ this._pushContext();
+ var synchronous = true;
+ var r = this._execute(executor, function(value) {
+ promise._resolveCallback(value);
+ }, function (reason) {
+ promise._rejectCallback(reason, synchronous);
+ });
+ synchronous = false;
+ this._popContext();
+
+ if (r !== undefined) {
+ promise._rejectCallback(r, true);
+ }
+};
+
+Promise.prototype._settlePromiseFromHandler = function (
+ handler, receiver, value, promise
+) {
+ var bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+ promise._pushContext();
+ var x;
+ if (receiver === APPLY) {
+ if (!value || typeof value.length !== "number") {
+ x = errorObj;
+ x.e = new TypeError("cannot .spread() a non-array: " +
+ util.classString(value));
+ } else {
+ x = tryCatch(handler).apply(this._boundValue(), value);
+ }
+ } else {
+ x = tryCatch(handler).call(receiver, value);
+ }
+ var promiseCreated = promise._popContext();
+ bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+
+ if (x === NEXT_FILTER) {
+ promise._reject(value);
+ } else if (x === errorObj) {
+ promise._rejectCallback(x.e, false);
+ } else {
+ debug.checkForgottenReturns(x, promiseCreated, "", promise, this);
+ promise._resolveCallback(x);
+ }
+};
+
+Promise.prototype._target = function() {
+ var ret = this;
+ while (ret._isFollowing()) ret = ret._followee();
+ return ret;
+};
+
+Promise.prototype._followee = function() {
+ return this._rejectionHandler0;
+};
+
+Promise.prototype._setFollowee = function(promise) {
+ this._rejectionHandler0 = promise;
+};
+
+Promise.prototype._settlePromise = function(promise, handler, receiver, value) {
+ var isPromise = promise instanceof Promise;
+ var bitField = this._bitField;
+ var asyncGuaranteed = ((bitField & 134217728) !== 0);
+ if (((bitField & 65536) !== 0)) {
+ if (isPromise) promise._invokeInternalOnCancel();
+
+ if (receiver instanceof PassThroughHandlerContext &&
+ receiver.isFinallyHandler()) {
+ receiver.cancelPromise = promise;
+ if (tryCatch(handler).call(receiver, value) === errorObj) {
+ promise._reject(errorObj.e);
+ }
+ } else if (handler === reflectHandler) {
+ promise._fulfill(reflectHandler.call(receiver));
+ } else if (receiver instanceof Proxyable) {
+ receiver._promiseCancelled(promise);
+ } else if (isPromise || promise instanceof PromiseArray) {
+ promise._cancel();
+ } else {
+ receiver.cancel();
+ }
+ } else if (typeof handler === "function") {
+ if (!isPromise) {
+ handler.call(receiver, value, promise);
+ } else {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (receiver instanceof Proxyable) {
+ if (!receiver._isResolved()) {
+ if (((bitField & 33554432) !== 0)) {
+ receiver._promiseFulfilled(value, promise);
+ } else {
+ receiver._promiseRejected(value, promise);
+ }
+ }
+ } else if (isPromise) {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ if (((bitField & 33554432) !== 0)) {
+ promise._fulfill(value);
+ } else {
+ promise._reject(value);
+ }
+ }
+};
+
+Promise.prototype._settlePromiseLateCancellationObserver = function(ctx) {
+ var handler = ctx.handler;
+ var promise = ctx.promise;
+ var receiver = ctx.receiver;
+ var value = ctx.value;
+ if (typeof handler === "function") {
+ if (!(promise instanceof Promise)) {
+ handler.call(receiver, value, promise);
+ } else {
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (promise instanceof Promise) {
+ promise._reject(value);
+ }
+};
+
+Promise.prototype._settlePromiseCtx = function(ctx) {
+ this._settlePromise(ctx.promise, ctx.handler, ctx.receiver, ctx.value);
+};
+
+Promise.prototype._settlePromise0 = function(handler, value, bitField) {
+ var promise = this._promise0;
+ var receiver = this._receiverAt(0);
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._settlePromise(promise, handler, receiver, value);
+};
+
+Promise.prototype._clearCallbackDataAtIndex = function(index) {
+ var base = index * 4 - 4;
+ this[base + 2] =
+ this[base + 3] =
+ this[base + 0] =
+ this[base + 1] = undefined;
+};
+
+Promise.prototype._fulfill = function (value) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ if (value === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._reject(err);
+ }
+ this._setFulfilled();
+ this._rejectionHandler0 = value;
+
+ if ((bitField & 65535) > 0) {
+ if (((bitField & 134217728) !== 0)) {
+ this._settlePromises();
+ } else {
+ async.settlePromises(this);
+ }
+ }
+};
+
+Promise.prototype._reject = function (reason) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ this._setRejected();
+ this._fulfillmentHandler0 = reason;
+
+ if (this._isFinal()) {
+ return async.fatalError(reason, util.isNode);
+ }
+
+ if ((bitField & 65535) > 0) {
+ async.settlePromises(this);
+ } else {
+ this._ensurePossibleRejectionHandled();
+ }
+};
+
+Promise.prototype._fulfillPromises = function (len, value) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._fulfillmentHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, value);
+ }
+};
+
+Promise.prototype._rejectPromises = function (len, reason) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._rejectionHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, reason);
+ }
+};
+
+Promise.prototype._settlePromises = function () {
+ var bitField = this._bitField;
+ var len = (bitField & 65535);
+
+ if (len > 0) {
+ if (((bitField & 16842752) !== 0)) {
+ var reason = this._fulfillmentHandler0;
+ this._settlePromise0(this._rejectionHandler0, reason, bitField);
+ this._rejectPromises(len, reason);
+ } else {
+ var value = this._rejectionHandler0;
+ this._settlePromise0(this._fulfillmentHandler0, value, bitField);
+ this._fulfillPromises(len, value);
+ }
+ this._setLength(0);
+ }
+ this._clearCancellationData();
+};
+
+Promise.prototype._settledValue = function() {
+ var bitField = this._bitField;
+ if (((bitField & 33554432) !== 0)) {
+ return this._rejectionHandler0;
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._fulfillmentHandler0;
+ }
+};
+
+function deferResolve(v) {this.promise._resolveCallback(v);}
+function deferReject(v) {this.promise._rejectCallback(v, false);}
+
+Promise.defer = Promise.pending = function() {
+ debug.deprecated("Promise.defer", "new Promise");
+ var promise = new Promise(INTERNAL);
+ return {
+ promise: promise,
+ resolve: deferResolve,
+ reject: deferReject
+ };
+};
+
+util.notEnumerableProp(Promise,
+ "_makeSelfResolutionError",
+ makeSelfResolutionError);
+
+_dereq_("./method")(Promise, INTERNAL, tryConvertToPromise, apiRejection,
+ debug);
+_dereq_("./bind")(Promise, INTERNAL, tryConvertToPromise, debug);
+_dereq_("./cancel")(Promise, PromiseArray, apiRejection, debug);
+_dereq_("./direct_resolve")(Promise);
+_dereq_("./synchronous_inspection")(Promise);
+_dereq_("./join")(
+ Promise, PromiseArray, tryConvertToPromise, INTERNAL, async, getDomain);
+Promise.Promise = Promise;
+Promise.version = "3.5.1";
+
+ util.toFastProperties(Promise);
+ util.toFastProperties(Promise.prototype);
+ function fillTypes(value) {
+ var p = new Promise(INTERNAL);
+ p._fulfillmentHandler0 = value;
+ p._rejectionHandler0 = value;
+ p._promise0 = value;
+ p._receiver0 = value;
+ }
+ // Complete slack tracking, opt out of field-type tracking and
+ // stabilize map
+ fillTypes({a: 1});
+ fillTypes({b: 2});
+ fillTypes({c: 3});
+ fillTypes(1);
+ fillTypes(function(){});
+ fillTypes(undefined);
+ fillTypes(false);
+ fillTypes(new Promise(INTERNAL));
+ debug.setBounds(Async.firstLineError, util.lastLineError);
+ return Promise;
+
+};
+
+},{"./async":1,"./bind":2,"./cancel":4,"./catch_filter":5,"./context":6,"./debuggability":7,"./direct_resolve":8,"./errors":9,"./es5":10,"./finally":11,"./join":12,"./method":13,"./nodeback":14,"./promise_array":16,"./synchronous_inspection":19,"./thenables":20,"./util":21}],16:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise,
+ apiRejection, Proxyable) {
+var util = _dereq_("./util");
+var isArray = util.isArray;
+
+function toResolutionValue(val) {
+ switch(val) {
+ case -2: return [];
+ case -3: return {};
+ case -6: return new Map();
+ }
+}
+
+function PromiseArray(values) {
+ var promise = this._promise = new Promise(INTERNAL);
+ if (values instanceof Promise) {
+ promise._propagateFrom(values, 3);
+ }
+ promise._setOnCancel(this);
+ this._values = values;
+ this._length = 0;
+ this._totalResolved = 0;
+ this._init(undefined, -2);
+}
+util.inherits(PromiseArray, Proxyable);
+
+PromiseArray.prototype.length = function () {
+ return this._length;
+};
+
+PromiseArray.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseArray.prototype._init = function init(_, resolveValueIfEmpty) {
+ var values = tryConvertToPromise(this._values, this._promise);
+ if (values instanceof Promise) {
+ values = values._target();
+ var bitField = values._bitField;
+ ;
+ this._values = values;
+
+ if (((bitField & 50397184) === 0)) {
+ this._promise._setAsyncGuaranteed();
+ return values._then(
+ init,
+ this._reject,
+ undefined,
+ this,
+ resolveValueIfEmpty
+ );
+ } else if (((bitField & 33554432) !== 0)) {
+ values = values._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._reject(values._reason());
+ } else {
+ return this._cancel();
+ }
+ }
+ values = util.asArray(values);
+ if (values === null) {
+ var err = apiRejection(
+ "expecting an array or an iterable object but got " + util.classString(values)).reason();
+ this._promise._rejectCallback(err, false);
+ return;
+ }
+
+ if (values.length === 0) {
+ if (resolveValueIfEmpty === -5) {
+ this._resolveEmptyArray();
+ }
+ else {
+ this._resolve(toResolutionValue(resolveValueIfEmpty));
+ }
+ return;
+ }
+ this._iterate(values);
+};
+
+PromiseArray.prototype._iterate = function(values) {
+ var len = this.getActualLength(values.length);
+ this._length = len;
+ this._values = this.shouldCopyValues() ? new Array(len) : this._values;
+ var result = this._promise;
+ var isResolved = false;
+ var bitField = null;
+ for (var i = 0; i < len; ++i) {
+ var maybePromise = tryConvertToPromise(values[i], result);
+
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ bitField = maybePromise._bitField;
+ } else {
+ bitField = null;
+ }
+
+ if (isResolved) {
+ if (bitField !== null) {
+ maybePromise.suppressUnhandledRejections();
+ }
+ } else if (bitField !== null) {
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._proxy(this, i);
+ this._values[i] = maybePromise;
+ } else if (((bitField & 33554432) !== 0)) {
+ isResolved = this._promiseFulfilled(maybePromise._value(), i);
+ } else if (((bitField & 16777216) !== 0)) {
+ isResolved = this._promiseRejected(maybePromise._reason(), i);
+ } else {
+ isResolved = this._promiseCancelled(i);
+ }
+ } else {
+ isResolved = this._promiseFulfilled(maybePromise, i);
+ }
+ }
+ if (!isResolved) result._setAsyncGuaranteed();
+};
+
+PromiseArray.prototype._isResolved = function () {
+ return this._values === null;
+};
+
+PromiseArray.prototype._resolve = function (value) {
+ this._values = null;
+ this._promise._fulfill(value);
+};
+
+PromiseArray.prototype._cancel = function() {
+ if (this._isResolved() || !this._promise._isCancellable()) return;
+ this._values = null;
+ this._promise._cancel();
+};
+
+PromiseArray.prototype._reject = function (reason) {
+ this._values = null;
+ this._promise._rejectCallback(reason, false);
+};
+
+PromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+PromiseArray.prototype._promiseCancelled = function() {
+ this._cancel();
+ return true;
+};
+
+PromiseArray.prototype._promiseRejected = function (reason) {
+ this._totalResolved++;
+ this._reject(reason);
+ return true;
+};
+
+PromiseArray.prototype._resultCancelled = function() {
+ if (this._isResolved()) return;
+ var values = this._values;
+ this._cancel();
+ if (values instanceof Promise) {
+ values.cancel();
+ } else {
+ for (var i = 0; i < values.length; ++i) {
+ if (values[i] instanceof Promise) {
+ values[i].cancel();
+ }
+ }
+ }
+};
+
+PromiseArray.prototype.shouldCopyValues = function () {
+ return true;
+};
+
+PromiseArray.prototype.getActualLength = function (len) {
+ return len;
+};
+
+return PromiseArray;
+};
+
+},{"./util":21}],17:[function(_dereq_,module,exports){
+"use strict";
+function arrayMove(src, srcIndex, dst, dstIndex, len) {
+ for (var j = 0; j < len; ++j) {
+ dst[j + dstIndex] = src[j + srcIndex];
+ src[j + srcIndex] = void 0;
+ }
+}
+
+function Queue(capacity) {
+ this._capacity = capacity;
+ this._length = 0;
+ this._front = 0;
+}
+
+Queue.prototype._willBeOverCapacity = function (size) {
+ return this._capacity < size;
+};
+
+Queue.prototype._pushOne = function (arg) {
+ var length = this.length();
+ this._checkCapacity(length + 1);
+ var i = (this._front + length) & (this._capacity - 1);
+ this[i] = arg;
+ this._length = length + 1;
+};
+
+Queue.prototype.push = function (fn, receiver, arg) {
+ var length = this.length() + 3;
+ if (this._willBeOverCapacity(length)) {
+ this._pushOne(fn);
+ this._pushOne(receiver);
+ this._pushOne(arg);
+ return;
+ }
+ var j = this._front + length - 3;
+ this._checkCapacity(length);
+ var wrapMask = this._capacity - 1;
+ this[(j + 0) & wrapMask] = fn;
+ this[(j + 1) & wrapMask] = receiver;
+ this[(j + 2) & wrapMask] = arg;
+ this._length = length;
+};
+
+Queue.prototype.shift = function () {
+ var front = this._front,
+ ret = this[front];
+
+ this[front] = undefined;
+ this._front = (front + 1) & (this._capacity - 1);
+ this._length--;
+ return ret;
+};
+
+Queue.prototype.length = function () {
+ return this._length;
+};
+
+Queue.prototype._checkCapacity = function (size) {
+ if (this._capacity < size) {
+ this._resizeTo(this._capacity << 1);
+ }
+};
+
+Queue.prototype._resizeTo = function (capacity) {
+ var oldCapacity = this._capacity;
+ this._capacity = capacity;
+ var front = this._front;
+ var length = this._length;
+ var moveItemsCount = (front + length) & (oldCapacity - 1);
+ arrayMove(this, 0, this, oldCapacity, moveItemsCount);
+};
+
+module.exports = Queue;
+
+},{}],18:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util");
+var schedule;
+var noAsyncScheduler = function() {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var NativePromise = util.getNativePromise();
+if (util.isNode && typeof MutationObserver === "undefined") {
+ var GlobalSetImmediate = global.setImmediate;
+ var ProcessNextTick = process.nextTick;
+ schedule = util.isRecentNode
+ ? function(fn) { GlobalSetImmediate.call(global, fn); }
+ : function(fn) { ProcessNextTick.call(process, fn); };
+} else if (typeof NativePromise === "function" &&
+ typeof NativePromise.resolve === "function") {
+ var nativePromise = NativePromise.resolve();
+ schedule = function(fn) {
+ nativePromise.then(fn);
+ };
+} else if ((typeof MutationObserver !== "undefined") &&
+ !(typeof window !== "undefined" &&
+ window.navigator &&
+ (window.navigator.standalone || window.cordova))) {
+ schedule = (function() {
+ var div = document.createElement("div");
+ var opts = {attributes: true};
+ var toggleScheduled = false;
+ var div2 = document.createElement("div");
+ var o2 = new MutationObserver(function() {
+ div.classList.toggle("foo");
+ toggleScheduled = false;
+ });
+ o2.observe(div2, opts);
+
+ var scheduleToggle = function() {
+ if (toggleScheduled) return;
+ toggleScheduled = true;
+ div2.classList.toggle("foo");
+ };
+
+ return function schedule(fn) {
+ var o = new MutationObserver(function() {
+ o.disconnect();
+ fn();
+ });
+ o.observe(div, opts);
+ scheduleToggle();
+ };
+ })();
+} else if (typeof setImmediate !== "undefined") {
+ schedule = function (fn) {
+ setImmediate(fn);
+ };
+} else if (typeof setTimeout !== "undefined") {
+ schedule = function (fn) {
+ setTimeout(fn, 0);
+ };
+} else {
+ schedule = noAsyncScheduler;
+}
+module.exports = schedule;
+
+},{"./util":21}],19:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function PromiseInspection(promise) {
+ if (promise !== undefined) {
+ promise = promise._target();
+ this._bitField = promise._bitField;
+ this._settledValueField = promise._isFateSealed()
+ ? promise._settledValue() : undefined;
+ }
+ else {
+ this._bitField = 0;
+ this._settledValueField = undefined;
+ }
+}
+
+PromiseInspection.prototype._settledValue = function() {
+ return this._settledValueField;
+};
+
+var value = PromiseInspection.prototype.value = function () {
+ if (!this.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var reason = PromiseInspection.prototype.error =
+PromiseInspection.prototype.reason = function () {
+ if (!this.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var isFulfilled = PromiseInspection.prototype.isFulfilled = function() {
+ return (this._bitField & 33554432) !== 0;
+};
+
+var isRejected = PromiseInspection.prototype.isRejected = function () {
+ return (this._bitField & 16777216) !== 0;
+};
+
+var isPending = PromiseInspection.prototype.isPending = function () {
+ return (this._bitField & 50397184) === 0;
+};
+
+var isResolved = PromiseInspection.prototype.isResolved = function () {
+ return (this._bitField & 50331648) !== 0;
+};
+
+PromiseInspection.prototype.isCancelled = function() {
+ return (this._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.__isCancelled = function() {
+ return (this._bitField & 65536) === 65536;
+};
+
+Promise.prototype._isCancelled = function() {
+ return this._target().__isCancelled();
+};
+
+Promise.prototype.isCancelled = function() {
+ return (this._target()._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.isPending = function() {
+ return isPending.call(this._target());
+};
+
+Promise.prototype.isRejected = function() {
+ return isRejected.call(this._target());
+};
+
+Promise.prototype.isFulfilled = function() {
+ return isFulfilled.call(this._target());
+};
+
+Promise.prototype.isResolved = function() {
+ return isResolved.call(this._target());
+};
+
+Promise.prototype.value = function() {
+ return value.call(this._target());
+};
+
+Promise.prototype.reason = function() {
+ var target = this._target();
+ target._unsetRejectionIsUnhandled();
+ return reason.call(target);
+};
+
+Promise.prototype._value = function() {
+ return this._settledValue();
+};
+
+Promise.prototype._reason = function() {
+ this._unsetRejectionIsUnhandled();
+ return this._settledValue();
+};
+
+Promise.PromiseInspection = PromiseInspection;
+};
+
+},{}],20:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = _dereq_("./util");
+var errorObj = util.errorObj;
+var isObject = util.isObject;
+
+function tryConvertToPromise(obj, context) {
+ if (isObject(obj)) {
+ if (obj instanceof Promise) return obj;
+ var then = getThen(obj);
+ if (then === errorObj) {
+ if (context) context._pushContext();
+ var ret = Promise.reject(then.e);
+ if (context) context._popContext();
+ return ret;
+ } else if (typeof then === "function") {
+ if (isAnyBluebirdPromise(obj)) {
+ var ret = new Promise(INTERNAL);
+ obj._then(
+ ret._fulfill,
+ ret._reject,
+ undefined,
+ ret,
+ null
+ );
+ return ret;
+ }
+ return doThenable(obj, then, context);
+ }
+ }
+ return obj;
+}
+
+function doGetThen(obj) {
+ return obj.then;
+}
+
+function getThen(obj) {
+ try {
+ return doGetThen(obj);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+
+var hasProp = {}.hasOwnProperty;
+function isAnyBluebirdPromise(obj) {
+ try {
+ return hasProp.call(obj, "_promise0");
+ } catch (e) {
+ return false;
+ }
+}
+
+function doThenable(x, then, context) {
+ var promise = new Promise(INTERNAL);
+ var ret = promise;
+ if (context) context._pushContext();
+ promise._captureStackTrace();
+ if (context) context._popContext();
+ var synchronous = true;
+ var result = util.tryCatch(then).call(x, resolve, reject);
+ synchronous = false;
+
+ if (promise && result === errorObj) {
+ promise._rejectCallback(result.e, true, true);
+ promise = null;
+ }
+
+ function resolve(value) {
+ if (!promise) return;
+ promise._resolveCallback(value);
+ promise = null;
+ }
+
+ function reject(reason) {
+ if (!promise) return;
+ promise._rejectCallback(reason, synchronous, true);
+ promise = null;
+ }
+ return ret;
+}
+
+return tryConvertToPromise;
+};
+
+},{"./util":21}],21:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5");
+var canEvaluate = typeof navigator == "undefined";
+
+var errorObj = {e: {}};
+var tryCatchTarget;
+var globalObject = typeof self !== "undefined" ? self :
+ typeof window !== "undefined" ? window :
+ typeof global !== "undefined" ? global :
+ this !== undefined ? this : null;
+
+function tryCatcher() {
+ try {
+ var target = tryCatchTarget;
+ tryCatchTarget = null;
+ return target.apply(this, arguments);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+function tryCatch(fn) {
+ tryCatchTarget = fn;
+ return tryCatcher;
+}
+
+var inherits = function(Child, Parent) {
+ var hasProp = {}.hasOwnProperty;
+
+ function T() {
+ this.constructor = Child;
+ this.constructor$ = Parent;
+ for (var propertyName in Parent.prototype) {
+ if (hasProp.call(Parent.prototype, propertyName) &&
+ propertyName.charAt(propertyName.length-1) !== "$"
+ ) {
+ this[propertyName + "$"] = Parent.prototype[propertyName];
+ }
+ }
+ }
+ T.prototype = Parent.prototype;
+ Child.prototype = new T();
+ return Child.prototype;
+};
+
+
+function isPrimitive(val) {
+ return val == null || val === true || val === false ||
+ typeof val === "string" || typeof val === "number";
+
+}
+
+function isObject(value) {
+ return typeof value === "function" ||
+ typeof value === "object" && value !== null;
+}
+
+function maybeWrapAsError(maybeError) {
+ if (!isPrimitive(maybeError)) return maybeError;
+
+ return new Error(safeToString(maybeError));
+}
+
+function withAppended(target, appendee) {
+ var len = target.length;
+ var ret = new Array(len + 1);
+ var i;
+ for (i = 0; i < len; ++i) {
+ ret[i] = target[i];
+ }
+ ret[i] = appendee;
+ return ret;
+}
+
+function getDataPropertyOrDefault(obj, key, defaultValue) {
+ if (es5.isES5) {
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+
+ if (desc != null) {
+ return desc.get == null && desc.set == null
+ ? desc.value
+ : defaultValue;
+ }
+ } else {
+ return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined;
+ }
+}
+
+function notEnumerableProp(obj, name, value) {
+ if (isPrimitive(obj)) return obj;
+ var descriptor = {
+ value: value,
+ configurable: true,
+ enumerable: false,
+ writable: true
+ };
+ es5.defineProperty(obj, name, descriptor);
+ return obj;
+}
+
+function thrower(r) {
+ throw r;
+}
+
+var inheritedDataKeys = (function() {
+ var excludedPrototypes = [
+ Array.prototype,
+ Object.prototype,
+ Function.prototype
+ ];
+
+ var isExcludedProto = function(val) {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (excludedPrototypes[i] === val) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+ if (es5.isES5) {
+ var getKeys = Object.getOwnPropertyNames;
+ return function(obj) {
+ var ret = [];
+ var visitedKeys = Object.create(null);
+ while (obj != null && !isExcludedProto(obj)) {
+ var keys;
+ try {
+ keys = getKeys(obj);
+ } catch (e) {
+ return ret;
+ }
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (visitedKeys[key]) continue;
+ visitedKeys[key] = true;
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null && desc.get == null && desc.set == null) {
+ ret.push(key);
+ }
+ }
+ obj = es5.getPrototypeOf(obj);
+ }
+ return ret;
+ };
+ } else {
+ var hasProp = {}.hasOwnProperty;
+ return function(obj) {
+ if (isExcludedProto(obj)) return [];
+ var ret = [];
+
+ /*jshint forin:false */
+ enumeration: for (var key in obj) {
+ if (hasProp.call(obj, key)) {
+ ret.push(key);
+ } else {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (hasProp.call(excludedPrototypes[i], key)) {
+ continue enumeration;
+ }
+ }
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+ }
+
+})();
+
+var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/;
+function isClass(fn) {
+ try {
+ if (typeof fn === "function") {
+ var keys = es5.names(fn.prototype);
+
+ var hasMethods = es5.isES5 && keys.length > 1;
+ var hasMethodsOtherThanConstructor = keys.length > 0 &&
+ !(keys.length === 1 && keys[0] === "constructor");
+ var hasThisAssignmentAndStaticMethods =
+ thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0;
+
+ if (hasMethods || hasMethodsOtherThanConstructor ||
+ hasThisAssignmentAndStaticMethods) {
+ return true;
+ }
+ }
+ return false;
+ } catch (e) {
+ return false;
+ }
+}
+
+function toFastProperties(obj) {
+ /*jshint -W027,-W055,-W031*/
+ function FakeConstructor() {}
+ FakeConstructor.prototype = obj;
+ var l = 8;
+ while (l--) new FakeConstructor();
+ return obj;
+ eval(obj);
+}
+
+var rident = /^[a-z$_][a-z$_0-9]*$/i;
+function isIdentifier(str) {
+ return rident.test(str);
+}
+
+function filledRange(count, prefix, suffix) {
+ var ret = new Array(count);
+ for(var i = 0; i < count; ++i) {
+ ret[i] = prefix + i + suffix;
+ }
+ return ret;
+}
+
+function safeToString(obj) {
+ try {
+ return obj + "";
+ } catch (e) {
+ return "[no string representation]";
+ }
+}
+
+function isError(obj) {
+ return obj instanceof Error ||
+ (obj !== null &&
+ typeof obj === "object" &&
+ typeof obj.message === "string" &&
+ typeof obj.name === "string");
+}
+
+function markAsOriginatingFromRejection(e) {
+ try {
+ notEnumerableProp(e, "isOperational", true);
+ }
+ catch(ignore) {}
+}
+
+function originatesFromRejection(e) {
+ if (e == null) return false;
+ return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) ||
+ e["isOperational"] === true);
+}
+
+function canAttachTrace(obj) {
+ return isError(obj) && es5.propertyIsWritable(obj, "stack");
+}
+
+var ensureErrorObject = (function() {
+ if (!("stack" in new Error())) {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ try {throw new Error(safeToString(value));}
+ catch(err) {return err;}
+ };
+ } else {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ return new Error(safeToString(value));
+ };
+ }
+})();
+
+function classString(obj) {
+ return {}.toString.call(obj);
+}
+
+function copyDescriptors(from, to, filter) {
+ var keys = es5.names(from);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (filter(key)) {
+ try {
+ es5.defineProperty(to, key, es5.getDescriptor(from, key));
+ } catch (ignore) {}
+ }
+ }
+}
+
+var asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ }
+ return null;
+};
+
+if (typeof Symbol !== "undefined" && Symbol.iterator) {
+ var ArrayFrom = typeof Array.from === "function" ? function(v) {
+ return Array.from(v);
+ } : function(v) {
+ var ret = [];
+ var it = v[Symbol.iterator]();
+ var itResult;
+ while (!((itResult = it.next()).done)) {
+ ret.push(itResult.value);
+ }
+ return ret;
+ };
+
+ asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ } else if (v != null && typeof v[Symbol.iterator] === "function") {
+ return ArrayFrom(v);
+ }
+ return null;
+ };
+}
+
+var isNode = typeof process !== "undefined" &&
+ classString(process).toLowerCase() === "[object process]";
+
+var hasEnvVariables = typeof process !== "undefined" &&
+ typeof process.env !== "undefined";
+
+function env(key) {
+ return hasEnvVariables ? process.env[key] : undefined;
+}
+
+function getNativePromise() {
+ if (typeof Promise === "function") {
+ try {
+ var promise = new Promise(function(){});
+ if ({}.toString.call(promise) === "[object Promise]") {
+ return Promise;
+ }
+ } catch (e) {}
+ }
+}
+
+function domainBind(self, cb) {
+ return self.bind(cb);
+}
+
+var ret = {
+ isClass: isClass,
+ isIdentifier: isIdentifier,
+ inheritedDataKeys: inheritedDataKeys,
+ getDataPropertyOrDefault: getDataPropertyOrDefault,
+ thrower: thrower,
+ isArray: es5.isArray,
+ asArray: asArray,
+ notEnumerableProp: notEnumerableProp,
+ isPrimitive: isPrimitive,
+ isObject: isObject,
+ isError: isError,
+ canEvaluate: canEvaluate,
+ errorObj: errorObj,
+ tryCatch: tryCatch,
+ inherits: inherits,
+ withAppended: withAppended,
+ maybeWrapAsError: maybeWrapAsError,
+ toFastProperties: toFastProperties,
+ filledRange: filledRange,
+ toString: safeToString,
+ canAttachTrace: canAttachTrace,
+ ensureErrorObject: ensureErrorObject,
+ originatesFromRejection: originatesFromRejection,
+ markAsOriginatingFromRejection: markAsOriginatingFromRejection,
+ classString: classString,
+ copyDescriptors: copyDescriptors,
+ hasDevTools: typeof chrome !== "undefined" && chrome &&
+ typeof chrome.loadTimes === "function",
+ isNode: isNode,
+ hasEnvVariables: hasEnvVariables,
+ env: env,
+ global: globalObject,
+ getNativePromise: getNativePromise,
+ domainBind: domainBind
+};
+ret.isRecentNode = ret.isNode && (function() {
+ var version = process.versions.node.split(".").map(Number);
+ return (version[0] === 0 && version[1] > 10) || (version[0] > 0);
+})();
+
+if (ret.isNode) ret.toFastProperties(process);
+
+try {throw new Error(); } catch (e) {ret.lastLineError = e;}
+module.exports = ret;
+
+},{"./es5":10}]},{},[3])(3)
+}); ;if (typeof window !== 'undefined' && window !== null) { window.P = window.Promise; } else if (typeof self !== 'undefined' && self !== null) { self.P = self.Promise; }
\ No newline at end of file
diff --git a/Restaurant/node_modules/bluebird/js/browser/bluebird.core.min.js b/Restaurant/node_modules/bluebird/js/browser/bluebird.core.min.js
new file mode 100644
index 0000000..6aca6aa
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/browser/bluebird.core.min.js
@@ -0,0 +1,31 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2013-2017 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 3.5.1
+ * Features enabled: core
+ * Features disabled: race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, using, timers, filter, any, each
+*/
+!function(t){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=t();else if("function"==typeof define&&define.amd)define([],t);else{var e;"undefined"!=typeof window?e=window:"undefined"!=typeof global?e=global:"undefined"!=typeof self&&(e=self),e.Promise=t()}}(function(){var t,e,n;return function r(t,e,n){function i(a,s){if(!e[a]){if(!t[a]){var c="function"==typeof _dereq_&&_dereq_;if(!s&&c)return c(a,!0);if(o)return o(a,!0);var l=new Error("Cannot find module '"+a+"'");throw l.code="MODULE_NOT_FOUND",l}var u=e[a]={exports:{}};t[a][0].call(u.exports,function(e){var n=t[a][1][e];return i(n?n:e)},u,u.exports,r,t,e,n)}return e[a].exports}for(var o="function"==typeof _dereq_&&_dereq_,a=0;a0;){var e=t.shift();if("function"==typeof e){var n=t.shift(),r=t.shift();e.call(n,r)}else e._settlePromises()}},r.prototype._drainQueues=function(){this._drainQueue(this._normalQueue),this._reset(),this._haveDrainedQueues=!0,this._drainQueue(this._lateQueue)},r.prototype._queueTick=function(){this._isTickUsed||(this._isTickUsed=!0,this._schedule(this.drainQueues))},r.prototype._reset=function(){this._isTickUsed=!1},e.exports=r,e.exports.firstLineError=s},{"./queue":17,"./schedule":18,"./util":21}],2:[function(t,e,n){"use strict";e.exports=function(t,e,n,r){var i=!1,o=function(t,e){this._reject(e)},a=function(t,e){e.promiseRejectionQueued=!0,e.bindingPromise._then(o,o,null,this,t)},s=function(t,e){0===(50397184&this._bitField)&&this._resolveCallback(e.target)},c=function(t,e){e.promiseRejectionQueued||this._reject(t)};t.prototype.bind=function(o){i||(i=!0,t.prototype._propagateFrom=r.propagateFromFunction(),t.prototype._boundValue=r.boundValueFunction());var l=n(o),u=new t(e);u._propagateFrom(this,1);var p=this._target();if(u._setBoundTo(l),l instanceof t){var f={promiseRejectionQueued:!1,promise:u,target:p,bindingPromise:l};p._then(e,a,void 0,u,f),l._then(s,c,void 0,u,f),u._setOnCancel(l)}else u._resolveCallback(p);return u},t.prototype._setBoundTo=function(t){void 0!==t?(this._bitField=2097152|this._bitField,this._boundTo=t):this._bitField=-2097153&this._bitField},t.prototype._isBound=function(){return 2097152===(2097152&this._bitField)},t.bind=function(e,n){return t.resolve(n).bind(e)}}},{}],3:[function(t,e,n){"use strict";function r(){try{Promise===o&&(Promise=i)}catch(t){}return o}var i;"undefined"!=typeof Promise&&(i=Promise);var o=t("./promise")();o.noConflict=r,e.exports=o},{"./promise":15}],4:[function(t,e,n){"use strict";e.exports=function(e,n,r,i){var o=t("./util"),a=o.tryCatch,s=o.errorObj,c=e._async;e.prototype["break"]=e.prototype.cancel=function(){if(!i.cancellation())return this._warn("cancellation is disabled");for(var t=this,e=t;t._isCancellable();){if(!t._cancelBy(e)){e._isFollowing()?e._followee().cancel():e._cancelBranched();break}var n=t._cancellationParent;if(null==n||!n._isCancellable()){t._isFollowing()?t._followee().cancel():t._cancelBranched();break}t._isFollowing()&&t._followee().cancel(),t._setWillBeCancelled(),e=t,t=n}},e.prototype._branchHasCancelled=function(){this._branchesRemainingToCancel--},e.prototype._enoughBranchesHaveCancelled=function(){return void 0===this._branchesRemainingToCancel||this._branchesRemainingToCancel<=0},e.prototype._cancelBy=function(t){return t===this?(this._branchesRemainingToCancel=0,this._invokeOnCancel(),!0):(this._branchHasCancelled(),this._enoughBranchesHaveCancelled()?(this._invokeOnCancel(),!0):!1)},e.prototype._cancelBranched=function(){this._enoughBranchesHaveCancelled()&&this._cancel()},e.prototype._cancel=function(){this._isCancellable()&&(this._setCancelled(),c.invoke(this._cancelPromises,this,void 0))},e.prototype._cancelPromises=function(){this._length()>0&&this._settlePromises()},e.prototype._unsetOnCancel=function(){this._onCancelField=void 0},e.prototype._isCancellable=function(){return this.isPending()&&!this._isCancelled()},e.prototype.isCancellable=function(){return this.isPending()&&!this.isCancelled()},e.prototype._doInvokeOnCancel=function(t,e){if(o.isArray(t))for(var n=0;n=0?o[t]:void 0}var i=!1,o=[];return t.prototype._promiseCreated=function(){},t.prototype._pushContext=function(){},t.prototype._popContext=function(){return null},t._peekContext=t.prototype._peekContext=function(){},e.prototype._pushContext=function(){void 0!==this._trace&&(this._trace._promiseCreated=null,o.push(this._trace))},e.prototype._popContext=function(){if(void 0!==this._trace){var t=o.pop(),e=t._promiseCreated;return t._promiseCreated=null,e}return null},e.CapturedTrace=null,e.create=n,e.deactivateLongStackTraces=function(){},e.activateLongStackTraces=function(){var n=t.prototype._pushContext,o=t.prototype._popContext,a=t._peekContext,s=t.prototype._peekContext,c=t.prototype._promiseCreated;e.deactivateLongStackTraces=function(){t.prototype._pushContext=n,t.prototype._popContext=o,t._peekContext=a,t.prototype._peekContext=s,t.prototype._promiseCreated=c,i=!1},i=!0,t.prototype._pushContext=e.prototype._pushContext,t.prototype._popContext=e.prototype._popContext,t._peekContext=t.prototype._peekContext=r,t.prototype._promiseCreated=function(){var t=this._peekContext();t&&null==t._promiseCreated&&(t._promiseCreated=this)}},e}},{}],7:[function(t,e,n){"use strict";e.exports=function(e,n){function r(t,e){return{promise:e}}function i(){return!1}function o(t,e,n){var r=this;try{t(e,n,function(t){if("function"!=typeof t)throw new TypeError("onCancel must be a function, got: "+I.toString(t));r._attachCancellationCallback(t)})}catch(i){return i}}function a(t){if(!this._isCancellable())return this;var e=this._onCancel();void 0!==e?I.isArray(e)?e.push(t):this._setOnCancel([e,t]):this._setOnCancel(t)}function s(){return this._onCancelField}function c(t){this._onCancelField=t}function l(){this._cancellationParent=void 0,this._onCancelField=void 0}function u(t,e){if(0!==(1&e)){this._cancellationParent=t;var n=t._branchesRemainingToCancel;void 0===n&&(n=0),t._branchesRemainingToCancel=n+1}0!==(2&e)&&t._isBound()&&this._setBoundTo(t._boundTo)}function p(t,e){0!==(2&e)&&t._isBound()&&this._setBoundTo(t._boundTo)}function f(){var t=this._boundTo;return void 0!==t&&t instanceof e?t.isFulfilled()?t.value():void 0:t}function h(){this._trace=new x(this._peekContext())}function _(t,e){if(H(t)){var n=this._trace;if(void 0!==n&&e&&(n=n._parent),void 0!==n)n.attachExtraTrace(t);else if(!t.__stackCleaned__){var r=E(t);I.notEnumerableProp(t,"stack",r.message+"\n"+r.stack.join("\n")),I.notEnumerableProp(t,"__stackCleaned__",!0)}}}function d(t,e,n,r,i){if(void 0===t&&null!==e&&X){if(void 0!==i&&i._returnedNonUndefined())return;if(0===(65535&r._bitField))return;n&&(n+=" ");var o="",a="";if(e._trace){for(var s=e._trace.stack.split("\n"),c=C(s),l=c.length-1;l>=0;--l){var u=c[l];if(!V.test(u)){var p=u.match(Q);p&&(o="at "+p[1]+":"+p[2]+":"+p[3]+" ");break}}if(c.length>0)for(var f=c[0],l=0;l0&&(a="\n"+s[l-1]);break}}var h="a promise was created in a "+n+"handler "+o+"but was not returned from it, see http://goo.gl/rRqMUw"+a;r._warn(h,!0,e)}}function v(t,e){var n=t+" is deprecated and will be removed in a future version.";return e&&(n+=" Use "+e+" instead."),y(n)}function y(t,n,r){if(ot.warnings){var i,o=new U(t);if(n)r._attachExtraTrace(o);else if(ot.longStackTraces&&(i=e._peekContext()))i.attachExtraTrace(o);else{var a=E(o);o.stack=a.message+"\n"+a.stack.join("\n")}tt("warning",o)||k(o,"",!0)}}function g(t,e){for(var n=0;n=0;--s)if(r[s]===o){a=s;break}for(var s=a;s>=0;--s){var c=r[s];if(e[i]!==c)break;e.pop(),i--}e=r}}function C(t){for(var e=[],n=0;n0&&"SyntaxError"!=t.name&&(e=e.slice(n)),e}function E(t){var e=t.stack,n=t.toString();return e="string"==typeof e&&e.length>0?w(t):[" (No stack trace)"],{message:n,stack:"SyntaxError"==t.name?e:C(e)}}function k(t,e,n){if("undefined"!=typeof console){var r;if(I.isObject(t)){var i=t.stack;r=e+G(i,t)}else r=e+String(t);"function"==typeof N?N(r,n):("function"==typeof console.log||"object"==typeof console.log)&&console.log(r)}}function j(t,e,n,r){var i=!1;try{"function"==typeof e&&(i=!0,"rejectionHandled"===t?e(r):e(n,r))}catch(o){B.throwLater(o)}"unhandledRejection"===t?tt(t,n,r)||i||k(n,"Unhandled rejection "):tt(t,r)}function F(t){var e;if("function"==typeof t)e="[function "+(t.name||"anonymous")+"]";else{e=t&&"function"==typeof t.toString?t.toString():I.toString(t);var n=/\[object [a-zA-Z0-9$_]+\]/;if(n.test(e))try{var r=JSON.stringify(t);e=r}catch(i){}0===e.length&&(e="(empty array)")}return"(<"+T(e)+">, no stack trace)"}function T(t){var e=41;return t.lengtha||0>s||!n||!r||n!==r||a>=s||(nt=function(t){if(D.test(t))return!0;var e=R(t);return e&&e.fileName===n&&a<=e.line&&e.line<=s?!0:!1})}}function x(t){this._parent=t,this._promisesCreated=0;var e=this._length=1+(void 0===t?0:t._length);it(this,x),e>32&&this.uncycle()}var O,A,N,L=e._getDomain,B=e._async,U=t("./errors").Warning,I=t("./util"),H=I.canAttachTrace,D=/[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/,V=/\((?:timers\.js):\d+:\d+\)/,Q=/[\/<\(](.+?):(\d+):(\d+)\)?\s*$/,q=null,G=null,M=!1,W=!(0==I.env("BLUEBIRD_DEBUG")||!I.env("BLUEBIRD_DEBUG")&&"development"!==I.env("NODE_ENV")),$=!(0==I.env("BLUEBIRD_WARNINGS")||!W&&!I.env("BLUEBIRD_WARNINGS")),z=!(0==I.env("BLUEBIRD_LONG_STACK_TRACES")||!W&&!I.env("BLUEBIRD_LONG_STACK_TRACES")),X=0!=I.env("BLUEBIRD_W_FORGOTTEN_RETURN")&&($||!!I.env("BLUEBIRD_W_FORGOTTEN_RETURN"));e.prototype.suppressUnhandledRejections=function(){var t=this._target();t._bitField=-1048577&t._bitField|524288},e.prototype._ensurePossibleRejectionHandled=function(){if(0===(524288&this._bitField)){this._setRejectionIsUnhandled();var t=this;setTimeout(function(){t._notifyUnhandledRejection()},1)}},e.prototype._notifyUnhandledRejectionIsHandled=function(){j("rejectionHandled",O,void 0,this)},e.prototype._setReturnedNonUndefined=function(){this._bitField=268435456|this._bitField},e.prototype._returnedNonUndefined=function(){return 0!==(268435456&this._bitField)},e.prototype._notifyUnhandledRejection=function(){if(this._isRejectionUnhandled()){var t=this._settledValue();this._setUnhandledRejectionIsNotified(),j("unhandledRejection",A,t,this)}},e.prototype._setUnhandledRejectionIsNotified=function(){this._bitField=262144|this._bitField},e.prototype._unsetUnhandledRejectionIsNotified=function(){this._bitField=-262145&this._bitField},e.prototype._isUnhandledRejectionNotified=function(){return(262144&this._bitField)>0},e.prototype._setRejectionIsUnhandled=function(){this._bitField=1048576|this._bitField},e.prototype._unsetRejectionIsUnhandled=function(){this._bitField=-1048577&this._bitField,this._isUnhandledRejectionNotified()&&(this._unsetUnhandledRejectionIsNotified(),this._notifyUnhandledRejectionIsHandled())},e.prototype._isRejectionUnhandled=function(){return(1048576&this._bitField)>0},e.prototype._warn=function(t,e,n){return y(t,e,n||this)},e.onPossiblyUnhandledRejection=function(t){var e=L();A="function"==typeof t?null===e?t:I.domainBind(e,t):void 0},e.onUnhandledRejectionHandled=function(t){var e=L();O="function"==typeof t?null===e?t:I.domainBind(e,t):void 0};var K=function(){};e.longStackTraces=function(){if(B.haveItemsQueued()&&!ot.longStackTraces)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/MqrFmX\n");if(!ot.longStackTraces&&P()){var t=e.prototype._captureStackTrace,r=e.prototype._attachExtraTrace;ot.longStackTraces=!0,K=function(){if(B.haveItemsQueued()&&!ot.longStackTraces)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/MqrFmX\n");e.prototype._captureStackTrace=t,e.prototype._attachExtraTrace=r,n.deactivateLongStackTraces(),B.enableTrampoline(),ot.longStackTraces=!1},e.prototype._captureStackTrace=h,e.prototype._attachExtraTrace=_,n.activateLongStackTraces(),B.disableTrampolineIfNecessary()}},e.hasLongStackTraces=function(){return ot.longStackTraces&&P()};var J=function(){try{if("function"==typeof CustomEvent){var t=new CustomEvent("CustomEvent");return I.global.dispatchEvent(t),function(t,e){var n=new CustomEvent(t.toLowerCase(),{detail:e,cancelable:!0});return!I.global.dispatchEvent(n)}}if("function"==typeof Event){var t=new Event("CustomEvent");return I.global.dispatchEvent(t),function(t,e){var n=new Event(t.toLowerCase(),{cancelable:!0});return n.detail=e,!I.global.dispatchEvent(n)}}var t=document.createEvent("CustomEvent");return t.initCustomEvent("testingtheevent",!1,!0,{}),I.global.dispatchEvent(t),function(t,e){var n=document.createEvent("CustomEvent");return n.initCustomEvent(t.toLowerCase(),!1,!0,e),!I.global.dispatchEvent(n)}}catch(e){}return function(){return!1}}(),Y=function(){return I.isNode?function(){return process.emit.apply(process,arguments)}:I.global?function(t){var e="on"+t.toLowerCase(),n=I.global[e];return n?(n.apply(I.global,[].slice.call(arguments,1)),!0):!1}:function(){return!1}}(),Z={promiseCreated:r,promiseFulfilled:r,promiseRejected:r,promiseResolved:r,promiseCancelled:r,promiseChained:function(t,e,n){return{promise:e,child:n}},warning:function(t,e){return{warning:e}},unhandledRejection:function(t,e,n){return{reason:e,promise:n}},rejectionHandled:r},tt=function(t){var e=!1;try{e=Y.apply(null,arguments)}catch(n){B.throwLater(n),e=!0}var r=!1;try{r=J(t,Z[t].apply(null,arguments))}catch(n){B.throwLater(n),r=!0}return r||e};e.config=function(t){if(t=Object(t),"longStackTraces"in t&&(t.longStackTraces?e.longStackTraces():!t.longStackTraces&&e.hasLongStackTraces()&&K()),"warnings"in t){var n=t.warnings;ot.warnings=!!n,X=ot.warnings,I.isObject(n)&&"wForgottenReturn"in n&&(X=!!n.wForgottenReturn)}if("cancellation"in t&&t.cancellation&&!ot.cancellation){if(B.haveItemsQueued())throw new Error("cannot enable cancellation after promises are in use");e.prototype._clearCancellationData=l,e.prototype._propagateFrom=u,e.prototype._onCancel=s,e.prototype._setOnCancel=c,e.prototype._attachCancellationCallback=a,e.prototype._execute=o,et=u,ot.cancellation=!0}return"monitoring"in t&&(t.monitoring&&!ot.monitoring?(ot.monitoring=!0,e.prototype._fireEvent=tt):!t.monitoring&&ot.monitoring&&(ot.monitoring=!1,e.prototype._fireEvent=i)),e},e.prototype._fireEvent=i,e.prototype._execute=function(t,e,n){try{t(e,n)}catch(r){return r}},e.prototype._onCancel=function(){},e.prototype._setOnCancel=function(t){},e.prototype._attachCancellationCallback=function(t){},e.prototype._captureStackTrace=function(){},e.prototype._attachExtraTrace=function(){},e.prototype._clearCancellationData=function(){},e.prototype._propagateFrom=function(t,e){};var et=p,nt=function(){return!1},rt=/[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;I.inherits(x,Error),n.CapturedTrace=x,x.prototype.uncycle=function(){var t=this._length;if(!(2>t)){for(var e=[],n={},r=0,i=this;void 0!==i;++r)e.push(i),i=i._parent;t=this._length=r;for(var r=t-1;r>=0;--r){var o=e[r].stack;void 0===n[o]&&(n[o]=r)}for(var r=0;t>r;++r){var a=e[r].stack,s=n[a];if(void 0!==s&&s!==r){s>0&&(e[s-1]._parent=void 0,e[s-1]._length=1),e[r]._parent=void 0,e[r]._length=1;var c=r>0?e[r-1]:this;t-1>s?(c._parent=e[s+1],c._parent.uncycle(),c._length=c._parent._length+1):(c._parent=void 0,c._length=1);for(var l=c._length+1,u=r-2;u>=0;--u)e[u]._length=l,l++;return}}}},x.prototype.attachExtraTrace=function(t){if(!t.__stackCleaned__){this.uncycle();for(var e=E(t),n=e.message,r=[e.stack],i=this;void 0!==i;)r.push(C(i.stack.split("\n"))),i=i._parent;b(r),m(r),I.notEnumerableProp(t,"stack",g(n,r)),I.notEnumerableProp(t,"__stackCleaned__",!0)}};var it=function(){var t=/^\s*at\s*/,e=function(t,e){return"string"==typeof t?t:void 0!==e.name&&void 0!==e.message?e.toString():F(e)};if("number"==typeof Error.stackTraceLimit&&"function"==typeof Error.captureStackTrace){Error.stackTraceLimit+=6,q=t,G=e;var n=Error.captureStackTrace;return nt=function(t){return D.test(t)},function(t,e){Error.stackTraceLimit+=6,n(t,e),Error.stackTraceLimit-=6}}var r=new Error;if("string"==typeof r.stack&&r.stack.split("\n")[0].indexOf("stackDetection@")>=0)return q=/@/,G=e,M=!0,function(t){t.stack=(new Error).stack};var i;try{throw new Error}catch(o){i="stack"in o}return"stack"in r||!i||"number"!=typeof Error.stackTraceLimit?(G=function(t,e){return"string"==typeof t?t:"object"!=typeof e&&"function"!=typeof e||void 0===e.name||void 0===e.message?F(e):e.toString()},null):(q=t,G=e,function(t){Error.stackTraceLimit+=6;try{throw new Error}catch(e){t.stack=e.stack}Error.stackTraceLimit-=6})}([]);"undefined"!=typeof console&&"undefined"!=typeof console.warn&&(N=function(t){console.warn(t)},I.isNode&&process.stderr.isTTY?N=function(t,e){var n=e?"[33m":"[31m";console.warn(n+t+"[0m\n")}:I.isNode||"string"!=typeof(new Error).stack||(N=function(t,e){console.warn("%c"+t,e?"color: darkorange":"color: red")}));var ot={warnings:$,longStackTraces:!1,cancellation:!1,monitoring:!1};return z&&e.longStackTraces(),{longStackTraces:function(){return ot.longStackTraces},warnings:function(){return ot.warnings},cancellation:function(){return ot.cancellation},monitoring:function(){return ot.monitoring},propagateFromFunction:function(){return et},boundValueFunction:function(){return f},checkForgottenReturns:d,setBounds:S,warn:y,deprecated:v,CapturedTrace:x,fireDomEvent:J,fireGlobalEvent:Y}}},{"./errors":9,"./util":21}],8:[function(t,e,n){"use strict";e.exports=function(t){function e(){return this.value}function n(){throw this.reason}t.prototype["return"]=t.prototype.thenReturn=function(n){return n instanceof t&&n.suppressUnhandledRejections(),this._then(e,void 0,void 0,{value:n},void 0)},t.prototype["throw"]=t.prototype.thenThrow=function(t){return this._then(n,void 0,void 0,{reason:t},void 0)},t.prototype.catchThrow=function(t){if(arguments.length<=1)return this._then(void 0,n,void 0,{reason:t},void 0);var e=arguments[1],r=function(){throw e};return this.caught(t,r)},t.prototype.catchReturn=function(n){if(arguments.length<=1)return n instanceof t&&n.suppressUnhandledRejections(),this._then(void 0,e,void 0,{value:n},void 0);var r=arguments[1];r instanceof t&&r.suppressUnhandledRejections();var i=function(){return r};return this.caught(n,i)}}},{}],9:[function(t,e,n){"use strict";function r(t,e){function n(r){return this instanceof n?(p(this,"message","string"==typeof r?r:e),p(this,"name",t),void(Error.captureStackTrace?Error.captureStackTrace(this,this.constructor):Error.call(this))):new n(r)}return u(n,Error),n}function i(t){return this instanceof i?(p(this,"name","OperationalError"),p(this,"message",t),this.cause=t,this.isOperational=!0,void(t instanceof Error?(p(this,"message",t.message),p(this,"stack",t.stack)):Error.captureStackTrace&&Error.captureStackTrace(this,this.constructor))):new i(t)}var o,a,s=t("./es5"),c=s.freeze,l=t("./util"),u=l.inherits,p=l.notEnumerableProp,f=r("Warning","warning"),h=r("CancellationError","cancellation error"),_=r("TimeoutError","timeout error"),d=r("AggregateError","aggregate error");try{o=TypeError,a=RangeError}catch(v){o=r("TypeError","type error"),a=r("RangeError","range error")}for(var y="join pop push shift unshift slice filter forEach some every map indexOf lastIndexOf reduce reduceRight sort reverse".split(" "),g=0;g1?t.cancelPromise._reject(e):t.cancelPromise._cancel(),t.cancelPromise=null,!0):!1}function s(){return l.call(this,this.promise._target()._settledValue())}function c(t){return a(this,t)?void 0:(f.e=t,f)}function l(t){var i=this.promise,l=this.handler;if(!this.called){this.called=!0;var u=this.isFinallyHandler()?l.call(i._boundValue()):l.call(i._boundValue(),t);if(u===r)return u;if(void 0!==u){i._setReturnedNonUndefined();var h=n(u,i);if(h instanceof e){if(null!=this.cancelPromise){if(h._isCancelled()){var _=new p("late cancellation observer");return i._attachExtraTrace(_),f.e=_,f}h.isPending()&&h._attachCancellationCallback(new o(this))}return h._then(s,c,void 0,this,void 0)}}}return i.isRejected()?(a(this),f.e=t,f):(a(this),t)}var u=t("./util"),p=e.CancellationError,f=u.errorObj,h=t("./catch_filter")(r);return i.prototype.isFinallyHandler=function(){return 0===this.type},o.prototype._resultCancelled=function(){a(this.finallyHandler)},e.prototype._passThrough=function(t,e,n,r){return"function"!=typeof t?this.then():this._then(n,r,void 0,new i(this,e,t),void 0)},e.prototype.lastly=e.prototype["finally"]=function(t){return this._passThrough(t,0,l,l)},e.prototype.tap=function(t){return this._passThrough(t,1,l)},e.prototype.tapCatch=function(t){var n=arguments.length;if(1===n)return this._passThrough(t,1,void 0,l);var r,i=new Array(n-1),o=0;for(r=0;n-1>r;++r){var a=arguments[r];if(!u.isObject(a))return e.reject(new TypeError("tapCatch statement predicate: expecting an object but got "+u.classString(a)));i[o++]=a}i.length=o;var s=arguments[r];return this._passThrough(h(i,s,this),1,void 0,l)},i}},{"./catch_filter":5,"./util":21}],12:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,a){var s=t("./util");s.canEvaluate,s.tryCatch,s.errorObj;e.join=function(){var t,e=arguments.length-1;if(e>0&&"function"==typeof arguments[e]){t=arguments[e];var r}var i=[].slice.call(arguments);t&&i.pop();var r=new n(i).promise();return void 0!==t?r.spread(t):r}}},{"./util":21}],13:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o){var a=t("./util"),s=a.tryCatch;e.method=function(t){if("function"!=typeof t)throw new e.TypeError("expecting a function but got "+a.classString(t));return function(){var r=new e(n);r._captureStackTrace(),r._pushContext();var i=s(t).apply(this,arguments),a=r._popContext();return o.checkForgottenReturns(i,a,"Promise.method",r),r._resolveFromSyncValue(i),r}},e.attempt=e["try"]=function(t){if("function"!=typeof t)return i("expecting a function but got "+a.classString(t));var r=new e(n);r._captureStackTrace(),r._pushContext();var c;if(arguments.length>1){o.deprecated("calling Promise.try with more than 1 argument");var l=arguments[1],u=arguments[2];c=a.isArray(l)?s(t).apply(u,l):s(t).call(u,l)}else c=s(t)();var p=r._popContext();return o.checkForgottenReturns(c,p,"Promise.try",r),r._resolveFromSyncValue(c),r},e.prototype._resolveFromSyncValue=function(t){t===a.errorObj?this._rejectCallback(t.e,!1):this._resolveCallback(t,!0)}}},{"./util":21}],14:[function(t,e,n){"use strict";function r(t){return t instanceof Error&&u.getPrototypeOf(t)===Error.prototype}function i(t){var e;if(r(t)){e=new l(t),e.name=t.name,e.message=t.message,e.stack=t.stack;for(var n=u.keys(t),i=0;i1){var n,r=new Array(e-1),i=0;for(n=0;e-1>n;++n){var o=arguments[n];if(!h.isObject(o))return p("Catch statement predicate: expecting an object but got "+h.classString(o));r[i++]=o}return r.length=i,t=arguments[n],this.then(void 0,P(r,t,this))}return this.then(void 0,t)},i.prototype.reflect=function(){return this._then(u,u,void 0,this,void 0)},i.prototype.then=function(t,e){if(F.warnings()&&arguments.length>0&&"function"!=typeof t&&"function"!=typeof e){var n=".then() only accepts functions but was passed: "+h.classString(t);arguments.length>1&&(n+=", "+h.classString(e)),this._warn(n)}return this._then(t,e,void 0,void 0,void 0)},i.prototype.done=function(t,e){var n=this._then(t,e,void 0,void 0,void 0);n._setIsFinal()},i.prototype.spread=function(t){return"function"!=typeof t?p("expecting a function but got "+h.classString(t)):this.all()._then(t,void 0,void 0,C,void 0);
+},i.prototype.toJSON=function(){var t={isFulfilled:!1,isRejected:!1,fulfillmentValue:void 0,rejectionReason:void 0};return this.isFulfilled()?(t.fulfillmentValue=this.value(),t.isFulfilled=!0):this.isRejected()&&(t.rejectionReason=this.reason(),t.isRejected=!0),t},i.prototype.all=function(){return arguments.length>0&&this._warn(".all() was passed arguments but it does not take any"),new k(this).promise()},i.prototype.error=function(t){return this.caught(h.originatesFromRejection,t)},i.getNewLibraryCopy=e.exports,i.is=function(t){return t instanceof i},i.fromNode=i.fromCallback=function(t){var e=new i(b);e._captureStackTrace();var n=arguments.length>1?!!Object(arguments[1]).multiArgs:!1,r=x(t)(R(e,n));return r===S&&e._rejectCallback(r.e,!0),e._isFateSealed()||e._setAsyncGuaranteed(),e},i.all=function(t){return new k(t).promise()},i.cast=function(t){var e=E(t);return e instanceof i||(e=new i(b),e._captureStackTrace(),e._setFulfilled(),e._rejectionHandler0=t),e},i.resolve=i.fulfilled=i.cast,i.reject=i.rejected=function(t){var e=new i(b);return e._captureStackTrace(),e._rejectCallback(t,!0),e},i.setScheduler=function(t){if("function"!=typeof t)throw new g("expecting a function but got "+h.classString(t));return v.setScheduler(t)},i.prototype._then=function(t,e,n,r,o){var a=void 0!==o,s=a?o:new i(b),l=this._target(),u=l._bitField;a||(s._propagateFrom(this,3),s._captureStackTrace(),void 0===r&&0!==(2097152&this._bitField)&&(r=0!==(50397184&u)?this._boundValue():l===this?void 0:this._boundTo),this._fireEvent("promiseChained",this,s));var p=c();if(0!==(50397184&u)){var f,_,d=l._settlePromiseCtx;0!==(33554432&u)?(_=l._rejectionHandler0,f=t):0!==(16777216&u)?(_=l._fulfillmentHandler0,f=e,l._unsetRejectionIsUnhandled()):(d=l._settlePromiseLateCancellationObserver,_=new m("late cancellation observer"),l._attachExtraTrace(_),f=e),v.invoke(d,l,{handler:null===p?f:"function"==typeof f&&h.domainBind(p,f),promise:s,receiver:r,value:_})}else l._addCallbacks(t,e,s,r,p);return s},i.prototype._length=function(){return 65535&this._bitField},i.prototype._isFateSealed=function(){return 0!==(117506048&this._bitField)},i.prototype._isFollowing=function(){return 67108864===(67108864&this._bitField)},i.prototype._setLength=function(t){this._bitField=-65536&this._bitField|65535&t},i.prototype._setFulfilled=function(){this._bitField=33554432|this._bitField,this._fireEvent("promiseFulfilled",this)},i.prototype._setRejected=function(){this._bitField=16777216|this._bitField,this._fireEvent("promiseRejected",this)},i.prototype._setFollowing=function(){this._bitField=67108864|this._bitField,this._fireEvent("promiseResolved",this)},i.prototype._setIsFinal=function(){this._bitField=4194304|this._bitField},i.prototype._isFinal=function(){return(4194304&this._bitField)>0},i.prototype._unsetCancelled=function(){this._bitField=-65537&this._bitField},i.prototype._setCancelled=function(){this._bitField=65536|this._bitField,this._fireEvent("promiseCancelled",this)},i.prototype._setWillBeCancelled=function(){this._bitField=8388608|this._bitField},i.prototype._setAsyncGuaranteed=function(){v.hasCustomScheduler()||(this._bitField=134217728|this._bitField)},i.prototype._receiverAt=function(t){var e=0===t?this._receiver0:this[4*t-4+3];return e===f?void 0:void 0===e&&this._isBound()?this._boundValue():e},i.prototype._promiseAt=function(t){return this[4*t-4+2]},i.prototype._fulfillmentHandlerAt=function(t){return this[4*t-4+0]},i.prototype._rejectionHandlerAt=function(t){return this[4*t-4+1]},i.prototype._boundValue=function(){},i.prototype._migrateCallback0=function(t){var e=(t._bitField,t._fulfillmentHandler0),n=t._rejectionHandler0,r=t._promise0,i=t._receiverAt(0);void 0===i&&(i=f),this._addCallbacks(e,n,r,i,null)},i.prototype._migrateCallbackAt=function(t,e){var n=t._fulfillmentHandlerAt(e),r=t._rejectionHandlerAt(e),i=t._promiseAt(e),o=t._receiverAt(e);void 0===o&&(o=f),this._addCallbacks(n,r,i,o,null)},i.prototype._addCallbacks=function(t,e,n,r,i){var o=this._length();if(o>=65531&&(o=0,this._setLength(0)),0===o)this._promise0=n,this._receiver0=r,"function"==typeof t&&(this._fulfillmentHandler0=null===i?t:h.domainBind(i,t)),"function"==typeof e&&(this._rejectionHandler0=null===i?e:h.domainBind(i,e));else{var a=4*o-4;this[a+2]=n,this[a+3]=r,"function"==typeof t&&(this[a+0]=null===i?t:h.domainBind(i,t)),"function"==typeof e&&(this[a+1]=null===i?e:h.domainBind(i,e))}return this._setLength(o+1),o},i.prototype._proxy=function(t,e){this._addCallbacks(void 0,void 0,e,t,null)},i.prototype._resolveCallback=function(t,e){if(0===(117506048&this._bitField)){if(t===this)return this._rejectCallback(l(),!1);var n=E(t,this);if(!(n instanceof i))return this._fulfill(t);e&&this._propagateFrom(n,2);var r=n._target();if(r===this)return void this._reject(l());var o=r._bitField;if(0===(50397184&o)){var a=this._length();a>0&&r._migrateCallback0(this);for(var s=1;a>s;++s)r._migrateCallbackAt(this,s);this._setFollowing(),this._setLength(0),this._setFollowee(r)}else if(0!==(33554432&o))this._fulfill(r._value());else if(0!==(16777216&o))this._reject(r._reason());else{var c=new m("late cancellation observer");r._attachExtraTrace(c),this._reject(c)}}},i.prototype._rejectCallback=function(t,e,n){var r=h.ensureErrorObject(t),i=r===t;if(!i&&!n&&F.warnings()){var o="a promise was rejected with a non-error: "+h.classString(t);this._warn(o,!0)}this._attachExtraTrace(r,e?i:!1),this._reject(t)},i.prototype._resolveFromExecutor=function(t){if(t!==b){var e=this;this._captureStackTrace(),this._pushContext();var n=!0,r=this._execute(t,function(t){e._resolveCallback(t)},function(t){e._rejectCallback(t,n)});n=!1,this._popContext(),void 0!==r&&e._rejectCallback(r,!0)}},i.prototype._settlePromiseFromHandler=function(t,e,n,r){var i=r._bitField;if(0===(65536&i)){r._pushContext();var o;e===C?n&&"number"==typeof n.length?o=x(t).apply(this._boundValue(),n):(o=S,o.e=new g("cannot .spread() a non-array: "+h.classString(n))):o=x(t).call(e,n);var a=r._popContext();i=r._bitField,0===(65536&i)&&(o===w?r._reject(n):o===S?r._rejectCallback(o.e,!1):(F.checkForgottenReturns(o,a,"",r,this),r._resolveCallback(o)))}},i.prototype._target=function(){for(var t=this;t._isFollowing();)t=t._followee();return t},i.prototype._followee=function(){return this._rejectionHandler0},i.prototype._setFollowee=function(t){this._rejectionHandler0=t},i.prototype._settlePromise=function(t,e,r,o){var a=t instanceof i,s=this._bitField,c=0!==(134217728&s);0!==(65536&s)?(a&&t._invokeInternalOnCancel(),r instanceof T&&r.isFinallyHandler()?(r.cancelPromise=t,x(e).call(r,o)===S&&t._reject(S.e)):e===u?t._fulfill(u.call(r)):r instanceof n?r._promiseCancelled(t):a||t instanceof k?t._cancel():r.cancel()):"function"==typeof e?a?(c&&t._setAsyncGuaranteed(),this._settlePromiseFromHandler(e,r,o,t)):e.call(r,o,t):r instanceof n?r._isResolved()||(0!==(33554432&s)?r._promiseFulfilled(o,t):r._promiseRejected(o,t)):a&&(c&&t._setAsyncGuaranteed(),0!==(33554432&s)?t._fulfill(o):t._reject(o))},i.prototype._settlePromiseLateCancellationObserver=function(t){var e=t.handler,n=t.promise,r=t.receiver,o=t.value;"function"==typeof e?n instanceof i?this._settlePromiseFromHandler(e,r,o,n):e.call(r,o,n):n instanceof i&&n._reject(o)},i.prototype._settlePromiseCtx=function(t){this._settlePromise(t.promise,t.handler,t.receiver,t.value)},i.prototype._settlePromise0=function(t,e,n){var r=this._promise0,i=this._receiverAt(0);this._promise0=void 0,this._receiver0=void 0,this._settlePromise(r,t,i,e)},i.prototype._clearCallbackDataAtIndex=function(t){var e=4*t-4;this[e+2]=this[e+3]=this[e+0]=this[e+1]=void 0},i.prototype._fulfill=function(t){var e=this._bitField;if(!((117506048&e)>>>16)){if(t===this){var n=l();return this._attachExtraTrace(n),this._reject(n)}this._setFulfilled(),this._rejectionHandler0=t,(65535&e)>0&&(0!==(134217728&e)?this._settlePromises():v.settlePromises(this))}},i.prototype._reject=function(t){var e=this._bitField;if(!((117506048&e)>>>16))return this._setRejected(),this._fulfillmentHandler0=t,this._isFinal()?v.fatalError(t,h.isNode):void((65535&e)>0?v.settlePromises(this):this._ensurePossibleRejectionHandled())},i.prototype._fulfillPromises=function(t,e){for(var n=1;t>n;n++){var r=this._fulfillmentHandlerAt(n),i=this._promiseAt(n),o=this._receiverAt(n);this._clearCallbackDataAtIndex(n),this._settlePromise(i,r,o,e)}},i.prototype._rejectPromises=function(t,e){for(var n=1;t>n;n++){var r=this._rejectionHandlerAt(n),i=this._promiseAt(n),o=this._receiverAt(n);this._clearCallbackDataAtIndex(n),this._settlePromise(i,r,o,e)}},i.prototype._settlePromises=function(){var t=this._bitField,e=65535&t;if(e>0){if(0!==(16842752&t)){var n=this._fulfillmentHandler0;this._settlePromise0(this._rejectionHandler0,n,t),this._rejectPromises(e,n)}else{var r=this._rejectionHandler0;this._settlePromise0(this._fulfillmentHandler0,r,t),this._fulfillPromises(e,r)}this._setLength(0)}this._clearCancellationData()},i.prototype._settledValue=function(){var t=this._bitField;return 0!==(33554432&t)?this._rejectionHandler0:0!==(16777216&t)?this._fulfillmentHandler0:void 0},i.defer=i.pending=function(){F.deprecated("Promise.defer","new Promise");var t=new i(b);return{promise:t,resolve:o,reject:a}},h.notEnumerableProp(i,"_makeSelfResolutionError",l),t("./method")(i,b,E,p,F),t("./bind")(i,b,E,F),t("./cancel")(i,k,p,F),t("./direct_resolve")(i),t("./synchronous_inspection")(i),t("./join")(i,k,E,b,v,c),i.Promise=i,i.version="3.5.1",h.toFastProperties(i),h.toFastProperties(i.prototype),s({a:1}),s({b:2}),s({c:3}),s(1),s(function(){}),s(void 0),s(!1),s(new i(b)),F.setBounds(d.firstLineError,h.lastLineError),i}},{"./async":1,"./bind":2,"./cancel":4,"./catch_filter":5,"./context":6,"./debuggability":7,"./direct_resolve":8,"./errors":9,"./es5":10,"./finally":11,"./join":12,"./method":13,"./nodeback":14,"./promise_array":16,"./synchronous_inspection":19,"./thenables":20,"./util":21}],16:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o){function a(t){switch(t){case-2:return[];case-3:return{};case-6:return new Map}}function s(t){var r=this._promise=new e(n);t instanceof e&&r._propagateFrom(t,3),r._setOnCancel(this),this._values=t,this._length=0,this._totalResolved=0,this._init(void 0,-2)}var c=t("./util");c.isArray;return c.inherits(s,o),s.prototype.length=function(){return this._length},s.prototype.promise=function(){return this._promise},s.prototype._init=function l(t,n){var o=r(this._values,this._promise);if(o instanceof e){o=o._target();var s=o._bitField;if(this._values=o,0===(50397184&s))return this._promise._setAsyncGuaranteed(),o._then(l,this._reject,void 0,this,n);if(0===(33554432&s))return 0!==(16777216&s)?this._reject(o._reason()):this._cancel();o=o._value()}if(o=c.asArray(o),null===o){var u=i("expecting an array or an iterable object but got "+c.classString(o)).reason();return void this._promise._rejectCallback(u,!1)}return 0===o.length?void(-5===n?this._resolveEmptyArray():this._resolve(a(n))):void this._iterate(o)},s.prototype._iterate=function(t){var n=this.getActualLength(t.length);this._length=n,this._values=this.shouldCopyValues()?new Array(n):this._values;for(var i=this._promise,o=!1,a=null,s=0;n>s;++s){var c=r(t[s],i);c instanceof e?(c=c._target(),a=c._bitField):a=null,o?null!==a&&c.suppressUnhandledRejections():null!==a?0===(50397184&a)?(c._proxy(this,s),this._values[s]=c):o=0!==(33554432&a)?this._promiseFulfilled(c._value(),s):0!==(16777216&a)?this._promiseRejected(c._reason(),s):this._promiseCancelled(s):o=this._promiseFulfilled(c,s)}o||i._setAsyncGuaranteed()},s.prototype._isResolved=function(){return null===this._values},s.prototype._resolve=function(t){this._values=null,this._promise._fulfill(t)},s.prototype._cancel=function(){!this._isResolved()&&this._promise._isCancellable()&&(this._values=null,this._promise._cancel())},s.prototype._reject=function(t){this._values=null,this._promise._rejectCallback(t,!1)},s.prototype._promiseFulfilled=function(t,e){this._values[e]=t;var n=++this._totalResolved;return n>=this._length?(this._resolve(this._values),!0):!1},s.prototype._promiseCancelled=function(){return this._cancel(),!0},s.prototype._promiseRejected=function(t){return this._totalResolved++,this._reject(t),!0},s.prototype._resultCancelled=function(){if(!this._isResolved()){var t=this._values;if(this._cancel(),t instanceof e)t.cancel();else for(var n=0;no;++o)n[o+r]=t[o+e],t[o+e]=void 0}function i(t){this._capacity=t,this._length=0,this._front=0}i.prototype._willBeOverCapacity=function(t){return this._capacityn;++n)i[n]=t[n];return i[n]=e,i}function l(t,e,n){if(!F.isES5)return{}.hasOwnProperty.call(t,e)?t[e]:void 0;var r=Object.getOwnPropertyDescriptor(t,e);return null!=r?null==r.get&&null==r.set?r.value:n:void 0}function u(t,e,n){if(o(t))return t;var r={value:n,configurable:!0,enumerable:!1,writable:!0};return F.defineProperty(t,e,r),t}function p(t){throw t}function f(t){try{if("function"==typeof t){var e=F.names(t.prototype),n=F.isES5&&e.length>1,r=e.length>0&&!(1===e.length&&"constructor"===e[0]),i=A.test(t+"")&&F.names(t).length>0;if(n||r||i)return!0}return!1}catch(o){return!1}}function h(t){function e(){}e.prototype=t;for(var n=8;n--;)new e;return t}function _(t){return N.test(t)}function d(t,e,n){for(var r=new Array(t),i=0;t>i;++i)r[i]=e+i+n;return r}function v(t){try{return t+""}catch(e){return"[no string representation]"}}function y(t){return t instanceof Error||null!==t&&"object"==typeof t&&"string"==typeof t.message&&"string"==typeof t.name}function g(t){try{u(t,"isOperational",!0)}catch(e){}}function m(t){return null==t?!1:t instanceof Error.__BluebirdErrorTypes__.OperationalError||t.isOperational===!0}function b(t){return y(t)&&F.propertyIsWritable(t,"stack")}function C(t){return{}.toString.call(t)}function w(t,e,n){for(var r=F.names(t),i=0;i10||t[0]>0}(),D.isNode&&D.toFastProperties(process);try{throw new Error}catch(V){D.lastLineError=V}e.exports=D},{"./es5":10}]},{},[3])(3)}),"undefined"!=typeof window&&null!==window?window.P=window.Promise:"undefined"!=typeof self&&null!==self&&(self.P=self.Promise);
\ No newline at end of file
diff --git a/Restaurant/node_modules/bluebird/js/browser/bluebird.js b/Restaurant/node_modules/bluebird/js/browser/bluebird.js
new file mode 100644
index 0000000..2bc524b
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/browser/bluebird.js
@@ -0,0 +1,5623 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2013-2017 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 3.5.1
+ * Features enabled: core, race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, using, timers, filter, any, each
+*/
+!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var f;"undefined"!=typeof window?f=window:"undefined"!=typeof global?f=global:"undefined"!=typeof self&&(f=self),f.Promise=e()}}(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof _dereq_=="function"&&_dereq_;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof _dereq_=="function"&&_dereq_;for(var o=0;o 0) {
+ var fn = queue.shift();
+ if (typeof fn !== "function") {
+ fn._settlePromises();
+ continue;
+ }
+ var receiver = queue.shift();
+ var arg = queue.shift();
+ fn.call(receiver, arg);
+ }
+};
+
+Async.prototype._drainQueues = function () {
+ this._drainQueue(this._normalQueue);
+ this._reset();
+ this._haveDrainedQueues = true;
+ this._drainQueue(this._lateQueue);
+};
+
+Async.prototype._queueTick = function () {
+ if (!this._isTickUsed) {
+ this._isTickUsed = true;
+ this._schedule(this.drainQueues);
+ }
+};
+
+Async.prototype._reset = function () {
+ this._isTickUsed = false;
+};
+
+module.exports = Async;
+module.exports.firstLineError = firstLineError;
+
+},{"./queue":26,"./schedule":29,"./util":36}],3:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise, debug) {
+var calledBind = false;
+var rejectThis = function(_, e) {
+ this._reject(e);
+};
+
+var targetRejected = function(e, context) {
+ context.promiseRejectionQueued = true;
+ context.bindingPromise._then(rejectThis, rejectThis, null, this, e);
+};
+
+var bindingResolved = function(thisArg, context) {
+ if (((this._bitField & 50397184) === 0)) {
+ this._resolveCallback(context.target);
+ }
+};
+
+var bindingRejected = function(e, context) {
+ if (!context.promiseRejectionQueued) this._reject(e);
+};
+
+Promise.prototype.bind = function (thisArg) {
+ if (!calledBind) {
+ calledBind = true;
+ Promise.prototype._propagateFrom = debug.propagateFromFunction();
+ Promise.prototype._boundValue = debug.boundValueFunction();
+ }
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+ ret._propagateFrom(this, 1);
+ var target = this._target();
+ ret._setBoundTo(maybePromise);
+ if (maybePromise instanceof Promise) {
+ var context = {
+ promiseRejectionQueued: false,
+ promise: ret,
+ target: target,
+ bindingPromise: maybePromise
+ };
+ target._then(INTERNAL, targetRejected, undefined, ret, context);
+ maybePromise._then(
+ bindingResolved, bindingRejected, undefined, ret, context);
+ ret._setOnCancel(maybePromise);
+ } else {
+ ret._resolveCallback(target);
+ }
+ return ret;
+};
+
+Promise.prototype._setBoundTo = function (obj) {
+ if (obj !== undefined) {
+ this._bitField = this._bitField | 2097152;
+ this._boundTo = obj;
+ } else {
+ this._bitField = this._bitField & (~2097152);
+ }
+};
+
+Promise.prototype._isBound = function () {
+ return (this._bitField & 2097152) === 2097152;
+};
+
+Promise.bind = function (thisArg, value) {
+ return Promise.resolve(value).bind(thisArg);
+};
+};
+
+},{}],4:[function(_dereq_,module,exports){
+"use strict";
+var old;
+if (typeof Promise !== "undefined") old = Promise;
+function noConflict() {
+ try { if (Promise === bluebird) Promise = old; }
+ catch (e) {}
+ return bluebird;
+}
+var bluebird = _dereq_("./promise")();
+bluebird.noConflict = noConflict;
+module.exports = bluebird;
+
+},{"./promise":22}],5:[function(_dereq_,module,exports){
+"use strict";
+var cr = Object.create;
+if (cr) {
+ var callerCache = cr(null);
+ var getterCache = cr(null);
+ callerCache[" size"] = getterCache[" size"] = 0;
+}
+
+module.exports = function(Promise) {
+var util = _dereq_("./util");
+var canEvaluate = util.canEvaluate;
+var isIdentifier = util.isIdentifier;
+
+var getMethodCaller;
+var getGetter;
+if (!true) {
+var makeMethodCaller = function (methodName) {
+ return new Function("ensureMethod", " \n\
+ return function(obj) { \n\
+ 'use strict' \n\
+ var len = this.length; \n\
+ ensureMethod(obj, 'methodName'); \n\
+ switch(len) { \n\
+ case 1: return obj.methodName(this[0]); \n\
+ case 2: return obj.methodName(this[0], this[1]); \n\
+ case 3: return obj.methodName(this[0], this[1], this[2]); \n\
+ case 0: return obj.methodName(); \n\
+ default: \n\
+ return obj.methodName.apply(obj, this); \n\
+ } \n\
+ }; \n\
+ ".replace(/methodName/g, methodName))(ensureMethod);
+};
+
+var makeGetter = function (propertyName) {
+ return new Function("obj", " \n\
+ 'use strict'; \n\
+ return obj.propertyName; \n\
+ ".replace("propertyName", propertyName));
+};
+
+var getCompiled = function(name, compiler, cache) {
+ var ret = cache[name];
+ if (typeof ret !== "function") {
+ if (!isIdentifier(name)) {
+ return null;
+ }
+ ret = compiler(name);
+ cache[name] = ret;
+ cache[" size"]++;
+ if (cache[" size"] > 512) {
+ var keys = Object.keys(cache);
+ for (var i = 0; i < 256; ++i) delete cache[keys[i]];
+ cache[" size"] = keys.length - 256;
+ }
+ }
+ return ret;
+};
+
+getMethodCaller = function(name) {
+ return getCompiled(name, makeMethodCaller, callerCache);
+};
+
+getGetter = function(name) {
+ return getCompiled(name, makeGetter, getterCache);
+};
+}
+
+function ensureMethod(obj, methodName) {
+ var fn;
+ if (obj != null) fn = obj[methodName];
+ if (typeof fn !== "function") {
+ var message = "Object " + util.classString(obj) + " has no method '" +
+ util.toString(methodName) + "'";
+ throw new Promise.TypeError(message);
+ }
+ return fn;
+}
+
+function caller(obj) {
+ var methodName = this.pop();
+ var fn = ensureMethod(obj, methodName);
+ return fn.apply(obj, this);
+}
+Promise.prototype.call = function (methodName) {
+ var args = [].slice.call(arguments, 1);;
+ if (!true) {
+ if (canEvaluate) {
+ var maybeCaller = getMethodCaller(methodName);
+ if (maybeCaller !== null) {
+ return this._then(
+ maybeCaller, undefined, undefined, args, undefined);
+ }
+ }
+ }
+ args.push(methodName);
+ return this._then(caller, undefined, undefined, args, undefined);
+};
+
+function namedGetter(obj) {
+ return obj[this];
+}
+function indexedGetter(obj) {
+ var index = +this;
+ if (index < 0) index = Math.max(0, index + obj.length);
+ return obj[index];
+}
+Promise.prototype.get = function (propertyName) {
+ var isIndex = (typeof propertyName === "number");
+ var getter;
+ if (!isIndex) {
+ if (canEvaluate) {
+ var maybeGetter = getGetter(propertyName);
+ getter = maybeGetter !== null ? maybeGetter : namedGetter;
+ } else {
+ getter = namedGetter;
+ }
+ } else {
+ getter = indexedGetter;
+ }
+ return this._then(getter, undefined, undefined, propertyName, undefined);
+};
+};
+
+},{"./util":36}],6:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, PromiseArray, apiRejection, debug) {
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+Promise.prototype["break"] = Promise.prototype.cancel = function() {
+ if (!debug.cancellation()) return this._warn("cancellation is disabled");
+
+ var promise = this;
+ var child = promise;
+ while (promise._isCancellable()) {
+ if (!promise._cancelBy(child)) {
+ if (child._isFollowing()) {
+ child._followee().cancel();
+ } else {
+ child._cancelBranched();
+ }
+ break;
+ }
+
+ var parent = promise._cancellationParent;
+ if (parent == null || !parent._isCancellable()) {
+ if (promise._isFollowing()) {
+ promise._followee().cancel();
+ } else {
+ promise._cancelBranched();
+ }
+ break;
+ } else {
+ if (promise._isFollowing()) promise._followee().cancel();
+ promise._setWillBeCancelled();
+ child = promise;
+ promise = parent;
+ }
+ }
+};
+
+Promise.prototype._branchHasCancelled = function() {
+ this._branchesRemainingToCancel--;
+};
+
+Promise.prototype._enoughBranchesHaveCancelled = function() {
+ return this._branchesRemainingToCancel === undefined ||
+ this._branchesRemainingToCancel <= 0;
+};
+
+Promise.prototype._cancelBy = function(canceller) {
+ if (canceller === this) {
+ this._branchesRemainingToCancel = 0;
+ this._invokeOnCancel();
+ return true;
+ } else {
+ this._branchHasCancelled();
+ if (this._enoughBranchesHaveCancelled()) {
+ this._invokeOnCancel();
+ return true;
+ }
+ }
+ return false;
+};
+
+Promise.prototype._cancelBranched = function() {
+ if (this._enoughBranchesHaveCancelled()) {
+ this._cancel();
+ }
+};
+
+Promise.prototype._cancel = function() {
+ if (!this._isCancellable()) return;
+ this._setCancelled();
+ async.invoke(this._cancelPromises, this, undefined);
+};
+
+Promise.prototype._cancelPromises = function() {
+ if (this._length() > 0) this._settlePromises();
+};
+
+Promise.prototype._unsetOnCancel = function() {
+ this._onCancelField = undefined;
+};
+
+Promise.prototype._isCancellable = function() {
+ return this.isPending() && !this._isCancelled();
+};
+
+Promise.prototype.isCancellable = function() {
+ return this.isPending() && !this.isCancelled();
+};
+
+Promise.prototype._doInvokeOnCancel = function(onCancelCallback, internalOnly) {
+ if (util.isArray(onCancelCallback)) {
+ for (var i = 0; i < onCancelCallback.length; ++i) {
+ this._doInvokeOnCancel(onCancelCallback[i], internalOnly);
+ }
+ } else if (onCancelCallback !== undefined) {
+ if (typeof onCancelCallback === "function") {
+ if (!internalOnly) {
+ var e = tryCatch(onCancelCallback).call(this._boundValue());
+ if (e === errorObj) {
+ this._attachExtraTrace(e.e);
+ async.throwLater(e.e);
+ }
+ }
+ } else {
+ onCancelCallback._resultCancelled(this);
+ }
+ }
+};
+
+Promise.prototype._invokeOnCancel = function() {
+ var onCancelCallback = this._onCancel();
+ this._unsetOnCancel();
+ async.invoke(this._doInvokeOnCancel, this, onCancelCallback);
+};
+
+Promise.prototype._invokeInternalOnCancel = function() {
+ if (this._isCancellable()) {
+ this._doInvokeOnCancel(this._onCancel(), true);
+ this._unsetOnCancel();
+ }
+};
+
+Promise.prototype._resultCancelled = function() {
+ this.cancel();
+};
+
+};
+
+},{"./util":36}],7:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(NEXT_FILTER) {
+var util = _dereq_("./util");
+var getKeys = _dereq_("./es5").keys;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function catchFilter(instances, cb, promise) {
+ return function(e) {
+ var boundTo = promise._boundValue();
+ predicateLoop: for (var i = 0; i < instances.length; ++i) {
+ var item = instances[i];
+
+ if (item === Error ||
+ (item != null && item.prototype instanceof Error)) {
+ if (e instanceof item) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (typeof item === "function") {
+ var matchesPredicate = tryCatch(item).call(boundTo, e);
+ if (matchesPredicate === errorObj) {
+ return matchesPredicate;
+ } else if (matchesPredicate) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (util.isObject(e)) {
+ var keys = getKeys(item);
+ for (var j = 0; j < keys.length; ++j) {
+ var key = keys[j];
+ if (item[key] != e[key]) {
+ continue predicateLoop;
+ }
+ }
+ return tryCatch(cb).call(boundTo, e);
+ }
+ }
+ return NEXT_FILTER;
+ };
+}
+
+return catchFilter;
+};
+
+},{"./es5":13,"./util":36}],8:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var longStackTraces = false;
+var contextStack = [];
+
+Promise.prototype._promiseCreated = function() {};
+Promise.prototype._pushContext = function() {};
+Promise.prototype._popContext = function() {return null;};
+Promise._peekContext = Promise.prototype._peekContext = function() {};
+
+function Context() {
+ this._trace = new Context.CapturedTrace(peekContext());
+}
+Context.prototype._pushContext = function () {
+ if (this._trace !== undefined) {
+ this._trace._promiseCreated = null;
+ contextStack.push(this._trace);
+ }
+};
+
+Context.prototype._popContext = function () {
+ if (this._trace !== undefined) {
+ var trace = contextStack.pop();
+ var ret = trace._promiseCreated;
+ trace._promiseCreated = null;
+ return ret;
+ }
+ return null;
+};
+
+function createContext() {
+ if (longStackTraces) return new Context();
+}
+
+function peekContext() {
+ var lastIndex = contextStack.length - 1;
+ if (lastIndex >= 0) {
+ return contextStack[lastIndex];
+ }
+ return undefined;
+}
+Context.CapturedTrace = null;
+Context.create = createContext;
+Context.deactivateLongStackTraces = function() {};
+Context.activateLongStackTraces = function() {
+ var Promise_pushContext = Promise.prototype._pushContext;
+ var Promise_popContext = Promise.prototype._popContext;
+ var Promise_PeekContext = Promise._peekContext;
+ var Promise_peekContext = Promise.prototype._peekContext;
+ var Promise_promiseCreated = Promise.prototype._promiseCreated;
+ Context.deactivateLongStackTraces = function() {
+ Promise.prototype._pushContext = Promise_pushContext;
+ Promise.prototype._popContext = Promise_popContext;
+ Promise._peekContext = Promise_PeekContext;
+ Promise.prototype._peekContext = Promise_peekContext;
+ Promise.prototype._promiseCreated = Promise_promiseCreated;
+ longStackTraces = false;
+ };
+ longStackTraces = true;
+ Promise.prototype._pushContext = Context.prototype._pushContext;
+ Promise.prototype._popContext = Context.prototype._popContext;
+ Promise._peekContext = Promise.prototype._peekContext = peekContext;
+ Promise.prototype._promiseCreated = function() {
+ var ctx = this._peekContext();
+ if (ctx && ctx._promiseCreated == null) ctx._promiseCreated = this;
+ };
+};
+return Context;
+};
+
+},{}],9:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, Context) {
+var getDomain = Promise._getDomain;
+var async = Promise._async;
+var Warning = _dereq_("./errors").Warning;
+var util = _dereq_("./util");
+var canAttachTrace = util.canAttachTrace;
+var unhandledRejectionHandled;
+var possiblyUnhandledRejection;
+var bluebirdFramePattern =
+ /[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/;
+var nodeFramePattern = /\((?:timers\.js):\d+:\d+\)/;
+var parseLinePattern = /[\/<\(](.+?):(\d+):(\d+)\)?\s*$/;
+var stackFramePattern = null;
+var formatStack = null;
+var indentStackFrames = false;
+var printWarning;
+var debugging = !!(util.env("BLUEBIRD_DEBUG") != 0 &&
+ (true ||
+ util.env("BLUEBIRD_DEBUG") ||
+ util.env("NODE_ENV") === "development"));
+
+var warnings = !!(util.env("BLUEBIRD_WARNINGS") != 0 &&
+ (debugging || util.env("BLUEBIRD_WARNINGS")));
+
+var longStackTraces = !!(util.env("BLUEBIRD_LONG_STACK_TRACES") != 0 &&
+ (debugging || util.env("BLUEBIRD_LONG_STACK_TRACES")));
+
+var wForgottenReturn = util.env("BLUEBIRD_W_FORGOTTEN_RETURN") != 0 &&
+ (warnings || !!util.env("BLUEBIRD_W_FORGOTTEN_RETURN"));
+
+Promise.prototype.suppressUnhandledRejections = function() {
+ var target = this._target();
+ target._bitField = ((target._bitField & (~1048576)) |
+ 524288);
+};
+
+Promise.prototype._ensurePossibleRejectionHandled = function () {
+ if ((this._bitField & 524288) !== 0) return;
+ this._setRejectionIsUnhandled();
+ var self = this;
+ setTimeout(function() {
+ self._notifyUnhandledRejection();
+ }, 1);
+};
+
+Promise.prototype._notifyUnhandledRejectionIsHandled = function () {
+ fireRejectionEvent("rejectionHandled",
+ unhandledRejectionHandled, undefined, this);
+};
+
+Promise.prototype._setReturnedNonUndefined = function() {
+ this._bitField = this._bitField | 268435456;
+};
+
+Promise.prototype._returnedNonUndefined = function() {
+ return (this._bitField & 268435456) !== 0;
+};
+
+Promise.prototype._notifyUnhandledRejection = function () {
+ if (this._isRejectionUnhandled()) {
+ var reason = this._settledValue();
+ this._setUnhandledRejectionIsNotified();
+ fireRejectionEvent("unhandledRejection",
+ possiblyUnhandledRejection, reason, this);
+ }
+};
+
+Promise.prototype._setUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField | 262144;
+};
+
+Promise.prototype._unsetUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField & (~262144);
+};
+
+Promise.prototype._isUnhandledRejectionNotified = function () {
+ return (this._bitField & 262144) > 0;
+};
+
+Promise.prototype._setRejectionIsUnhandled = function () {
+ this._bitField = this._bitField | 1048576;
+};
+
+Promise.prototype._unsetRejectionIsUnhandled = function () {
+ this._bitField = this._bitField & (~1048576);
+ if (this._isUnhandledRejectionNotified()) {
+ this._unsetUnhandledRejectionIsNotified();
+ this._notifyUnhandledRejectionIsHandled();
+ }
+};
+
+Promise.prototype._isRejectionUnhandled = function () {
+ return (this._bitField & 1048576) > 0;
+};
+
+Promise.prototype._warn = function(message, shouldUseOwnTrace, promise) {
+ return warn(message, shouldUseOwnTrace, promise || this);
+};
+
+Promise.onPossiblyUnhandledRejection = function (fn) {
+ var domain = getDomain();
+ possiblyUnhandledRejection =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+Promise.onUnhandledRejectionHandled = function (fn) {
+ var domain = getDomain();
+ unhandledRejectionHandled =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+var disableLongStackTraces = function() {};
+Promise.longStackTraces = function () {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (!config.longStackTraces && longStackTracesIsSupported()) {
+ var Promise_captureStackTrace = Promise.prototype._captureStackTrace;
+ var Promise_attachExtraTrace = Promise.prototype._attachExtraTrace;
+ config.longStackTraces = true;
+ disableLongStackTraces = function() {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ Promise.prototype._captureStackTrace = Promise_captureStackTrace;
+ Promise.prototype._attachExtraTrace = Promise_attachExtraTrace;
+ Context.deactivateLongStackTraces();
+ async.enableTrampoline();
+ config.longStackTraces = false;
+ };
+ Promise.prototype._captureStackTrace = longStackTracesCaptureStackTrace;
+ Promise.prototype._attachExtraTrace = longStackTracesAttachExtraTrace;
+ Context.activateLongStackTraces();
+ async.disableTrampolineIfNecessary();
+ }
+};
+
+Promise.hasLongStackTraces = function () {
+ return config.longStackTraces && longStackTracesIsSupported();
+};
+
+var fireDomEvent = (function() {
+ try {
+ if (typeof CustomEvent === "function") {
+ var event = new CustomEvent("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new CustomEvent(name.toLowerCase(), {
+ detail: event,
+ cancelable: true
+ });
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else if (typeof Event === "function") {
+ var event = new Event("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new Event(name.toLowerCase(), {
+ cancelable: true
+ });
+ domEvent.detail = event;
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else {
+ var event = document.createEvent("CustomEvent");
+ event.initCustomEvent("testingtheevent", false, true, {});
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = document.createEvent("CustomEvent");
+ domEvent.initCustomEvent(name.toLowerCase(), false, true,
+ event);
+ return !util.global.dispatchEvent(domEvent);
+ };
+ }
+ } catch (e) {}
+ return function() {
+ return false;
+ };
+})();
+
+var fireGlobalEvent = (function() {
+ if (util.isNode) {
+ return function() {
+ return process.emit.apply(process, arguments);
+ };
+ } else {
+ if (!util.global) {
+ return function() {
+ return false;
+ };
+ }
+ return function(name) {
+ var methodName = "on" + name.toLowerCase();
+ var method = util.global[methodName];
+ if (!method) return false;
+ method.apply(util.global, [].slice.call(arguments, 1));
+ return true;
+ };
+ }
+})();
+
+function generatePromiseLifecycleEventObject(name, promise) {
+ return {promise: promise};
+}
+
+var eventToObjectGenerator = {
+ promiseCreated: generatePromiseLifecycleEventObject,
+ promiseFulfilled: generatePromiseLifecycleEventObject,
+ promiseRejected: generatePromiseLifecycleEventObject,
+ promiseResolved: generatePromiseLifecycleEventObject,
+ promiseCancelled: generatePromiseLifecycleEventObject,
+ promiseChained: function(name, promise, child) {
+ return {promise: promise, child: child};
+ },
+ warning: function(name, warning) {
+ return {warning: warning};
+ },
+ unhandledRejection: function (name, reason, promise) {
+ return {reason: reason, promise: promise};
+ },
+ rejectionHandled: generatePromiseLifecycleEventObject
+};
+
+var activeFireEvent = function (name) {
+ var globalEventFired = false;
+ try {
+ globalEventFired = fireGlobalEvent.apply(null, arguments);
+ } catch (e) {
+ async.throwLater(e);
+ globalEventFired = true;
+ }
+
+ var domEventFired = false;
+ try {
+ domEventFired = fireDomEvent(name,
+ eventToObjectGenerator[name].apply(null, arguments));
+ } catch (e) {
+ async.throwLater(e);
+ domEventFired = true;
+ }
+
+ return domEventFired || globalEventFired;
+};
+
+Promise.config = function(opts) {
+ opts = Object(opts);
+ if ("longStackTraces" in opts) {
+ if (opts.longStackTraces) {
+ Promise.longStackTraces();
+ } else if (!opts.longStackTraces && Promise.hasLongStackTraces()) {
+ disableLongStackTraces();
+ }
+ }
+ if ("warnings" in opts) {
+ var warningsOption = opts.warnings;
+ config.warnings = !!warningsOption;
+ wForgottenReturn = config.warnings;
+
+ if (util.isObject(warningsOption)) {
+ if ("wForgottenReturn" in warningsOption) {
+ wForgottenReturn = !!warningsOption.wForgottenReturn;
+ }
+ }
+ }
+ if ("cancellation" in opts && opts.cancellation && !config.cancellation) {
+ if (async.haveItemsQueued()) {
+ throw new Error(
+ "cannot enable cancellation after promises are in use");
+ }
+ Promise.prototype._clearCancellationData =
+ cancellationClearCancellationData;
+ Promise.prototype._propagateFrom = cancellationPropagateFrom;
+ Promise.prototype._onCancel = cancellationOnCancel;
+ Promise.prototype._setOnCancel = cancellationSetOnCancel;
+ Promise.prototype._attachCancellationCallback =
+ cancellationAttachCancellationCallback;
+ Promise.prototype._execute = cancellationExecute;
+ propagateFromFunction = cancellationPropagateFrom;
+ config.cancellation = true;
+ }
+ if ("monitoring" in opts) {
+ if (opts.monitoring && !config.monitoring) {
+ config.monitoring = true;
+ Promise.prototype._fireEvent = activeFireEvent;
+ } else if (!opts.monitoring && config.monitoring) {
+ config.monitoring = false;
+ Promise.prototype._fireEvent = defaultFireEvent;
+ }
+ }
+ return Promise;
+};
+
+function defaultFireEvent() { return false; }
+
+Promise.prototype._fireEvent = defaultFireEvent;
+Promise.prototype._execute = function(executor, resolve, reject) {
+ try {
+ executor(resolve, reject);
+ } catch (e) {
+ return e;
+ }
+};
+Promise.prototype._onCancel = function () {};
+Promise.prototype._setOnCancel = function (handler) { ; };
+Promise.prototype._attachCancellationCallback = function(onCancel) {
+ ;
+};
+Promise.prototype._captureStackTrace = function () {};
+Promise.prototype._attachExtraTrace = function () {};
+Promise.prototype._clearCancellationData = function() {};
+Promise.prototype._propagateFrom = function (parent, flags) {
+ ;
+ ;
+};
+
+function cancellationExecute(executor, resolve, reject) {
+ var promise = this;
+ try {
+ executor(resolve, reject, function(onCancel) {
+ if (typeof onCancel !== "function") {
+ throw new TypeError("onCancel must be a function, got: " +
+ util.toString(onCancel));
+ }
+ promise._attachCancellationCallback(onCancel);
+ });
+ } catch (e) {
+ return e;
+ }
+}
+
+function cancellationAttachCancellationCallback(onCancel) {
+ if (!this._isCancellable()) return this;
+
+ var previousOnCancel = this._onCancel();
+ if (previousOnCancel !== undefined) {
+ if (util.isArray(previousOnCancel)) {
+ previousOnCancel.push(onCancel);
+ } else {
+ this._setOnCancel([previousOnCancel, onCancel]);
+ }
+ } else {
+ this._setOnCancel(onCancel);
+ }
+}
+
+function cancellationOnCancel() {
+ return this._onCancelField;
+}
+
+function cancellationSetOnCancel(onCancel) {
+ this._onCancelField = onCancel;
+}
+
+function cancellationClearCancellationData() {
+ this._cancellationParent = undefined;
+ this._onCancelField = undefined;
+}
+
+function cancellationPropagateFrom(parent, flags) {
+ if ((flags & 1) !== 0) {
+ this._cancellationParent = parent;
+ var branchesRemainingToCancel = parent._branchesRemainingToCancel;
+ if (branchesRemainingToCancel === undefined) {
+ branchesRemainingToCancel = 0;
+ }
+ parent._branchesRemainingToCancel = branchesRemainingToCancel + 1;
+ }
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+
+function bindingPropagateFrom(parent, flags) {
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+var propagateFromFunction = bindingPropagateFrom;
+
+function boundValueFunction() {
+ var ret = this._boundTo;
+ if (ret !== undefined) {
+ if (ret instanceof Promise) {
+ if (ret.isFulfilled()) {
+ return ret.value();
+ } else {
+ return undefined;
+ }
+ }
+ }
+ return ret;
+}
+
+function longStackTracesCaptureStackTrace() {
+ this._trace = new CapturedTrace(this._peekContext());
+}
+
+function longStackTracesAttachExtraTrace(error, ignoreSelf) {
+ if (canAttachTrace(error)) {
+ var trace = this._trace;
+ if (trace !== undefined) {
+ if (ignoreSelf) trace = trace._parent;
+ }
+ if (trace !== undefined) {
+ trace.attachExtraTrace(error);
+ } else if (!error.__stackCleaned__) {
+ var parsed = parseStackAndMessage(error);
+ util.notEnumerableProp(error, "stack",
+ parsed.message + "\n" + parsed.stack.join("\n"));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+ }
+ }
+}
+
+function checkForgottenReturns(returnValue, promiseCreated, name, promise,
+ parent) {
+ if (returnValue === undefined && promiseCreated !== null &&
+ wForgottenReturn) {
+ if (parent !== undefined && parent._returnedNonUndefined()) return;
+ if ((promise._bitField & 65535) === 0) return;
+
+ if (name) name = name + " ";
+ var handlerLine = "";
+ var creatorLine = "";
+ if (promiseCreated._trace) {
+ var traceLines = promiseCreated._trace.stack.split("\n");
+ var stack = cleanStack(traceLines);
+ for (var i = stack.length - 1; i >= 0; --i) {
+ var line = stack[i];
+ if (!nodeFramePattern.test(line)) {
+ var lineMatches = line.match(parseLinePattern);
+ if (lineMatches) {
+ handlerLine = "at " + lineMatches[1] +
+ ":" + lineMatches[2] + ":" + lineMatches[3] + " ";
+ }
+ break;
+ }
+ }
+
+ if (stack.length > 0) {
+ var firstUserLine = stack[0];
+ for (var i = 0; i < traceLines.length; ++i) {
+
+ if (traceLines[i] === firstUserLine) {
+ if (i > 0) {
+ creatorLine = "\n" + traceLines[i - 1];
+ }
+ break;
+ }
+ }
+
+ }
+ }
+ var msg = "a promise was created in a " + name +
+ "handler " + handlerLine + "but was not returned from it, " +
+ "see http://goo.gl/rRqMUw" +
+ creatorLine;
+ promise._warn(msg, true, promiseCreated);
+ }
+}
+
+function deprecated(name, replacement) {
+ var message = name +
+ " is deprecated and will be removed in a future version.";
+ if (replacement) message += " Use " + replacement + " instead.";
+ return warn(message);
+}
+
+function warn(message, shouldUseOwnTrace, promise) {
+ if (!config.warnings) return;
+ var warning = new Warning(message);
+ var ctx;
+ if (shouldUseOwnTrace) {
+ promise._attachExtraTrace(warning);
+ } else if (config.longStackTraces && (ctx = Promise._peekContext())) {
+ ctx.attachExtraTrace(warning);
+ } else {
+ var parsed = parseStackAndMessage(warning);
+ warning.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ }
+
+ if (!activeFireEvent("warning", warning)) {
+ formatAndLogError(warning, "", true);
+ }
+}
+
+function reconstructStack(message, stacks) {
+ for (var i = 0; i < stacks.length - 1; ++i) {
+ stacks[i].push("From previous event:");
+ stacks[i] = stacks[i].join("\n");
+ }
+ if (i < stacks.length) {
+ stacks[i] = stacks[i].join("\n");
+ }
+ return message + "\n" + stacks.join("\n");
+}
+
+function removeDuplicateOrEmptyJumps(stacks) {
+ for (var i = 0; i < stacks.length; ++i) {
+ if (stacks[i].length === 0 ||
+ ((i + 1 < stacks.length) && stacks[i][0] === stacks[i+1][0])) {
+ stacks.splice(i, 1);
+ i--;
+ }
+ }
+}
+
+function removeCommonRoots(stacks) {
+ var current = stacks[0];
+ for (var i = 1; i < stacks.length; ++i) {
+ var prev = stacks[i];
+ var currentLastIndex = current.length - 1;
+ var currentLastLine = current[currentLastIndex];
+ var commonRootMeetPoint = -1;
+
+ for (var j = prev.length - 1; j >= 0; --j) {
+ if (prev[j] === currentLastLine) {
+ commonRootMeetPoint = j;
+ break;
+ }
+ }
+
+ for (var j = commonRootMeetPoint; j >= 0; --j) {
+ var line = prev[j];
+ if (current[currentLastIndex] === line) {
+ current.pop();
+ currentLastIndex--;
+ } else {
+ break;
+ }
+ }
+ current = prev;
+ }
+}
+
+function cleanStack(stack) {
+ var ret = [];
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ var isTraceLine = " (No stack trace)" === line ||
+ stackFramePattern.test(line);
+ var isInternalFrame = isTraceLine && shouldIgnore(line);
+ if (isTraceLine && !isInternalFrame) {
+ if (indentStackFrames && line.charAt(0) !== " ") {
+ line = " " + line;
+ }
+ ret.push(line);
+ }
+ }
+ return ret;
+}
+
+function stackFramesAsArray(error) {
+ var stack = error.stack.replace(/\s+$/g, "").split("\n");
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ if (" (No stack trace)" === line || stackFramePattern.test(line)) {
+ break;
+ }
+ }
+ if (i > 0 && error.name != "SyntaxError") {
+ stack = stack.slice(i);
+ }
+ return stack;
+}
+
+function parseStackAndMessage(error) {
+ var stack = error.stack;
+ var message = error.toString();
+ stack = typeof stack === "string" && stack.length > 0
+ ? stackFramesAsArray(error) : [" (No stack trace)"];
+ return {
+ message: message,
+ stack: error.name == "SyntaxError" ? stack : cleanStack(stack)
+ };
+}
+
+function formatAndLogError(error, title, isSoft) {
+ if (typeof console !== "undefined") {
+ var message;
+ if (util.isObject(error)) {
+ var stack = error.stack;
+ message = title + formatStack(stack, error);
+ } else {
+ message = title + String(error);
+ }
+ if (typeof printWarning === "function") {
+ printWarning(message, isSoft);
+ } else if (typeof console.log === "function" ||
+ typeof console.log === "object") {
+ console.log(message);
+ }
+ }
+}
+
+function fireRejectionEvent(name, localHandler, reason, promise) {
+ var localEventFired = false;
+ try {
+ if (typeof localHandler === "function") {
+ localEventFired = true;
+ if (name === "rejectionHandled") {
+ localHandler(promise);
+ } else {
+ localHandler(reason, promise);
+ }
+ }
+ } catch (e) {
+ async.throwLater(e);
+ }
+
+ if (name === "unhandledRejection") {
+ if (!activeFireEvent(name, reason, promise) && !localEventFired) {
+ formatAndLogError(reason, "Unhandled rejection ");
+ }
+ } else {
+ activeFireEvent(name, promise);
+ }
+}
+
+function formatNonError(obj) {
+ var str;
+ if (typeof obj === "function") {
+ str = "[function " +
+ (obj.name || "anonymous") +
+ "]";
+ } else {
+ str = obj && typeof obj.toString === "function"
+ ? obj.toString() : util.toString(obj);
+ var ruselessToString = /\[object [a-zA-Z0-9$_]+\]/;
+ if (ruselessToString.test(str)) {
+ try {
+ var newStr = JSON.stringify(obj);
+ str = newStr;
+ }
+ catch(e) {
+
+ }
+ }
+ if (str.length === 0) {
+ str = "(empty array)";
+ }
+ }
+ return ("(<" + snip(str) + ">, no stack trace)");
+}
+
+function snip(str) {
+ var maxChars = 41;
+ if (str.length < maxChars) {
+ return str;
+ }
+ return str.substr(0, maxChars - 3) + "...";
+}
+
+function longStackTracesIsSupported() {
+ return typeof captureStackTrace === "function";
+}
+
+var shouldIgnore = function() { return false; };
+var parseLineInfoRegex = /[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;
+function parseLineInfo(line) {
+ var matches = line.match(parseLineInfoRegex);
+ if (matches) {
+ return {
+ fileName: matches[1],
+ line: parseInt(matches[2], 10)
+ };
+ }
+}
+
+function setBounds(firstLineError, lastLineError) {
+ if (!longStackTracesIsSupported()) return;
+ var firstStackLines = firstLineError.stack.split("\n");
+ var lastStackLines = lastLineError.stack.split("\n");
+ var firstIndex = -1;
+ var lastIndex = -1;
+ var firstFileName;
+ var lastFileName;
+ for (var i = 0; i < firstStackLines.length; ++i) {
+ var result = parseLineInfo(firstStackLines[i]);
+ if (result) {
+ firstFileName = result.fileName;
+ firstIndex = result.line;
+ break;
+ }
+ }
+ for (var i = 0; i < lastStackLines.length; ++i) {
+ var result = parseLineInfo(lastStackLines[i]);
+ if (result) {
+ lastFileName = result.fileName;
+ lastIndex = result.line;
+ break;
+ }
+ }
+ if (firstIndex < 0 || lastIndex < 0 || !firstFileName || !lastFileName ||
+ firstFileName !== lastFileName || firstIndex >= lastIndex) {
+ return;
+ }
+
+ shouldIgnore = function(line) {
+ if (bluebirdFramePattern.test(line)) return true;
+ var info = parseLineInfo(line);
+ if (info) {
+ if (info.fileName === firstFileName &&
+ (firstIndex <= info.line && info.line <= lastIndex)) {
+ return true;
+ }
+ }
+ return false;
+ };
+}
+
+function CapturedTrace(parent) {
+ this._parent = parent;
+ this._promisesCreated = 0;
+ var length = this._length = 1 + (parent === undefined ? 0 : parent._length);
+ captureStackTrace(this, CapturedTrace);
+ if (length > 32) this.uncycle();
+}
+util.inherits(CapturedTrace, Error);
+Context.CapturedTrace = CapturedTrace;
+
+CapturedTrace.prototype.uncycle = function() {
+ var length = this._length;
+ if (length < 2) return;
+ var nodes = [];
+ var stackToIndex = {};
+
+ for (var i = 0, node = this; node !== undefined; ++i) {
+ nodes.push(node);
+ node = node._parent;
+ }
+ length = this._length = i;
+ for (var i = length - 1; i >= 0; --i) {
+ var stack = nodes[i].stack;
+ if (stackToIndex[stack] === undefined) {
+ stackToIndex[stack] = i;
+ }
+ }
+ for (var i = 0; i < length; ++i) {
+ var currentStack = nodes[i].stack;
+ var index = stackToIndex[currentStack];
+ if (index !== undefined && index !== i) {
+ if (index > 0) {
+ nodes[index - 1]._parent = undefined;
+ nodes[index - 1]._length = 1;
+ }
+ nodes[i]._parent = undefined;
+ nodes[i]._length = 1;
+ var cycleEdgeNode = i > 0 ? nodes[i - 1] : this;
+
+ if (index < length - 1) {
+ cycleEdgeNode._parent = nodes[index + 1];
+ cycleEdgeNode._parent.uncycle();
+ cycleEdgeNode._length =
+ cycleEdgeNode._parent._length + 1;
+ } else {
+ cycleEdgeNode._parent = undefined;
+ cycleEdgeNode._length = 1;
+ }
+ var currentChildLength = cycleEdgeNode._length + 1;
+ for (var j = i - 2; j >= 0; --j) {
+ nodes[j]._length = currentChildLength;
+ currentChildLength++;
+ }
+ return;
+ }
+ }
+};
+
+CapturedTrace.prototype.attachExtraTrace = function(error) {
+ if (error.__stackCleaned__) return;
+ this.uncycle();
+ var parsed = parseStackAndMessage(error);
+ var message = parsed.message;
+ var stacks = [parsed.stack];
+
+ var trace = this;
+ while (trace !== undefined) {
+ stacks.push(cleanStack(trace.stack.split("\n")));
+ trace = trace._parent;
+ }
+ removeCommonRoots(stacks);
+ removeDuplicateOrEmptyJumps(stacks);
+ util.notEnumerableProp(error, "stack", reconstructStack(message, stacks));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+};
+
+var captureStackTrace = (function stackDetection() {
+ var v8stackFramePattern = /^\s*at\s*/;
+ var v8stackFormatter = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if (error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ if (typeof Error.stackTraceLimit === "number" &&
+ typeof Error.captureStackTrace === "function") {
+ Error.stackTraceLimit += 6;
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ var captureStackTrace = Error.captureStackTrace;
+
+ shouldIgnore = function(line) {
+ return bluebirdFramePattern.test(line);
+ };
+ return function(receiver, ignoreUntil) {
+ Error.stackTraceLimit += 6;
+ captureStackTrace(receiver, ignoreUntil);
+ Error.stackTraceLimit -= 6;
+ };
+ }
+ var err = new Error();
+
+ if (typeof err.stack === "string" &&
+ err.stack.split("\n")[0].indexOf("stackDetection@") >= 0) {
+ stackFramePattern = /@/;
+ formatStack = v8stackFormatter;
+ indentStackFrames = true;
+ return function captureStackTrace(o) {
+ o.stack = new Error().stack;
+ };
+ }
+
+ var hasStackAfterThrow;
+ try { throw new Error(); }
+ catch(e) {
+ hasStackAfterThrow = ("stack" in e);
+ }
+ if (!("stack" in err) && hasStackAfterThrow &&
+ typeof Error.stackTraceLimit === "number") {
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ return function captureStackTrace(o) {
+ Error.stackTraceLimit += 6;
+ try { throw new Error(); }
+ catch(e) { o.stack = e.stack; }
+ Error.stackTraceLimit -= 6;
+ };
+ }
+
+ formatStack = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if ((typeof error === "object" ||
+ typeof error === "function") &&
+ error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ return null;
+
+})([]);
+
+if (typeof console !== "undefined" && typeof console.warn !== "undefined") {
+ printWarning = function (message) {
+ console.warn(message);
+ };
+ if (util.isNode && process.stderr.isTTY) {
+ printWarning = function(message, isSoft) {
+ var color = isSoft ? "\u001b[33m" : "\u001b[31m";
+ console.warn(color + message + "\u001b[0m\n");
+ };
+ } else if (!util.isNode && typeof (new Error().stack) === "string") {
+ printWarning = function(message, isSoft) {
+ console.warn("%c" + message,
+ isSoft ? "color: darkorange" : "color: red");
+ };
+ }
+}
+
+var config = {
+ warnings: warnings,
+ longStackTraces: false,
+ cancellation: false,
+ monitoring: false
+};
+
+if (longStackTraces) Promise.longStackTraces();
+
+return {
+ longStackTraces: function() {
+ return config.longStackTraces;
+ },
+ warnings: function() {
+ return config.warnings;
+ },
+ cancellation: function() {
+ return config.cancellation;
+ },
+ monitoring: function() {
+ return config.monitoring;
+ },
+ propagateFromFunction: function() {
+ return propagateFromFunction;
+ },
+ boundValueFunction: function() {
+ return boundValueFunction;
+ },
+ checkForgottenReturns: checkForgottenReturns,
+ setBounds: setBounds,
+ warn: warn,
+ deprecated: deprecated,
+ CapturedTrace: CapturedTrace,
+ fireDomEvent: fireDomEvent,
+ fireGlobalEvent: fireGlobalEvent
+};
+};
+
+},{"./errors":12,"./util":36}],10:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function returner() {
+ return this.value;
+}
+function thrower() {
+ throw this.reason;
+}
+
+Promise.prototype["return"] =
+Promise.prototype.thenReturn = function (value) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ returner, undefined, undefined, {value: value}, undefined);
+};
+
+Promise.prototype["throw"] =
+Promise.prototype.thenThrow = function (reason) {
+ return this._then(
+ thrower, undefined, undefined, {reason: reason}, undefined);
+};
+
+Promise.prototype.catchThrow = function (reason) {
+ if (arguments.length <= 1) {
+ return this._then(
+ undefined, thrower, undefined, {reason: reason}, undefined);
+ } else {
+ var _reason = arguments[1];
+ var handler = function() {throw _reason;};
+ return this.caught(reason, handler);
+ }
+};
+
+Promise.prototype.catchReturn = function (value) {
+ if (arguments.length <= 1) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ undefined, returner, undefined, {value: value}, undefined);
+ } else {
+ var _value = arguments[1];
+ if (_value instanceof Promise) _value.suppressUnhandledRejections();
+ var handler = function() {return _value;};
+ return this.caught(value, handler);
+ }
+};
+};
+
+},{}],11:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseReduce = Promise.reduce;
+var PromiseAll = Promise.all;
+
+function promiseAllThis() {
+ return PromiseAll(this);
+}
+
+function PromiseMapSeries(promises, fn) {
+ return PromiseReduce(promises, fn, INTERNAL, INTERNAL);
+}
+
+Promise.prototype.each = function (fn) {
+ return PromiseReduce(this, fn, INTERNAL, 0)
+ ._then(promiseAllThis, undefined, undefined, this, undefined);
+};
+
+Promise.prototype.mapSeries = function (fn) {
+ return PromiseReduce(this, fn, INTERNAL, INTERNAL);
+};
+
+Promise.each = function (promises, fn) {
+ return PromiseReduce(promises, fn, INTERNAL, 0)
+ ._then(promiseAllThis, undefined, undefined, promises, undefined);
+};
+
+Promise.mapSeries = PromiseMapSeries;
+};
+
+
+},{}],12:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5");
+var Objectfreeze = es5.freeze;
+var util = _dereq_("./util");
+var inherits = util.inherits;
+var notEnumerableProp = util.notEnumerableProp;
+
+function subError(nameProperty, defaultMessage) {
+ function SubError(message) {
+ if (!(this instanceof SubError)) return new SubError(message);
+ notEnumerableProp(this, "message",
+ typeof message === "string" ? message : defaultMessage);
+ notEnumerableProp(this, "name", nameProperty);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ Error.call(this);
+ }
+ }
+ inherits(SubError, Error);
+ return SubError;
+}
+
+var _TypeError, _RangeError;
+var Warning = subError("Warning", "warning");
+var CancellationError = subError("CancellationError", "cancellation error");
+var TimeoutError = subError("TimeoutError", "timeout error");
+var AggregateError = subError("AggregateError", "aggregate error");
+try {
+ _TypeError = TypeError;
+ _RangeError = RangeError;
+} catch(e) {
+ _TypeError = subError("TypeError", "type error");
+ _RangeError = subError("RangeError", "range error");
+}
+
+var methods = ("join pop push shift unshift slice filter forEach some " +
+ "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" ");
+
+for (var i = 0; i < methods.length; ++i) {
+ if (typeof Array.prototype[methods[i]] === "function") {
+ AggregateError.prototype[methods[i]] = Array.prototype[methods[i]];
+ }
+}
+
+es5.defineProperty(AggregateError.prototype, "length", {
+ value: 0,
+ configurable: false,
+ writable: true,
+ enumerable: true
+});
+AggregateError.prototype["isOperational"] = true;
+var level = 0;
+AggregateError.prototype.toString = function() {
+ var indent = Array(level * 4 + 1).join(" ");
+ var ret = "\n" + indent + "AggregateError of:" + "\n";
+ level++;
+ indent = Array(level * 4 + 1).join(" ");
+ for (var i = 0; i < this.length; ++i) {
+ var str = this[i] === this ? "[Circular AggregateError]" : this[i] + "";
+ var lines = str.split("\n");
+ for (var j = 0; j < lines.length; ++j) {
+ lines[j] = indent + lines[j];
+ }
+ str = lines.join("\n");
+ ret += str + "\n";
+ }
+ level--;
+ return ret;
+};
+
+function OperationalError(message) {
+ if (!(this instanceof OperationalError))
+ return new OperationalError(message);
+ notEnumerableProp(this, "name", "OperationalError");
+ notEnumerableProp(this, "message", message);
+ this.cause = message;
+ this["isOperational"] = true;
+
+ if (message instanceof Error) {
+ notEnumerableProp(this, "message", message.message);
+ notEnumerableProp(this, "stack", message.stack);
+ } else if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ }
+
+}
+inherits(OperationalError, Error);
+
+var errorTypes = Error["__BluebirdErrorTypes__"];
+if (!errorTypes) {
+ errorTypes = Objectfreeze({
+ CancellationError: CancellationError,
+ TimeoutError: TimeoutError,
+ OperationalError: OperationalError,
+ RejectionError: OperationalError,
+ AggregateError: AggregateError
+ });
+ es5.defineProperty(Error, "__BluebirdErrorTypes__", {
+ value: errorTypes,
+ writable: false,
+ enumerable: false,
+ configurable: false
+ });
+}
+
+module.exports = {
+ Error: Error,
+ TypeError: _TypeError,
+ RangeError: _RangeError,
+ CancellationError: errorTypes.CancellationError,
+ OperationalError: errorTypes.OperationalError,
+ TimeoutError: errorTypes.TimeoutError,
+ AggregateError: errorTypes.AggregateError,
+ Warning: Warning
+};
+
+},{"./es5":13,"./util":36}],13:[function(_dereq_,module,exports){
+var isES5 = (function(){
+ "use strict";
+ return this === undefined;
+})();
+
+if (isES5) {
+ module.exports = {
+ freeze: Object.freeze,
+ defineProperty: Object.defineProperty,
+ getDescriptor: Object.getOwnPropertyDescriptor,
+ keys: Object.keys,
+ names: Object.getOwnPropertyNames,
+ getPrototypeOf: Object.getPrototypeOf,
+ isArray: Array.isArray,
+ isES5: isES5,
+ propertyIsWritable: function(obj, prop) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop);
+ return !!(!descriptor || descriptor.writable || descriptor.set);
+ }
+ };
+} else {
+ var has = {}.hasOwnProperty;
+ var str = {}.toString;
+ var proto = {}.constructor.prototype;
+
+ var ObjectKeys = function (o) {
+ var ret = [];
+ for (var key in o) {
+ if (has.call(o, key)) {
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+
+ var ObjectGetDescriptor = function(o, key) {
+ return {value: o[key]};
+ };
+
+ var ObjectDefineProperty = function (o, key, desc) {
+ o[key] = desc.value;
+ return o;
+ };
+
+ var ObjectFreeze = function (obj) {
+ return obj;
+ };
+
+ var ObjectGetPrototypeOf = function (obj) {
+ try {
+ return Object(obj).constructor.prototype;
+ }
+ catch (e) {
+ return proto;
+ }
+ };
+
+ var ArrayIsArray = function (obj) {
+ try {
+ return str.call(obj) === "[object Array]";
+ }
+ catch(e) {
+ return false;
+ }
+ };
+
+ module.exports = {
+ isArray: ArrayIsArray,
+ keys: ObjectKeys,
+ names: ObjectKeys,
+ defineProperty: ObjectDefineProperty,
+ getDescriptor: ObjectGetDescriptor,
+ freeze: ObjectFreeze,
+ getPrototypeOf: ObjectGetPrototypeOf,
+ isES5: isES5,
+ propertyIsWritable: function() {
+ return true;
+ }
+ };
+}
+
+},{}],14:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseMap = Promise.map;
+
+Promise.prototype.filter = function (fn, options) {
+ return PromiseMap(this, fn, options, INTERNAL);
+};
+
+Promise.filter = function (promises, fn, options) {
+ return PromiseMap(promises, fn, options, INTERNAL);
+};
+};
+
+},{}],15:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, tryConvertToPromise, NEXT_FILTER) {
+var util = _dereq_("./util");
+var CancellationError = Promise.CancellationError;
+var errorObj = util.errorObj;
+var catchFilter = _dereq_("./catch_filter")(NEXT_FILTER);
+
+function PassThroughHandlerContext(promise, type, handler) {
+ this.promise = promise;
+ this.type = type;
+ this.handler = handler;
+ this.called = false;
+ this.cancelPromise = null;
+}
+
+PassThroughHandlerContext.prototype.isFinallyHandler = function() {
+ return this.type === 0;
+};
+
+function FinallyHandlerCancelReaction(finallyHandler) {
+ this.finallyHandler = finallyHandler;
+}
+
+FinallyHandlerCancelReaction.prototype._resultCancelled = function() {
+ checkCancel(this.finallyHandler);
+};
+
+function checkCancel(ctx, reason) {
+ if (ctx.cancelPromise != null) {
+ if (arguments.length > 1) {
+ ctx.cancelPromise._reject(reason);
+ } else {
+ ctx.cancelPromise._cancel();
+ }
+ ctx.cancelPromise = null;
+ return true;
+ }
+ return false;
+}
+
+function succeed() {
+ return finallyHandler.call(this, this.promise._target()._settledValue());
+}
+function fail(reason) {
+ if (checkCancel(this, reason)) return;
+ errorObj.e = reason;
+ return errorObj;
+}
+function finallyHandler(reasonOrValue) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ if (!this.called) {
+ this.called = true;
+ var ret = this.isFinallyHandler()
+ ? handler.call(promise._boundValue())
+ : handler.call(promise._boundValue(), reasonOrValue);
+ if (ret === NEXT_FILTER) {
+ return ret;
+ } else if (ret !== undefined) {
+ promise._setReturnedNonUndefined();
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ if (this.cancelPromise != null) {
+ if (maybePromise._isCancelled()) {
+ var reason =
+ new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ errorObj.e = reason;
+ return errorObj;
+ } else if (maybePromise.isPending()) {
+ maybePromise._attachCancellationCallback(
+ new FinallyHandlerCancelReaction(this));
+ }
+ }
+ return maybePromise._then(
+ succeed, fail, undefined, this, undefined);
+ }
+ }
+ }
+
+ if (promise.isRejected()) {
+ checkCancel(this);
+ errorObj.e = reasonOrValue;
+ return errorObj;
+ } else {
+ checkCancel(this);
+ return reasonOrValue;
+ }
+}
+
+Promise.prototype._passThrough = function(handler, type, success, fail) {
+ if (typeof handler !== "function") return this.then();
+ return this._then(success,
+ fail,
+ undefined,
+ new PassThroughHandlerContext(this, type, handler),
+ undefined);
+};
+
+Promise.prototype.lastly =
+Promise.prototype["finally"] = function (handler) {
+ return this._passThrough(handler,
+ 0,
+ finallyHandler,
+ finallyHandler);
+};
+
+
+Promise.prototype.tap = function (handler) {
+ return this._passThrough(handler, 1, finallyHandler);
+};
+
+Promise.prototype.tapCatch = function (handlerOrPredicate) {
+ var len = arguments.length;
+ if(len === 1) {
+ return this._passThrough(handlerOrPredicate,
+ 1,
+ undefined,
+ finallyHandler);
+ } else {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return Promise.reject(new TypeError(
+ "tapCatch statement predicate: "
+ + "expecting an object but got " + util.classString(item)
+ ));
+ }
+ }
+ catchInstances.length = j;
+ var handler = arguments[i];
+ return this._passThrough(catchFilter(catchInstances, handler, this),
+ 1,
+ undefined,
+ finallyHandler);
+ }
+
+};
+
+return PassThroughHandlerContext;
+};
+
+},{"./catch_filter":7,"./util":36}],16:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ apiRejection,
+ INTERNAL,
+ tryConvertToPromise,
+ Proxyable,
+ debug) {
+var errors = _dereq_("./errors");
+var TypeError = errors.TypeError;
+var util = _dereq_("./util");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+var yieldHandlers = [];
+
+function promiseFromYieldHandler(value, yieldHandlers, traceParent) {
+ for (var i = 0; i < yieldHandlers.length; ++i) {
+ traceParent._pushContext();
+ var result = tryCatch(yieldHandlers[i])(value);
+ traceParent._popContext();
+ if (result === errorObj) {
+ traceParent._pushContext();
+ var ret = Promise.reject(errorObj.e);
+ traceParent._popContext();
+ return ret;
+ }
+ var maybePromise = tryConvertToPromise(result, traceParent);
+ if (maybePromise instanceof Promise) return maybePromise;
+ }
+ return null;
+}
+
+function PromiseSpawn(generatorFunction, receiver, yieldHandler, stack) {
+ if (debug.cancellation()) {
+ var internal = new Promise(INTERNAL);
+ var _finallyPromise = this._finallyPromise = new Promise(INTERNAL);
+ this._promise = internal.lastly(function() {
+ return _finallyPromise;
+ });
+ internal._captureStackTrace();
+ internal._setOnCancel(this);
+ } else {
+ var promise = this._promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ }
+ this._stack = stack;
+ this._generatorFunction = generatorFunction;
+ this._receiver = receiver;
+ this._generator = undefined;
+ this._yieldHandlers = typeof yieldHandler === "function"
+ ? [yieldHandler].concat(yieldHandlers)
+ : yieldHandlers;
+ this._yieldedPromise = null;
+ this._cancellationPhase = false;
+}
+util.inherits(PromiseSpawn, Proxyable);
+
+PromiseSpawn.prototype._isResolved = function() {
+ return this._promise === null;
+};
+
+PromiseSpawn.prototype._cleanup = function() {
+ this._promise = this._generator = null;
+ if (debug.cancellation() && this._finallyPromise !== null) {
+ this._finallyPromise._fulfill();
+ this._finallyPromise = null;
+ }
+};
+
+PromiseSpawn.prototype._promiseCancelled = function() {
+ if (this._isResolved()) return;
+ var implementsReturn = typeof this._generator["return"] !== "undefined";
+
+ var result;
+ if (!implementsReturn) {
+ var reason = new Promise.CancellationError(
+ "generator .return() sentinel");
+ Promise.coroutine.returnSentinel = reason;
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ result = tryCatch(this._generator["throw"]).call(this._generator,
+ reason);
+ this._promise._popContext();
+ } else {
+ this._promise._pushContext();
+ result = tryCatch(this._generator["return"]).call(this._generator,
+ undefined);
+ this._promise._popContext();
+ }
+ this._cancellationPhase = true;
+ this._yieldedPromise = null;
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._promiseFulfilled = function(value) {
+ this._yieldedPromise = null;
+ this._promise._pushContext();
+ var result = tryCatch(this._generator.next).call(this._generator, value);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._promiseRejected = function(reason) {
+ this._yieldedPromise = null;
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ var result = tryCatch(this._generator["throw"])
+ .call(this._generator, reason);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._resultCancelled = function() {
+ if (this._yieldedPromise instanceof Promise) {
+ var promise = this._yieldedPromise;
+ this._yieldedPromise = null;
+ promise.cancel();
+ }
+};
+
+PromiseSpawn.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseSpawn.prototype._run = function () {
+ this._generator = this._generatorFunction.call(this._receiver);
+ this._receiver =
+ this._generatorFunction = undefined;
+ this._promiseFulfilled(undefined);
+};
+
+PromiseSpawn.prototype._continue = function (result) {
+ var promise = this._promise;
+ if (result === errorObj) {
+ this._cleanup();
+ if (this._cancellationPhase) {
+ return promise.cancel();
+ } else {
+ return promise._rejectCallback(result.e, false);
+ }
+ }
+
+ var value = result.value;
+ if (result.done === true) {
+ this._cleanup();
+ if (this._cancellationPhase) {
+ return promise.cancel();
+ } else {
+ return promise._resolveCallback(value);
+ }
+ } else {
+ var maybePromise = tryConvertToPromise(value, this._promise);
+ if (!(maybePromise instanceof Promise)) {
+ maybePromise =
+ promiseFromYieldHandler(maybePromise,
+ this._yieldHandlers,
+ this._promise);
+ if (maybePromise === null) {
+ this._promiseRejected(
+ new TypeError(
+ "A value %s was yielded that could not be treated as a promise\u000a\u000a See http://goo.gl/MqrFmX\u000a\u000a".replace("%s", String(value)) +
+ "From coroutine:\u000a" +
+ this._stack.split("\n").slice(1, -7).join("\n")
+ )
+ );
+ return;
+ }
+ }
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ this._yieldedPromise = maybePromise;
+ maybePromise._proxy(this, null);
+ } else if (((bitField & 33554432) !== 0)) {
+ Promise._async.invoke(
+ this._promiseFulfilled, this, maybePromise._value()
+ );
+ } else if (((bitField & 16777216) !== 0)) {
+ Promise._async.invoke(
+ this._promiseRejected, this, maybePromise._reason()
+ );
+ } else {
+ this._promiseCancelled();
+ }
+ }
+};
+
+Promise.coroutine = function (generatorFunction, options) {
+ if (typeof generatorFunction !== "function") {
+ throw new TypeError("generatorFunction must be a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var yieldHandler = Object(options).yieldHandler;
+ var PromiseSpawn$ = PromiseSpawn;
+ var stack = new Error().stack;
+ return function () {
+ var generator = generatorFunction.apply(this, arguments);
+ var spawn = new PromiseSpawn$(undefined, undefined, yieldHandler,
+ stack);
+ var ret = spawn.promise();
+ spawn._generator = generator;
+ spawn._promiseFulfilled(undefined);
+ return ret;
+ };
+};
+
+Promise.coroutine.addYieldHandler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ yieldHandlers.push(fn);
+};
+
+Promise.spawn = function (generatorFunction) {
+ debug.deprecated("Promise.spawn()", "Promise.coroutine()");
+ if (typeof generatorFunction !== "function") {
+ return apiRejection("generatorFunction must be a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var spawn = new PromiseSpawn(generatorFunction, this);
+ var ret = spawn.promise();
+ spawn._run(Promise.spawn);
+ return ret;
+};
+};
+
+},{"./errors":12,"./util":36}],17:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, PromiseArray, tryConvertToPromise, INTERNAL, async,
+ getDomain) {
+var util = _dereq_("./util");
+var canEvaluate = util.canEvaluate;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var reject;
+
+if (!true) {
+if (canEvaluate) {
+ var thenCallback = function(i) {
+ return new Function("value", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = value; \n\
+ holder.checkFulfillment(this); \n\
+ ".replace(/Index/g, i));
+ };
+
+ var promiseSetter = function(i) {
+ return new Function("promise", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = promise; \n\
+ ".replace(/Index/g, i));
+ };
+
+ var generateHolderClass = function(total) {
+ var props = new Array(total);
+ for (var i = 0; i < props.length; ++i) {
+ props[i] = "this.p" + (i+1);
+ }
+ var assignment = props.join(" = ") + " = null;";
+ var cancellationCode= "var promise;\n" + props.map(function(prop) {
+ return " \n\
+ promise = " + prop + "; \n\
+ if (promise instanceof Promise) { \n\
+ promise.cancel(); \n\
+ } \n\
+ ";
+ }).join("\n");
+ var passedArguments = props.join(", ");
+ var name = "Holder$" + total;
+
+
+ var code = "return function(tryCatch, errorObj, Promise, async) { \n\
+ 'use strict'; \n\
+ function [TheName](fn) { \n\
+ [TheProperties] \n\
+ this.fn = fn; \n\
+ this.asyncNeeded = true; \n\
+ this.now = 0; \n\
+ } \n\
+ \n\
+ [TheName].prototype._callFunction = function(promise) { \n\
+ promise._pushContext(); \n\
+ var ret = tryCatch(this.fn)([ThePassedArguments]); \n\
+ promise._popContext(); \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(ret.e, false); \n\
+ } else { \n\
+ promise._resolveCallback(ret); \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype.checkFulfillment = function(promise) { \n\
+ var now = ++this.now; \n\
+ if (now === [TheTotal]) { \n\
+ if (this.asyncNeeded) { \n\
+ async.invoke(this._callFunction, this, promise); \n\
+ } else { \n\
+ this._callFunction(promise); \n\
+ } \n\
+ \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype._resultCancelled = function() { \n\
+ [CancellationCode] \n\
+ }; \n\
+ \n\
+ return [TheName]; \n\
+ }(tryCatch, errorObj, Promise, async); \n\
+ ";
+
+ code = code.replace(/\[TheName\]/g, name)
+ .replace(/\[TheTotal\]/g, total)
+ .replace(/\[ThePassedArguments\]/g, passedArguments)
+ .replace(/\[TheProperties\]/g, assignment)
+ .replace(/\[CancellationCode\]/g, cancellationCode);
+
+ return new Function("tryCatch", "errorObj", "Promise", "async", code)
+ (tryCatch, errorObj, Promise, async);
+ };
+
+ var holderClasses = [];
+ var thenCallbacks = [];
+ var promiseSetters = [];
+
+ for (var i = 0; i < 8; ++i) {
+ holderClasses.push(generateHolderClass(i + 1));
+ thenCallbacks.push(thenCallback(i + 1));
+ promiseSetters.push(promiseSetter(i + 1));
+ }
+
+ reject = function (reason) {
+ this._reject(reason);
+ };
+}}
+
+Promise.join = function () {
+ var last = arguments.length - 1;
+ var fn;
+ if (last > 0 && typeof arguments[last] === "function") {
+ fn = arguments[last];
+ if (!true) {
+ if (last <= 8 && canEvaluate) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var HolderClass = holderClasses[last - 1];
+ var holder = new HolderClass(fn);
+ var callbacks = thenCallbacks;
+
+ for (var i = 0; i < last; ++i) {
+ var maybePromise = tryConvertToPromise(arguments[i], ret);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._then(callbacks[i], reject,
+ undefined, ret, holder);
+ promiseSetters[i](maybePromise, holder);
+ holder.asyncNeeded = false;
+ } else if (((bitField & 33554432) !== 0)) {
+ callbacks[i].call(ret,
+ maybePromise._value(), holder);
+ } else if (((bitField & 16777216) !== 0)) {
+ ret._reject(maybePromise._reason());
+ } else {
+ ret._cancel();
+ }
+ } else {
+ callbacks[i].call(ret, maybePromise, holder);
+ }
+ }
+
+ if (!ret._isFateSealed()) {
+ if (holder.asyncNeeded) {
+ var domain = getDomain();
+ if (domain !== null) {
+ holder.fn = util.domainBind(domain, holder.fn);
+ }
+ }
+ ret._setAsyncGuaranteed();
+ ret._setOnCancel(holder);
+ }
+ return ret;
+ }
+ }
+ }
+ var args = [].slice.call(arguments);;
+ if (fn) args.pop();
+ var ret = new PromiseArray(args).promise();
+ return fn !== undefined ? ret.spread(fn) : ret;
+};
+
+};
+
+},{"./util":36}],18:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL,
+ debug) {
+var getDomain = Promise._getDomain;
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+function MappingPromiseArray(promises, fn, limit, _filter) {
+ this.constructor$(promises);
+ this._promise._captureStackTrace();
+ var domain = getDomain();
+ this._callback = domain === null ? fn : util.domainBind(domain, fn);
+ this._preservedValues = _filter === INTERNAL
+ ? new Array(this.length())
+ : null;
+ this._limit = limit;
+ this._inFlight = 0;
+ this._queue = [];
+ async.invoke(this._asyncInit, this, undefined);
+}
+util.inherits(MappingPromiseArray, PromiseArray);
+
+MappingPromiseArray.prototype._asyncInit = function() {
+ this._init$(undefined, -2);
+};
+
+MappingPromiseArray.prototype._init = function () {};
+
+MappingPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var values = this._values;
+ var length = this.length();
+ var preservedValues = this._preservedValues;
+ var limit = this._limit;
+
+ if (index < 0) {
+ index = (index * -1) - 1;
+ values[index] = value;
+ if (limit >= 1) {
+ this._inFlight--;
+ this._drainQueue();
+ if (this._isResolved()) return true;
+ }
+ } else {
+ if (limit >= 1 && this._inFlight >= limit) {
+ values[index] = value;
+ this._queue.push(index);
+ return false;
+ }
+ if (preservedValues !== null) preservedValues[index] = value;
+
+ var promise = this._promise;
+ var callback = this._callback;
+ var receiver = promise._boundValue();
+ promise._pushContext();
+ var ret = tryCatch(callback).call(receiver, value, index, length);
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret,
+ promiseCreated,
+ preservedValues !== null ? "Promise.filter" : "Promise.map",
+ promise
+ );
+ if (ret === errorObj) {
+ this._reject(ret.e);
+ return true;
+ }
+
+ var maybePromise = tryConvertToPromise(ret, this._promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ if (limit >= 1) this._inFlight++;
+ values[index] = maybePromise;
+ maybePromise._proxy(this, (index + 1) * -1);
+ return false;
+ } else if (((bitField & 33554432) !== 0)) {
+ ret = maybePromise._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(maybePromise._reason());
+ return true;
+ } else {
+ this._cancel();
+ return true;
+ }
+ }
+ values[index] = ret;
+ }
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= length) {
+ if (preservedValues !== null) {
+ this._filter(values, preservedValues);
+ } else {
+ this._resolve(values);
+ }
+ return true;
+ }
+ return false;
+};
+
+MappingPromiseArray.prototype._drainQueue = function () {
+ var queue = this._queue;
+ var limit = this._limit;
+ var values = this._values;
+ while (queue.length > 0 && this._inFlight < limit) {
+ if (this._isResolved()) return;
+ var index = queue.pop();
+ this._promiseFulfilled(values[index], index);
+ }
+};
+
+MappingPromiseArray.prototype._filter = function (booleans, values) {
+ var len = values.length;
+ var ret = new Array(len);
+ var j = 0;
+ for (var i = 0; i < len; ++i) {
+ if (booleans[i]) ret[j++] = values[i];
+ }
+ ret.length = j;
+ this._resolve(ret);
+};
+
+MappingPromiseArray.prototype.preservedValues = function () {
+ return this._preservedValues;
+};
+
+function map(promises, fn, options, _filter) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+
+ var limit = 0;
+ if (options !== undefined) {
+ if (typeof options === "object" && options !== null) {
+ if (typeof options.concurrency !== "number") {
+ return Promise.reject(
+ new TypeError("'concurrency' must be a number but it is " +
+ util.classString(options.concurrency)));
+ }
+ limit = options.concurrency;
+ } else {
+ return Promise.reject(new TypeError(
+ "options argument must be an object but it is " +
+ util.classString(options)));
+ }
+ }
+ limit = typeof limit === "number" &&
+ isFinite(limit) && limit >= 1 ? limit : 0;
+ return new MappingPromiseArray(promises, fn, limit, _filter).promise();
+}
+
+Promise.prototype.map = function (fn, options) {
+ return map(this, fn, options, null);
+};
+
+Promise.map = function (promises, fn, options, _filter) {
+ return map(promises, fn, options, _filter);
+};
+
+
+};
+
+},{"./util":36}],19:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, INTERNAL, tryConvertToPromise, apiRejection, debug) {
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+
+Promise.method = function (fn) {
+ if (typeof fn !== "function") {
+ throw new Promise.TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return function () {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = tryCatch(fn).apply(this, arguments);
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.method", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+ };
+};
+
+Promise.attempt = Promise["try"] = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value;
+ if (arguments.length > 1) {
+ debug.deprecated("calling Promise.try with more than 1 argument");
+ var arg = arguments[1];
+ var ctx = arguments[2];
+ value = util.isArray(arg) ? tryCatch(fn).apply(ctx, arg)
+ : tryCatch(fn).call(ctx, arg);
+ } else {
+ value = tryCatch(fn)();
+ }
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.try", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+};
+
+Promise.prototype._resolveFromSyncValue = function (value) {
+ if (value === util.errorObj) {
+ this._rejectCallback(value.e, false);
+ } else {
+ this._resolveCallback(value, true);
+ }
+};
+};
+
+},{"./util":36}],20:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util");
+var maybeWrapAsError = util.maybeWrapAsError;
+var errors = _dereq_("./errors");
+var OperationalError = errors.OperationalError;
+var es5 = _dereq_("./es5");
+
+function isUntypedError(obj) {
+ return obj instanceof Error &&
+ es5.getPrototypeOf(obj) === Error.prototype;
+}
+
+var rErrorKey = /^(?:name|message|stack|cause)$/;
+function wrapAsOperationalError(obj) {
+ var ret;
+ if (isUntypedError(obj)) {
+ ret = new OperationalError(obj);
+ ret.name = obj.name;
+ ret.message = obj.message;
+ ret.stack = obj.stack;
+ var keys = es5.keys(obj);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (!rErrorKey.test(key)) {
+ ret[key] = obj[key];
+ }
+ }
+ return ret;
+ }
+ util.markAsOriginatingFromRejection(obj);
+ return obj;
+}
+
+function nodebackForPromise(promise, multiArgs) {
+ return function(err, value) {
+ if (promise === null) return;
+ if (err) {
+ var wrapped = wrapAsOperationalError(maybeWrapAsError(err));
+ promise._attachExtraTrace(wrapped);
+ promise._reject(wrapped);
+ } else if (!multiArgs) {
+ promise._fulfill(value);
+ } else {
+ var args = [].slice.call(arguments, 1);;
+ promise._fulfill(args);
+ }
+ promise = null;
+ };
+}
+
+module.exports = nodebackForPromise;
+
+},{"./errors":12,"./es5":13,"./util":36}],21:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var util = _dereq_("./util");
+var async = Promise._async;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function spreadAdapter(val, nodeback) {
+ var promise = this;
+ if (!util.isArray(val)) return successAdapter.call(promise, val, nodeback);
+ var ret =
+ tryCatch(nodeback).apply(promise._boundValue(), [null].concat(val));
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+function successAdapter(val, nodeback) {
+ var promise = this;
+ var receiver = promise._boundValue();
+ var ret = val === undefined
+ ? tryCatch(nodeback).call(receiver, null)
+ : tryCatch(nodeback).call(receiver, null, val);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+function errorAdapter(reason, nodeback) {
+ var promise = this;
+ if (!reason) {
+ var newReason = new Error(reason + "");
+ newReason.cause = reason;
+ reason = newReason;
+ }
+ var ret = tryCatch(nodeback).call(promise._boundValue(), reason);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+Promise.prototype.asCallback = Promise.prototype.nodeify = function (nodeback,
+ options) {
+ if (typeof nodeback == "function") {
+ var adapter = successAdapter;
+ if (options !== undefined && Object(options).spread) {
+ adapter = spreadAdapter;
+ }
+ this._then(
+ adapter,
+ errorAdapter,
+ undefined,
+ this,
+ nodeback
+ );
+ }
+ return this;
+};
+};
+
+},{"./util":36}],22:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function() {
+var makeSelfResolutionError = function () {
+ return new TypeError("circular promise resolution chain\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var reflectHandler = function() {
+ return new Promise.PromiseInspection(this._target());
+};
+var apiRejection = function(msg) {
+ return Promise.reject(new TypeError(msg));
+};
+function Proxyable() {}
+var UNDEFINED_BINDING = {};
+var util = _dereq_("./util");
+
+var getDomain;
+if (util.isNode) {
+ getDomain = function() {
+ var ret = process.domain;
+ if (ret === undefined) ret = null;
+ return ret;
+ };
+} else {
+ getDomain = function() {
+ return null;
+ };
+}
+util.notEnumerableProp(Promise, "_getDomain", getDomain);
+
+var es5 = _dereq_("./es5");
+var Async = _dereq_("./async");
+var async = new Async();
+es5.defineProperty(Promise, "_async", {value: async});
+var errors = _dereq_("./errors");
+var TypeError = Promise.TypeError = errors.TypeError;
+Promise.RangeError = errors.RangeError;
+var CancellationError = Promise.CancellationError = errors.CancellationError;
+Promise.TimeoutError = errors.TimeoutError;
+Promise.OperationalError = errors.OperationalError;
+Promise.RejectionError = errors.OperationalError;
+Promise.AggregateError = errors.AggregateError;
+var INTERNAL = function(){};
+var APPLY = {};
+var NEXT_FILTER = {};
+var tryConvertToPromise = _dereq_("./thenables")(Promise, INTERNAL);
+var PromiseArray =
+ _dereq_("./promise_array")(Promise, INTERNAL,
+ tryConvertToPromise, apiRejection, Proxyable);
+var Context = _dereq_("./context")(Promise);
+ /*jshint unused:false*/
+var createContext = Context.create;
+var debug = _dereq_("./debuggability")(Promise, Context);
+var CapturedTrace = debug.CapturedTrace;
+var PassThroughHandlerContext =
+ _dereq_("./finally")(Promise, tryConvertToPromise, NEXT_FILTER);
+var catchFilter = _dereq_("./catch_filter")(NEXT_FILTER);
+var nodebackForPromise = _dereq_("./nodeback");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+function check(self, executor) {
+ if (self == null || self.constructor !== Promise) {
+ throw new TypeError("the promise constructor cannot be invoked directly\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (typeof executor !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(executor));
+ }
+
+}
+
+function Promise(executor) {
+ if (executor !== INTERNAL) {
+ check(this, executor);
+ }
+ this._bitField = 0;
+ this._fulfillmentHandler0 = undefined;
+ this._rejectionHandler0 = undefined;
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._resolveFromExecutor(executor);
+ this._promiseCreated();
+ this._fireEvent("promiseCreated", this);
+}
+
+Promise.prototype.toString = function () {
+ return "[object Promise]";
+};
+
+Promise.prototype.caught = Promise.prototype["catch"] = function (fn) {
+ var len = arguments.length;
+ if (len > 1) {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return apiRejection("Catch statement predicate: " +
+ "expecting an object but got " + util.classString(item));
+ }
+ }
+ catchInstances.length = j;
+ fn = arguments[i];
+ return this.then(undefined, catchFilter(catchInstances, fn, this));
+ }
+ return this.then(undefined, fn);
+};
+
+Promise.prototype.reflect = function () {
+ return this._then(reflectHandler,
+ reflectHandler, undefined, this, undefined);
+};
+
+Promise.prototype.then = function (didFulfill, didReject) {
+ if (debug.warnings() && arguments.length > 0 &&
+ typeof didFulfill !== "function" &&
+ typeof didReject !== "function") {
+ var msg = ".then() only accepts functions but was passed: " +
+ util.classString(didFulfill);
+ if (arguments.length > 1) {
+ msg += ", " + util.classString(didReject);
+ }
+ this._warn(msg);
+ }
+ return this._then(didFulfill, didReject, undefined, undefined, undefined);
+};
+
+Promise.prototype.done = function (didFulfill, didReject) {
+ var promise =
+ this._then(didFulfill, didReject, undefined, undefined, undefined);
+ promise._setIsFinal();
+};
+
+Promise.prototype.spread = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ return this.all()._then(fn, undefined, undefined, APPLY, undefined);
+};
+
+Promise.prototype.toJSON = function () {
+ var ret = {
+ isFulfilled: false,
+ isRejected: false,
+ fulfillmentValue: undefined,
+ rejectionReason: undefined
+ };
+ if (this.isFulfilled()) {
+ ret.fulfillmentValue = this.value();
+ ret.isFulfilled = true;
+ } else if (this.isRejected()) {
+ ret.rejectionReason = this.reason();
+ ret.isRejected = true;
+ }
+ return ret;
+};
+
+Promise.prototype.all = function () {
+ if (arguments.length > 0) {
+ this._warn(".all() was passed arguments but it does not take any");
+ }
+ return new PromiseArray(this).promise();
+};
+
+Promise.prototype.error = function (fn) {
+ return this.caught(util.originatesFromRejection, fn);
+};
+
+Promise.getNewLibraryCopy = module.exports;
+
+Promise.is = function (val) {
+ return val instanceof Promise;
+};
+
+Promise.fromNode = Promise.fromCallback = function(fn) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var multiArgs = arguments.length > 1 ? !!Object(arguments[1]).multiArgs
+ : false;
+ var result = tryCatch(fn)(nodebackForPromise(ret, multiArgs));
+ if (result === errorObj) {
+ ret._rejectCallback(result.e, true);
+ }
+ if (!ret._isFateSealed()) ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.all = function (promises) {
+ return new PromiseArray(promises).promise();
+};
+
+Promise.cast = function (obj) {
+ var ret = tryConvertToPromise(obj);
+ if (!(ret instanceof Promise)) {
+ ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._setFulfilled();
+ ret._rejectionHandler0 = obj;
+ }
+ return ret;
+};
+
+Promise.resolve = Promise.fulfilled = Promise.cast;
+
+Promise.reject = Promise.rejected = function (reason) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._rejectCallback(reason, true);
+ return ret;
+};
+
+Promise.setScheduler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return async.setScheduler(fn);
+};
+
+Promise.prototype._then = function (
+ didFulfill,
+ didReject,
+ _, receiver,
+ internalData
+) {
+ var haveInternalData = internalData !== undefined;
+ var promise = haveInternalData ? internalData : new Promise(INTERNAL);
+ var target = this._target();
+ var bitField = target._bitField;
+
+ if (!haveInternalData) {
+ promise._propagateFrom(this, 3);
+ promise._captureStackTrace();
+ if (receiver === undefined &&
+ ((this._bitField & 2097152) !== 0)) {
+ if (!((bitField & 50397184) === 0)) {
+ receiver = this._boundValue();
+ } else {
+ receiver = target === this ? undefined : this._boundTo;
+ }
+ }
+ this._fireEvent("promiseChained", this, promise);
+ }
+
+ var domain = getDomain();
+ if (!((bitField & 50397184) === 0)) {
+ var handler, value, settler = target._settlePromiseCtx;
+ if (((bitField & 33554432) !== 0)) {
+ value = target._rejectionHandler0;
+ handler = didFulfill;
+ } else if (((bitField & 16777216) !== 0)) {
+ value = target._fulfillmentHandler0;
+ handler = didReject;
+ target._unsetRejectionIsUnhandled();
+ } else {
+ settler = target._settlePromiseLateCancellationObserver;
+ value = new CancellationError("late cancellation observer");
+ target._attachExtraTrace(value);
+ handler = didReject;
+ }
+
+ async.invoke(settler, target, {
+ handler: domain === null ? handler
+ : (typeof handler === "function" &&
+ util.domainBind(domain, handler)),
+ promise: promise,
+ receiver: receiver,
+ value: value
+ });
+ } else {
+ target._addCallbacks(didFulfill, didReject, promise, receiver, domain);
+ }
+
+ return promise;
+};
+
+Promise.prototype._length = function () {
+ return this._bitField & 65535;
+};
+
+Promise.prototype._isFateSealed = function () {
+ return (this._bitField & 117506048) !== 0;
+};
+
+Promise.prototype._isFollowing = function () {
+ return (this._bitField & 67108864) === 67108864;
+};
+
+Promise.prototype._setLength = function (len) {
+ this._bitField = (this._bitField & -65536) |
+ (len & 65535);
+};
+
+Promise.prototype._setFulfilled = function () {
+ this._bitField = this._bitField | 33554432;
+ this._fireEvent("promiseFulfilled", this);
+};
+
+Promise.prototype._setRejected = function () {
+ this._bitField = this._bitField | 16777216;
+ this._fireEvent("promiseRejected", this);
+};
+
+Promise.prototype._setFollowing = function () {
+ this._bitField = this._bitField | 67108864;
+ this._fireEvent("promiseResolved", this);
+};
+
+Promise.prototype._setIsFinal = function () {
+ this._bitField = this._bitField | 4194304;
+};
+
+Promise.prototype._isFinal = function () {
+ return (this._bitField & 4194304) > 0;
+};
+
+Promise.prototype._unsetCancelled = function() {
+ this._bitField = this._bitField & (~65536);
+};
+
+Promise.prototype._setCancelled = function() {
+ this._bitField = this._bitField | 65536;
+ this._fireEvent("promiseCancelled", this);
+};
+
+Promise.prototype._setWillBeCancelled = function() {
+ this._bitField = this._bitField | 8388608;
+};
+
+Promise.prototype._setAsyncGuaranteed = function() {
+ if (async.hasCustomScheduler()) return;
+ this._bitField = this._bitField | 134217728;
+};
+
+Promise.prototype._receiverAt = function (index) {
+ var ret = index === 0 ? this._receiver0 : this[
+ index * 4 - 4 + 3];
+ if (ret === UNDEFINED_BINDING) {
+ return undefined;
+ } else if (ret === undefined && this._isBound()) {
+ return this._boundValue();
+ }
+ return ret;
+};
+
+Promise.prototype._promiseAt = function (index) {
+ return this[
+ index * 4 - 4 + 2];
+};
+
+Promise.prototype._fulfillmentHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 0];
+};
+
+Promise.prototype._rejectionHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 1];
+};
+
+Promise.prototype._boundValue = function() {};
+
+Promise.prototype._migrateCallback0 = function (follower) {
+ var bitField = follower._bitField;
+ var fulfill = follower._fulfillmentHandler0;
+ var reject = follower._rejectionHandler0;
+ var promise = follower._promise0;
+ var receiver = follower._receiverAt(0);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._migrateCallbackAt = function (follower, index) {
+ var fulfill = follower._fulfillmentHandlerAt(index);
+ var reject = follower._rejectionHandlerAt(index);
+ var promise = follower._promiseAt(index);
+ var receiver = follower._receiverAt(index);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._addCallbacks = function (
+ fulfill,
+ reject,
+ promise,
+ receiver,
+ domain
+) {
+ var index = this._length();
+
+ if (index >= 65535 - 4) {
+ index = 0;
+ this._setLength(0);
+ }
+
+ if (index === 0) {
+ this._promise0 = promise;
+ this._receiver0 = receiver;
+ if (typeof fulfill === "function") {
+ this._fulfillmentHandler0 =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this._rejectionHandler0 =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ } else {
+ var base = index * 4 - 4;
+ this[base + 2] = promise;
+ this[base + 3] = receiver;
+ if (typeof fulfill === "function") {
+ this[base + 0] =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this[base + 1] =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ }
+ this._setLength(index + 1);
+ return index;
+};
+
+Promise.prototype._proxy = function (proxyable, arg) {
+ this._addCallbacks(undefined, undefined, arg, proxyable, null);
+};
+
+Promise.prototype._resolveCallback = function(value, shouldBind) {
+ if (((this._bitField & 117506048) !== 0)) return;
+ if (value === this)
+ return this._rejectCallback(makeSelfResolutionError(), false);
+ var maybePromise = tryConvertToPromise(value, this);
+ if (!(maybePromise instanceof Promise)) return this._fulfill(value);
+
+ if (shouldBind) this._propagateFrom(maybePromise, 2);
+
+ var promise = maybePromise._target();
+
+ if (promise === this) {
+ this._reject(makeSelfResolutionError());
+ return;
+ }
+
+ var bitField = promise._bitField;
+ if (((bitField & 50397184) === 0)) {
+ var len = this._length();
+ if (len > 0) promise._migrateCallback0(this);
+ for (var i = 1; i < len; ++i) {
+ promise._migrateCallbackAt(this, i);
+ }
+ this._setFollowing();
+ this._setLength(0);
+ this._setFollowee(promise);
+ } else if (((bitField & 33554432) !== 0)) {
+ this._fulfill(promise._value());
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(promise._reason());
+ } else {
+ var reason = new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ this._reject(reason);
+ }
+};
+
+Promise.prototype._rejectCallback =
+function(reason, synchronous, ignoreNonErrorWarnings) {
+ var trace = util.ensureErrorObject(reason);
+ var hasStack = trace === reason;
+ if (!hasStack && !ignoreNonErrorWarnings && debug.warnings()) {
+ var message = "a promise was rejected with a non-error: " +
+ util.classString(reason);
+ this._warn(message, true);
+ }
+ this._attachExtraTrace(trace, synchronous ? hasStack : false);
+ this._reject(reason);
+};
+
+Promise.prototype._resolveFromExecutor = function (executor) {
+ if (executor === INTERNAL) return;
+ var promise = this;
+ this._captureStackTrace();
+ this._pushContext();
+ var synchronous = true;
+ var r = this._execute(executor, function(value) {
+ promise._resolveCallback(value);
+ }, function (reason) {
+ promise._rejectCallback(reason, synchronous);
+ });
+ synchronous = false;
+ this._popContext();
+
+ if (r !== undefined) {
+ promise._rejectCallback(r, true);
+ }
+};
+
+Promise.prototype._settlePromiseFromHandler = function (
+ handler, receiver, value, promise
+) {
+ var bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+ promise._pushContext();
+ var x;
+ if (receiver === APPLY) {
+ if (!value || typeof value.length !== "number") {
+ x = errorObj;
+ x.e = new TypeError("cannot .spread() a non-array: " +
+ util.classString(value));
+ } else {
+ x = tryCatch(handler).apply(this._boundValue(), value);
+ }
+ } else {
+ x = tryCatch(handler).call(receiver, value);
+ }
+ var promiseCreated = promise._popContext();
+ bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+
+ if (x === NEXT_FILTER) {
+ promise._reject(value);
+ } else if (x === errorObj) {
+ promise._rejectCallback(x.e, false);
+ } else {
+ debug.checkForgottenReturns(x, promiseCreated, "", promise, this);
+ promise._resolveCallback(x);
+ }
+};
+
+Promise.prototype._target = function() {
+ var ret = this;
+ while (ret._isFollowing()) ret = ret._followee();
+ return ret;
+};
+
+Promise.prototype._followee = function() {
+ return this._rejectionHandler0;
+};
+
+Promise.prototype._setFollowee = function(promise) {
+ this._rejectionHandler0 = promise;
+};
+
+Promise.prototype._settlePromise = function(promise, handler, receiver, value) {
+ var isPromise = promise instanceof Promise;
+ var bitField = this._bitField;
+ var asyncGuaranteed = ((bitField & 134217728) !== 0);
+ if (((bitField & 65536) !== 0)) {
+ if (isPromise) promise._invokeInternalOnCancel();
+
+ if (receiver instanceof PassThroughHandlerContext &&
+ receiver.isFinallyHandler()) {
+ receiver.cancelPromise = promise;
+ if (tryCatch(handler).call(receiver, value) === errorObj) {
+ promise._reject(errorObj.e);
+ }
+ } else if (handler === reflectHandler) {
+ promise._fulfill(reflectHandler.call(receiver));
+ } else if (receiver instanceof Proxyable) {
+ receiver._promiseCancelled(promise);
+ } else if (isPromise || promise instanceof PromiseArray) {
+ promise._cancel();
+ } else {
+ receiver.cancel();
+ }
+ } else if (typeof handler === "function") {
+ if (!isPromise) {
+ handler.call(receiver, value, promise);
+ } else {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (receiver instanceof Proxyable) {
+ if (!receiver._isResolved()) {
+ if (((bitField & 33554432) !== 0)) {
+ receiver._promiseFulfilled(value, promise);
+ } else {
+ receiver._promiseRejected(value, promise);
+ }
+ }
+ } else if (isPromise) {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ if (((bitField & 33554432) !== 0)) {
+ promise._fulfill(value);
+ } else {
+ promise._reject(value);
+ }
+ }
+};
+
+Promise.prototype._settlePromiseLateCancellationObserver = function(ctx) {
+ var handler = ctx.handler;
+ var promise = ctx.promise;
+ var receiver = ctx.receiver;
+ var value = ctx.value;
+ if (typeof handler === "function") {
+ if (!(promise instanceof Promise)) {
+ handler.call(receiver, value, promise);
+ } else {
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (promise instanceof Promise) {
+ promise._reject(value);
+ }
+};
+
+Promise.prototype._settlePromiseCtx = function(ctx) {
+ this._settlePromise(ctx.promise, ctx.handler, ctx.receiver, ctx.value);
+};
+
+Promise.prototype._settlePromise0 = function(handler, value, bitField) {
+ var promise = this._promise0;
+ var receiver = this._receiverAt(0);
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._settlePromise(promise, handler, receiver, value);
+};
+
+Promise.prototype._clearCallbackDataAtIndex = function(index) {
+ var base = index * 4 - 4;
+ this[base + 2] =
+ this[base + 3] =
+ this[base + 0] =
+ this[base + 1] = undefined;
+};
+
+Promise.prototype._fulfill = function (value) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ if (value === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._reject(err);
+ }
+ this._setFulfilled();
+ this._rejectionHandler0 = value;
+
+ if ((bitField & 65535) > 0) {
+ if (((bitField & 134217728) !== 0)) {
+ this._settlePromises();
+ } else {
+ async.settlePromises(this);
+ }
+ }
+};
+
+Promise.prototype._reject = function (reason) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ this._setRejected();
+ this._fulfillmentHandler0 = reason;
+
+ if (this._isFinal()) {
+ return async.fatalError(reason, util.isNode);
+ }
+
+ if ((bitField & 65535) > 0) {
+ async.settlePromises(this);
+ } else {
+ this._ensurePossibleRejectionHandled();
+ }
+};
+
+Promise.prototype._fulfillPromises = function (len, value) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._fulfillmentHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, value);
+ }
+};
+
+Promise.prototype._rejectPromises = function (len, reason) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._rejectionHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, reason);
+ }
+};
+
+Promise.prototype._settlePromises = function () {
+ var bitField = this._bitField;
+ var len = (bitField & 65535);
+
+ if (len > 0) {
+ if (((bitField & 16842752) !== 0)) {
+ var reason = this._fulfillmentHandler0;
+ this._settlePromise0(this._rejectionHandler0, reason, bitField);
+ this._rejectPromises(len, reason);
+ } else {
+ var value = this._rejectionHandler0;
+ this._settlePromise0(this._fulfillmentHandler0, value, bitField);
+ this._fulfillPromises(len, value);
+ }
+ this._setLength(0);
+ }
+ this._clearCancellationData();
+};
+
+Promise.prototype._settledValue = function() {
+ var bitField = this._bitField;
+ if (((bitField & 33554432) !== 0)) {
+ return this._rejectionHandler0;
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._fulfillmentHandler0;
+ }
+};
+
+function deferResolve(v) {this.promise._resolveCallback(v);}
+function deferReject(v) {this.promise._rejectCallback(v, false);}
+
+Promise.defer = Promise.pending = function() {
+ debug.deprecated("Promise.defer", "new Promise");
+ var promise = new Promise(INTERNAL);
+ return {
+ promise: promise,
+ resolve: deferResolve,
+ reject: deferReject
+ };
+};
+
+util.notEnumerableProp(Promise,
+ "_makeSelfResolutionError",
+ makeSelfResolutionError);
+
+_dereq_("./method")(Promise, INTERNAL, tryConvertToPromise, apiRejection,
+ debug);
+_dereq_("./bind")(Promise, INTERNAL, tryConvertToPromise, debug);
+_dereq_("./cancel")(Promise, PromiseArray, apiRejection, debug);
+_dereq_("./direct_resolve")(Promise);
+_dereq_("./synchronous_inspection")(Promise);
+_dereq_("./join")(
+ Promise, PromiseArray, tryConvertToPromise, INTERNAL, async, getDomain);
+Promise.Promise = Promise;
+Promise.version = "3.5.1";
+_dereq_('./map.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL, debug);
+_dereq_('./call_get.js')(Promise);
+_dereq_('./using.js')(Promise, apiRejection, tryConvertToPromise, createContext, INTERNAL, debug);
+_dereq_('./timers.js')(Promise, INTERNAL, debug);
+_dereq_('./generators.js')(Promise, apiRejection, INTERNAL, tryConvertToPromise, Proxyable, debug);
+_dereq_('./nodeify.js')(Promise);
+_dereq_('./promisify.js')(Promise, INTERNAL);
+_dereq_('./props.js')(Promise, PromiseArray, tryConvertToPromise, apiRejection);
+_dereq_('./race.js')(Promise, INTERNAL, tryConvertToPromise, apiRejection);
+_dereq_('./reduce.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL, debug);
+_dereq_('./settle.js')(Promise, PromiseArray, debug);
+_dereq_('./some.js')(Promise, PromiseArray, apiRejection);
+_dereq_('./filter.js')(Promise, INTERNAL);
+_dereq_('./each.js')(Promise, INTERNAL);
+_dereq_('./any.js')(Promise);
+
+ util.toFastProperties(Promise);
+ util.toFastProperties(Promise.prototype);
+ function fillTypes(value) {
+ var p = new Promise(INTERNAL);
+ p._fulfillmentHandler0 = value;
+ p._rejectionHandler0 = value;
+ p._promise0 = value;
+ p._receiver0 = value;
+ }
+ // Complete slack tracking, opt out of field-type tracking and
+ // stabilize map
+ fillTypes({a: 1});
+ fillTypes({b: 2});
+ fillTypes({c: 3});
+ fillTypes(1);
+ fillTypes(function(){});
+ fillTypes(undefined);
+ fillTypes(false);
+ fillTypes(new Promise(INTERNAL));
+ debug.setBounds(Async.firstLineError, util.lastLineError);
+ return Promise;
+
+};
+
+},{"./any.js":1,"./async":2,"./bind":3,"./call_get.js":5,"./cancel":6,"./catch_filter":7,"./context":8,"./debuggability":9,"./direct_resolve":10,"./each.js":11,"./errors":12,"./es5":13,"./filter.js":14,"./finally":15,"./generators.js":16,"./join":17,"./map.js":18,"./method":19,"./nodeback":20,"./nodeify.js":21,"./promise_array":23,"./promisify.js":24,"./props.js":25,"./race.js":27,"./reduce.js":28,"./settle.js":30,"./some.js":31,"./synchronous_inspection":32,"./thenables":33,"./timers.js":34,"./using.js":35,"./util":36}],23:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise,
+ apiRejection, Proxyable) {
+var util = _dereq_("./util");
+var isArray = util.isArray;
+
+function toResolutionValue(val) {
+ switch(val) {
+ case -2: return [];
+ case -3: return {};
+ case -6: return new Map();
+ }
+}
+
+function PromiseArray(values) {
+ var promise = this._promise = new Promise(INTERNAL);
+ if (values instanceof Promise) {
+ promise._propagateFrom(values, 3);
+ }
+ promise._setOnCancel(this);
+ this._values = values;
+ this._length = 0;
+ this._totalResolved = 0;
+ this._init(undefined, -2);
+}
+util.inherits(PromiseArray, Proxyable);
+
+PromiseArray.prototype.length = function () {
+ return this._length;
+};
+
+PromiseArray.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseArray.prototype._init = function init(_, resolveValueIfEmpty) {
+ var values = tryConvertToPromise(this._values, this._promise);
+ if (values instanceof Promise) {
+ values = values._target();
+ var bitField = values._bitField;
+ ;
+ this._values = values;
+
+ if (((bitField & 50397184) === 0)) {
+ this._promise._setAsyncGuaranteed();
+ return values._then(
+ init,
+ this._reject,
+ undefined,
+ this,
+ resolveValueIfEmpty
+ );
+ } else if (((bitField & 33554432) !== 0)) {
+ values = values._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._reject(values._reason());
+ } else {
+ return this._cancel();
+ }
+ }
+ values = util.asArray(values);
+ if (values === null) {
+ var err = apiRejection(
+ "expecting an array or an iterable object but got " + util.classString(values)).reason();
+ this._promise._rejectCallback(err, false);
+ return;
+ }
+
+ if (values.length === 0) {
+ if (resolveValueIfEmpty === -5) {
+ this._resolveEmptyArray();
+ }
+ else {
+ this._resolve(toResolutionValue(resolveValueIfEmpty));
+ }
+ return;
+ }
+ this._iterate(values);
+};
+
+PromiseArray.prototype._iterate = function(values) {
+ var len = this.getActualLength(values.length);
+ this._length = len;
+ this._values = this.shouldCopyValues() ? new Array(len) : this._values;
+ var result = this._promise;
+ var isResolved = false;
+ var bitField = null;
+ for (var i = 0; i < len; ++i) {
+ var maybePromise = tryConvertToPromise(values[i], result);
+
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ bitField = maybePromise._bitField;
+ } else {
+ bitField = null;
+ }
+
+ if (isResolved) {
+ if (bitField !== null) {
+ maybePromise.suppressUnhandledRejections();
+ }
+ } else if (bitField !== null) {
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._proxy(this, i);
+ this._values[i] = maybePromise;
+ } else if (((bitField & 33554432) !== 0)) {
+ isResolved = this._promiseFulfilled(maybePromise._value(), i);
+ } else if (((bitField & 16777216) !== 0)) {
+ isResolved = this._promiseRejected(maybePromise._reason(), i);
+ } else {
+ isResolved = this._promiseCancelled(i);
+ }
+ } else {
+ isResolved = this._promiseFulfilled(maybePromise, i);
+ }
+ }
+ if (!isResolved) result._setAsyncGuaranteed();
+};
+
+PromiseArray.prototype._isResolved = function () {
+ return this._values === null;
+};
+
+PromiseArray.prototype._resolve = function (value) {
+ this._values = null;
+ this._promise._fulfill(value);
+};
+
+PromiseArray.prototype._cancel = function() {
+ if (this._isResolved() || !this._promise._isCancellable()) return;
+ this._values = null;
+ this._promise._cancel();
+};
+
+PromiseArray.prototype._reject = function (reason) {
+ this._values = null;
+ this._promise._rejectCallback(reason, false);
+};
+
+PromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+PromiseArray.prototype._promiseCancelled = function() {
+ this._cancel();
+ return true;
+};
+
+PromiseArray.prototype._promiseRejected = function (reason) {
+ this._totalResolved++;
+ this._reject(reason);
+ return true;
+};
+
+PromiseArray.prototype._resultCancelled = function() {
+ if (this._isResolved()) return;
+ var values = this._values;
+ this._cancel();
+ if (values instanceof Promise) {
+ values.cancel();
+ } else {
+ for (var i = 0; i < values.length; ++i) {
+ if (values[i] instanceof Promise) {
+ values[i].cancel();
+ }
+ }
+ }
+};
+
+PromiseArray.prototype.shouldCopyValues = function () {
+ return true;
+};
+
+PromiseArray.prototype.getActualLength = function (len) {
+ return len;
+};
+
+return PromiseArray;
+};
+
+},{"./util":36}],24:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var THIS = {};
+var util = _dereq_("./util");
+var nodebackForPromise = _dereq_("./nodeback");
+var withAppended = util.withAppended;
+var maybeWrapAsError = util.maybeWrapAsError;
+var canEvaluate = util.canEvaluate;
+var TypeError = _dereq_("./errors").TypeError;
+var defaultSuffix = "Async";
+var defaultPromisified = {__isPromisified__: true};
+var noCopyProps = [
+ "arity", "length",
+ "name",
+ "arguments",
+ "caller",
+ "callee",
+ "prototype",
+ "__isPromisified__"
+];
+var noCopyPropsPattern = new RegExp("^(?:" + noCopyProps.join("|") + ")$");
+
+var defaultFilter = function(name) {
+ return util.isIdentifier(name) &&
+ name.charAt(0) !== "_" &&
+ name !== "constructor";
+};
+
+function propsFilter(key) {
+ return !noCopyPropsPattern.test(key);
+}
+
+function isPromisified(fn) {
+ try {
+ return fn.__isPromisified__ === true;
+ }
+ catch (e) {
+ return false;
+ }
+}
+
+function hasPromisified(obj, key, suffix) {
+ var val = util.getDataPropertyOrDefault(obj, key + suffix,
+ defaultPromisified);
+ return val ? isPromisified(val) : false;
+}
+function checkValid(ret, suffix, suffixRegexp) {
+ for (var i = 0; i < ret.length; i += 2) {
+ var key = ret[i];
+ if (suffixRegexp.test(key)) {
+ var keyWithoutAsyncSuffix = key.replace(suffixRegexp, "");
+ for (var j = 0; j < ret.length; j += 2) {
+ if (ret[j] === keyWithoutAsyncSuffix) {
+ throw new TypeError("Cannot promisify an API that has normal methods with '%s'-suffix\u000a\u000a See http://goo.gl/MqrFmX\u000a"
+ .replace("%s", suffix));
+ }
+ }
+ }
+ }
+}
+
+function promisifiableMethods(obj, suffix, suffixRegexp, filter) {
+ var keys = util.inheritedDataKeys(obj);
+ var ret = [];
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ var value = obj[key];
+ var passesDefaultFilter = filter === defaultFilter
+ ? true : defaultFilter(key, value, obj);
+ if (typeof value === "function" &&
+ !isPromisified(value) &&
+ !hasPromisified(obj, key, suffix) &&
+ filter(key, value, obj, passesDefaultFilter)) {
+ ret.push(key, value);
+ }
+ }
+ checkValid(ret, suffix, suffixRegexp);
+ return ret;
+}
+
+var escapeIdentRegex = function(str) {
+ return str.replace(/([$])/, "\\$");
+};
+
+var makeNodePromisifiedEval;
+if (!true) {
+var switchCaseArgumentOrder = function(likelyArgumentCount) {
+ var ret = [likelyArgumentCount];
+ var min = Math.max(0, likelyArgumentCount - 1 - 3);
+ for(var i = likelyArgumentCount - 1; i >= min; --i) {
+ ret.push(i);
+ }
+ for(var i = likelyArgumentCount + 1; i <= 3; ++i) {
+ ret.push(i);
+ }
+ return ret;
+};
+
+var argumentSequence = function(argumentCount) {
+ return util.filledRange(argumentCount, "_arg", "");
+};
+
+var parameterDeclaration = function(parameterCount) {
+ return util.filledRange(
+ Math.max(parameterCount, 3), "_arg", "");
+};
+
+var parameterCount = function(fn) {
+ if (typeof fn.length === "number") {
+ return Math.max(Math.min(fn.length, 1023 + 1), 0);
+ }
+ return 0;
+};
+
+makeNodePromisifiedEval =
+function(callback, receiver, originalName, fn, _, multiArgs) {
+ var newParameterCount = Math.max(0, parameterCount(fn) - 1);
+ var argumentOrder = switchCaseArgumentOrder(newParameterCount);
+ var shouldProxyThis = typeof callback === "string" || receiver === THIS;
+
+ function generateCallForArgumentCount(count) {
+ var args = argumentSequence(count).join(", ");
+ var comma = count > 0 ? ", " : "";
+ var ret;
+ if (shouldProxyThis) {
+ ret = "ret = callback.call(this, {{args}}, nodeback); break;\n";
+ } else {
+ ret = receiver === undefined
+ ? "ret = callback({{args}}, nodeback); break;\n"
+ : "ret = callback.call(receiver, {{args}}, nodeback); break;\n";
+ }
+ return ret.replace("{{args}}", args).replace(", ", comma);
+ }
+
+ function generateArgumentSwitchCase() {
+ var ret = "";
+ for (var i = 0; i < argumentOrder.length; ++i) {
+ ret += "case " + argumentOrder[i] +":" +
+ generateCallForArgumentCount(argumentOrder[i]);
+ }
+
+ ret += " \n\
+ default: \n\
+ var args = new Array(len + 1); \n\
+ var i = 0; \n\
+ for (var i = 0; i < len; ++i) { \n\
+ args[i] = arguments[i]; \n\
+ } \n\
+ args[i] = nodeback; \n\
+ [CodeForCall] \n\
+ break; \n\
+ ".replace("[CodeForCall]", (shouldProxyThis
+ ? "ret = callback.apply(this, args);\n"
+ : "ret = callback.apply(receiver, args);\n"));
+ return ret;
+ }
+
+ var getFunctionCode = typeof callback === "string"
+ ? ("this != null ? this['"+callback+"'] : fn")
+ : "fn";
+ var body = "'use strict'; \n\
+ var ret = function (Parameters) { \n\
+ 'use strict'; \n\
+ var len = arguments.length; \n\
+ var promise = new Promise(INTERNAL); \n\
+ promise._captureStackTrace(); \n\
+ var nodeback = nodebackForPromise(promise, " + multiArgs + "); \n\
+ var ret; \n\
+ var callback = tryCatch([GetFunctionCode]); \n\
+ switch(len) { \n\
+ [CodeForSwitchCase] \n\
+ } \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(maybeWrapAsError(ret.e), true, true);\n\
+ } \n\
+ if (!promise._isFateSealed()) promise._setAsyncGuaranteed(); \n\
+ return promise; \n\
+ }; \n\
+ notEnumerableProp(ret, '__isPromisified__', true); \n\
+ return ret; \n\
+ ".replace("[CodeForSwitchCase]", generateArgumentSwitchCase())
+ .replace("[GetFunctionCode]", getFunctionCode);
+ body = body.replace("Parameters", parameterDeclaration(newParameterCount));
+ return new Function("Promise",
+ "fn",
+ "receiver",
+ "withAppended",
+ "maybeWrapAsError",
+ "nodebackForPromise",
+ "tryCatch",
+ "errorObj",
+ "notEnumerableProp",
+ "INTERNAL",
+ body)(
+ Promise,
+ fn,
+ receiver,
+ withAppended,
+ maybeWrapAsError,
+ nodebackForPromise,
+ util.tryCatch,
+ util.errorObj,
+ util.notEnumerableProp,
+ INTERNAL);
+};
+}
+
+function makeNodePromisifiedClosure(callback, receiver, _, fn, __, multiArgs) {
+ var defaultThis = (function() {return this;})();
+ var method = callback;
+ if (typeof method === "string") {
+ callback = fn;
+ }
+ function promisified() {
+ var _receiver = receiver;
+ if (receiver === THIS) _receiver = this;
+ var promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ var cb = typeof method === "string" && this !== defaultThis
+ ? this[method] : callback;
+ var fn = nodebackForPromise(promise, multiArgs);
+ try {
+ cb.apply(_receiver, withAppended(arguments, fn));
+ } catch(e) {
+ promise._rejectCallback(maybeWrapAsError(e), true, true);
+ }
+ if (!promise._isFateSealed()) promise._setAsyncGuaranteed();
+ return promise;
+ }
+ util.notEnumerableProp(promisified, "__isPromisified__", true);
+ return promisified;
+}
+
+var makeNodePromisified = canEvaluate
+ ? makeNodePromisifiedEval
+ : makeNodePromisifiedClosure;
+
+function promisifyAll(obj, suffix, filter, promisifier, multiArgs) {
+ var suffixRegexp = new RegExp(escapeIdentRegex(suffix) + "$");
+ var methods =
+ promisifiableMethods(obj, suffix, suffixRegexp, filter);
+
+ for (var i = 0, len = methods.length; i < len; i+= 2) {
+ var key = methods[i];
+ var fn = methods[i+1];
+ var promisifiedKey = key + suffix;
+ if (promisifier === makeNodePromisified) {
+ obj[promisifiedKey] =
+ makeNodePromisified(key, THIS, key, fn, suffix, multiArgs);
+ } else {
+ var promisified = promisifier(fn, function() {
+ return makeNodePromisified(key, THIS, key,
+ fn, suffix, multiArgs);
+ });
+ util.notEnumerableProp(promisified, "__isPromisified__", true);
+ obj[promisifiedKey] = promisified;
+ }
+ }
+ util.toFastProperties(obj);
+ return obj;
+}
+
+function promisify(callback, receiver, multiArgs) {
+ return makeNodePromisified(callback, receiver, undefined,
+ callback, null, multiArgs);
+}
+
+Promise.promisify = function (fn, options) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ if (isPromisified(fn)) {
+ return fn;
+ }
+ options = Object(options);
+ var receiver = options.context === undefined ? THIS : options.context;
+ var multiArgs = !!options.multiArgs;
+ var ret = promisify(fn, receiver, multiArgs);
+ util.copyDescriptors(fn, ret, propsFilter);
+ return ret;
+};
+
+Promise.promisifyAll = function (target, options) {
+ if (typeof target !== "function" && typeof target !== "object") {
+ throw new TypeError("the target of promisifyAll must be an object or a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ options = Object(options);
+ var multiArgs = !!options.multiArgs;
+ var suffix = options.suffix;
+ if (typeof suffix !== "string") suffix = defaultSuffix;
+ var filter = options.filter;
+ if (typeof filter !== "function") filter = defaultFilter;
+ var promisifier = options.promisifier;
+ if (typeof promisifier !== "function") promisifier = makeNodePromisified;
+
+ if (!util.isIdentifier(suffix)) {
+ throw new RangeError("suffix must be a valid identifier\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+
+ var keys = util.inheritedDataKeys(target);
+ for (var i = 0; i < keys.length; ++i) {
+ var value = target[keys[i]];
+ if (keys[i] !== "constructor" &&
+ util.isClass(value)) {
+ promisifyAll(value.prototype, suffix, filter, promisifier,
+ multiArgs);
+ promisifyAll(value, suffix, filter, promisifier, multiArgs);
+ }
+ }
+
+ return promisifyAll(target, suffix, filter, promisifier, multiArgs);
+};
+};
+
+
+},{"./errors":12,"./nodeback":20,"./util":36}],25:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(
+ Promise, PromiseArray, tryConvertToPromise, apiRejection) {
+var util = _dereq_("./util");
+var isObject = util.isObject;
+var es5 = _dereq_("./es5");
+var Es6Map;
+if (typeof Map === "function") Es6Map = Map;
+
+var mapToEntries = (function() {
+ var index = 0;
+ var size = 0;
+
+ function extractEntry(value, key) {
+ this[index] = value;
+ this[index + size] = key;
+ index++;
+ }
+
+ return function mapToEntries(map) {
+ size = map.size;
+ index = 0;
+ var ret = new Array(map.size * 2);
+ map.forEach(extractEntry, ret);
+ return ret;
+ };
+})();
+
+var entriesToMap = function(entries) {
+ var ret = new Es6Map();
+ var length = entries.length / 2 | 0;
+ for (var i = 0; i < length; ++i) {
+ var key = entries[length + i];
+ var value = entries[i];
+ ret.set(key, value);
+ }
+ return ret;
+};
+
+function PropertiesPromiseArray(obj) {
+ var isMap = false;
+ var entries;
+ if (Es6Map !== undefined && obj instanceof Es6Map) {
+ entries = mapToEntries(obj);
+ isMap = true;
+ } else {
+ var keys = es5.keys(obj);
+ var len = keys.length;
+ entries = new Array(len * 2);
+ for (var i = 0; i < len; ++i) {
+ var key = keys[i];
+ entries[i] = obj[key];
+ entries[i + len] = key;
+ }
+ }
+ this.constructor$(entries);
+ this._isMap = isMap;
+ this._init$(undefined, isMap ? -6 : -3);
+}
+util.inherits(PropertiesPromiseArray, PromiseArray);
+
+PropertiesPromiseArray.prototype._init = function () {};
+
+PropertiesPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ var val;
+ if (this._isMap) {
+ val = entriesToMap(this._values);
+ } else {
+ val = {};
+ var keyOffset = this.length();
+ for (var i = 0, len = this.length(); i < len; ++i) {
+ val[this._values[i + keyOffset]] = this._values[i];
+ }
+ }
+ this._resolve(val);
+ return true;
+ }
+ return false;
+};
+
+PropertiesPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+PropertiesPromiseArray.prototype.getActualLength = function (len) {
+ return len >> 1;
+};
+
+function props(promises) {
+ var ret;
+ var castValue = tryConvertToPromise(promises);
+
+ if (!isObject(castValue)) {
+ return apiRejection("cannot await properties of a non-object\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ } else if (castValue instanceof Promise) {
+ ret = castValue._then(
+ Promise.props, undefined, undefined, undefined, undefined);
+ } else {
+ ret = new PropertiesPromiseArray(castValue).promise();
+ }
+
+ if (castValue instanceof Promise) {
+ ret._propagateFrom(castValue, 2);
+ }
+ return ret;
+}
+
+Promise.prototype.props = function () {
+ return props(this);
+};
+
+Promise.props = function (promises) {
+ return props(promises);
+};
+};
+
+},{"./es5":13,"./util":36}],26:[function(_dereq_,module,exports){
+"use strict";
+function arrayMove(src, srcIndex, dst, dstIndex, len) {
+ for (var j = 0; j < len; ++j) {
+ dst[j + dstIndex] = src[j + srcIndex];
+ src[j + srcIndex] = void 0;
+ }
+}
+
+function Queue(capacity) {
+ this._capacity = capacity;
+ this._length = 0;
+ this._front = 0;
+}
+
+Queue.prototype._willBeOverCapacity = function (size) {
+ return this._capacity < size;
+};
+
+Queue.prototype._pushOne = function (arg) {
+ var length = this.length();
+ this._checkCapacity(length + 1);
+ var i = (this._front + length) & (this._capacity - 1);
+ this[i] = arg;
+ this._length = length + 1;
+};
+
+Queue.prototype.push = function (fn, receiver, arg) {
+ var length = this.length() + 3;
+ if (this._willBeOverCapacity(length)) {
+ this._pushOne(fn);
+ this._pushOne(receiver);
+ this._pushOne(arg);
+ return;
+ }
+ var j = this._front + length - 3;
+ this._checkCapacity(length);
+ var wrapMask = this._capacity - 1;
+ this[(j + 0) & wrapMask] = fn;
+ this[(j + 1) & wrapMask] = receiver;
+ this[(j + 2) & wrapMask] = arg;
+ this._length = length;
+};
+
+Queue.prototype.shift = function () {
+ var front = this._front,
+ ret = this[front];
+
+ this[front] = undefined;
+ this._front = (front + 1) & (this._capacity - 1);
+ this._length--;
+ return ret;
+};
+
+Queue.prototype.length = function () {
+ return this._length;
+};
+
+Queue.prototype._checkCapacity = function (size) {
+ if (this._capacity < size) {
+ this._resizeTo(this._capacity << 1);
+ }
+};
+
+Queue.prototype._resizeTo = function (capacity) {
+ var oldCapacity = this._capacity;
+ this._capacity = capacity;
+ var front = this._front;
+ var length = this._length;
+ var moveItemsCount = (front + length) & (oldCapacity - 1);
+ arrayMove(this, 0, this, oldCapacity, moveItemsCount);
+};
+
+module.exports = Queue;
+
+},{}],27:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(
+ Promise, INTERNAL, tryConvertToPromise, apiRejection) {
+var util = _dereq_("./util");
+
+var raceLater = function (promise) {
+ return promise.then(function(array) {
+ return race(array, promise);
+ });
+};
+
+function race(promises, parent) {
+ var maybePromise = tryConvertToPromise(promises);
+
+ if (maybePromise instanceof Promise) {
+ return raceLater(maybePromise);
+ } else {
+ promises = util.asArray(promises);
+ if (promises === null)
+ return apiRejection("expecting an array or an iterable object but got " + util.classString(promises));
+ }
+
+ var ret = new Promise(INTERNAL);
+ if (parent !== undefined) {
+ ret._propagateFrom(parent, 3);
+ }
+ var fulfill = ret._fulfill;
+ var reject = ret._reject;
+ for (var i = 0, len = promises.length; i < len; ++i) {
+ var val = promises[i];
+
+ if (val === undefined && !(i in promises)) {
+ continue;
+ }
+
+ Promise.cast(val)._then(fulfill, reject, undefined, ret, null);
+ }
+ return ret;
+}
+
+Promise.race = function (promises) {
+ return race(promises, undefined);
+};
+
+Promise.prototype.race = function () {
+ return race(this, undefined);
+};
+
+};
+
+},{"./util":36}],28:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL,
+ debug) {
+var getDomain = Promise._getDomain;
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+
+function ReductionPromiseArray(promises, fn, initialValue, _each) {
+ this.constructor$(promises);
+ var domain = getDomain();
+ this._fn = domain === null ? fn : util.domainBind(domain, fn);
+ if (initialValue !== undefined) {
+ initialValue = Promise.resolve(initialValue);
+ initialValue._attachCancellationCallback(this);
+ }
+ this._initialValue = initialValue;
+ this._currentCancellable = null;
+ if(_each === INTERNAL) {
+ this._eachValues = Array(this._length);
+ } else if (_each === 0) {
+ this._eachValues = null;
+ } else {
+ this._eachValues = undefined;
+ }
+ this._promise._captureStackTrace();
+ this._init$(undefined, -5);
+}
+util.inherits(ReductionPromiseArray, PromiseArray);
+
+ReductionPromiseArray.prototype._gotAccum = function(accum) {
+ if (this._eachValues !== undefined &&
+ this._eachValues !== null &&
+ accum !== INTERNAL) {
+ this._eachValues.push(accum);
+ }
+};
+
+ReductionPromiseArray.prototype._eachComplete = function(value) {
+ if (this._eachValues !== null) {
+ this._eachValues.push(value);
+ }
+ return this._eachValues;
+};
+
+ReductionPromiseArray.prototype._init = function() {};
+
+ReductionPromiseArray.prototype._resolveEmptyArray = function() {
+ this._resolve(this._eachValues !== undefined ? this._eachValues
+ : this._initialValue);
+};
+
+ReductionPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+ReductionPromiseArray.prototype._resolve = function(value) {
+ this._promise._resolveCallback(value);
+ this._values = null;
+};
+
+ReductionPromiseArray.prototype._resultCancelled = function(sender) {
+ if (sender === this._initialValue) return this._cancel();
+ if (this._isResolved()) return;
+ this._resultCancelled$();
+ if (this._currentCancellable instanceof Promise) {
+ this._currentCancellable.cancel();
+ }
+ if (this._initialValue instanceof Promise) {
+ this._initialValue.cancel();
+ }
+};
+
+ReductionPromiseArray.prototype._iterate = function (values) {
+ this._values = values;
+ var value;
+ var i;
+ var length = values.length;
+ if (this._initialValue !== undefined) {
+ value = this._initialValue;
+ i = 0;
+ } else {
+ value = Promise.resolve(values[0]);
+ i = 1;
+ }
+
+ this._currentCancellable = value;
+
+ if (!value.isRejected()) {
+ for (; i < length; ++i) {
+ var ctx = {
+ accum: null,
+ value: values[i],
+ index: i,
+ length: length,
+ array: this
+ };
+ value = value._then(gotAccum, undefined, undefined, ctx, undefined);
+ }
+ }
+
+ if (this._eachValues !== undefined) {
+ value = value
+ ._then(this._eachComplete, undefined, undefined, this, undefined);
+ }
+ value._then(completed, completed, undefined, value, this);
+};
+
+Promise.prototype.reduce = function (fn, initialValue) {
+ return reduce(this, fn, initialValue, null);
+};
+
+Promise.reduce = function (promises, fn, initialValue, _each) {
+ return reduce(promises, fn, initialValue, _each);
+};
+
+function completed(valueOrReason, array) {
+ if (this.isFulfilled()) {
+ array._resolve(valueOrReason);
+ } else {
+ array._reject(valueOrReason);
+ }
+}
+
+function reduce(promises, fn, initialValue, _each) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var array = new ReductionPromiseArray(promises, fn, initialValue, _each);
+ return array.promise();
+}
+
+function gotAccum(accum) {
+ this.accum = accum;
+ this.array._gotAccum(accum);
+ var value = tryConvertToPromise(this.value, this.array._promise);
+ if (value instanceof Promise) {
+ this.array._currentCancellable = value;
+ return value._then(gotValue, undefined, undefined, this, undefined);
+ } else {
+ return gotValue.call(this, value);
+ }
+}
+
+function gotValue(value) {
+ var array = this.array;
+ var promise = array._promise;
+ var fn = tryCatch(array._fn);
+ promise._pushContext();
+ var ret;
+ if (array._eachValues !== undefined) {
+ ret = fn.call(promise._boundValue(), value, this.index, this.length);
+ } else {
+ ret = fn.call(promise._boundValue(),
+ this.accum, value, this.index, this.length);
+ }
+ if (ret instanceof Promise) {
+ array._currentCancellable = ret;
+ }
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret,
+ promiseCreated,
+ array._eachValues !== undefined ? "Promise.each" : "Promise.reduce",
+ promise
+ );
+ return ret;
+}
+};
+
+},{"./util":36}],29:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util");
+var schedule;
+var noAsyncScheduler = function() {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var NativePromise = util.getNativePromise();
+if (util.isNode && typeof MutationObserver === "undefined") {
+ var GlobalSetImmediate = global.setImmediate;
+ var ProcessNextTick = process.nextTick;
+ schedule = util.isRecentNode
+ ? function(fn) { GlobalSetImmediate.call(global, fn); }
+ : function(fn) { ProcessNextTick.call(process, fn); };
+} else if (typeof NativePromise === "function" &&
+ typeof NativePromise.resolve === "function") {
+ var nativePromise = NativePromise.resolve();
+ schedule = function(fn) {
+ nativePromise.then(fn);
+ };
+} else if ((typeof MutationObserver !== "undefined") &&
+ !(typeof window !== "undefined" &&
+ window.navigator &&
+ (window.navigator.standalone || window.cordova))) {
+ schedule = (function() {
+ var div = document.createElement("div");
+ var opts = {attributes: true};
+ var toggleScheduled = false;
+ var div2 = document.createElement("div");
+ var o2 = new MutationObserver(function() {
+ div.classList.toggle("foo");
+ toggleScheduled = false;
+ });
+ o2.observe(div2, opts);
+
+ var scheduleToggle = function() {
+ if (toggleScheduled) return;
+ toggleScheduled = true;
+ div2.classList.toggle("foo");
+ };
+
+ return function schedule(fn) {
+ var o = new MutationObserver(function() {
+ o.disconnect();
+ fn();
+ });
+ o.observe(div, opts);
+ scheduleToggle();
+ };
+ })();
+} else if (typeof setImmediate !== "undefined") {
+ schedule = function (fn) {
+ setImmediate(fn);
+ };
+} else if (typeof setTimeout !== "undefined") {
+ schedule = function (fn) {
+ setTimeout(fn, 0);
+ };
+} else {
+ schedule = noAsyncScheduler;
+}
+module.exports = schedule;
+
+},{"./util":36}],30:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+ function(Promise, PromiseArray, debug) {
+var PromiseInspection = Promise.PromiseInspection;
+var util = _dereq_("./util");
+
+function SettledPromiseArray(values) {
+ this.constructor$(values);
+}
+util.inherits(SettledPromiseArray, PromiseArray);
+
+SettledPromiseArray.prototype._promiseResolved = function (index, inspection) {
+ this._values[index] = inspection;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+SettledPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 33554432;
+ ret._settledValueField = value;
+ return this._promiseResolved(index, ret);
+};
+SettledPromiseArray.prototype._promiseRejected = function (reason, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 16777216;
+ ret._settledValueField = reason;
+ return this._promiseResolved(index, ret);
+};
+
+Promise.settle = function (promises) {
+ debug.deprecated(".settle()", ".reflect()");
+ return new SettledPromiseArray(promises).promise();
+};
+
+Promise.prototype.settle = function () {
+ return Promise.settle(this);
+};
+};
+
+},{"./util":36}],31:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, PromiseArray, apiRejection) {
+var util = _dereq_("./util");
+var RangeError = _dereq_("./errors").RangeError;
+var AggregateError = _dereq_("./errors").AggregateError;
+var isArray = util.isArray;
+var CANCELLATION = {};
+
+
+function SomePromiseArray(values) {
+ this.constructor$(values);
+ this._howMany = 0;
+ this._unwrap = false;
+ this._initialized = false;
+}
+util.inherits(SomePromiseArray, PromiseArray);
+
+SomePromiseArray.prototype._init = function () {
+ if (!this._initialized) {
+ return;
+ }
+ if (this._howMany === 0) {
+ this._resolve([]);
+ return;
+ }
+ this._init$(undefined, -5);
+ var isArrayResolved = isArray(this._values);
+ if (!this._isResolved() &&
+ isArrayResolved &&
+ this._howMany > this._canPossiblyFulfill()) {
+ this._reject(this._getRangeError(this.length()));
+ }
+};
+
+SomePromiseArray.prototype.init = function () {
+ this._initialized = true;
+ this._init();
+};
+
+SomePromiseArray.prototype.setUnwrap = function () {
+ this._unwrap = true;
+};
+
+SomePromiseArray.prototype.howMany = function () {
+ return this._howMany;
+};
+
+SomePromiseArray.prototype.setHowMany = function (count) {
+ this._howMany = count;
+};
+
+SomePromiseArray.prototype._promiseFulfilled = function (value) {
+ this._addFulfilled(value);
+ if (this._fulfilled() === this.howMany()) {
+ this._values.length = this.howMany();
+ if (this.howMany() === 1 && this._unwrap) {
+ this._resolve(this._values[0]);
+ } else {
+ this._resolve(this._values);
+ }
+ return true;
+ }
+ return false;
+
+};
+SomePromiseArray.prototype._promiseRejected = function (reason) {
+ this._addRejected(reason);
+ return this._checkOutcome();
+};
+
+SomePromiseArray.prototype._promiseCancelled = function () {
+ if (this._values instanceof Promise || this._values == null) {
+ return this._cancel();
+ }
+ this._addRejected(CANCELLATION);
+ return this._checkOutcome();
+};
+
+SomePromiseArray.prototype._checkOutcome = function() {
+ if (this.howMany() > this._canPossiblyFulfill()) {
+ var e = new AggregateError();
+ for (var i = this.length(); i < this._values.length; ++i) {
+ if (this._values[i] !== CANCELLATION) {
+ e.push(this._values[i]);
+ }
+ }
+ if (e.length > 0) {
+ this._reject(e);
+ } else {
+ this._cancel();
+ }
+ return true;
+ }
+ return false;
+};
+
+SomePromiseArray.prototype._fulfilled = function () {
+ return this._totalResolved;
+};
+
+SomePromiseArray.prototype._rejected = function () {
+ return this._values.length - this.length();
+};
+
+SomePromiseArray.prototype._addRejected = function (reason) {
+ this._values.push(reason);
+};
+
+SomePromiseArray.prototype._addFulfilled = function (value) {
+ this._values[this._totalResolved++] = value;
+};
+
+SomePromiseArray.prototype._canPossiblyFulfill = function () {
+ return this.length() - this._rejected();
+};
+
+SomePromiseArray.prototype._getRangeError = function (count) {
+ var message = "Input array must contain at least " +
+ this._howMany + " items but contains only " + count + " items";
+ return new RangeError(message);
+};
+
+SomePromiseArray.prototype._resolveEmptyArray = function () {
+ this._reject(this._getRangeError(0));
+};
+
+function some(promises, howMany) {
+ if ((howMany | 0) !== howMany || howMany < 0) {
+ return apiRejection("expecting a positive integer\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(howMany);
+ ret.init();
+ return promise;
+}
+
+Promise.some = function (promises, howMany) {
+ return some(promises, howMany);
+};
+
+Promise.prototype.some = function (howMany) {
+ return some(this, howMany);
+};
+
+Promise._SomePromiseArray = SomePromiseArray;
+};
+
+},{"./errors":12,"./util":36}],32:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function PromiseInspection(promise) {
+ if (promise !== undefined) {
+ promise = promise._target();
+ this._bitField = promise._bitField;
+ this._settledValueField = promise._isFateSealed()
+ ? promise._settledValue() : undefined;
+ }
+ else {
+ this._bitField = 0;
+ this._settledValueField = undefined;
+ }
+}
+
+PromiseInspection.prototype._settledValue = function() {
+ return this._settledValueField;
+};
+
+var value = PromiseInspection.prototype.value = function () {
+ if (!this.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var reason = PromiseInspection.prototype.error =
+PromiseInspection.prototype.reason = function () {
+ if (!this.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var isFulfilled = PromiseInspection.prototype.isFulfilled = function() {
+ return (this._bitField & 33554432) !== 0;
+};
+
+var isRejected = PromiseInspection.prototype.isRejected = function () {
+ return (this._bitField & 16777216) !== 0;
+};
+
+var isPending = PromiseInspection.prototype.isPending = function () {
+ return (this._bitField & 50397184) === 0;
+};
+
+var isResolved = PromiseInspection.prototype.isResolved = function () {
+ return (this._bitField & 50331648) !== 0;
+};
+
+PromiseInspection.prototype.isCancelled = function() {
+ return (this._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.__isCancelled = function() {
+ return (this._bitField & 65536) === 65536;
+};
+
+Promise.prototype._isCancelled = function() {
+ return this._target().__isCancelled();
+};
+
+Promise.prototype.isCancelled = function() {
+ return (this._target()._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.isPending = function() {
+ return isPending.call(this._target());
+};
+
+Promise.prototype.isRejected = function() {
+ return isRejected.call(this._target());
+};
+
+Promise.prototype.isFulfilled = function() {
+ return isFulfilled.call(this._target());
+};
+
+Promise.prototype.isResolved = function() {
+ return isResolved.call(this._target());
+};
+
+Promise.prototype.value = function() {
+ return value.call(this._target());
+};
+
+Promise.prototype.reason = function() {
+ var target = this._target();
+ target._unsetRejectionIsUnhandled();
+ return reason.call(target);
+};
+
+Promise.prototype._value = function() {
+ return this._settledValue();
+};
+
+Promise.prototype._reason = function() {
+ this._unsetRejectionIsUnhandled();
+ return this._settledValue();
+};
+
+Promise.PromiseInspection = PromiseInspection;
+};
+
+},{}],33:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = _dereq_("./util");
+var errorObj = util.errorObj;
+var isObject = util.isObject;
+
+function tryConvertToPromise(obj, context) {
+ if (isObject(obj)) {
+ if (obj instanceof Promise) return obj;
+ var then = getThen(obj);
+ if (then === errorObj) {
+ if (context) context._pushContext();
+ var ret = Promise.reject(then.e);
+ if (context) context._popContext();
+ return ret;
+ } else if (typeof then === "function") {
+ if (isAnyBluebirdPromise(obj)) {
+ var ret = new Promise(INTERNAL);
+ obj._then(
+ ret._fulfill,
+ ret._reject,
+ undefined,
+ ret,
+ null
+ );
+ return ret;
+ }
+ return doThenable(obj, then, context);
+ }
+ }
+ return obj;
+}
+
+function doGetThen(obj) {
+ return obj.then;
+}
+
+function getThen(obj) {
+ try {
+ return doGetThen(obj);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+
+var hasProp = {}.hasOwnProperty;
+function isAnyBluebirdPromise(obj) {
+ try {
+ return hasProp.call(obj, "_promise0");
+ } catch (e) {
+ return false;
+ }
+}
+
+function doThenable(x, then, context) {
+ var promise = new Promise(INTERNAL);
+ var ret = promise;
+ if (context) context._pushContext();
+ promise._captureStackTrace();
+ if (context) context._popContext();
+ var synchronous = true;
+ var result = util.tryCatch(then).call(x, resolve, reject);
+ synchronous = false;
+
+ if (promise && result === errorObj) {
+ promise._rejectCallback(result.e, true, true);
+ promise = null;
+ }
+
+ function resolve(value) {
+ if (!promise) return;
+ promise._resolveCallback(value);
+ promise = null;
+ }
+
+ function reject(reason) {
+ if (!promise) return;
+ promise._rejectCallback(reason, synchronous, true);
+ promise = null;
+ }
+ return ret;
+}
+
+return tryConvertToPromise;
+};
+
+},{"./util":36}],34:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, debug) {
+var util = _dereq_("./util");
+var TimeoutError = Promise.TimeoutError;
+
+function HandleWrapper(handle) {
+ this.handle = handle;
+}
+
+HandleWrapper.prototype._resultCancelled = function() {
+ clearTimeout(this.handle);
+};
+
+var afterValue = function(value) { return delay(+this).thenReturn(value); };
+var delay = Promise.delay = function (ms, value) {
+ var ret;
+ var handle;
+ if (value !== undefined) {
+ ret = Promise.resolve(value)
+ ._then(afterValue, null, null, ms, undefined);
+ if (debug.cancellation() && value instanceof Promise) {
+ ret._setOnCancel(value);
+ }
+ } else {
+ ret = new Promise(INTERNAL);
+ handle = setTimeout(function() { ret._fulfill(); }, +ms);
+ if (debug.cancellation()) {
+ ret._setOnCancel(new HandleWrapper(handle));
+ }
+ ret._captureStackTrace();
+ }
+ ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.prototype.delay = function (ms) {
+ return delay(ms, this);
+};
+
+var afterTimeout = function (promise, message, parent) {
+ var err;
+ if (typeof message !== "string") {
+ if (message instanceof Error) {
+ err = message;
+ } else {
+ err = new TimeoutError("operation timed out");
+ }
+ } else {
+ err = new TimeoutError(message);
+ }
+ util.markAsOriginatingFromRejection(err);
+ promise._attachExtraTrace(err);
+ promise._reject(err);
+
+ if (parent != null) {
+ parent.cancel();
+ }
+};
+
+function successClear(value) {
+ clearTimeout(this.handle);
+ return value;
+}
+
+function failureClear(reason) {
+ clearTimeout(this.handle);
+ throw reason;
+}
+
+Promise.prototype.timeout = function (ms, message) {
+ ms = +ms;
+ var ret, parent;
+
+ var handleWrapper = new HandleWrapper(setTimeout(function timeoutTimeout() {
+ if (ret.isPending()) {
+ afterTimeout(ret, message, parent);
+ }
+ }, ms));
+
+ if (debug.cancellation()) {
+ parent = this.then();
+ ret = parent._then(successClear, failureClear,
+ undefined, handleWrapper, undefined);
+ ret._setOnCancel(handleWrapper);
+ } else {
+ ret = this._then(successClear, failureClear,
+ undefined, handleWrapper, undefined);
+ }
+
+ return ret;
+};
+
+};
+
+},{"./util":36}],35:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function (Promise, apiRejection, tryConvertToPromise,
+ createContext, INTERNAL, debug) {
+ var util = _dereq_("./util");
+ var TypeError = _dereq_("./errors").TypeError;
+ var inherits = _dereq_("./util").inherits;
+ var errorObj = util.errorObj;
+ var tryCatch = util.tryCatch;
+ var NULL = {};
+
+ function thrower(e) {
+ setTimeout(function(){throw e;}, 0);
+ }
+
+ function castPreservingDisposable(thenable) {
+ var maybePromise = tryConvertToPromise(thenable);
+ if (maybePromise !== thenable &&
+ typeof thenable._isDisposable === "function" &&
+ typeof thenable._getDisposer === "function" &&
+ thenable._isDisposable()) {
+ maybePromise._setDisposable(thenable._getDisposer());
+ }
+ return maybePromise;
+ }
+ function dispose(resources, inspection) {
+ var i = 0;
+ var len = resources.length;
+ var ret = new Promise(INTERNAL);
+ function iterator() {
+ if (i >= len) return ret._fulfill();
+ var maybePromise = castPreservingDisposable(resources[i++]);
+ if (maybePromise instanceof Promise &&
+ maybePromise._isDisposable()) {
+ try {
+ maybePromise = tryConvertToPromise(
+ maybePromise._getDisposer().tryDispose(inspection),
+ resources.promise);
+ } catch (e) {
+ return thrower(e);
+ }
+ if (maybePromise instanceof Promise) {
+ return maybePromise._then(iterator, thrower,
+ null, null, null);
+ }
+ }
+ iterator();
+ }
+ iterator();
+ return ret;
+ }
+
+ function Disposer(data, promise, context) {
+ this._data = data;
+ this._promise = promise;
+ this._context = context;
+ }
+
+ Disposer.prototype.data = function () {
+ return this._data;
+ };
+
+ Disposer.prototype.promise = function () {
+ return this._promise;
+ };
+
+ Disposer.prototype.resource = function () {
+ if (this.promise().isFulfilled()) {
+ return this.promise().value();
+ }
+ return NULL;
+ };
+
+ Disposer.prototype.tryDispose = function(inspection) {
+ var resource = this.resource();
+ var context = this._context;
+ if (context !== undefined) context._pushContext();
+ var ret = resource !== NULL
+ ? this.doDispose(resource, inspection) : null;
+ if (context !== undefined) context._popContext();
+ this._promise._unsetDisposable();
+ this._data = null;
+ return ret;
+ };
+
+ Disposer.isDisposer = function (d) {
+ return (d != null &&
+ typeof d.resource === "function" &&
+ typeof d.tryDispose === "function");
+ };
+
+ function FunctionDisposer(fn, promise, context) {
+ this.constructor$(fn, promise, context);
+ }
+ inherits(FunctionDisposer, Disposer);
+
+ FunctionDisposer.prototype.doDispose = function (resource, inspection) {
+ var fn = this.data();
+ return fn.call(resource, resource, inspection);
+ };
+
+ function maybeUnwrapDisposer(value) {
+ if (Disposer.isDisposer(value)) {
+ this.resources[this.index]._setDisposable(value);
+ return value.promise();
+ }
+ return value;
+ }
+
+ function ResourceList(length) {
+ this.length = length;
+ this.promise = null;
+ this[length-1] = null;
+ }
+
+ ResourceList.prototype._resultCancelled = function() {
+ var len = this.length;
+ for (var i = 0; i < len; ++i) {
+ var item = this[i];
+ if (item instanceof Promise) {
+ item.cancel();
+ }
+ }
+ };
+
+ Promise.using = function () {
+ var len = arguments.length;
+ if (len < 2) return apiRejection(
+ "you must pass at least 2 arguments to Promise.using");
+ var fn = arguments[len - 1];
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var input;
+ var spreadArgs = true;
+ if (len === 2 && Array.isArray(arguments[0])) {
+ input = arguments[0];
+ len = input.length;
+ spreadArgs = false;
+ } else {
+ input = arguments;
+ len--;
+ }
+ var resources = new ResourceList(len);
+ for (var i = 0; i < len; ++i) {
+ var resource = input[i];
+ if (Disposer.isDisposer(resource)) {
+ var disposer = resource;
+ resource = resource.promise();
+ resource._setDisposable(disposer);
+ } else {
+ var maybePromise = tryConvertToPromise(resource);
+ if (maybePromise instanceof Promise) {
+ resource =
+ maybePromise._then(maybeUnwrapDisposer, null, null, {
+ resources: resources,
+ index: i
+ }, undefined);
+ }
+ }
+ resources[i] = resource;
+ }
+
+ var reflectedResources = new Array(resources.length);
+ for (var i = 0; i < reflectedResources.length; ++i) {
+ reflectedResources[i] = Promise.resolve(resources[i]).reflect();
+ }
+
+ var resultPromise = Promise.all(reflectedResources)
+ .then(function(inspections) {
+ for (var i = 0; i < inspections.length; ++i) {
+ var inspection = inspections[i];
+ if (inspection.isRejected()) {
+ errorObj.e = inspection.error();
+ return errorObj;
+ } else if (!inspection.isFulfilled()) {
+ resultPromise.cancel();
+ return;
+ }
+ inspections[i] = inspection.value();
+ }
+ promise._pushContext();
+
+ fn = tryCatch(fn);
+ var ret = spreadArgs
+ ? fn.apply(undefined, inspections) : fn(inspections);
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret, promiseCreated, "Promise.using", promise);
+ return ret;
+ });
+
+ var promise = resultPromise.lastly(function() {
+ var inspection = new Promise.PromiseInspection(resultPromise);
+ return dispose(resources, inspection);
+ });
+ resources.promise = promise;
+ promise._setOnCancel(resources);
+ return promise;
+ };
+
+ Promise.prototype._setDisposable = function (disposer) {
+ this._bitField = this._bitField | 131072;
+ this._disposer = disposer;
+ };
+
+ Promise.prototype._isDisposable = function () {
+ return (this._bitField & 131072) > 0;
+ };
+
+ Promise.prototype._getDisposer = function () {
+ return this._disposer;
+ };
+
+ Promise.prototype._unsetDisposable = function () {
+ this._bitField = this._bitField & (~131072);
+ this._disposer = undefined;
+ };
+
+ Promise.prototype.disposer = function (fn) {
+ if (typeof fn === "function") {
+ return new FunctionDisposer(fn, this, createContext());
+ }
+ throw new TypeError();
+ };
+
+};
+
+},{"./errors":12,"./util":36}],36:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5");
+var canEvaluate = typeof navigator == "undefined";
+
+var errorObj = {e: {}};
+var tryCatchTarget;
+var globalObject = typeof self !== "undefined" ? self :
+ typeof window !== "undefined" ? window :
+ typeof global !== "undefined" ? global :
+ this !== undefined ? this : null;
+
+function tryCatcher() {
+ try {
+ var target = tryCatchTarget;
+ tryCatchTarget = null;
+ return target.apply(this, arguments);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+function tryCatch(fn) {
+ tryCatchTarget = fn;
+ return tryCatcher;
+}
+
+var inherits = function(Child, Parent) {
+ var hasProp = {}.hasOwnProperty;
+
+ function T() {
+ this.constructor = Child;
+ this.constructor$ = Parent;
+ for (var propertyName in Parent.prototype) {
+ if (hasProp.call(Parent.prototype, propertyName) &&
+ propertyName.charAt(propertyName.length-1) !== "$"
+ ) {
+ this[propertyName + "$"] = Parent.prototype[propertyName];
+ }
+ }
+ }
+ T.prototype = Parent.prototype;
+ Child.prototype = new T();
+ return Child.prototype;
+};
+
+
+function isPrimitive(val) {
+ return val == null || val === true || val === false ||
+ typeof val === "string" || typeof val === "number";
+
+}
+
+function isObject(value) {
+ return typeof value === "function" ||
+ typeof value === "object" && value !== null;
+}
+
+function maybeWrapAsError(maybeError) {
+ if (!isPrimitive(maybeError)) return maybeError;
+
+ return new Error(safeToString(maybeError));
+}
+
+function withAppended(target, appendee) {
+ var len = target.length;
+ var ret = new Array(len + 1);
+ var i;
+ for (i = 0; i < len; ++i) {
+ ret[i] = target[i];
+ }
+ ret[i] = appendee;
+ return ret;
+}
+
+function getDataPropertyOrDefault(obj, key, defaultValue) {
+ if (es5.isES5) {
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+
+ if (desc != null) {
+ return desc.get == null && desc.set == null
+ ? desc.value
+ : defaultValue;
+ }
+ } else {
+ return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined;
+ }
+}
+
+function notEnumerableProp(obj, name, value) {
+ if (isPrimitive(obj)) return obj;
+ var descriptor = {
+ value: value,
+ configurable: true,
+ enumerable: false,
+ writable: true
+ };
+ es5.defineProperty(obj, name, descriptor);
+ return obj;
+}
+
+function thrower(r) {
+ throw r;
+}
+
+var inheritedDataKeys = (function() {
+ var excludedPrototypes = [
+ Array.prototype,
+ Object.prototype,
+ Function.prototype
+ ];
+
+ var isExcludedProto = function(val) {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (excludedPrototypes[i] === val) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+ if (es5.isES5) {
+ var getKeys = Object.getOwnPropertyNames;
+ return function(obj) {
+ var ret = [];
+ var visitedKeys = Object.create(null);
+ while (obj != null && !isExcludedProto(obj)) {
+ var keys;
+ try {
+ keys = getKeys(obj);
+ } catch (e) {
+ return ret;
+ }
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (visitedKeys[key]) continue;
+ visitedKeys[key] = true;
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null && desc.get == null && desc.set == null) {
+ ret.push(key);
+ }
+ }
+ obj = es5.getPrototypeOf(obj);
+ }
+ return ret;
+ };
+ } else {
+ var hasProp = {}.hasOwnProperty;
+ return function(obj) {
+ if (isExcludedProto(obj)) return [];
+ var ret = [];
+
+ /*jshint forin:false */
+ enumeration: for (var key in obj) {
+ if (hasProp.call(obj, key)) {
+ ret.push(key);
+ } else {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (hasProp.call(excludedPrototypes[i], key)) {
+ continue enumeration;
+ }
+ }
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+ }
+
+})();
+
+var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/;
+function isClass(fn) {
+ try {
+ if (typeof fn === "function") {
+ var keys = es5.names(fn.prototype);
+
+ var hasMethods = es5.isES5 && keys.length > 1;
+ var hasMethodsOtherThanConstructor = keys.length > 0 &&
+ !(keys.length === 1 && keys[0] === "constructor");
+ var hasThisAssignmentAndStaticMethods =
+ thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0;
+
+ if (hasMethods || hasMethodsOtherThanConstructor ||
+ hasThisAssignmentAndStaticMethods) {
+ return true;
+ }
+ }
+ return false;
+ } catch (e) {
+ return false;
+ }
+}
+
+function toFastProperties(obj) {
+ /*jshint -W027,-W055,-W031*/
+ function FakeConstructor() {}
+ FakeConstructor.prototype = obj;
+ var l = 8;
+ while (l--) new FakeConstructor();
+ return obj;
+ eval(obj);
+}
+
+var rident = /^[a-z$_][a-z$_0-9]*$/i;
+function isIdentifier(str) {
+ return rident.test(str);
+}
+
+function filledRange(count, prefix, suffix) {
+ var ret = new Array(count);
+ for(var i = 0; i < count; ++i) {
+ ret[i] = prefix + i + suffix;
+ }
+ return ret;
+}
+
+function safeToString(obj) {
+ try {
+ return obj + "";
+ } catch (e) {
+ return "[no string representation]";
+ }
+}
+
+function isError(obj) {
+ return obj instanceof Error ||
+ (obj !== null &&
+ typeof obj === "object" &&
+ typeof obj.message === "string" &&
+ typeof obj.name === "string");
+}
+
+function markAsOriginatingFromRejection(e) {
+ try {
+ notEnumerableProp(e, "isOperational", true);
+ }
+ catch(ignore) {}
+}
+
+function originatesFromRejection(e) {
+ if (e == null) return false;
+ return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) ||
+ e["isOperational"] === true);
+}
+
+function canAttachTrace(obj) {
+ return isError(obj) && es5.propertyIsWritable(obj, "stack");
+}
+
+var ensureErrorObject = (function() {
+ if (!("stack" in new Error())) {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ try {throw new Error(safeToString(value));}
+ catch(err) {return err;}
+ };
+ } else {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ return new Error(safeToString(value));
+ };
+ }
+})();
+
+function classString(obj) {
+ return {}.toString.call(obj);
+}
+
+function copyDescriptors(from, to, filter) {
+ var keys = es5.names(from);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (filter(key)) {
+ try {
+ es5.defineProperty(to, key, es5.getDescriptor(from, key));
+ } catch (ignore) {}
+ }
+ }
+}
+
+var asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ }
+ return null;
+};
+
+if (typeof Symbol !== "undefined" && Symbol.iterator) {
+ var ArrayFrom = typeof Array.from === "function" ? function(v) {
+ return Array.from(v);
+ } : function(v) {
+ var ret = [];
+ var it = v[Symbol.iterator]();
+ var itResult;
+ while (!((itResult = it.next()).done)) {
+ ret.push(itResult.value);
+ }
+ return ret;
+ };
+
+ asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ } else if (v != null && typeof v[Symbol.iterator] === "function") {
+ return ArrayFrom(v);
+ }
+ return null;
+ };
+}
+
+var isNode = typeof process !== "undefined" &&
+ classString(process).toLowerCase() === "[object process]";
+
+var hasEnvVariables = typeof process !== "undefined" &&
+ typeof process.env !== "undefined";
+
+function env(key) {
+ return hasEnvVariables ? process.env[key] : undefined;
+}
+
+function getNativePromise() {
+ if (typeof Promise === "function") {
+ try {
+ var promise = new Promise(function(){});
+ if ({}.toString.call(promise) === "[object Promise]") {
+ return Promise;
+ }
+ } catch (e) {}
+ }
+}
+
+function domainBind(self, cb) {
+ return self.bind(cb);
+}
+
+var ret = {
+ isClass: isClass,
+ isIdentifier: isIdentifier,
+ inheritedDataKeys: inheritedDataKeys,
+ getDataPropertyOrDefault: getDataPropertyOrDefault,
+ thrower: thrower,
+ isArray: es5.isArray,
+ asArray: asArray,
+ notEnumerableProp: notEnumerableProp,
+ isPrimitive: isPrimitive,
+ isObject: isObject,
+ isError: isError,
+ canEvaluate: canEvaluate,
+ errorObj: errorObj,
+ tryCatch: tryCatch,
+ inherits: inherits,
+ withAppended: withAppended,
+ maybeWrapAsError: maybeWrapAsError,
+ toFastProperties: toFastProperties,
+ filledRange: filledRange,
+ toString: safeToString,
+ canAttachTrace: canAttachTrace,
+ ensureErrorObject: ensureErrorObject,
+ originatesFromRejection: originatesFromRejection,
+ markAsOriginatingFromRejection: markAsOriginatingFromRejection,
+ classString: classString,
+ copyDescriptors: copyDescriptors,
+ hasDevTools: typeof chrome !== "undefined" && chrome &&
+ typeof chrome.loadTimes === "function",
+ isNode: isNode,
+ hasEnvVariables: hasEnvVariables,
+ env: env,
+ global: globalObject,
+ getNativePromise: getNativePromise,
+ domainBind: domainBind
+};
+ret.isRecentNode = ret.isNode && (function() {
+ var version = process.versions.node.split(".").map(Number);
+ return (version[0] === 0 && version[1] > 10) || (version[0] > 0);
+})();
+
+if (ret.isNode) ret.toFastProperties(process);
+
+try {throw new Error(); } catch (e) {ret.lastLineError = e;}
+module.exports = ret;
+
+},{"./es5":13}]},{},[4])(4)
+}); ;if (typeof window !== 'undefined' && window !== null) { window.P = window.Promise; } else if (typeof self !== 'undefined' && self !== null) { self.P = self.Promise; }
\ No newline at end of file
diff --git a/Restaurant/node_modules/bluebird/js/browser/bluebird.min.js b/Restaurant/node_modules/bluebird/js/browser/bluebird.min.js
new file mode 100644
index 0000000..e02a9cd
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/browser/bluebird.min.js
@@ -0,0 +1,31 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2013-2017 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 3.5.1
+ * Features enabled: core, race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, using, timers, filter, any, each
+*/
+!function(t){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=t();else if("function"==typeof define&&define.amd)define([],t);else{var e;"undefined"!=typeof window?e=window:"undefined"!=typeof global?e=global:"undefined"!=typeof self&&(e=self),e.Promise=t()}}(function(){var t,e,n;return function r(t,e,n){function i(s,a){if(!e[s]){if(!t[s]){var c="function"==typeof _dereq_&&_dereq_;if(!a&&c)return c(s,!0);if(o)return o(s,!0);var l=new Error("Cannot find module '"+s+"'");throw l.code="MODULE_NOT_FOUND",l}var u=e[s]={exports:{}};t[s][0].call(u.exports,function(e){var n=t[s][1][e];return i(n?n:e)},u,u.exports,r,t,e,n)}return e[s].exports}for(var o="function"==typeof _dereq_&&_dereq_,s=0;s0;){var e=t.shift();if("function"==typeof e){var n=t.shift(),r=t.shift();e.call(n,r)}else e._settlePromises()}},r.prototype._drainQueues=function(){this._drainQueue(this._normalQueue),this._reset(),this._haveDrainedQueues=!0,this._drainQueue(this._lateQueue)},r.prototype._queueTick=function(){this._isTickUsed||(this._isTickUsed=!0,this._schedule(this.drainQueues))},r.prototype._reset=function(){this._isTickUsed=!1},e.exports=r,e.exports.firstLineError=a},{"./queue":26,"./schedule":29,"./util":36}],3:[function(t,e,n){"use strict";e.exports=function(t,e,n,r){var i=!1,o=function(t,e){this._reject(e)},s=function(t,e){e.promiseRejectionQueued=!0,e.bindingPromise._then(o,o,null,this,t)},a=function(t,e){0===(50397184&this._bitField)&&this._resolveCallback(e.target)},c=function(t,e){e.promiseRejectionQueued||this._reject(t)};t.prototype.bind=function(o){i||(i=!0,t.prototype._propagateFrom=r.propagateFromFunction(),t.prototype._boundValue=r.boundValueFunction());var l=n(o),u=new t(e);u._propagateFrom(this,1);var p=this._target();if(u._setBoundTo(l),l instanceof t){var h={promiseRejectionQueued:!1,promise:u,target:p,bindingPromise:l};p._then(e,s,void 0,u,h),l._then(a,c,void 0,u,h),u._setOnCancel(l)}else u._resolveCallback(p);return u},t.prototype._setBoundTo=function(t){void 0!==t?(this._bitField=2097152|this._bitField,this._boundTo=t):this._bitField=-2097153&this._bitField},t.prototype._isBound=function(){return 2097152===(2097152&this._bitField)},t.bind=function(e,n){return t.resolve(n).bind(e)}}},{}],4:[function(t,e,n){"use strict";function r(){try{Promise===o&&(Promise=i)}catch(t){}return o}var i;"undefined"!=typeof Promise&&(i=Promise);var o=t("./promise")();o.noConflict=r,e.exports=o},{"./promise":22}],5:[function(t,e,n){"use strict";var r=Object.create;if(r){var i=r(null),o=r(null);i[" size"]=o[" size"]=0}e.exports=function(e){function n(t,n){var r;if(null!=t&&(r=t[n]),"function"!=typeof r){var i="Object "+a.classString(t)+" has no method '"+a.toString(n)+"'";throw new e.TypeError(i)}return r}function r(t){var e=this.pop(),r=n(t,e);return r.apply(t,this)}function i(t){return t[this]}function o(t){var e=+this;return 0>e&&(e=Math.max(0,e+t.length)),t[e]}var s,a=t("./util"),c=a.canEvaluate;a.isIdentifier;e.prototype.call=function(t){var e=[].slice.call(arguments,1);return e.push(t),this._then(r,void 0,void 0,e,void 0)},e.prototype.get=function(t){var e,n="number"==typeof t;if(n)e=o;else if(c){var r=s(t);e=null!==r?r:i}else e=i;return this._then(e,void 0,void 0,t,void 0)}}},{"./util":36}],6:[function(t,e,n){"use strict";e.exports=function(e,n,r,i){var o=t("./util"),s=o.tryCatch,a=o.errorObj,c=e._async;e.prototype["break"]=e.prototype.cancel=function(){if(!i.cancellation())return this._warn("cancellation is disabled");for(var t=this,e=t;t._isCancellable();){if(!t._cancelBy(e)){e._isFollowing()?e._followee().cancel():e._cancelBranched();break}var n=t._cancellationParent;if(null==n||!n._isCancellable()){t._isFollowing()?t._followee().cancel():t._cancelBranched();break}t._isFollowing()&&t._followee().cancel(),t._setWillBeCancelled(),e=t,t=n}},e.prototype._branchHasCancelled=function(){this._branchesRemainingToCancel--},e.prototype._enoughBranchesHaveCancelled=function(){return void 0===this._branchesRemainingToCancel||this._branchesRemainingToCancel<=0},e.prototype._cancelBy=function(t){return t===this?(this._branchesRemainingToCancel=0,this._invokeOnCancel(),!0):(this._branchHasCancelled(),this._enoughBranchesHaveCancelled()?(this._invokeOnCancel(),!0):!1)},e.prototype._cancelBranched=function(){this._enoughBranchesHaveCancelled()&&this._cancel()},e.prototype._cancel=function(){this._isCancellable()&&(this._setCancelled(),c.invoke(this._cancelPromises,this,void 0))},e.prototype._cancelPromises=function(){this._length()>0&&this._settlePromises()},e.prototype._unsetOnCancel=function(){this._onCancelField=void 0},e.prototype._isCancellable=function(){return this.isPending()&&!this._isCancelled()},e.prototype.isCancellable=function(){return this.isPending()&&!this.isCancelled()},e.prototype._doInvokeOnCancel=function(t,e){if(o.isArray(t))for(var n=0;n=0?o[t]:void 0}var i=!1,o=[];return t.prototype._promiseCreated=function(){},t.prototype._pushContext=function(){},t.prototype._popContext=function(){return null},t._peekContext=t.prototype._peekContext=function(){},e.prototype._pushContext=function(){void 0!==this._trace&&(this._trace._promiseCreated=null,o.push(this._trace))},e.prototype._popContext=function(){if(void 0!==this._trace){var t=o.pop(),e=t._promiseCreated;return t._promiseCreated=null,e}return null},e.CapturedTrace=null,e.create=n,e.deactivateLongStackTraces=function(){},e.activateLongStackTraces=function(){var n=t.prototype._pushContext,o=t.prototype._popContext,s=t._peekContext,a=t.prototype._peekContext,c=t.prototype._promiseCreated;e.deactivateLongStackTraces=function(){t.prototype._pushContext=n,t.prototype._popContext=o,t._peekContext=s,t.prototype._peekContext=a,t.prototype._promiseCreated=c,i=!1},i=!0,t.prototype._pushContext=e.prototype._pushContext,t.prototype._popContext=e.prototype._popContext,t._peekContext=t.prototype._peekContext=r,t.prototype._promiseCreated=function(){var t=this._peekContext();t&&null==t._promiseCreated&&(t._promiseCreated=this)}},e}},{}],9:[function(t,e,n){"use strict";e.exports=function(e,n){function r(t,e){return{promise:e}}function i(){return!1}function o(t,e,n){var r=this;try{t(e,n,function(t){if("function"!=typeof t)throw new TypeError("onCancel must be a function, got: "+H.toString(t));r._attachCancellationCallback(t)})}catch(i){return i}}function s(t){if(!this._isCancellable())return this;var e=this._onCancel();void 0!==e?H.isArray(e)?e.push(t):this._setOnCancel([e,t]):this._setOnCancel(t)}function a(){return this._onCancelField}function c(t){this._onCancelField=t}function l(){this._cancellationParent=void 0,this._onCancelField=void 0}function u(t,e){if(0!==(1&e)){this._cancellationParent=t;var n=t._branchesRemainingToCancel;void 0===n&&(n=0),t._branchesRemainingToCancel=n+1}0!==(2&e)&&t._isBound()&&this._setBoundTo(t._boundTo)}function p(t,e){0!==(2&e)&&t._isBound()&&this._setBoundTo(t._boundTo)}function h(){var t=this._boundTo;return void 0!==t&&t instanceof e?t.isFulfilled()?t.value():void 0:t}function f(){this._trace=new S(this._peekContext())}function _(t,e){if(N(t)){var n=this._trace;if(void 0!==n&&e&&(n=n._parent),void 0!==n)n.attachExtraTrace(t);else if(!t.__stackCleaned__){var r=j(t);H.notEnumerableProp(t,"stack",r.message+"\n"+r.stack.join("\n")),H.notEnumerableProp(t,"__stackCleaned__",!0)}}}function d(t,e,n,r,i){if(void 0===t&&null!==e&&W){if(void 0!==i&&i._returnedNonUndefined())return;if(0===(65535&r._bitField))return;n&&(n+=" ");var o="",s="";if(e._trace){for(var a=e._trace.stack.split("\n"),c=w(a),l=c.length-1;l>=0;--l){var u=c[l];if(!U.test(u)){var p=u.match(M);p&&(o="at "+p[1]+":"+p[2]+":"+p[3]+" ");break}}if(c.length>0)for(var h=c[0],l=0;l0&&(s="\n"+a[l-1]);break}}var f="a promise was created in a "+n+"handler "+o+"but was not returned from it, see http://goo.gl/rRqMUw"+s;r._warn(f,!0,e)}}function v(t,e){var n=t+" is deprecated and will be removed in a future version.";return e&&(n+=" Use "+e+" instead."),y(n)}function y(t,n,r){if(ot.warnings){var i,o=new L(t);if(n)r._attachExtraTrace(o);else if(ot.longStackTraces&&(i=e._peekContext()))i.attachExtraTrace(o);else{var s=j(o);o.stack=s.message+"\n"+s.stack.join("\n")}tt("warning",o)||E(o,"",!0)}}function m(t,e){for(var n=0;n=0;--a)if(r[a]===o){s=a;break}for(var a=s;a>=0;--a){var c=r[a];if(e[i]!==c)break;e.pop(),i--}e=r}}function w(t){for(var e=[],n=0;n0&&"SyntaxError"!=t.name&&(e=e.slice(n)),e}function j(t){var e=t.stack,n=t.toString();return e="string"==typeof e&&e.length>0?C(t):[" (No stack trace)"],{message:n,stack:"SyntaxError"==t.name?e:w(e)}}function E(t,e,n){if("undefined"!=typeof console){var r;if(H.isObject(t)){var i=t.stack;r=e+Q(i,t)}else r=e+String(t);"function"==typeof D?D(r,n):("function"==typeof console.log||"object"==typeof console.log)&&console.log(r)}}function k(t,e,n,r){var i=!1;try{"function"==typeof e&&(i=!0,"rejectionHandled"===t?e(r):e(n,r))}catch(o){I.throwLater(o)}"unhandledRejection"===t?tt(t,n,r)||i||E(n,"Unhandled rejection "):tt(t,r)}function F(t){var e;if("function"==typeof t)e="[function "+(t.name||"anonymous")+"]";else{e=t&&"function"==typeof t.toString?t.toString():H.toString(t);var n=/\[object [a-zA-Z0-9$_]+\]/;if(n.test(e))try{var r=JSON.stringify(t);e=r}catch(i){}0===e.length&&(e="(empty array)")}return"(<"+x(e)+">, no stack trace)"}function x(t){var e=41;return t.lengths||0>a||!n||!r||n!==r||s>=a||(nt=function(t){if(B.test(t))return!0;var e=P(t);return e&&e.fileName===n&&s<=e.line&&e.line<=a?!0:!1})}}function S(t){this._parent=t,this._promisesCreated=0;var e=this._length=1+(void 0===t?0:t._length);it(this,S),e>32&&this.uncycle()}var O,A,D,V=e._getDomain,I=e._async,L=t("./errors").Warning,H=t("./util"),N=H.canAttachTrace,B=/[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/,U=/\((?:timers\.js):\d+:\d+\)/,M=/[\/<\(](.+?):(\d+):(\d+)\)?\s*$/,q=null,Q=null,$=!1,G=!(0==H.env("BLUEBIRD_DEBUG")||!H.env("BLUEBIRD_DEBUG")&&"development"!==H.env("NODE_ENV")),z=!(0==H.env("BLUEBIRD_WARNINGS")||!G&&!H.env("BLUEBIRD_WARNINGS")),X=!(0==H.env("BLUEBIRD_LONG_STACK_TRACES")||!G&&!H.env("BLUEBIRD_LONG_STACK_TRACES")),W=0!=H.env("BLUEBIRD_W_FORGOTTEN_RETURN")&&(z||!!H.env("BLUEBIRD_W_FORGOTTEN_RETURN"));e.prototype.suppressUnhandledRejections=function(){var t=this._target();t._bitField=-1048577&t._bitField|524288},e.prototype._ensurePossibleRejectionHandled=function(){if(0===(524288&this._bitField)){this._setRejectionIsUnhandled();var t=this;setTimeout(function(){t._notifyUnhandledRejection()},1)}},e.prototype._notifyUnhandledRejectionIsHandled=function(){k("rejectionHandled",O,void 0,this)},e.prototype._setReturnedNonUndefined=function(){this._bitField=268435456|this._bitField},e.prototype._returnedNonUndefined=function(){return 0!==(268435456&this._bitField)},e.prototype._notifyUnhandledRejection=function(){if(this._isRejectionUnhandled()){var t=this._settledValue();this._setUnhandledRejectionIsNotified(),k("unhandledRejection",A,t,this)}},e.prototype._setUnhandledRejectionIsNotified=function(){this._bitField=262144|this._bitField},e.prototype._unsetUnhandledRejectionIsNotified=function(){this._bitField=-262145&this._bitField},e.prototype._isUnhandledRejectionNotified=function(){return(262144&this._bitField)>0},e.prototype._setRejectionIsUnhandled=function(){this._bitField=1048576|this._bitField},e.prototype._unsetRejectionIsUnhandled=function(){this._bitField=-1048577&this._bitField,this._isUnhandledRejectionNotified()&&(this._unsetUnhandledRejectionIsNotified(),this._notifyUnhandledRejectionIsHandled())},e.prototype._isRejectionUnhandled=function(){return(1048576&this._bitField)>0},e.prototype._warn=function(t,e,n){return y(t,e,n||this)},e.onPossiblyUnhandledRejection=function(t){var e=V();A="function"==typeof t?null===e?t:H.domainBind(e,t):void 0},e.onUnhandledRejectionHandled=function(t){var e=V();O="function"==typeof t?null===e?t:H.domainBind(e,t):void 0};var K=function(){};e.longStackTraces=function(){if(I.haveItemsQueued()&&!ot.longStackTraces)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/MqrFmX\n");if(!ot.longStackTraces&&T()){var t=e.prototype._captureStackTrace,r=e.prototype._attachExtraTrace;ot.longStackTraces=!0,K=function(){if(I.haveItemsQueued()&&!ot.longStackTraces)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/MqrFmX\n");e.prototype._captureStackTrace=t,e.prototype._attachExtraTrace=r,n.deactivateLongStackTraces(),I.enableTrampoline(),ot.longStackTraces=!1},e.prototype._captureStackTrace=f,e.prototype._attachExtraTrace=_,n.activateLongStackTraces(),I.disableTrampolineIfNecessary()}},e.hasLongStackTraces=function(){return ot.longStackTraces&&T()};var J=function(){try{if("function"==typeof CustomEvent){var t=new CustomEvent("CustomEvent");return H.global.dispatchEvent(t),function(t,e){var n=new CustomEvent(t.toLowerCase(),{detail:e,cancelable:!0});return!H.global.dispatchEvent(n)}}if("function"==typeof Event){var t=new Event("CustomEvent");return H.global.dispatchEvent(t),function(t,e){var n=new Event(t.toLowerCase(),{cancelable:!0});return n.detail=e,!H.global.dispatchEvent(n)}}var t=document.createEvent("CustomEvent");return t.initCustomEvent("testingtheevent",!1,!0,{}),H.global.dispatchEvent(t),function(t,e){var n=document.createEvent("CustomEvent");return n.initCustomEvent(t.toLowerCase(),!1,!0,e),!H.global.dispatchEvent(n)}}catch(e){}return function(){return!1}}(),Y=function(){return H.isNode?function(){return process.emit.apply(process,arguments)}:H.global?function(t){var e="on"+t.toLowerCase(),n=H.global[e];return n?(n.apply(H.global,[].slice.call(arguments,1)),!0):!1}:function(){return!1}}(),Z={promiseCreated:r,promiseFulfilled:r,promiseRejected:r,promiseResolved:r,promiseCancelled:r,promiseChained:function(t,e,n){return{promise:e,child:n}},warning:function(t,e){return{warning:e}},unhandledRejection:function(t,e,n){return{reason:e,promise:n}},rejectionHandled:r},tt=function(t){var e=!1;try{e=Y.apply(null,arguments)}catch(n){I.throwLater(n),e=!0}var r=!1;try{r=J(t,Z[t].apply(null,arguments))}catch(n){I.throwLater(n),r=!0}return r||e};e.config=function(t){if(t=Object(t),"longStackTraces"in t&&(t.longStackTraces?e.longStackTraces():!t.longStackTraces&&e.hasLongStackTraces()&&K()),"warnings"in t){var n=t.warnings;ot.warnings=!!n,W=ot.warnings,H.isObject(n)&&"wForgottenReturn"in n&&(W=!!n.wForgottenReturn)}if("cancellation"in t&&t.cancellation&&!ot.cancellation){if(I.haveItemsQueued())throw new Error("cannot enable cancellation after promises are in use");e.prototype._clearCancellationData=l,e.prototype._propagateFrom=u,e.prototype._onCancel=a,e.prototype._setOnCancel=c,e.prototype._attachCancellationCallback=s,e.prototype._execute=o,et=u,ot.cancellation=!0}return"monitoring"in t&&(t.monitoring&&!ot.monitoring?(ot.monitoring=!0,e.prototype._fireEvent=tt):!t.monitoring&&ot.monitoring&&(ot.monitoring=!1,e.prototype._fireEvent=i)),e},e.prototype._fireEvent=i,e.prototype._execute=function(t,e,n){try{t(e,n)}catch(r){return r}},e.prototype._onCancel=function(){},e.prototype._setOnCancel=function(t){},e.prototype._attachCancellationCallback=function(t){},e.prototype._captureStackTrace=function(){},e.prototype._attachExtraTrace=function(){},e.prototype._clearCancellationData=function(){},e.prototype._propagateFrom=function(t,e){};var et=p,nt=function(){return!1},rt=/[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;H.inherits(S,Error),n.CapturedTrace=S,S.prototype.uncycle=function(){var t=this._length;if(!(2>t)){for(var e=[],n={},r=0,i=this;void 0!==i;++r)e.push(i),i=i._parent;t=this._length=r;for(var r=t-1;r>=0;--r){var o=e[r].stack;void 0===n[o]&&(n[o]=r)}for(var r=0;t>r;++r){var s=e[r].stack,a=n[s];if(void 0!==a&&a!==r){a>0&&(e[a-1]._parent=void 0,e[a-1]._length=1),e[r]._parent=void 0,e[r]._length=1;var c=r>0?e[r-1]:this;t-1>a?(c._parent=e[a+1],c._parent.uncycle(),c._length=c._parent._length+1):(c._parent=void 0,c._length=1);for(var l=c._length+1,u=r-2;u>=0;--u)e[u]._length=l,l++;return}}}},S.prototype.attachExtraTrace=function(t){if(!t.__stackCleaned__){this.uncycle();for(var e=j(t),n=e.message,r=[e.stack],i=this;void 0!==i;)r.push(w(i.stack.split("\n"))),i=i._parent;b(r),g(r),H.notEnumerableProp(t,"stack",m(n,r)),H.notEnumerableProp(t,"__stackCleaned__",!0)}};var it=function(){var t=/^\s*at\s*/,e=function(t,e){return"string"==typeof t?t:void 0!==e.name&&void 0!==e.message?e.toString():F(e)};if("number"==typeof Error.stackTraceLimit&&"function"==typeof Error.captureStackTrace){Error.stackTraceLimit+=6,q=t,Q=e;var n=Error.captureStackTrace;return nt=function(t){return B.test(t)},function(t,e){Error.stackTraceLimit+=6,n(t,e),Error.stackTraceLimit-=6}}var r=new Error;if("string"==typeof r.stack&&r.stack.split("\n")[0].indexOf("stackDetection@")>=0)return q=/@/,Q=e,$=!0,function(t){t.stack=(new Error).stack};var i;try{throw new Error}catch(o){i="stack"in o}return"stack"in r||!i||"number"!=typeof Error.stackTraceLimit?(Q=function(t,e){return"string"==typeof t?t:"object"!=typeof e&&"function"!=typeof e||void 0===e.name||void 0===e.message?F(e):e.toString()},null):(q=t,Q=e,function(t){Error.stackTraceLimit+=6;try{throw new Error}catch(e){t.stack=e.stack}Error.stackTraceLimit-=6})}([]);"undefined"!=typeof console&&"undefined"!=typeof console.warn&&(D=function(t){console.warn(t)},H.isNode&&process.stderr.isTTY?D=function(t,e){var n=e?"[33m":"[31m";console.warn(n+t+"[0m\n")}:H.isNode||"string"!=typeof(new Error).stack||(D=function(t,e){console.warn("%c"+t,e?"color: darkorange":"color: red")}));var ot={warnings:z,longStackTraces:!1,cancellation:!1,monitoring:!1};return X&&e.longStackTraces(),{longStackTraces:function(){return ot.longStackTraces},warnings:function(){return ot.warnings},cancellation:function(){return ot.cancellation},monitoring:function(){return ot.monitoring},propagateFromFunction:function(){return et},boundValueFunction:function(){return h},checkForgottenReturns:d,setBounds:R,warn:y,deprecated:v,CapturedTrace:S,fireDomEvent:J,fireGlobalEvent:Y}}},{"./errors":12,"./util":36}],10:[function(t,e,n){"use strict";e.exports=function(t){function e(){return this.value}function n(){throw this.reason}t.prototype["return"]=t.prototype.thenReturn=function(n){return n instanceof t&&n.suppressUnhandledRejections(),this._then(e,void 0,void 0,{value:n},void 0)},t.prototype["throw"]=t.prototype.thenThrow=function(t){return this._then(n,void 0,void 0,{reason:t},void 0)},t.prototype.catchThrow=function(t){if(arguments.length<=1)return this._then(void 0,n,void 0,{reason:t},void 0);var e=arguments[1],r=function(){throw e};return this.caught(t,r)},t.prototype.catchReturn=function(n){if(arguments.length<=1)return n instanceof t&&n.suppressUnhandledRejections(),this._then(void 0,e,void 0,{value:n},void 0);var r=arguments[1];r instanceof t&&r.suppressUnhandledRejections();var i=function(){return r};return this.caught(n,i)}}},{}],11:[function(t,e,n){"use strict";e.exports=function(t,e){function n(){return o(this)}function r(t,n){return i(t,n,e,e)}var i=t.reduce,o=t.all;t.prototype.each=function(t){return i(this,t,e,0)._then(n,void 0,void 0,this,void 0)},t.prototype.mapSeries=function(t){return i(this,t,e,e)},t.each=function(t,r){return i(t,r,e,0)._then(n,void 0,void 0,t,void 0)},t.mapSeries=r}},{}],12:[function(t,e,n){"use strict";function r(t,e){function n(r){return this instanceof n?(p(this,"message","string"==typeof r?r:e),p(this,"name",t),void(Error.captureStackTrace?Error.captureStackTrace(this,this.constructor):Error.call(this))):new n(r)}return u(n,Error),n}function i(t){return this instanceof i?(p(this,"name","OperationalError"),p(this,"message",t),this.cause=t,this.isOperational=!0,void(t instanceof Error?(p(this,"message",t.message),p(this,"stack",t.stack)):Error.captureStackTrace&&Error.captureStackTrace(this,this.constructor))):new i(t)}var o,s,a=t("./es5"),c=a.freeze,l=t("./util"),u=l.inherits,p=l.notEnumerableProp,h=r("Warning","warning"),f=r("CancellationError","cancellation error"),_=r("TimeoutError","timeout error"),d=r("AggregateError","aggregate error");try{o=TypeError,s=RangeError}catch(v){o=r("TypeError","type error"),s=r("RangeError","range error")}for(var y="join pop push shift unshift slice filter forEach some every map indexOf lastIndexOf reduce reduceRight sort reverse".split(" "),m=0;m1?t.cancelPromise._reject(e):t.cancelPromise._cancel(),t.cancelPromise=null,!0):!1}function a(){return l.call(this,this.promise._target()._settledValue())}function c(t){return s(this,t)?void 0:(h.e=t,h)}function l(t){var i=this.promise,l=this.handler;if(!this.called){this.called=!0;var u=this.isFinallyHandler()?l.call(i._boundValue()):l.call(i._boundValue(),t);if(u===r)return u;if(void 0!==u){i._setReturnedNonUndefined();var f=n(u,i);if(f instanceof e){if(null!=this.cancelPromise){if(f._isCancelled()){var _=new p("late cancellation observer");return i._attachExtraTrace(_),h.e=_,h}f.isPending()&&f._attachCancellationCallback(new o(this))}return f._then(a,c,void 0,this,void 0)}}}return i.isRejected()?(s(this),h.e=t,h):(s(this),t)}var u=t("./util"),p=e.CancellationError,h=u.errorObj,f=t("./catch_filter")(r);return i.prototype.isFinallyHandler=function(){return 0===this.type},o.prototype._resultCancelled=function(){s(this.finallyHandler)},e.prototype._passThrough=function(t,e,n,r){return"function"!=typeof t?this.then():this._then(n,r,void 0,new i(this,e,t),void 0)},e.prototype.lastly=e.prototype["finally"]=function(t){return this._passThrough(t,0,l,l)},e.prototype.tap=function(t){return this._passThrough(t,1,l)},e.prototype.tapCatch=function(t){var n=arguments.length;if(1===n)return this._passThrough(t,1,void 0,l);var r,i=new Array(n-1),o=0;for(r=0;n-1>r;++r){var s=arguments[r];if(!u.isObject(s))return e.reject(new TypeError("tapCatch statement predicate: expecting an object but got "+u.classString(s)));i[o++]=s}i.length=o;var a=arguments[r];return this._passThrough(f(i,a,this),1,void 0,l)},i}},{"./catch_filter":7,"./util":36}],16:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,s){function a(t,n,r){for(var o=0;o0&&"function"==typeof arguments[e]){t=arguments[e];var r}var i=[].slice.call(arguments);t&&i.pop();var r=new n(i).promise();return void 0!==t?r.spread(t):r}}},{"./util":36}],18:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,s){function a(t,e,n,r){this.constructor$(t),this._promise._captureStackTrace();var i=l();this._callback=null===i?e:u.domainBind(i,e),this._preservedValues=r===o?new Array(this.length()):null,this._limit=n,this._inFlight=0,this._queue=[],f.invoke(this._asyncInit,this,void 0)}function c(t,n,i,o){if("function"!=typeof n)return r("expecting a function but got "+u.classString(n));var s=0;if(void 0!==i){if("object"!=typeof i||null===i)return e.reject(new TypeError("options argument must be an object but it is "+u.classString(i)));if("number"!=typeof i.concurrency)return e.reject(new TypeError("'concurrency' must be a number but it is "+u.classString(i.concurrency)));s=i.concurrency}return s="number"==typeof s&&isFinite(s)&&s>=1?s:0,new a(t,n,s,o).promise()}var l=e._getDomain,u=t("./util"),p=u.tryCatch,h=u.errorObj,f=e._async;u.inherits(a,n),a.prototype._asyncInit=function(){this._init$(void 0,-2)},a.prototype._init=function(){},a.prototype._promiseFulfilled=function(t,n){var r=this._values,o=this.length(),a=this._preservedValues,c=this._limit;if(0>n){if(n=-1*n-1,r[n]=t,c>=1&&(this._inFlight--,this._drainQueue(),this._isResolved()))return!0}else{if(c>=1&&this._inFlight>=c)return r[n]=t,this._queue.push(n),!1;null!==a&&(a[n]=t);var l=this._promise,u=this._callback,f=l._boundValue();l._pushContext();var _=p(u).call(f,t,n,o),d=l._popContext();if(s.checkForgottenReturns(_,d,null!==a?"Promise.filter":"Promise.map",l),_===h)return this._reject(_.e),!0;var v=i(_,this._promise);if(v instanceof e){v=v._target();var y=v._bitField;if(0===(50397184&y))return c>=1&&this._inFlight++,r[n]=v,v._proxy(this,-1*(n+1)),!1;if(0===(33554432&y))return 0!==(16777216&y)?(this._reject(v._reason()),!0):(this._cancel(),!0);_=v._value()}r[n]=_}var m=++this._totalResolved;return m>=o?(null!==a?this._filter(r,a):this._resolve(r),!0):!1},a.prototype._drainQueue=function(){for(var t=this._queue,e=this._limit,n=this._values;t.length>0&&this._inFlighto;++o)t[o]&&(r[i++]=e[o]);r.length=i,this._resolve(r)},a.prototype.preservedValues=function(){return this._preservedValues},e.prototype.map=function(t,e){return c(this,t,e,null)},e.map=function(t,e,n,r){return c(t,e,n,r)}}},{"./util":36}],19:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o){var s=t("./util"),a=s.tryCatch;e.method=function(t){if("function"!=typeof t)throw new e.TypeError("expecting a function but got "+s.classString(t));return function(){var r=new e(n);r._captureStackTrace(),r._pushContext();var i=a(t).apply(this,arguments),s=r._popContext();return o.checkForgottenReturns(i,s,"Promise.method",r),r._resolveFromSyncValue(i),r}},e.attempt=e["try"]=function(t){if("function"!=typeof t)return i("expecting a function but got "+s.classString(t));var r=new e(n);r._captureStackTrace(),r._pushContext();var c;if(arguments.length>1){o.deprecated("calling Promise.try with more than 1 argument");var l=arguments[1],u=arguments[2];c=s.isArray(l)?a(t).apply(u,l):a(t).call(u,l)}else c=a(t)();var p=r._popContext();return o.checkForgottenReturns(c,p,"Promise.try",r),r._resolveFromSyncValue(c),r},e.prototype._resolveFromSyncValue=function(t){t===s.errorObj?this._rejectCallback(t.e,!1):this._resolveCallback(t,!0)}}},{"./util":36}],20:[function(t,e,n){"use strict";function r(t){return t instanceof Error&&u.getPrototypeOf(t)===Error.prototype}function i(t){var e;if(r(t)){e=new l(t),e.name=t.name,e.message=t.message,e.stack=t.stack;for(var n=u.keys(t),i=0;i1){var n,r=new Array(e-1),i=0;for(n=0;e-1>n;++n){var o=arguments[n];if(!f.isObject(o))return p("Catch statement predicate: expecting an object but got "+f.classString(o));r[i++]=o}return r.length=i,t=arguments[n],this.then(void 0,P(r,t,this))}return this.then(void 0,t)},i.prototype.reflect=function(){return this._then(u,u,void 0,this,void 0)},i.prototype.then=function(t,e){if(x.warnings()&&arguments.length>0&&"function"!=typeof t&&"function"!=typeof e){var n=".then() only accepts functions but was passed: "+f.classString(t);arguments.length>1&&(n+=", "+f.classString(e)),this._warn(n)}return this._then(t,e,void 0,void 0,void 0)},i.prototype.done=function(t,e){var n=this._then(t,e,void 0,void 0,void 0);n._setIsFinal()},i.prototype.spread=function(t){return"function"!=typeof t?p("expecting a function but got "+f.classString(t)):this.all()._then(t,void 0,void 0,w,void 0)},i.prototype.toJSON=function(){var t={isFulfilled:!1,isRejected:!1,fulfillmentValue:void 0,rejectionReason:void 0};return this.isFulfilled()?(t.fulfillmentValue=this.value(),t.isFulfilled=!0):this.isRejected()&&(t.rejectionReason=this.reason(),t.isRejected=!0),t},i.prototype.all=function(){return arguments.length>0&&this._warn(".all() was passed arguments but it does not take any"),new E(this).promise()},i.prototype.error=function(t){return this.caught(f.originatesFromRejection,t)},i.getNewLibraryCopy=e.exports,i.is=function(t){return t instanceof i},i.fromNode=i.fromCallback=function(t){var e=new i(b);e._captureStackTrace();var n=arguments.length>1?!!Object(arguments[1]).multiArgs:!1,r=O(t)(R(e,n));return r===S&&e._rejectCallback(r.e,!0),e._isFateSealed()||e._setAsyncGuaranteed(),e},i.all=function(t){return new E(t).promise()},i.cast=function(t){var e=j(t);return e instanceof i||(e=new i(b),e._captureStackTrace(),e._setFulfilled(),e._rejectionHandler0=t),e},i.resolve=i.fulfilled=i.cast,i.reject=i.rejected=function(t){var e=new i(b);return e._captureStackTrace(),e._rejectCallback(t,!0),e},i.setScheduler=function(t){if("function"!=typeof t)throw new m("expecting a function but got "+f.classString(t));return v.setScheduler(t)},i.prototype._then=function(t,e,n,r,o){var s=void 0!==o,a=s?o:new i(b),l=this._target(),u=l._bitField;s||(a._propagateFrom(this,3),a._captureStackTrace(),void 0===r&&0!==(2097152&this._bitField)&&(r=0!==(50397184&u)?this._boundValue():l===this?void 0:this._boundTo),this._fireEvent("promiseChained",this,a));var p=c();if(0!==(50397184&u)){var h,_,d=l._settlePromiseCtx;0!==(33554432&u)?(_=l._rejectionHandler0,h=t):0!==(16777216&u)?(_=l._fulfillmentHandler0,h=e,l._unsetRejectionIsUnhandled()):(d=l._settlePromiseLateCancellationObserver,_=new g("late cancellation observer"),l._attachExtraTrace(_),h=e),v.invoke(d,l,{handler:null===p?h:"function"==typeof h&&f.domainBind(p,h),promise:a,receiver:r,value:_})}else l._addCallbacks(t,e,a,r,p);return a},i.prototype._length=function(){return 65535&this._bitField},i.prototype._isFateSealed=function(){return 0!==(117506048&this._bitField)},i.prototype._isFollowing=function(){return 67108864===(67108864&this._bitField)},i.prototype._setLength=function(t){this._bitField=-65536&this._bitField|65535&t},i.prototype._setFulfilled=function(){this._bitField=33554432|this._bitField,this._fireEvent("promiseFulfilled",this)},i.prototype._setRejected=function(){this._bitField=16777216|this._bitField,this._fireEvent("promiseRejected",this)},i.prototype._setFollowing=function(){this._bitField=67108864|this._bitField,this._fireEvent("promiseResolved",this)},i.prototype._setIsFinal=function(){this._bitField=4194304|this._bitField},i.prototype._isFinal=function(){return(4194304&this._bitField)>0},i.prototype._unsetCancelled=function(){this._bitField=-65537&this._bitField},i.prototype._setCancelled=function(){this._bitField=65536|this._bitField,this._fireEvent("promiseCancelled",this)},i.prototype._setWillBeCancelled=function(){this._bitField=8388608|this._bitField},i.prototype._setAsyncGuaranteed=function(){v.hasCustomScheduler()||(this._bitField=134217728|this._bitField)},i.prototype._receiverAt=function(t){var e=0===t?this._receiver0:this[4*t-4+3];return e===h?void 0:void 0===e&&this._isBound()?this._boundValue():e},i.prototype._promiseAt=function(t){return this[4*t-4+2]},i.prototype._fulfillmentHandlerAt=function(t){return this[4*t-4+0]},i.prototype._rejectionHandlerAt=function(t){return this[4*t-4+1]},i.prototype._boundValue=function(){},i.prototype._migrateCallback0=function(t){var e=(t._bitField,t._fulfillmentHandler0),n=t._rejectionHandler0,r=t._promise0,i=t._receiverAt(0);void 0===i&&(i=h),this._addCallbacks(e,n,r,i,null)},i.prototype._migrateCallbackAt=function(t,e){var n=t._fulfillmentHandlerAt(e),r=t._rejectionHandlerAt(e),i=t._promiseAt(e),o=t._receiverAt(e);void 0===o&&(o=h),this._addCallbacks(n,r,i,o,null)},i.prototype._addCallbacks=function(t,e,n,r,i){var o=this._length();if(o>=65531&&(o=0,this._setLength(0)),0===o)this._promise0=n,this._receiver0=r,"function"==typeof t&&(this._fulfillmentHandler0=null===i?t:f.domainBind(i,t)),"function"==typeof e&&(this._rejectionHandler0=null===i?e:f.domainBind(i,e));else{var s=4*o-4;this[s+2]=n,this[s+3]=r,"function"==typeof t&&(this[s+0]=null===i?t:f.domainBind(i,t)),"function"==typeof e&&(this[s+1]=null===i?e:f.domainBind(i,e))}return this._setLength(o+1),o},i.prototype._proxy=function(t,e){this._addCallbacks(void 0,void 0,e,t,null)},i.prototype._resolveCallback=function(t,e){if(0===(117506048&this._bitField)){if(t===this)return this._rejectCallback(l(),!1);var n=j(t,this);if(!(n instanceof i))return this._fulfill(t);e&&this._propagateFrom(n,2);var r=n._target();if(r===this)return void this._reject(l());var o=r._bitField;if(0===(50397184&o)){var s=this._length();s>0&&r._migrateCallback0(this);for(var a=1;s>a;++a)r._migrateCallbackAt(this,a);this._setFollowing(),this._setLength(0),this._setFollowee(r)}else if(0!==(33554432&o))this._fulfill(r._value());else if(0!==(16777216&o))this._reject(r._reason());else{var c=new g("late cancellation observer");r._attachExtraTrace(c),this._reject(c)}}},i.prototype._rejectCallback=function(t,e,n){var r=f.ensureErrorObject(t),i=r===t;if(!i&&!n&&x.warnings()){var o="a promise was rejected with a non-error: "+f.classString(t);this._warn(o,!0)}this._attachExtraTrace(r,e?i:!1),this._reject(t)},i.prototype._resolveFromExecutor=function(t){if(t!==b){var e=this;this._captureStackTrace(),this._pushContext();var n=!0,r=this._execute(t,function(t){e._resolveCallback(t)},function(t){e._rejectCallback(t,n)});n=!1,this._popContext(),void 0!==r&&e._rejectCallback(r,!0)}},i.prototype._settlePromiseFromHandler=function(t,e,n,r){var i=r._bitField;if(0===(65536&i)){r._pushContext();var o;e===w?n&&"number"==typeof n.length?o=O(t).apply(this._boundValue(),n):(o=S,o.e=new m("cannot .spread() a non-array: "+f.classString(n))):o=O(t).call(e,n);var s=r._popContext();i=r._bitField,0===(65536&i)&&(o===C?r._reject(n):o===S?r._rejectCallback(o.e,!1):(x.checkForgottenReturns(o,s,"",r,this),r._resolveCallback(o)))}},i.prototype._target=function(){for(var t=this;t._isFollowing();)t=t._followee();return t},i.prototype._followee=function(){return this._rejectionHandler0},i.prototype._setFollowee=function(t){this._rejectionHandler0=t},i.prototype._settlePromise=function(t,e,r,o){var s=t instanceof i,a=this._bitField,c=0!==(134217728&a);0!==(65536&a)?(s&&t._invokeInternalOnCancel(),r instanceof T&&r.isFinallyHandler()?(r.cancelPromise=t,O(e).call(r,o)===S&&t._reject(S.e)):e===u?t._fulfill(u.call(r)):r instanceof n?r._promiseCancelled(t):s||t instanceof E?t._cancel():r.cancel()):"function"==typeof e?s?(c&&t._setAsyncGuaranteed(),this._settlePromiseFromHandler(e,r,o,t)):e.call(r,o,t):r instanceof n?r._isResolved()||(0!==(33554432&a)?r._promiseFulfilled(o,t):r._promiseRejected(o,t)):s&&(c&&t._setAsyncGuaranteed(),0!==(33554432&a)?t._fulfill(o):t._reject(o))},i.prototype._settlePromiseLateCancellationObserver=function(t){var e=t.handler,n=t.promise,r=t.receiver,o=t.value;"function"==typeof e?n instanceof i?this._settlePromiseFromHandler(e,r,o,n):e.call(r,o,n):n instanceof i&&n._reject(o)},i.prototype._settlePromiseCtx=function(t){this._settlePromise(t.promise,t.handler,t.receiver,t.value)},i.prototype._settlePromise0=function(t,e,n){var r=this._promise0,i=this._receiverAt(0);this._promise0=void 0,this._receiver0=void 0,this._settlePromise(r,t,i,e)},i.prototype._clearCallbackDataAtIndex=function(t){var e=4*t-4;this[e+2]=this[e+3]=this[e+0]=this[e+1]=void 0},i.prototype._fulfill=function(t){var e=this._bitField;if(!((117506048&e)>>>16)){if(t===this){var n=l();return this._attachExtraTrace(n),this._reject(n)}this._setFulfilled(),this._rejectionHandler0=t,(65535&e)>0&&(0!==(134217728&e)?this._settlePromises():v.settlePromises(this))}},i.prototype._reject=function(t){var e=this._bitField;if(!((117506048&e)>>>16))return this._setRejected(),this._fulfillmentHandler0=t,this._isFinal()?v.fatalError(t,f.isNode):void((65535&e)>0?v.settlePromises(this):this._ensurePossibleRejectionHandled())},i.prototype._fulfillPromises=function(t,e){for(var n=1;t>n;n++){var r=this._fulfillmentHandlerAt(n),i=this._promiseAt(n),o=this._receiverAt(n);this._clearCallbackDataAtIndex(n),this._settlePromise(i,r,o,e)}},i.prototype._rejectPromises=function(t,e){for(var n=1;t>n;n++){var r=this._rejectionHandlerAt(n),i=this._promiseAt(n),o=this._receiverAt(n);this._clearCallbackDataAtIndex(n),this._settlePromise(i,r,o,e)}},i.prototype._settlePromises=function(){var t=this._bitField,e=65535&t;if(e>0){if(0!==(16842752&t)){var n=this._fulfillmentHandler0;this._settlePromise0(this._rejectionHandler0,n,t),this._rejectPromises(e,n)}else{var r=this._rejectionHandler0;this._settlePromise0(this._fulfillmentHandler0,r,t),this._fulfillPromises(e,r)}this._setLength(0)}this._clearCancellationData()},i.prototype._settledValue=function(){var t=this._bitField;return 0!==(33554432&t)?this._rejectionHandler0:0!==(16777216&t)?this._fulfillmentHandler0:void 0},i.defer=i.pending=function(){x.deprecated("Promise.defer","new Promise");var t=new i(b);return{promise:t,resolve:o,reject:s}},f.notEnumerableProp(i,"_makeSelfResolutionError",l),t("./method")(i,b,j,p,x),t("./bind")(i,b,j,x),t("./cancel")(i,E,p,x),t("./direct_resolve")(i),t("./synchronous_inspection")(i),t("./join")(i,E,j,b,v,c),i.Promise=i,i.version="3.5.1",t("./map.js")(i,E,p,j,b,x),t("./call_get.js")(i),t("./using.js")(i,p,j,F,b,x),t("./timers.js")(i,b,x),t("./generators.js")(i,p,b,j,n,x),t("./nodeify.js")(i),t("./promisify.js")(i,b),t("./props.js")(i,E,j,p),t("./race.js")(i,b,j,p),t("./reduce.js")(i,E,p,j,b,x),t("./settle.js")(i,E,x),t("./some.js")(i,E,p),t("./filter.js")(i,b),t("./each.js")(i,b),t("./any.js")(i),f.toFastProperties(i),f.toFastProperties(i.prototype),a({a:1}),a({b:2}),a({c:3}),a(1),a(function(){}),a(void 0),a(!1),a(new i(b)),x.setBounds(d.firstLineError,f.lastLineError),i}},{"./any.js":1,"./async":2,"./bind":3,"./call_get.js":5,"./cancel":6,"./catch_filter":7,"./context":8,"./debuggability":9,"./direct_resolve":10,"./each.js":11,"./errors":12,"./es5":13,"./filter.js":14,"./finally":15,"./generators.js":16,"./join":17,"./map.js":18,"./method":19,"./nodeback":20,"./nodeify.js":21,"./promise_array":23,"./promisify.js":24,"./props.js":25,"./race.js":27,"./reduce.js":28,"./settle.js":30,"./some.js":31,"./synchronous_inspection":32,"./thenables":33,"./timers.js":34,"./using.js":35,"./util":36}],23:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o){function s(t){switch(t){case-2:return[];case-3:return{};case-6:return new Map}}function a(t){var r=this._promise=new e(n);t instanceof e&&r._propagateFrom(t,3),r._setOnCancel(this),this._values=t,this._length=0,this._totalResolved=0,this._init(void 0,-2)}var c=t("./util");c.isArray;return c.inherits(a,o),a.prototype.length=function(){return this._length},a.prototype.promise=function(){return this._promise},a.prototype._init=function l(t,n){var o=r(this._values,this._promise);if(o instanceof e){o=o._target();var a=o._bitField;if(this._values=o,0===(50397184&a))return this._promise._setAsyncGuaranteed(),o._then(l,this._reject,void 0,this,n);if(0===(33554432&a))return 0!==(16777216&a)?this._reject(o._reason()):this._cancel();o=o._value()}if(o=c.asArray(o),null===o){var u=i("expecting an array or an iterable object but got "+c.classString(o)).reason();return void this._promise._rejectCallback(u,!1)}return 0===o.length?void(-5===n?this._resolveEmptyArray():this._resolve(s(n))):void this._iterate(o)},a.prototype._iterate=function(t){var n=this.getActualLength(t.length);this._length=n,this._values=this.shouldCopyValues()?new Array(n):this._values;for(var i=this._promise,o=!1,s=null,a=0;n>a;++a){var c=r(t[a],i);c instanceof e?(c=c._target(),s=c._bitField):s=null,o?null!==s&&c.suppressUnhandledRejections():null!==s?0===(50397184&s)?(c._proxy(this,a),this._values[a]=c):o=0!==(33554432&s)?this._promiseFulfilled(c._value(),a):0!==(16777216&s)?this._promiseRejected(c._reason(),a):this._promiseCancelled(a):o=this._promiseFulfilled(c,a)}o||i._setAsyncGuaranteed()},a.prototype._isResolved=function(){return null===this._values},a.prototype._resolve=function(t){this._values=null,this._promise._fulfill(t)},a.prototype._cancel=function(){!this._isResolved()&&this._promise._isCancellable()&&(this._values=null,this._promise._cancel())},a.prototype._reject=function(t){this._values=null,this._promise._rejectCallback(t,!1)},a.prototype._promiseFulfilled=function(t,e){this._values[e]=t;var n=++this._totalResolved;return n>=this._length?(this._resolve(this._values),!0):!1},a.prototype._promiseCancelled=function(){return this._cancel(),!0},a.prototype._promiseRejected=function(t){return this._totalResolved++,this._reject(t),!0},a.prototype._resultCancelled=function(){if(!this._isResolved()){var t=this._values;if(this._cancel(),t instanceof e)t.cancel();else for(var n=0;nc;c+=2){var u=s[c],p=s[c+1],_=u+e;if(r===k)t[_]=k(u,h,u,p,e,i);else{var d=r(p,function(){return k(u,h,u,p,e,i)});f.notEnumerableProp(d,"__isPromisified__",!0),t[_]=d}}return f.toFastProperties(t),t}function u(t,e,n){return k(t,e,void 0,t,null,n)}var p,h={},f=t("./util"),_=t("./nodeback"),d=f.withAppended,v=f.maybeWrapAsError,y=f.canEvaluate,m=t("./errors").TypeError,g="Async",b={__isPromisified__:!0},w=["arity","length","name","arguments","caller","callee","prototype","__isPromisified__"],C=new RegExp("^(?:"+w.join("|")+")$"),j=function(t){return f.isIdentifier(t)&&"_"!==t.charAt(0)&&"constructor"!==t},E=function(t){return t.replace(/([$])/,"\\$")},k=y?p:c;e.promisify=function(t,e){if("function"!=typeof t)throw new m("expecting a function but got "+f.classString(t));if(i(t))return t;e=Object(e);var n=void 0===e.context?h:e.context,o=!!e.multiArgs,s=u(t,n,o);return f.copyDescriptors(t,s,r),s},e.promisifyAll=function(t,e){if("function"!=typeof t&&"object"!=typeof t)throw new m("the target of promisifyAll must be an object or a function\n\n See http://goo.gl/MqrFmX\n");e=Object(e);var n=!!e.multiArgs,r=e.suffix;"string"!=typeof r&&(r=g);var i=e.filter;"function"!=typeof i&&(i=j);var o=e.promisifier;if("function"!=typeof o&&(o=k),!f.isIdentifier(r))throw new RangeError("suffix must be a valid identifier\n\n See http://goo.gl/MqrFmX\n");for(var s=f.inheritedDataKeys(t),a=0;ao;++o){var s=r[o];e[o]=t[s],e[o+i]=s}}this.constructor$(e),this._isMap=n,this._init$(void 0,n?-6:-3)}function s(t){var n,s=r(t);return l(s)?(n=s instanceof e?s._then(e.props,void 0,void 0,void 0,void 0):new o(s).promise(),s instanceof e&&n._propagateFrom(s,2),n):i("cannot await properties of a non-object\n\n See http://goo.gl/MqrFmX\n")}var a,c=t("./util"),l=c.isObject,u=t("./es5");"function"==typeof Map&&(a=Map);var p=function(){function t(t,r){this[e]=t,this[e+n]=r,e++}var e=0,n=0;return function(r){n=r.size,e=0;var i=new Array(2*r.size);return r.forEach(t,i),i}}(),h=function(t){for(var e=new a,n=t.length/2|0,r=0;n>r;++r){var i=t[n+r],o=t[r];e.set(i,o)}return e};c.inherits(o,n),o.prototype._init=function(){},o.prototype._promiseFulfilled=function(t,e){this._values[e]=t;var n=++this._totalResolved;if(n>=this._length){var r;if(this._isMap)r=h(this._values);else{r={};for(var i=this.length(),o=0,s=this.length();s>o;++o)r[this._values[o+i]]=this._values[o]}return this._resolve(r),!0}return!1},o.prototype.shouldCopyValues=function(){return!1},o.prototype.getActualLength=function(t){return t>>1},e.prototype.props=function(){return s(this)},e.props=function(t){return s(t)}}},{"./es5":13,"./util":36}],26:[function(t,e,n){"use strict";function r(t,e,n,r,i){for(var o=0;i>o;++o)n[o+r]=t[o+e],t[o+e]=void 0}function i(t){this._capacity=t,this._length=0,this._front=0}i.prototype._willBeOverCapacity=function(t){return this._capacityh;++h){var _=t[h];(void 0!==_||h in t)&&e.cast(_)._then(u,p,void 0,l,null)}return l}var s=t("./util"),a=function(t){return t.then(function(e){return o(e,t)})};e.race=function(t){return o(t,void 0)},e.prototype.race=function(){return o(this,void 0)}}},{"./util":36}],28:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,s){function a(t,n,r,i){this.constructor$(t);var s=h();this._fn=null===s?n:f.domainBind(s,n),void 0!==r&&(r=e.resolve(r),r._attachCancellationCallback(this)),this._initialValue=r,this._currentCancellable=null,i===o?this._eachValues=Array(this._length):0===i?this._eachValues=null:this._eachValues=void 0,this._promise._captureStackTrace(),this._init$(void 0,-5)}function c(t,e){this.isFulfilled()?e._resolve(t):e._reject(t)}function l(t,e,n,i){if("function"!=typeof e)return r("expecting a function but got "+f.classString(e));var o=new a(t,e,n,i);return o.promise()}function u(t){this.accum=t,this.array._gotAccum(t);var n=i(this.value,this.array._promise);return n instanceof e?(this.array._currentCancellable=n,n._then(p,void 0,void 0,this,void 0)):p.call(this,n)}function p(t){var n=this.array,r=n._promise,i=_(n._fn);r._pushContext();var o;o=void 0!==n._eachValues?i.call(r._boundValue(),t,this.index,this.length):i.call(r._boundValue(),this.accum,t,this.index,this.length),o instanceof e&&(n._currentCancellable=o);var a=r._popContext();return s.checkForgottenReturns(o,a,void 0!==n._eachValues?"Promise.each":"Promise.reduce",r),o}var h=e._getDomain,f=t("./util"),_=f.tryCatch;f.inherits(a,n),a.prototype._gotAccum=function(t){void 0!==this._eachValues&&null!==this._eachValues&&t!==o&&this._eachValues.push(t)},a.prototype._eachComplete=function(t){return null!==this._eachValues&&this._eachValues.push(t),this._eachValues},a.prototype._init=function(){},a.prototype._resolveEmptyArray=function(){this._resolve(void 0!==this._eachValues?this._eachValues:this._initialValue)},a.prototype.shouldCopyValues=function(){return!1},a.prototype._resolve=function(t){this._promise._resolveCallback(t),this._values=null},a.prototype._resultCancelled=function(t){return t===this._initialValue?this._cancel():void(this._isResolved()||(this._resultCancelled$(),this._currentCancellable instanceof e&&this._currentCancellable.cancel(),this._initialValue instanceof e&&this._initialValue.cancel()))},a.prototype._iterate=function(t){this._values=t;var n,r,i=t.length;if(void 0!==this._initialValue?(n=this._initialValue,r=0):(n=e.resolve(t[0]),r=1),this._currentCancellable=n,!n.isRejected())for(;i>r;++r){var o={accum:null,value:t[r],index:r,length:i,array:this};n=n._then(u,void 0,void 0,o,void 0)}void 0!==this._eachValues&&(n=n._then(this._eachComplete,void 0,void 0,this,void 0)),n._then(c,c,void 0,n,this)},e.prototype.reduce=function(t,e){return l(this,t,e,null)},e.reduce=function(t,e,n,r){return l(t,e,n,r)}}},{"./util":36}],29:[function(t,e,n){"use strict";var r,i=t("./util"),o=function(){throw new Error("No async scheduler available\n\n See http://goo.gl/MqrFmX\n")},s=i.getNativePromise();if(i.isNode&&"undefined"==typeof MutationObserver){var a=global.setImmediate,c=process.nextTick;r=i.isRecentNode?function(t){a.call(global,t)}:function(t){c.call(process,t)}}else if("function"==typeof s&&"function"==typeof s.resolve){var l=s.resolve();r=function(t){l.then(t)}}else r="undefined"==typeof MutationObserver||"undefined"!=typeof window&&window.navigator&&(window.navigator.standalone||window.cordova)?"undefined"!=typeof setImmediate?function(t){setImmediate(t)}:"undefined"!=typeof setTimeout?function(t){setTimeout(t,0)}:o:function(){var t=document.createElement("div"),e={attributes:!0},n=!1,r=document.createElement("div"),i=new MutationObserver(function(){t.classList.toggle("foo"),n=!1});i.observe(r,e);var o=function(){n||(n=!0,r.classList.toggle("foo"))};return function(n){var r=new MutationObserver(function(){r.disconnect(),n()});r.observe(t,e),o()}}();e.exports=r},{"./util":36}],30:[function(t,e,n){"use strict";e.exports=function(e,n,r){function i(t){this.constructor$(t)}var o=e.PromiseInspection,s=t("./util");s.inherits(i,n),i.prototype._promiseResolved=function(t,e){this._values[t]=e;var n=++this._totalResolved;return n>=this._length?(this._resolve(this._values),!0):!1},i.prototype._promiseFulfilled=function(t,e){var n=new o;return n._bitField=33554432,n._settledValueField=t,this._promiseResolved(e,n)},i.prototype._promiseRejected=function(t,e){var n=new o;return n._bitField=16777216,n._settledValueField=t,this._promiseResolved(e,n)},e.settle=function(t){return r.deprecated(".settle()",".reflect()"),new i(t).promise()},e.prototype.settle=function(){return e.settle(this)}}},{"./util":36}],31:[function(t,e,n){"use strict";e.exports=function(e,n,r){function i(t){this.constructor$(t),
+this._howMany=0,this._unwrap=!1,this._initialized=!1}function o(t,e){if((0|e)!==e||0>e)return r("expecting a positive integer\n\n See http://goo.gl/MqrFmX\n");var n=new i(t),o=n.promise();return n.setHowMany(e),n.init(),o}var s=t("./util"),a=t("./errors").RangeError,c=t("./errors").AggregateError,l=s.isArray,u={};s.inherits(i,n),i.prototype._init=function(){if(this._initialized){if(0===this._howMany)return void this._resolve([]);this._init$(void 0,-5);var t=l(this._values);!this._isResolved()&&t&&this._howMany>this._canPossiblyFulfill()&&this._reject(this._getRangeError(this.length()))}},i.prototype.init=function(){this._initialized=!0,this._init()},i.prototype.setUnwrap=function(){this._unwrap=!0},i.prototype.howMany=function(){return this._howMany},i.prototype.setHowMany=function(t){this._howMany=t},i.prototype._promiseFulfilled=function(t){return this._addFulfilled(t),this._fulfilled()===this.howMany()?(this._values.length=this.howMany(),1===this.howMany()&&this._unwrap?this._resolve(this._values[0]):this._resolve(this._values),!0):!1},i.prototype._promiseRejected=function(t){return this._addRejected(t),this._checkOutcome()},i.prototype._promiseCancelled=function(){return this._values instanceof e||null==this._values?this._cancel():(this._addRejected(u),this._checkOutcome())},i.prototype._checkOutcome=function(){if(this.howMany()>this._canPossiblyFulfill()){for(var t=new c,e=this.length();e0?this._reject(t):this._cancel(),!0}return!1},i.prototype._fulfilled=function(){return this._totalResolved},i.prototype._rejected=function(){return this._values.length-this.length()},i.prototype._addRejected=function(t){this._values.push(t)},i.prototype._addFulfilled=function(t){this._values[this._totalResolved++]=t},i.prototype._canPossiblyFulfill=function(){return this.length()-this._rejected()},i.prototype._getRangeError=function(t){var e="Input array must contain at least "+this._howMany+" items but contains only "+t+" items";return new a(e)},i.prototype._resolveEmptyArray=function(){this._reject(this._getRangeError(0))},e.some=function(t,e){return o(t,e)},e.prototype.some=function(t){return o(this,t)},e._SomePromiseArray=i}},{"./errors":12,"./util":36}],32:[function(t,e,n){"use strict";e.exports=function(t){function e(t){void 0!==t?(t=t._target(),this._bitField=t._bitField,this._settledValueField=t._isFateSealed()?t._settledValue():void 0):(this._bitField=0,this._settledValueField=void 0)}e.prototype._settledValue=function(){return this._settledValueField};var n=e.prototype.value=function(){if(!this.isFulfilled())throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\n\n See http://goo.gl/MqrFmX\n");return this._settledValue()},r=e.prototype.error=e.prototype.reason=function(){if(!this.isRejected())throw new TypeError("cannot get rejection reason of a non-rejected promise\n\n See http://goo.gl/MqrFmX\n");return this._settledValue()},i=e.prototype.isFulfilled=function(){return 0!==(33554432&this._bitField)},o=e.prototype.isRejected=function(){return 0!==(16777216&this._bitField)},s=e.prototype.isPending=function(){return 0===(50397184&this._bitField)},a=e.prototype.isResolved=function(){return 0!==(50331648&this._bitField)};e.prototype.isCancelled=function(){return 0!==(8454144&this._bitField)},t.prototype.__isCancelled=function(){return 65536===(65536&this._bitField)},t.prototype._isCancelled=function(){return this._target().__isCancelled()},t.prototype.isCancelled=function(){return 0!==(8454144&this._target()._bitField)},t.prototype.isPending=function(){return s.call(this._target())},t.prototype.isRejected=function(){return o.call(this._target())},t.prototype.isFulfilled=function(){return i.call(this._target())},t.prototype.isResolved=function(){return a.call(this._target())},t.prototype.value=function(){return n.call(this._target())},t.prototype.reason=function(){var t=this._target();return t._unsetRejectionIsUnhandled(),r.call(t)},t.prototype._value=function(){return this._settledValue()},t.prototype._reason=function(){return this._unsetRejectionIsUnhandled(),this._settledValue()},t.PromiseInspection=e}},{}],33:[function(t,e,n){"use strict";e.exports=function(e,n){function r(t,r){if(u(t)){if(t instanceof e)return t;var i=o(t);if(i===l){r&&r._pushContext();var c=e.reject(i.e);return r&&r._popContext(),c}if("function"==typeof i){if(s(t)){var c=new e(n);return t._then(c._fulfill,c._reject,void 0,c,null),c}return a(t,i,r)}}return t}function i(t){return t.then}function o(t){try{return i(t)}catch(e){return l.e=e,l}}function s(t){try{return p.call(t,"_promise0")}catch(e){return!1}}function a(t,r,i){function o(t){a&&(a._resolveCallback(t),a=null)}function s(t){a&&(a._rejectCallback(t,p,!0),a=null)}var a=new e(n),u=a;i&&i._pushContext(),a._captureStackTrace(),i&&i._popContext();var p=!0,h=c.tryCatch(r).call(t,o,s);return p=!1,a&&h===l&&(a._rejectCallback(h.e,!0,!0),a=null),u}var c=t("./util"),l=c.errorObj,u=c.isObject,p={}.hasOwnProperty;return r}},{"./util":36}],34:[function(t,e,n){"use strict";e.exports=function(e,n,r){function i(t){this.handle=t}function o(t){return clearTimeout(this.handle),t}function s(t){throw clearTimeout(this.handle),t}var a=t("./util"),c=e.TimeoutError;i.prototype._resultCancelled=function(){clearTimeout(this.handle)};var l=function(t){return u(+this).thenReturn(t)},u=e.delay=function(t,o){var s,a;return void 0!==o?(s=e.resolve(o)._then(l,null,null,t,void 0),r.cancellation()&&o instanceof e&&s._setOnCancel(o)):(s=new e(n),a=setTimeout(function(){s._fulfill()},+t),r.cancellation()&&s._setOnCancel(new i(a)),s._captureStackTrace()),s._setAsyncGuaranteed(),s};e.prototype.delay=function(t){return u(t,this)};var p=function(t,e,n){var r;r="string"!=typeof e?e instanceof Error?e:new c("operation timed out"):new c(e),a.markAsOriginatingFromRejection(r),t._attachExtraTrace(r),t._reject(r),null!=n&&n.cancel()};e.prototype.timeout=function(t,e){t=+t;var n,a,c=new i(setTimeout(function(){n.isPending()&&p(n,e,a)},t));return r.cancellation()?(a=this.then(),n=a._then(o,s,void 0,c,void 0),n._setOnCancel(c)):n=this._then(o,s,void 0,c,void 0),n}}},{"./util":36}],35:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,s){function a(t){setTimeout(function(){throw t},0)}function c(t){var e=r(t);return e!==t&&"function"==typeof t._isDisposable&&"function"==typeof t._getDisposer&&t._isDisposable()&&e._setDisposable(t._getDisposer()),e}function l(t,n){function i(){if(s>=l)return u._fulfill();var o=c(t[s++]);if(o instanceof e&&o._isDisposable()){try{o=r(o._getDisposer().tryDispose(n),t.promise)}catch(p){return a(p)}if(o instanceof e)return o._then(i,a,null,null,null)}i()}var s=0,l=t.length,u=new e(o);return i(),u}function u(t,e,n){this._data=t,this._promise=e,this._context=n}function p(t,e,n){this.constructor$(t,e,n)}function h(t){return u.isDisposer(t)?(this.resources[this.index]._setDisposable(t),t.promise()):t}function f(t){this.length=t,this.promise=null,this[t-1]=null}var _=t("./util"),d=t("./errors").TypeError,v=t("./util").inherits,y=_.errorObj,m=_.tryCatch,g={};u.prototype.data=function(){return this._data},u.prototype.promise=function(){return this._promise},u.prototype.resource=function(){return this.promise().isFulfilled()?this.promise().value():g},u.prototype.tryDispose=function(t){var e=this.resource(),n=this._context;void 0!==n&&n._pushContext();var r=e!==g?this.doDispose(e,t):null;return void 0!==n&&n._popContext(),this._promise._unsetDisposable(),this._data=null,r},u.isDisposer=function(t){return null!=t&&"function"==typeof t.resource&&"function"==typeof t.tryDispose},v(p,u),p.prototype.doDispose=function(t,e){var n=this.data();return n.call(t,t,e)},f.prototype._resultCancelled=function(){for(var t=this.length,n=0;t>n;++n){var r=this[n];r instanceof e&&r.cancel()}},e.using=function(){var t=arguments.length;if(2>t)return n("you must pass at least 2 arguments to Promise.using");var i=arguments[t-1];if("function"!=typeof i)return n("expecting a function but got "+_.classString(i));var o,a=!0;2===t&&Array.isArray(arguments[0])?(o=arguments[0],t=o.length,a=!1):(o=arguments,t--);for(var c=new f(t),p=0;t>p;++p){var d=o[p];if(u.isDisposer(d)){var v=d;d=d.promise(),d._setDisposable(v)}else{var g=r(d);g instanceof e&&(d=g._then(h,null,null,{resources:c,index:p},void 0))}c[p]=d}for(var b=new Array(c.length),p=0;p0},e.prototype._getDisposer=function(){return this._disposer},e.prototype._unsetDisposable=function(){this._bitField=-131073&this._bitField,this._disposer=void 0},e.prototype.disposer=function(t){if("function"==typeof t)return new p(t,this,i());throw new d}}},{"./errors":12,"./util":36}],36:[function(t,e,n){"use strict";function r(){try{var t=P;return P=null,t.apply(this,arguments)}catch(e){return T.e=e,T}}function i(t){return P=t,r}function o(t){return null==t||t===!0||t===!1||"string"==typeof t||"number"==typeof t}function s(t){return"function"==typeof t||"object"==typeof t&&null!==t}function a(t){return o(t)?new Error(v(t)):t}function c(t,e){var n,r=t.length,i=new Array(r+1);for(n=0;r>n;++n)i[n]=t[n];return i[n]=e,i}function l(t,e,n){if(!F.isES5)return{}.hasOwnProperty.call(t,e)?t[e]:void 0;var r=Object.getOwnPropertyDescriptor(t,e);return null!=r?null==r.get&&null==r.set?r.value:n:void 0}function u(t,e,n){if(o(t))return t;var r={value:n,configurable:!0,enumerable:!1,writable:!0};return F.defineProperty(t,e,r),t}function p(t){throw t}function h(t){try{if("function"==typeof t){var e=F.names(t.prototype),n=F.isES5&&e.length>1,r=e.length>0&&!(1===e.length&&"constructor"===e[0]),i=A.test(t+"")&&F.names(t).length>0;if(n||r||i)return!0}return!1}catch(o){return!1}}function f(t){function e(){}e.prototype=t;for(var n=8;n--;)new e;return t}function _(t){return D.test(t)}function d(t,e,n){for(var r=new Array(t),i=0;t>i;++i)r[i]=e+i+n;return r}function v(t){try{return t+""}catch(e){return"[no string representation]"}}function y(t){return t instanceof Error||null!==t&&"object"==typeof t&&"string"==typeof t.message&&"string"==typeof t.name}function m(t){try{u(t,"isOperational",!0)}catch(e){}}function g(t){return null==t?!1:t instanceof Error.__BluebirdErrorTypes__.OperationalError||t.isOperational===!0}function b(t){return y(t)&&F.propertyIsWritable(t,"stack")}function w(t){return{}.toString.call(t)}function C(t,e,n){for(var r=F.names(t),i=0;i10||t[0]>0}(),B.isNode&&B.toFastProperties(process);try{throw new Error}catch(U){B.lastLineError=U}e.exports=B},{"./es5":13}]},{},[4])(4)}),"undefined"!=typeof window&&null!==window?window.P=window.Promise:"undefined"!=typeof self&&null!==self&&(self.P=self.Promise);
\ No newline at end of file
diff --git a/Restaurant/node_modules/bluebird/js/release/any.js b/Restaurant/node_modules/bluebird/js/release/any.js
new file mode 100644
index 0000000..05a6228
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/any.js
@@ -0,0 +1,21 @@
+"use strict";
+module.exports = function(Promise) {
+var SomePromiseArray = Promise._SomePromiseArray;
+function any(promises) {
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(1);
+ ret.setUnwrap();
+ ret.init();
+ return promise;
+}
+
+Promise.any = function (promises) {
+ return any(promises);
+};
+
+Promise.prototype.any = function () {
+ return any(this);
+};
+
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/assert.js b/Restaurant/node_modules/bluebird/js/release/assert.js
new file mode 100644
index 0000000..4518231
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/assert.js
@@ -0,0 +1,55 @@
+"use strict";
+module.exports = (function(){
+var AssertionError = (function() {
+ function AssertionError(a) {
+ this.constructor$(a);
+ this.message = a;
+ this.name = "AssertionError";
+ }
+ AssertionError.prototype = new Error();
+ AssertionError.prototype.constructor = AssertionError;
+ AssertionError.prototype.constructor$ = Error;
+ return AssertionError;
+})();
+
+function getParams(args) {
+ var params = [];
+ for (var i = 0; i < args.length; ++i) params.push("arg" + i);
+ return params;
+}
+
+function nativeAssert(callName, args, expect) {
+ try {
+ var params = getParams(args);
+ var constructorArgs = params;
+ constructorArgs.push("return " +
+ callName + "("+ params.join(",") + ");");
+ var fn = Function.apply(null, constructorArgs);
+ return fn.apply(null, args);
+ } catch (e) {
+ if (!(e instanceof SyntaxError)) {
+ throw e;
+ } else {
+ return expect;
+ }
+ }
+}
+
+return function assert(boolExpr, message) {
+ if (boolExpr === true) return;
+
+ if (typeof boolExpr === "string" &&
+ boolExpr.charAt(0) === "%") {
+ var nativeCallName = boolExpr;
+ var $_len = arguments.length;var args = new Array(Math.max($_len - 2, 0)); for(var $_i = 2; $_i < $_len; ++$_i) {args[$_i - 2] = arguments[$_i];};
+ if (nativeAssert(nativeCallName, args, message) === message) return;
+ message = (nativeCallName + " !== " + message);
+ }
+
+ var ret = new AssertionError(message);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(ret, assert);
+ }
+ throw ret;
+};
+})();
diff --git a/Restaurant/node_modules/bluebird/js/release/async.js b/Restaurant/node_modules/bluebird/js/release/async.js
new file mode 100644
index 0000000..41f6655
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/async.js
@@ -0,0 +1,161 @@
+"use strict";
+var firstLineError;
+try {throw new Error(); } catch (e) {firstLineError = e;}
+var schedule = require("./schedule");
+var Queue = require("./queue");
+var util = require("./util");
+
+function Async() {
+ this._customScheduler = false;
+ this._isTickUsed = false;
+ this._lateQueue = new Queue(16);
+ this._normalQueue = new Queue(16);
+ this._haveDrainedQueues = false;
+ this._trampolineEnabled = true;
+ var self = this;
+ this.drainQueues = function () {
+ self._drainQueues();
+ };
+ this._schedule = schedule;
+}
+
+Async.prototype.setScheduler = function(fn) {
+ var prev = this._schedule;
+ this._schedule = fn;
+ this._customScheduler = true;
+ return prev;
+};
+
+Async.prototype.hasCustomScheduler = function() {
+ return this._customScheduler;
+};
+
+Async.prototype.enableTrampoline = function() {
+ this._trampolineEnabled = true;
+};
+
+Async.prototype.disableTrampolineIfNecessary = function() {
+ if (util.hasDevTools) {
+ this._trampolineEnabled = false;
+ }
+};
+
+Async.prototype.haveItemsQueued = function () {
+ return this._isTickUsed || this._haveDrainedQueues;
+};
+
+
+Async.prototype.fatalError = function(e, isNode) {
+ if (isNode) {
+ process.stderr.write("Fatal " + (e instanceof Error ? e.stack : e) +
+ "\n");
+ process.exit(2);
+ } else {
+ this.throwLater(e);
+ }
+};
+
+Async.prototype.throwLater = function(fn, arg) {
+ if (arguments.length === 1) {
+ arg = fn;
+ fn = function () { throw arg; };
+ }
+ if (typeof setTimeout !== "undefined") {
+ setTimeout(function() {
+ fn(arg);
+ }, 0);
+ } else try {
+ this._schedule(function() {
+ fn(arg);
+ });
+ } catch (e) {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+};
+
+function AsyncInvokeLater(fn, receiver, arg) {
+ this._lateQueue.push(fn, receiver, arg);
+ this._queueTick();
+}
+
+function AsyncInvoke(fn, receiver, arg) {
+ this._normalQueue.push(fn, receiver, arg);
+ this._queueTick();
+}
+
+function AsyncSettlePromises(promise) {
+ this._normalQueue._pushOne(promise);
+ this._queueTick();
+}
+
+if (!util.hasDevTools) {
+ Async.prototype.invokeLater = AsyncInvokeLater;
+ Async.prototype.invoke = AsyncInvoke;
+ Async.prototype.settlePromises = AsyncSettlePromises;
+} else {
+ Async.prototype.invokeLater = function (fn, receiver, arg) {
+ if (this._trampolineEnabled) {
+ AsyncInvokeLater.call(this, fn, receiver, arg);
+ } else {
+ this._schedule(function() {
+ setTimeout(function() {
+ fn.call(receiver, arg);
+ }, 100);
+ });
+ }
+ };
+
+ Async.prototype.invoke = function (fn, receiver, arg) {
+ if (this._trampolineEnabled) {
+ AsyncInvoke.call(this, fn, receiver, arg);
+ } else {
+ this._schedule(function() {
+ fn.call(receiver, arg);
+ });
+ }
+ };
+
+ Async.prototype.settlePromises = function(promise) {
+ if (this._trampolineEnabled) {
+ AsyncSettlePromises.call(this, promise);
+ } else {
+ this._schedule(function() {
+ promise._settlePromises();
+ });
+ }
+ };
+}
+
+Async.prototype._drainQueue = function(queue) {
+ while (queue.length() > 0) {
+ var fn = queue.shift();
+ if (typeof fn !== "function") {
+ fn._settlePromises();
+ continue;
+ }
+ var receiver = queue.shift();
+ var arg = queue.shift();
+ fn.call(receiver, arg);
+ }
+};
+
+Async.prototype._drainQueues = function () {
+ this._drainQueue(this._normalQueue);
+ this._reset();
+ this._haveDrainedQueues = true;
+ this._drainQueue(this._lateQueue);
+};
+
+Async.prototype._queueTick = function () {
+ if (!this._isTickUsed) {
+ this._isTickUsed = true;
+ this._schedule(this.drainQueues);
+ }
+};
+
+Async.prototype._reset = function () {
+ this._isTickUsed = false;
+};
+
+module.exports = Async;
+module.exports.firstLineError = firstLineError;
diff --git a/Restaurant/node_modules/bluebird/js/release/bind.js b/Restaurant/node_modules/bluebird/js/release/bind.js
new file mode 100644
index 0000000..fc3379d
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/bind.js
@@ -0,0 +1,67 @@
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise, debug) {
+var calledBind = false;
+var rejectThis = function(_, e) {
+ this._reject(e);
+};
+
+var targetRejected = function(e, context) {
+ context.promiseRejectionQueued = true;
+ context.bindingPromise._then(rejectThis, rejectThis, null, this, e);
+};
+
+var bindingResolved = function(thisArg, context) {
+ if (((this._bitField & 50397184) === 0)) {
+ this._resolveCallback(context.target);
+ }
+};
+
+var bindingRejected = function(e, context) {
+ if (!context.promiseRejectionQueued) this._reject(e);
+};
+
+Promise.prototype.bind = function (thisArg) {
+ if (!calledBind) {
+ calledBind = true;
+ Promise.prototype._propagateFrom = debug.propagateFromFunction();
+ Promise.prototype._boundValue = debug.boundValueFunction();
+ }
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+ ret._propagateFrom(this, 1);
+ var target = this._target();
+ ret._setBoundTo(maybePromise);
+ if (maybePromise instanceof Promise) {
+ var context = {
+ promiseRejectionQueued: false,
+ promise: ret,
+ target: target,
+ bindingPromise: maybePromise
+ };
+ target._then(INTERNAL, targetRejected, undefined, ret, context);
+ maybePromise._then(
+ bindingResolved, bindingRejected, undefined, ret, context);
+ ret._setOnCancel(maybePromise);
+ } else {
+ ret._resolveCallback(target);
+ }
+ return ret;
+};
+
+Promise.prototype._setBoundTo = function (obj) {
+ if (obj !== undefined) {
+ this._bitField = this._bitField | 2097152;
+ this._boundTo = obj;
+ } else {
+ this._bitField = this._bitField & (~2097152);
+ }
+};
+
+Promise.prototype._isBound = function () {
+ return (this._bitField & 2097152) === 2097152;
+};
+
+Promise.bind = function (thisArg, value) {
+ return Promise.resolve(value).bind(thisArg);
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/bluebird.js b/Restaurant/node_modules/bluebird/js/release/bluebird.js
new file mode 100644
index 0000000..1c36cf3
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/bluebird.js
@@ -0,0 +1,11 @@
+"use strict";
+var old;
+if (typeof Promise !== "undefined") old = Promise;
+function noConflict() {
+ try { if (Promise === bluebird) Promise = old; }
+ catch (e) {}
+ return bluebird;
+}
+var bluebird = require("./promise")();
+bluebird.noConflict = noConflict;
+module.exports = bluebird;
diff --git a/Restaurant/node_modules/bluebird/js/release/call_get.js b/Restaurant/node_modules/bluebird/js/release/call_get.js
new file mode 100644
index 0000000..0ed7714
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/call_get.js
@@ -0,0 +1,123 @@
+"use strict";
+var cr = Object.create;
+if (cr) {
+ var callerCache = cr(null);
+ var getterCache = cr(null);
+ callerCache[" size"] = getterCache[" size"] = 0;
+}
+
+module.exports = function(Promise) {
+var util = require("./util");
+var canEvaluate = util.canEvaluate;
+var isIdentifier = util.isIdentifier;
+
+var getMethodCaller;
+var getGetter;
+if (!false) {
+var makeMethodCaller = function (methodName) {
+ return new Function("ensureMethod", " \n\
+ return function(obj) { \n\
+ 'use strict' \n\
+ var len = this.length; \n\
+ ensureMethod(obj, 'methodName'); \n\
+ switch(len) { \n\
+ case 1: return obj.methodName(this[0]); \n\
+ case 2: return obj.methodName(this[0], this[1]); \n\
+ case 3: return obj.methodName(this[0], this[1], this[2]); \n\
+ case 0: return obj.methodName(); \n\
+ default: \n\
+ return obj.methodName.apply(obj, this); \n\
+ } \n\
+ }; \n\
+ ".replace(/methodName/g, methodName))(ensureMethod);
+};
+
+var makeGetter = function (propertyName) {
+ return new Function("obj", " \n\
+ 'use strict'; \n\
+ return obj.propertyName; \n\
+ ".replace("propertyName", propertyName));
+};
+
+var getCompiled = function(name, compiler, cache) {
+ var ret = cache[name];
+ if (typeof ret !== "function") {
+ if (!isIdentifier(name)) {
+ return null;
+ }
+ ret = compiler(name);
+ cache[name] = ret;
+ cache[" size"]++;
+ if (cache[" size"] > 512) {
+ var keys = Object.keys(cache);
+ for (var i = 0; i < 256; ++i) delete cache[keys[i]];
+ cache[" size"] = keys.length - 256;
+ }
+ }
+ return ret;
+};
+
+getMethodCaller = function(name) {
+ return getCompiled(name, makeMethodCaller, callerCache);
+};
+
+getGetter = function(name) {
+ return getCompiled(name, makeGetter, getterCache);
+};
+}
+
+function ensureMethod(obj, methodName) {
+ var fn;
+ if (obj != null) fn = obj[methodName];
+ if (typeof fn !== "function") {
+ var message = "Object " + util.classString(obj) + " has no method '" +
+ util.toString(methodName) + "'";
+ throw new Promise.TypeError(message);
+ }
+ return fn;
+}
+
+function caller(obj) {
+ var methodName = this.pop();
+ var fn = ensureMethod(obj, methodName);
+ return fn.apply(obj, this);
+}
+Promise.prototype.call = function (methodName) {
+ var $_len = arguments.length;var args = new Array(Math.max($_len - 1, 0)); for(var $_i = 1; $_i < $_len; ++$_i) {args[$_i - 1] = arguments[$_i];};
+ if (!false) {
+ if (canEvaluate) {
+ var maybeCaller = getMethodCaller(methodName);
+ if (maybeCaller !== null) {
+ return this._then(
+ maybeCaller, undefined, undefined, args, undefined);
+ }
+ }
+ }
+ args.push(methodName);
+ return this._then(caller, undefined, undefined, args, undefined);
+};
+
+function namedGetter(obj) {
+ return obj[this];
+}
+function indexedGetter(obj) {
+ var index = +this;
+ if (index < 0) index = Math.max(0, index + obj.length);
+ return obj[index];
+}
+Promise.prototype.get = function (propertyName) {
+ var isIndex = (typeof propertyName === "number");
+ var getter;
+ if (!isIndex) {
+ if (canEvaluate) {
+ var maybeGetter = getGetter(propertyName);
+ getter = maybeGetter !== null ? maybeGetter : namedGetter;
+ } else {
+ getter = namedGetter;
+ }
+ } else {
+ getter = indexedGetter;
+ }
+ return this._then(getter, undefined, undefined, propertyName, undefined);
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/cancel.js b/Restaurant/node_modules/bluebird/js/release/cancel.js
new file mode 100644
index 0000000..7a12415
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/cancel.js
@@ -0,0 +1,129 @@
+"use strict";
+module.exports = function(Promise, PromiseArray, apiRejection, debug) {
+var util = require("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+Promise.prototype["break"] = Promise.prototype.cancel = function() {
+ if (!debug.cancellation()) return this._warn("cancellation is disabled");
+
+ var promise = this;
+ var child = promise;
+ while (promise._isCancellable()) {
+ if (!promise._cancelBy(child)) {
+ if (child._isFollowing()) {
+ child._followee().cancel();
+ } else {
+ child._cancelBranched();
+ }
+ break;
+ }
+
+ var parent = promise._cancellationParent;
+ if (parent == null || !parent._isCancellable()) {
+ if (promise._isFollowing()) {
+ promise._followee().cancel();
+ } else {
+ promise._cancelBranched();
+ }
+ break;
+ } else {
+ if (promise._isFollowing()) promise._followee().cancel();
+ promise._setWillBeCancelled();
+ child = promise;
+ promise = parent;
+ }
+ }
+};
+
+Promise.prototype._branchHasCancelled = function() {
+ this._branchesRemainingToCancel--;
+};
+
+Promise.prototype._enoughBranchesHaveCancelled = function() {
+ return this._branchesRemainingToCancel === undefined ||
+ this._branchesRemainingToCancel <= 0;
+};
+
+Promise.prototype._cancelBy = function(canceller) {
+ if (canceller === this) {
+ this._branchesRemainingToCancel = 0;
+ this._invokeOnCancel();
+ return true;
+ } else {
+ this._branchHasCancelled();
+ if (this._enoughBranchesHaveCancelled()) {
+ this._invokeOnCancel();
+ return true;
+ }
+ }
+ return false;
+};
+
+Promise.prototype._cancelBranched = function() {
+ if (this._enoughBranchesHaveCancelled()) {
+ this._cancel();
+ }
+};
+
+Promise.prototype._cancel = function() {
+ if (!this._isCancellable()) return;
+ this._setCancelled();
+ async.invoke(this._cancelPromises, this, undefined);
+};
+
+Promise.prototype._cancelPromises = function() {
+ if (this._length() > 0) this._settlePromises();
+};
+
+Promise.prototype._unsetOnCancel = function() {
+ this._onCancelField = undefined;
+};
+
+Promise.prototype._isCancellable = function() {
+ return this.isPending() && !this._isCancelled();
+};
+
+Promise.prototype.isCancellable = function() {
+ return this.isPending() && !this.isCancelled();
+};
+
+Promise.prototype._doInvokeOnCancel = function(onCancelCallback, internalOnly) {
+ if (util.isArray(onCancelCallback)) {
+ for (var i = 0; i < onCancelCallback.length; ++i) {
+ this._doInvokeOnCancel(onCancelCallback[i], internalOnly);
+ }
+ } else if (onCancelCallback !== undefined) {
+ if (typeof onCancelCallback === "function") {
+ if (!internalOnly) {
+ var e = tryCatch(onCancelCallback).call(this._boundValue());
+ if (e === errorObj) {
+ this._attachExtraTrace(e.e);
+ async.throwLater(e.e);
+ }
+ }
+ } else {
+ onCancelCallback._resultCancelled(this);
+ }
+ }
+};
+
+Promise.prototype._invokeOnCancel = function() {
+ var onCancelCallback = this._onCancel();
+ this._unsetOnCancel();
+ async.invoke(this._doInvokeOnCancel, this, onCancelCallback);
+};
+
+Promise.prototype._invokeInternalOnCancel = function() {
+ if (this._isCancellable()) {
+ this._doInvokeOnCancel(this._onCancel(), true);
+ this._unsetOnCancel();
+ }
+};
+
+Promise.prototype._resultCancelled = function() {
+ this.cancel();
+};
+
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/catch_filter.js b/Restaurant/node_modules/bluebird/js/release/catch_filter.js
new file mode 100644
index 0000000..0f24ce2
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/catch_filter.js
@@ -0,0 +1,42 @@
+"use strict";
+module.exports = function(NEXT_FILTER) {
+var util = require("./util");
+var getKeys = require("./es5").keys;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function catchFilter(instances, cb, promise) {
+ return function(e) {
+ var boundTo = promise._boundValue();
+ predicateLoop: for (var i = 0; i < instances.length; ++i) {
+ var item = instances[i];
+
+ if (item === Error ||
+ (item != null && item.prototype instanceof Error)) {
+ if (e instanceof item) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (typeof item === "function") {
+ var matchesPredicate = tryCatch(item).call(boundTo, e);
+ if (matchesPredicate === errorObj) {
+ return matchesPredicate;
+ } else if (matchesPredicate) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (util.isObject(e)) {
+ var keys = getKeys(item);
+ for (var j = 0; j < keys.length; ++j) {
+ var key = keys[j];
+ if (item[key] != e[key]) {
+ continue predicateLoop;
+ }
+ }
+ return tryCatch(cb).call(boundTo, e);
+ }
+ }
+ return NEXT_FILTER;
+ };
+}
+
+return catchFilter;
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/context.js b/Restaurant/node_modules/bluebird/js/release/context.js
new file mode 100644
index 0000000..c307414
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/context.js
@@ -0,0 +1,69 @@
+"use strict";
+module.exports = function(Promise) {
+var longStackTraces = false;
+var contextStack = [];
+
+Promise.prototype._promiseCreated = function() {};
+Promise.prototype._pushContext = function() {};
+Promise.prototype._popContext = function() {return null;};
+Promise._peekContext = Promise.prototype._peekContext = function() {};
+
+function Context() {
+ this._trace = new Context.CapturedTrace(peekContext());
+}
+Context.prototype._pushContext = function () {
+ if (this._trace !== undefined) {
+ this._trace._promiseCreated = null;
+ contextStack.push(this._trace);
+ }
+};
+
+Context.prototype._popContext = function () {
+ if (this._trace !== undefined) {
+ var trace = contextStack.pop();
+ var ret = trace._promiseCreated;
+ trace._promiseCreated = null;
+ return ret;
+ }
+ return null;
+};
+
+function createContext() {
+ if (longStackTraces) return new Context();
+}
+
+function peekContext() {
+ var lastIndex = contextStack.length - 1;
+ if (lastIndex >= 0) {
+ return contextStack[lastIndex];
+ }
+ return undefined;
+}
+Context.CapturedTrace = null;
+Context.create = createContext;
+Context.deactivateLongStackTraces = function() {};
+Context.activateLongStackTraces = function() {
+ var Promise_pushContext = Promise.prototype._pushContext;
+ var Promise_popContext = Promise.prototype._popContext;
+ var Promise_PeekContext = Promise._peekContext;
+ var Promise_peekContext = Promise.prototype._peekContext;
+ var Promise_promiseCreated = Promise.prototype._promiseCreated;
+ Context.deactivateLongStackTraces = function() {
+ Promise.prototype._pushContext = Promise_pushContext;
+ Promise.prototype._popContext = Promise_popContext;
+ Promise._peekContext = Promise_PeekContext;
+ Promise.prototype._peekContext = Promise_peekContext;
+ Promise.prototype._promiseCreated = Promise_promiseCreated;
+ longStackTraces = false;
+ };
+ longStackTraces = true;
+ Promise.prototype._pushContext = Context.prototype._pushContext;
+ Promise.prototype._popContext = Context.prototype._popContext;
+ Promise._peekContext = Promise.prototype._peekContext = peekContext;
+ Promise.prototype._promiseCreated = function() {
+ var ctx = this._peekContext();
+ if (ctx && ctx._promiseCreated == null) ctx._promiseCreated = this;
+ };
+};
+return Context;
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/debuggability.js b/Restaurant/node_modules/bluebird/js/release/debuggability.js
new file mode 100644
index 0000000..6956804
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/debuggability.js
@@ -0,0 +1,919 @@
+"use strict";
+module.exports = function(Promise, Context) {
+var getDomain = Promise._getDomain;
+var async = Promise._async;
+var Warning = require("./errors").Warning;
+var util = require("./util");
+var canAttachTrace = util.canAttachTrace;
+var unhandledRejectionHandled;
+var possiblyUnhandledRejection;
+var bluebirdFramePattern =
+ /[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/;
+var nodeFramePattern = /\((?:timers\.js):\d+:\d+\)/;
+var parseLinePattern = /[\/<\(](.+?):(\d+):(\d+)\)?\s*$/;
+var stackFramePattern = null;
+var formatStack = null;
+var indentStackFrames = false;
+var printWarning;
+var debugging = !!(util.env("BLUEBIRD_DEBUG") != 0 &&
+ (false ||
+ util.env("BLUEBIRD_DEBUG") ||
+ util.env("NODE_ENV") === "development"));
+
+var warnings = !!(util.env("BLUEBIRD_WARNINGS") != 0 &&
+ (debugging || util.env("BLUEBIRD_WARNINGS")));
+
+var longStackTraces = !!(util.env("BLUEBIRD_LONG_STACK_TRACES") != 0 &&
+ (debugging || util.env("BLUEBIRD_LONG_STACK_TRACES")));
+
+var wForgottenReturn = util.env("BLUEBIRD_W_FORGOTTEN_RETURN") != 0 &&
+ (warnings || !!util.env("BLUEBIRD_W_FORGOTTEN_RETURN"));
+
+Promise.prototype.suppressUnhandledRejections = function() {
+ var target = this._target();
+ target._bitField = ((target._bitField & (~1048576)) |
+ 524288);
+};
+
+Promise.prototype._ensurePossibleRejectionHandled = function () {
+ if ((this._bitField & 524288) !== 0) return;
+ this._setRejectionIsUnhandled();
+ var self = this;
+ setTimeout(function() {
+ self._notifyUnhandledRejection();
+ }, 1);
+};
+
+Promise.prototype._notifyUnhandledRejectionIsHandled = function () {
+ fireRejectionEvent("rejectionHandled",
+ unhandledRejectionHandled, undefined, this);
+};
+
+Promise.prototype._setReturnedNonUndefined = function() {
+ this._bitField = this._bitField | 268435456;
+};
+
+Promise.prototype._returnedNonUndefined = function() {
+ return (this._bitField & 268435456) !== 0;
+};
+
+Promise.prototype._notifyUnhandledRejection = function () {
+ if (this._isRejectionUnhandled()) {
+ var reason = this._settledValue();
+ this._setUnhandledRejectionIsNotified();
+ fireRejectionEvent("unhandledRejection",
+ possiblyUnhandledRejection, reason, this);
+ }
+};
+
+Promise.prototype._setUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField | 262144;
+};
+
+Promise.prototype._unsetUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField & (~262144);
+};
+
+Promise.prototype._isUnhandledRejectionNotified = function () {
+ return (this._bitField & 262144) > 0;
+};
+
+Promise.prototype._setRejectionIsUnhandled = function () {
+ this._bitField = this._bitField | 1048576;
+};
+
+Promise.prototype._unsetRejectionIsUnhandled = function () {
+ this._bitField = this._bitField & (~1048576);
+ if (this._isUnhandledRejectionNotified()) {
+ this._unsetUnhandledRejectionIsNotified();
+ this._notifyUnhandledRejectionIsHandled();
+ }
+};
+
+Promise.prototype._isRejectionUnhandled = function () {
+ return (this._bitField & 1048576) > 0;
+};
+
+Promise.prototype._warn = function(message, shouldUseOwnTrace, promise) {
+ return warn(message, shouldUseOwnTrace, promise || this);
+};
+
+Promise.onPossiblyUnhandledRejection = function (fn) {
+ var domain = getDomain();
+ possiblyUnhandledRejection =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+Promise.onUnhandledRejectionHandled = function (fn) {
+ var domain = getDomain();
+ unhandledRejectionHandled =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+var disableLongStackTraces = function() {};
+Promise.longStackTraces = function () {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (!config.longStackTraces && longStackTracesIsSupported()) {
+ var Promise_captureStackTrace = Promise.prototype._captureStackTrace;
+ var Promise_attachExtraTrace = Promise.prototype._attachExtraTrace;
+ config.longStackTraces = true;
+ disableLongStackTraces = function() {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ Promise.prototype._captureStackTrace = Promise_captureStackTrace;
+ Promise.prototype._attachExtraTrace = Promise_attachExtraTrace;
+ Context.deactivateLongStackTraces();
+ async.enableTrampoline();
+ config.longStackTraces = false;
+ };
+ Promise.prototype._captureStackTrace = longStackTracesCaptureStackTrace;
+ Promise.prototype._attachExtraTrace = longStackTracesAttachExtraTrace;
+ Context.activateLongStackTraces();
+ async.disableTrampolineIfNecessary();
+ }
+};
+
+Promise.hasLongStackTraces = function () {
+ return config.longStackTraces && longStackTracesIsSupported();
+};
+
+var fireDomEvent = (function() {
+ try {
+ if (typeof CustomEvent === "function") {
+ var event = new CustomEvent("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new CustomEvent(name.toLowerCase(), {
+ detail: event,
+ cancelable: true
+ });
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else if (typeof Event === "function") {
+ var event = new Event("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new Event(name.toLowerCase(), {
+ cancelable: true
+ });
+ domEvent.detail = event;
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else {
+ var event = document.createEvent("CustomEvent");
+ event.initCustomEvent("testingtheevent", false, true, {});
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = document.createEvent("CustomEvent");
+ domEvent.initCustomEvent(name.toLowerCase(), false, true,
+ event);
+ return !util.global.dispatchEvent(domEvent);
+ };
+ }
+ } catch (e) {}
+ return function() {
+ return false;
+ };
+})();
+
+var fireGlobalEvent = (function() {
+ if (util.isNode) {
+ return function() {
+ return process.emit.apply(process, arguments);
+ };
+ } else {
+ if (!util.global) {
+ return function() {
+ return false;
+ };
+ }
+ return function(name) {
+ var methodName = "on" + name.toLowerCase();
+ var method = util.global[methodName];
+ if (!method) return false;
+ method.apply(util.global, [].slice.call(arguments, 1));
+ return true;
+ };
+ }
+})();
+
+function generatePromiseLifecycleEventObject(name, promise) {
+ return {promise: promise};
+}
+
+var eventToObjectGenerator = {
+ promiseCreated: generatePromiseLifecycleEventObject,
+ promiseFulfilled: generatePromiseLifecycleEventObject,
+ promiseRejected: generatePromiseLifecycleEventObject,
+ promiseResolved: generatePromiseLifecycleEventObject,
+ promiseCancelled: generatePromiseLifecycleEventObject,
+ promiseChained: function(name, promise, child) {
+ return {promise: promise, child: child};
+ },
+ warning: function(name, warning) {
+ return {warning: warning};
+ },
+ unhandledRejection: function (name, reason, promise) {
+ return {reason: reason, promise: promise};
+ },
+ rejectionHandled: generatePromiseLifecycleEventObject
+};
+
+var activeFireEvent = function (name) {
+ var globalEventFired = false;
+ try {
+ globalEventFired = fireGlobalEvent.apply(null, arguments);
+ } catch (e) {
+ async.throwLater(e);
+ globalEventFired = true;
+ }
+
+ var domEventFired = false;
+ try {
+ domEventFired = fireDomEvent(name,
+ eventToObjectGenerator[name].apply(null, arguments));
+ } catch (e) {
+ async.throwLater(e);
+ domEventFired = true;
+ }
+
+ return domEventFired || globalEventFired;
+};
+
+Promise.config = function(opts) {
+ opts = Object(opts);
+ if ("longStackTraces" in opts) {
+ if (opts.longStackTraces) {
+ Promise.longStackTraces();
+ } else if (!opts.longStackTraces && Promise.hasLongStackTraces()) {
+ disableLongStackTraces();
+ }
+ }
+ if ("warnings" in opts) {
+ var warningsOption = opts.warnings;
+ config.warnings = !!warningsOption;
+ wForgottenReturn = config.warnings;
+
+ if (util.isObject(warningsOption)) {
+ if ("wForgottenReturn" in warningsOption) {
+ wForgottenReturn = !!warningsOption.wForgottenReturn;
+ }
+ }
+ }
+ if ("cancellation" in opts && opts.cancellation && !config.cancellation) {
+ if (async.haveItemsQueued()) {
+ throw new Error(
+ "cannot enable cancellation after promises are in use");
+ }
+ Promise.prototype._clearCancellationData =
+ cancellationClearCancellationData;
+ Promise.prototype._propagateFrom = cancellationPropagateFrom;
+ Promise.prototype._onCancel = cancellationOnCancel;
+ Promise.prototype._setOnCancel = cancellationSetOnCancel;
+ Promise.prototype._attachCancellationCallback =
+ cancellationAttachCancellationCallback;
+ Promise.prototype._execute = cancellationExecute;
+ propagateFromFunction = cancellationPropagateFrom;
+ config.cancellation = true;
+ }
+ if ("monitoring" in opts) {
+ if (opts.monitoring && !config.monitoring) {
+ config.monitoring = true;
+ Promise.prototype._fireEvent = activeFireEvent;
+ } else if (!opts.monitoring && config.monitoring) {
+ config.monitoring = false;
+ Promise.prototype._fireEvent = defaultFireEvent;
+ }
+ }
+ return Promise;
+};
+
+function defaultFireEvent() { return false; }
+
+Promise.prototype._fireEvent = defaultFireEvent;
+Promise.prototype._execute = function(executor, resolve, reject) {
+ try {
+ executor(resolve, reject);
+ } catch (e) {
+ return e;
+ }
+};
+Promise.prototype._onCancel = function () {};
+Promise.prototype._setOnCancel = function (handler) { ; };
+Promise.prototype._attachCancellationCallback = function(onCancel) {
+ ;
+};
+Promise.prototype._captureStackTrace = function () {};
+Promise.prototype._attachExtraTrace = function () {};
+Promise.prototype._clearCancellationData = function() {};
+Promise.prototype._propagateFrom = function (parent, flags) {
+ ;
+ ;
+};
+
+function cancellationExecute(executor, resolve, reject) {
+ var promise = this;
+ try {
+ executor(resolve, reject, function(onCancel) {
+ if (typeof onCancel !== "function") {
+ throw new TypeError("onCancel must be a function, got: " +
+ util.toString(onCancel));
+ }
+ promise._attachCancellationCallback(onCancel);
+ });
+ } catch (e) {
+ return e;
+ }
+}
+
+function cancellationAttachCancellationCallback(onCancel) {
+ if (!this._isCancellable()) return this;
+
+ var previousOnCancel = this._onCancel();
+ if (previousOnCancel !== undefined) {
+ if (util.isArray(previousOnCancel)) {
+ previousOnCancel.push(onCancel);
+ } else {
+ this._setOnCancel([previousOnCancel, onCancel]);
+ }
+ } else {
+ this._setOnCancel(onCancel);
+ }
+}
+
+function cancellationOnCancel() {
+ return this._onCancelField;
+}
+
+function cancellationSetOnCancel(onCancel) {
+ this._onCancelField = onCancel;
+}
+
+function cancellationClearCancellationData() {
+ this._cancellationParent = undefined;
+ this._onCancelField = undefined;
+}
+
+function cancellationPropagateFrom(parent, flags) {
+ if ((flags & 1) !== 0) {
+ this._cancellationParent = parent;
+ var branchesRemainingToCancel = parent._branchesRemainingToCancel;
+ if (branchesRemainingToCancel === undefined) {
+ branchesRemainingToCancel = 0;
+ }
+ parent._branchesRemainingToCancel = branchesRemainingToCancel + 1;
+ }
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+
+function bindingPropagateFrom(parent, flags) {
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+var propagateFromFunction = bindingPropagateFrom;
+
+function boundValueFunction() {
+ var ret = this._boundTo;
+ if (ret !== undefined) {
+ if (ret instanceof Promise) {
+ if (ret.isFulfilled()) {
+ return ret.value();
+ } else {
+ return undefined;
+ }
+ }
+ }
+ return ret;
+}
+
+function longStackTracesCaptureStackTrace() {
+ this._trace = new CapturedTrace(this._peekContext());
+}
+
+function longStackTracesAttachExtraTrace(error, ignoreSelf) {
+ if (canAttachTrace(error)) {
+ var trace = this._trace;
+ if (trace !== undefined) {
+ if (ignoreSelf) trace = trace._parent;
+ }
+ if (trace !== undefined) {
+ trace.attachExtraTrace(error);
+ } else if (!error.__stackCleaned__) {
+ var parsed = parseStackAndMessage(error);
+ util.notEnumerableProp(error, "stack",
+ parsed.message + "\n" + parsed.stack.join("\n"));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+ }
+ }
+}
+
+function checkForgottenReturns(returnValue, promiseCreated, name, promise,
+ parent) {
+ if (returnValue === undefined && promiseCreated !== null &&
+ wForgottenReturn) {
+ if (parent !== undefined && parent._returnedNonUndefined()) return;
+ if ((promise._bitField & 65535) === 0) return;
+
+ if (name) name = name + " ";
+ var handlerLine = "";
+ var creatorLine = "";
+ if (promiseCreated._trace) {
+ var traceLines = promiseCreated._trace.stack.split("\n");
+ var stack = cleanStack(traceLines);
+ for (var i = stack.length - 1; i >= 0; --i) {
+ var line = stack[i];
+ if (!nodeFramePattern.test(line)) {
+ var lineMatches = line.match(parseLinePattern);
+ if (lineMatches) {
+ handlerLine = "at " + lineMatches[1] +
+ ":" + lineMatches[2] + ":" + lineMatches[3] + " ";
+ }
+ break;
+ }
+ }
+
+ if (stack.length > 0) {
+ var firstUserLine = stack[0];
+ for (var i = 0; i < traceLines.length; ++i) {
+
+ if (traceLines[i] === firstUserLine) {
+ if (i > 0) {
+ creatorLine = "\n" + traceLines[i - 1];
+ }
+ break;
+ }
+ }
+
+ }
+ }
+ var msg = "a promise was created in a " + name +
+ "handler " + handlerLine + "but was not returned from it, " +
+ "see http://goo.gl/rRqMUw" +
+ creatorLine;
+ promise._warn(msg, true, promiseCreated);
+ }
+}
+
+function deprecated(name, replacement) {
+ var message = name +
+ " is deprecated and will be removed in a future version.";
+ if (replacement) message += " Use " + replacement + " instead.";
+ return warn(message);
+}
+
+function warn(message, shouldUseOwnTrace, promise) {
+ if (!config.warnings) return;
+ var warning = new Warning(message);
+ var ctx;
+ if (shouldUseOwnTrace) {
+ promise._attachExtraTrace(warning);
+ } else if (config.longStackTraces && (ctx = Promise._peekContext())) {
+ ctx.attachExtraTrace(warning);
+ } else {
+ var parsed = parseStackAndMessage(warning);
+ warning.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ }
+
+ if (!activeFireEvent("warning", warning)) {
+ formatAndLogError(warning, "", true);
+ }
+}
+
+function reconstructStack(message, stacks) {
+ for (var i = 0; i < stacks.length - 1; ++i) {
+ stacks[i].push("From previous event:");
+ stacks[i] = stacks[i].join("\n");
+ }
+ if (i < stacks.length) {
+ stacks[i] = stacks[i].join("\n");
+ }
+ return message + "\n" + stacks.join("\n");
+}
+
+function removeDuplicateOrEmptyJumps(stacks) {
+ for (var i = 0; i < stacks.length; ++i) {
+ if (stacks[i].length === 0 ||
+ ((i + 1 < stacks.length) && stacks[i][0] === stacks[i+1][0])) {
+ stacks.splice(i, 1);
+ i--;
+ }
+ }
+}
+
+function removeCommonRoots(stacks) {
+ var current = stacks[0];
+ for (var i = 1; i < stacks.length; ++i) {
+ var prev = stacks[i];
+ var currentLastIndex = current.length - 1;
+ var currentLastLine = current[currentLastIndex];
+ var commonRootMeetPoint = -1;
+
+ for (var j = prev.length - 1; j >= 0; --j) {
+ if (prev[j] === currentLastLine) {
+ commonRootMeetPoint = j;
+ break;
+ }
+ }
+
+ for (var j = commonRootMeetPoint; j >= 0; --j) {
+ var line = prev[j];
+ if (current[currentLastIndex] === line) {
+ current.pop();
+ currentLastIndex--;
+ } else {
+ break;
+ }
+ }
+ current = prev;
+ }
+}
+
+function cleanStack(stack) {
+ var ret = [];
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ var isTraceLine = " (No stack trace)" === line ||
+ stackFramePattern.test(line);
+ var isInternalFrame = isTraceLine && shouldIgnore(line);
+ if (isTraceLine && !isInternalFrame) {
+ if (indentStackFrames && line.charAt(0) !== " ") {
+ line = " " + line;
+ }
+ ret.push(line);
+ }
+ }
+ return ret;
+}
+
+function stackFramesAsArray(error) {
+ var stack = error.stack.replace(/\s+$/g, "").split("\n");
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ if (" (No stack trace)" === line || stackFramePattern.test(line)) {
+ break;
+ }
+ }
+ if (i > 0 && error.name != "SyntaxError") {
+ stack = stack.slice(i);
+ }
+ return stack;
+}
+
+function parseStackAndMessage(error) {
+ var stack = error.stack;
+ var message = error.toString();
+ stack = typeof stack === "string" && stack.length > 0
+ ? stackFramesAsArray(error) : [" (No stack trace)"];
+ return {
+ message: message,
+ stack: error.name == "SyntaxError" ? stack : cleanStack(stack)
+ };
+}
+
+function formatAndLogError(error, title, isSoft) {
+ if (typeof console !== "undefined") {
+ var message;
+ if (util.isObject(error)) {
+ var stack = error.stack;
+ message = title + formatStack(stack, error);
+ } else {
+ message = title + String(error);
+ }
+ if (typeof printWarning === "function") {
+ printWarning(message, isSoft);
+ } else if (typeof console.log === "function" ||
+ typeof console.log === "object") {
+ console.log(message);
+ }
+ }
+}
+
+function fireRejectionEvent(name, localHandler, reason, promise) {
+ var localEventFired = false;
+ try {
+ if (typeof localHandler === "function") {
+ localEventFired = true;
+ if (name === "rejectionHandled") {
+ localHandler(promise);
+ } else {
+ localHandler(reason, promise);
+ }
+ }
+ } catch (e) {
+ async.throwLater(e);
+ }
+
+ if (name === "unhandledRejection") {
+ if (!activeFireEvent(name, reason, promise) && !localEventFired) {
+ formatAndLogError(reason, "Unhandled rejection ");
+ }
+ } else {
+ activeFireEvent(name, promise);
+ }
+}
+
+function formatNonError(obj) {
+ var str;
+ if (typeof obj === "function") {
+ str = "[function " +
+ (obj.name || "anonymous") +
+ "]";
+ } else {
+ str = obj && typeof obj.toString === "function"
+ ? obj.toString() : util.toString(obj);
+ var ruselessToString = /\[object [a-zA-Z0-9$_]+\]/;
+ if (ruselessToString.test(str)) {
+ try {
+ var newStr = JSON.stringify(obj);
+ str = newStr;
+ }
+ catch(e) {
+
+ }
+ }
+ if (str.length === 0) {
+ str = "(empty array)";
+ }
+ }
+ return ("(<" + snip(str) + ">, no stack trace)");
+}
+
+function snip(str) {
+ var maxChars = 41;
+ if (str.length < maxChars) {
+ return str;
+ }
+ return str.substr(0, maxChars - 3) + "...";
+}
+
+function longStackTracesIsSupported() {
+ return typeof captureStackTrace === "function";
+}
+
+var shouldIgnore = function() { return false; };
+var parseLineInfoRegex = /[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;
+function parseLineInfo(line) {
+ var matches = line.match(parseLineInfoRegex);
+ if (matches) {
+ return {
+ fileName: matches[1],
+ line: parseInt(matches[2], 10)
+ };
+ }
+}
+
+function setBounds(firstLineError, lastLineError) {
+ if (!longStackTracesIsSupported()) return;
+ var firstStackLines = firstLineError.stack.split("\n");
+ var lastStackLines = lastLineError.stack.split("\n");
+ var firstIndex = -1;
+ var lastIndex = -1;
+ var firstFileName;
+ var lastFileName;
+ for (var i = 0; i < firstStackLines.length; ++i) {
+ var result = parseLineInfo(firstStackLines[i]);
+ if (result) {
+ firstFileName = result.fileName;
+ firstIndex = result.line;
+ break;
+ }
+ }
+ for (var i = 0; i < lastStackLines.length; ++i) {
+ var result = parseLineInfo(lastStackLines[i]);
+ if (result) {
+ lastFileName = result.fileName;
+ lastIndex = result.line;
+ break;
+ }
+ }
+ if (firstIndex < 0 || lastIndex < 0 || !firstFileName || !lastFileName ||
+ firstFileName !== lastFileName || firstIndex >= lastIndex) {
+ return;
+ }
+
+ shouldIgnore = function(line) {
+ if (bluebirdFramePattern.test(line)) return true;
+ var info = parseLineInfo(line);
+ if (info) {
+ if (info.fileName === firstFileName &&
+ (firstIndex <= info.line && info.line <= lastIndex)) {
+ return true;
+ }
+ }
+ return false;
+ };
+}
+
+function CapturedTrace(parent) {
+ this._parent = parent;
+ this._promisesCreated = 0;
+ var length = this._length = 1 + (parent === undefined ? 0 : parent._length);
+ captureStackTrace(this, CapturedTrace);
+ if (length > 32) this.uncycle();
+}
+util.inherits(CapturedTrace, Error);
+Context.CapturedTrace = CapturedTrace;
+
+CapturedTrace.prototype.uncycle = function() {
+ var length = this._length;
+ if (length < 2) return;
+ var nodes = [];
+ var stackToIndex = {};
+
+ for (var i = 0, node = this; node !== undefined; ++i) {
+ nodes.push(node);
+ node = node._parent;
+ }
+ length = this._length = i;
+ for (var i = length - 1; i >= 0; --i) {
+ var stack = nodes[i].stack;
+ if (stackToIndex[stack] === undefined) {
+ stackToIndex[stack] = i;
+ }
+ }
+ for (var i = 0; i < length; ++i) {
+ var currentStack = nodes[i].stack;
+ var index = stackToIndex[currentStack];
+ if (index !== undefined && index !== i) {
+ if (index > 0) {
+ nodes[index - 1]._parent = undefined;
+ nodes[index - 1]._length = 1;
+ }
+ nodes[i]._parent = undefined;
+ nodes[i]._length = 1;
+ var cycleEdgeNode = i > 0 ? nodes[i - 1] : this;
+
+ if (index < length - 1) {
+ cycleEdgeNode._parent = nodes[index + 1];
+ cycleEdgeNode._parent.uncycle();
+ cycleEdgeNode._length =
+ cycleEdgeNode._parent._length + 1;
+ } else {
+ cycleEdgeNode._parent = undefined;
+ cycleEdgeNode._length = 1;
+ }
+ var currentChildLength = cycleEdgeNode._length + 1;
+ for (var j = i - 2; j >= 0; --j) {
+ nodes[j]._length = currentChildLength;
+ currentChildLength++;
+ }
+ return;
+ }
+ }
+};
+
+CapturedTrace.prototype.attachExtraTrace = function(error) {
+ if (error.__stackCleaned__) return;
+ this.uncycle();
+ var parsed = parseStackAndMessage(error);
+ var message = parsed.message;
+ var stacks = [parsed.stack];
+
+ var trace = this;
+ while (trace !== undefined) {
+ stacks.push(cleanStack(trace.stack.split("\n")));
+ trace = trace._parent;
+ }
+ removeCommonRoots(stacks);
+ removeDuplicateOrEmptyJumps(stacks);
+ util.notEnumerableProp(error, "stack", reconstructStack(message, stacks));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+};
+
+var captureStackTrace = (function stackDetection() {
+ var v8stackFramePattern = /^\s*at\s*/;
+ var v8stackFormatter = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if (error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ if (typeof Error.stackTraceLimit === "number" &&
+ typeof Error.captureStackTrace === "function") {
+ Error.stackTraceLimit += 6;
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ var captureStackTrace = Error.captureStackTrace;
+
+ shouldIgnore = function(line) {
+ return bluebirdFramePattern.test(line);
+ };
+ return function(receiver, ignoreUntil) {
+ Error.stackTraceLimit += 6;
+ captureStackTrace(receiver, ignoreUntil);
+ Error.stackTraceLimit -= 6;
+ };
+ }
+ var err = new Error();
+
+ if (typeof err.stack === "string" &&
+ err.stack.split("\n")[0].indexOf("stackDetection@") >= 0) {
+ stackFramePattern = /@/;
+ formatStack = v8stackFormatter;
+ indentStackFrames = true;
+ return function captureStackTrace(o) {
+ o.stack = new Error().stack;
+ };
+ }
+
+ var hasStackAfterThrow;
+ try { throw new Error(); }
+ catch(e) {
+ hasStackAfterThrow = ("stack" in e);
+ }
+ if (!("stack" in err) && hasStackAfterThrow &&
+ typeof Error.stackTraceLimit === "number") {
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ return function captureStackTrace(o) {
+ Error.stackTraceLimit += 6;
+ try { throw new Error(); }
+ catch(e) { o.stack = e.stack; }
+ Error.stackTraceLimit -= 6;
+ };
+ }
+
+ formatStack = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if ((typeof error === "object" ||
+ typeof error === "function") &&
+ error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ return null;
+
+})([]);
+
+if (typeof console !== "undefined" && typeof console.warn !== "undefined") {
+ printWarning = function (message) {
+ console.warn(message);
+ };
+ if (util.isNode && process.stderr.isTTY) {
+ printWarning = function(message, isSoft) {
+ var color = isSoft ? "\u001b[33m" : "\u001b[31m";
+ console.warn(color + message + "\u001b[0m\n");
+ };
+ } else if (!util.isNode && typeof (new Error().stack) === "string") {
+ printWarning = function(message, isSoft) {
+ console.warn("%c" + message,
+ isSoft ? "color: darkorange" : "color: red");
+ };
+ }
+}
+
+var config = {
+ warnings: warnings,
+ longStackTraces: false,
+ cancellation: false,
+ monitoring: false
+};
+
+if (longStackTraces) Promise.longStackTraces();
+
+return {
+ longStackTraces: function() {
+ return config.longStackTraces;
+ },
+ warnings: function() {
+ return config.warnings;
+ },
+ cancellation: function() {
+ return config.cancellation;
+ },
+ monitoring: function() {
+ return config.monitoring;
+ },
+ propagateFromFunction: function() {
+ return propagateFromFunction;
+ },
+ boundValueFunction: function() {
+ return boundValueFunction;
+ },
+ checkForgottenReturns: checkForgottenReturns,
+ setBounds: setBounds,
+ warn: warn,
+ deprecated: deprecated,
+ CapturedTrace: CapturedTrace,
+ fireDomEvent: fireDomEvent,
+ fireGlobalEvent: fireGlobalEvent
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/direct_resolve.js b/Restaurant/node_modules/bluebird/js/release/direct_resolve.js
new file mode 100644
index 0000000..a890298
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/direct_resolve.js
@@ -0,0 +1,46 @@
+"use strict";
+module.exports = function(Promise) {
+function returner() {
+ return this.value;
+}
+function thrower() {
+ throw this.reason;
+}
+
+Promise.prototype["return"] =
+Promise.prototype.thenReturn = function (value) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ returner, undefined, undefined, {value: value}, undefined);
+};
+
+Promise.prototype["throw"] =
+Promise.prototype.thenThrow = function (reason) {
+ return this._then(
+ thrower, undefined, undefined, {reason: reason}, undefined);
+};
+
+Promise.prototype.catchThrow = function (reason) {
+ if (arguments.length <= 1) {
+ return this._then(
+ undefined, thrower, undefined, {reason: reason}, undefined);
+ } else {
+ var _reason = arguments[1];
+ var handler = function() {throw _reason;};
+ return this.caught(reason, handler);
+ }
+};
+
+Promise.prototype.catchReturn = function (value) {
+ if (arguments.length <= 1) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ undefined, returner, undefined, {value: value}, undefined);
+ } else {
+ var _value = arguments[1];
+ if (_value instanceof Promise) _value.suppressUnhandledRejections();
+ var handler = function() {return _value;};
+ return this.caught(value, handler);
+ }
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/each.js b/Restaurant/node_modules/bluebird/js/release/each.js
new file mode 100644
index 0000000..e4f3d05
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/each.js
@@ -0,0 +1,30 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseReduce = Promise.reduce;
+var PromiseAll = Promise.all;
+
+function promiseAllThis() {
+ return PromiseAll(this);
+}
+
+function PromiseMapSeries(promises, fn) {
+ return PromiseReduce(promises, fn, INTERNAL, INTERNAL);
+}
+
+Promise.prototype.each = function (fn) {
+ return PromiseReduce(this, fn, INTERNAL, 0)
+ ._then(promiseAllThis, undefined, undefined, this, undefined);
+};
+
+Promise.prototype.mapSeries = function (fn) {
+ return PromiseReduce(this, fn, INTERNAL, INTERNAL);
+};
+
+Promise.each = function (promises, fn) {
+ return PromiseReduce(promises, fn, INTERNAL, 0)
+ ._then(promiseAllThis, undefined, undefined, promises, undefined);
+};
+
+Promise.mapSeries = PromiseMapSeries;
+};
+
diff --git a/Restaurant/node_modules/bluebird/js/release/errors.js b/Restaurant/node_modules/bluebird/js/release/errors.js
new file mode 100644
index 0000000..f62f323
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/errors.js
@@ -0,0 +1,116 @@
+"use strict";
+var es5 = require("./es5");
+var Objectfreeze = es5.freeze;
+var util = require("./util");
+var inherits = util.inherits;
+var notEnumerableProp = util.notEnumerableProp;
+
+function subError(nameProperty, defaultMessage) {
+ function SubError(message) {
+ if (!(this instanceof SubError)) return new SubError(message);
+ notEnumerableProp(this, "message",
+ typeof message === "string" ? message : defaultMessage);
+ notEnumerableProp(this, "name", nameProperty);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ Error.call(this);
+ }
+ }
+ inherits(SubError, Error);
+ return SubError;
+}
+
+var _TypeError, _RangeError;
+var Warning = subError("Warning", "warning");
+var CancellationError = subError("CancellationError", "cancellation error");
+var TimeoutError = subError("TimeoutError", "timeout error");
+var AggregateError = subError("AggregateError", "aggregate error");
+try {
+ _TypeError = TypeError;
+ _RangeError = RangeError;
+} catch(e) {
+ _TypeError = subError("TypeError", "type error");
+ _RangeError = subError("RangeError", "range error");
+}
+
+var methods = ("join pop push shift unshift slice filter forEach some " +
+ "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" ");
+
+for (var i = 0; i < methods.length; ++i) {
+ if (typeof Array.prototype[methods[i]] === "function") {
+ AggregateError.prototype[methods[i]] = Array.prototype[methods[i]];
+ }
+}
+
+es5.defineProperty(AggregateError.prototype, "length", {
+ value: 0,
+ configurable: false,
+ writable: true,
+ enumerable: true
+});
+AggregateError.prototype["isOperational"] = true;
+var level = 0;
+AggregateError.prototype.toString = function() {
+ var indent = Array(level * 4 + 1).join(" ");
+ var ret = "\n" + indent + "AggregateError of:" + "\n";
+ level++;
+ indent = Array(level * 4 + 1).join(" ");
+ for (var i = 0; i < this.length; ++i) {
+ var str = this[i] === this ? "[Circular AggregateError]" : this[i] + "";
+ var lines = str.split("\n");
+ for (var j = 0; j < lines.length; ++j) {
+ lines[j] = indent + lines[j];
+ }
+ str = lines.join("\n");
+ ret += str + "\n";
+ }
+ level--;
+ return ret;
+};
+
+function OperationalError(message) {
+ if (!(this instanceof OperationalError))
+ return new OperationalError(message);
+ notEnumerableProp(this, "name", "OperationalError");
+ notEnumerableProp(this, "message", message);
+ this.cause = message;
+ this["isOperational"] = true;
+
+ if (message instanceof Error) {
+ notEnumerableProp(this, "message", message.message);
+ notEnumerableProp(this, "stack", message.stack);
+ } else if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ }
+
+}
+inherits(OperationalError, Error);
+
+var errorTypes = Error["__BluebirdErrorTypes__"];
+if (!errorTypes) {
+ errorTypes = Objectfreeze({
+ CancellationError: CancellationError,
+ TimeoutError: TimeoutError,
+ OperationalError: OperationalError,
+ RejectionError: OperationalError,
+ AggregateError: AggregateError
+ });
+ es5.defineProperty(Error, "__BluebirdErrorTypes__", {
+ value: errorTypes,
+ writable: false,
+ enumerable: false,
+ configurable: false
+ });
+}
+
+module.exports = {
+ Error: Error,
+ TypeError: _TypeError,
+ RangeError: _RangeError,
+ CancellationError: errorTypes.CancellationError,
+ OperationalError: errorTypes.OperationalError,
+ TimeoutError: errorTypes.TimeoutError,
+ AggregateError: errorTypes.AggregateError,
+ Warning: Warning
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/es5.js b/Restaurant/node_modules/bluebird/js/release/es5.js
new file mode 100644
index 0000000..ea41d5a
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/es5.js
@@ -0,0 +1,80 @@
+var isES5 = (function(){
+ "use strict";
+ return this === undefined;
+})();
+
+if (isES5) {
+ module.exports = {
+ freeze: Object.freeze,
+ defineProperty: Object.defineProperty,
+ getDescriptor: Object.getOwnPropertyDescriptor,
+ keys: Object.keys,
+ names: Object.getOwnPropertyNames,
+ getPrototypeOf: Object.getPrototypeOf,
+ isArray: Array.isArray,
+ isES5: isES5,
+ propertyIsWritable: function(obj, prop) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop);
+ return !!(!descriptor || descriptor.writable || descriptor.set);
+ }
+ };
+} else {
+ var has = {}.hasOwnProperty;
+ var str = {}.toString;
+ var proto = {}.constructor.prototype;
+
+ var ObjectKeys = function (o) {
+ var ret = [];
+ for (var key in o) {
+ if (has.call(o, key)) {
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+
+ var ObjectGetDescriptor = function(o, key) {
+ return {value: o[key]};
+ };
+
+ var ObjectDefineProperty = function (o, key, desc) {
+ o[key] = desc.value;
+ return o;
+ };
+
+ var ObjectFreeze = function (obj) {
+ return obj;
+ };
+
+ var ObjectGetPrototypeOf = function (obj) {
+ try {
+ return Object(obj).constructor.prototype;
+ }
+ catch (e) {
+ return proto;
+ }
+ };
+
+ var ArrayIsArray = function (obj) {
+ try {
+ return str.call(obj) === "[object Array]";
+ }
+ catch(e) {
+ return false;
+ }
+ };
+
+ module.exports = {
+ isArray: ArrayIsArray,
+ keys: ObjectKeys,
+ names: ObjectKeys,
+ defineProperty: ObjectDefineProperty,
+ getDescriptor: ObjectGetDescriptor,
+ freeze: ObjectFreeze,
+ getPrototypeOf: ObjectGetPrototypeOf,
+ isES5: isES5,
+ propertyIsWritable: function() {
+ return true;
+ }
+ };
+}
diff --git a/Restaurant/node_modules/bluebird/js/release/filter.js b/Restaurant/node_modules/bluebird/js/release/filter.js
new file mode 100644
index 0000000..ed57bf0
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/filter.js
@@ -0,0 +1,12 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseMap = Promise.map;
+
+Promise.prototype.filter = function (fn, options) {
+ return PromiseMap(this, fn, options, INTERNAL);
+};
+
+Promise.filter = function (promises, fn, options) {
+ return PromiseMap(promises, fn, options, INTERNAL);
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/finally.js b/Restaurant/node_modules/bluebird/js/release/finally.js
new file mode 100644
index 0000000..d57444b
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/finally.js
@@ -0,0 +1,146 @@
+"use strict";
+module.exports = function(Promise, tryConvertToPromise, NEXT_FILTER) {
+var util = require("./util");
+var CancellationError = Promise.CancellationError;
+var errorObj = util.errorObj;
+var catchFilter = require("./catch_filter")(NEXT_FILTER);
+
+function PassThroughHandlerContext(promise, type, handler) {
+ this.promise = promise;
+ this.type = type;
+ this.handler = handler;
+ this.called = false;
+ this.cancelPromise = null;
+}
+
+PassThroughHandlerContext.prototype.isFinallyHandler = function() {
+ return this.type === 0;
+};
+
+function FinallyHandlerCancelReaction(finallyHandler) {
+ this.finallyHandler = finallyHandler;
+}
+
+FinallyHandlerCancelReaction.prototype._resultCancelled = function() {
+ checkCancel(this.finallyHandler);
+};
+
+function checkCancel(ctx, reason) {
+ if (ctx.cancelPromise != null) {
+ if (arguments.length > 1) {
+ ctx.cancelPromise._reject(reason);
+ } else {
+ ctx.cancelPromise._cancel();
+ }
+ ctx.cancelPromise = null;
+ return true;
+ }
+ return false;
+}
+
+function succeed() {
+ return finallyHandler.call(this, this.promise._target()._settledValue());
+}
+function fail(reason) {
+ if (checkCancel(this, reason)) return;
+ errorObj.e = reason;
+ return errorObj;
+}
+function finallyHandler(reasonOrValue) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ if (!this.called) {
+ this.called = true;
+ var ret = this.isFinallyHandler()
+ ? handler.call(promise._boundValue())
+ : handler.call(promise._boundValue(), reasonOrValue);
+ if (ret === NEXT_FILTER) {
+ return ret;
+ } else if (ret !== undefined) {
+ promise._setReturnedNonUndefined();
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ if (this.cancelPromise != null) {
+ if (maybePromise._isCancelled()) {
+ var reason =
+ new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ errorObj.e = reason;
+ return errorObj;
+ } else if (maybePromise.isPending()) {
+ maybePromise._attachCancellationCallback(
+ new FinallyHandlerCancelReaction(this));
+ }
+ }
+ return maybePromise._then(
+ succeed, fail, undefined, this, undefined);
+ }
+ }
+ }
+
+ if (promise.isRejected()) {
+ checkCancel(this);
+ errorObj.e = reasonOrValue;
+ return errorObj;
+ } else {
+ checkCancel(this);
+ return reasonOrValue;
+ }
+}
+
+Promise.prototype._passThrough = function(handler, type, success, fail) {
+ if (typeof handler !== "function") return this.then();
+ return this._then(success,
+ fail,
+ undefined,
+ new PassThroughHandlerContext(this, type, handler),
+ undefined);
+};
+
+Promise.prototype.lastly =
+Promise.prototype["finally"] = function (handler) {
+ return this._passThrough(handler,
+ 0,
+ finallyHandler,
+ finallyHandler);
+};
+
+
+Promise.prototype.tap = function (handler) {
+ return this._passThrough(handler, 1, finallyHandler);
+};
+
+Promise.prototype.tapCatch = function (handlerOrPredicate) {
+ var len = arguments.length;
+ if(len === 1) {
+ return this._passThrough(handlerOrPredicate,
+ 1,
+ undefined,
+ finallyHandler);
+ } else {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return Promise.reject(new TypeError(
+ "tapCatch statement predicate: "
+ + "expecting an object but got " + util.classString(item)
+ ));
+ }
+ }
+ catchInstances.length = j;
+ var handler = arguments[i];
+ return this._passThrough(catchFilter(catchInstances, handler, this),
+ 1,
+ undefined,
+ finallyHandler);
+ }
+
+};
+
+return PassThroughHandlerContext;
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/generators.js b/Restaurant/node_modules/bluebird/js/release/generators.js
new file mode 100644
index 0000000..500c280
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/generators.js
@@ -0,0 +1,223 @@
+"use strict";
+module.exports = function(Promise,
+ apiRejection,
+ INTERNAL,
+ tryConvertToPromise,
+ Proxyable,
+ debug) {
+var errors = require("./errors");
+var TypeError = errors.TypeError;
+var util = require("./util");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+var yieldHandlers = [];
+
+function promiseFromYieldHandler(value, yieldHandlers, traceParent) {
+ for (var i = 0; i < yieldHandlers.length; ++i) {
+ traceParent._pushContext();
+ var result = tryCatch(yieldHandlers[i])(value);
+ traceParent._popContext();
+ if (result === errorObj) {
+ traceParent._pushContext();
+ var ret = Promise.reject(errorObj.e);
+ traceParent._popContext();
+ return ret;
+ }
+ var maybePromise = tryConvertToPromise(result, traceParent);
+ if (maybePromise instanceof Promise) return maybePromise;
+ }
+ return null;
+}
+
+function PromiseSpawn(generatorFunction, receiver, yieldHandler, stack) {
+ if (debug.cancellation()) {
+ var internal = new Promise(INTERNAL);
+ var _finallyPromise = this._finallyPromise = new Promise(INTERNAL);
+ this._promise = internal.lastly(function() {
+ return _finallyPromise;
+ });
+ internal._captureStackTrace();
+ internal._setOnCancel(this);
+ } else {
+ var promise = this._promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ }
+ this._stack = stack;
+ this._generatorFunction = generatorFunction;
+ this._receiver = receiver;
+ this._generator = undefined;
+ this._yieldHandlers = typeof yieldHandler === "function"
+ ? [yieldHandler].concat(yieldHandlers)
+ : yieldHandlers;
+ this._yieldedPromise = null;
+ this._cancellationPhase = false;
+}
+util.inherits(PromiseSpawn, Proxyable);
+
+PromiseSpawn.prototype._isResolved = function() {
+ return this._promise === null;
+};
+
+PromiseSpawn.prototype._cleanup = function() {
+ this._promise = this._generator = null;
+ if (debug.cancellation() && this._finallyPromise !== null) {
+ this._finallyPromise._fulfill();
+ this._finallyPromise = null;
+ }
+};
+
+PromiseSpawn.prototype._promiseCancelled = function() {
+ if (this._isResolved()) return;
+ var implementsReturn = typeof this._generator["return"] !== "undefined";
+
+ var result;
+ if (!implementsReturn) {
+ var reason = new Promise.CancellationError(
+ "generator .return() sentinel");
+ Promise.coroutine.returnSentinel = reason;
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ result = tryCatch(this._generator["throw"]).call(this._generator,
+ reason);
+ this._promise._popContext();
+ } else {
+ this._promise._pushContext();
+ result = tryCatch(this._generator["return"]).call(this._generator,
+ undefined);
+ this._promise._popContext();
+ }
+ this._cancellationPhase = true;
+ this._yieldedPromise = null;
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._promiseFulfilled = function(value) {
+ this._yieldedPromise = null;
+ this._promise._pushContext();
+ var result = tryCatch(this._generator.next).call(this._generator, value);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._promiseRejected = function(reason) {
+ this._yieldedPromise = null;
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ var result = tryCatch(this._generator["throw"])
+ .call(this._generator, reason);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._resultCancelled = function() {
+ if (this._yieldedPromise instanceof Promise) {
+ var promise = this._yieldedPromise;
+ this._yieldedPromise = null;
+ promise.cancel();
+ }
+};
+
+PromiseSpawn.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseSpawn.prototype._run = function () {
+ this._generator = this._generatorFunction.call(this._receiver);
+ this._receiver =
+ this._generatorFunction = undefined;
+ this._promiseFulfilled(undefined);
+};
+
+PromiseSpawn.prototype._continue = function (result) {
+ var promise = this._promise;
+ if (result === errorObj) {
+ this._cleanup();
+ if (this._cancellationPhase) {
+ return promise.cancel();
+ } else {
+ return promise._rejectCallback(result.e, false);
+ }
+ }
+
+ var value = result.value;
+ if (result.done === true) {
+ this._cleanup();
+ if (this._cancellationPhase) {
+ return promise.cancel();
+ } else {
+ return promise._resolveCallback(value);
+ }
+ } else {
+ var maybePromise = tryConvertToPromise(value, this._promise);
+ if (!(maybePromise instanceof Promise)) {
+ maybePromise =
+ promiseFromYieldHandler(maybePromise,
+ this._yieldHandlers,
+ this._promise);
+ if (maybePromise === null) {
+ this._promiseRejected(
+ new TypeError(
+ "A value %s was yielded that could not be treated as a promise\u000a\u000a See http://goo.gl/MqrFmX\u000a\u000a".replace("%s", String(value)) +
+ "From coroutine:\u000a" +
+ this._stack.split("\n").slice(1, -7).join("\n")
+ )
+ );
+ return;
+ }
+ }
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ this._yieldedPromise = maybePromise;
+ maybePromise._proxy(this, null);
+ } else if (((bitField & 33554432) !== 0)) {
+ Promise._async.invoke(
+ this._promiseFulfilled, this, maybePromise._value()
+ );
+ } else if (((bitField & 16777216) !== 0)) {
+ Promise._async.invoke(
+ this._promiseRejected, this, maybePromise._reason()
+ );
+ } else {
+ this._promiseCancelled();
+ }
+ }
+};
+
+Promise.coroutine = function (generatorFunction, options) {
+ if (typeof generatorFunction !== "function") {
+ throw new TypeError("generatorFunction must be a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var yieldHandler = Object(options).yieldHandler;
+ var PromiseSpawn$ = PromiseSpawn;
+ var stack = new Error().stack;
+ return function () {
+ var generator = generatorFunction.apply(this, arguments);
+ var spawn = new PromiseSpawn$(undefined, undefined, yieldHandler,
+ stack);
+ var ret = spawn.promise();
+ spawn._generator = generator;
+ spawn._promiseFulfilled(undefined);
+ return ret;
+ };
+};
+
+Promise.coroutine.addYieldHandler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ yieldHandlers.push(fn);
+};
+
+Promise.spawn = function (generatorFunction) {
+ debug.deprecated("Promise.spawn()", "Promise.coroutine()");
+ if (typeof generatorFunction !== "function") {
+ return apiRejection("generatorFunction must be a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var spawn = new PromiseSpawn(generatorFunction, this);
+ var ret = spawn.promise();
+ spawn._run(Promise.spawn);
+ return ret;
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/join.js b/Restaurant/node_modules/bluebird/js/release/join.js
new file mode 100644
index 0000000..4945e3f
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/join.js
@@ -0,0 +1,168 @@
+"use strict";
+module.exports =
+function(Promise, PromiseArray, tryConvertToPromise, INTERNAL, async,
+ getDomain) {
+var util = require("./util");
+var canEvaluate = util.canEvaluate;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var reject;
+
+if (!false) {
+if (canEvaluate) {
+ var thenCallback = function(i) {
+ return new Function("value", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = value; \n\
+ holder.checkFulfillment(this); \n\
+ ".replace(/Index/g, i));
+ };
+
+ var promiseSetter = function(i) {
+ return new Function("promise", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = promise; \n\
+ ".replace(/Index/g, i));
+ };
+
+ var generateHolderClass = function(total) {
+ var props = new Array(total);
+ for (var i = 0; i < props.length; ++i) {
+ props[i] = "this.p" + (i+1);
+ }
+ var assignment = props.join(" = ") + " = null;";
+ var cancellationCode= "var promise;\n" + props.map(function(prop) {
+ return " \n\
+ promise = " + prop + "; \n\
+ if (promise instanceof Promise) { \n\
+ promise.cancel(); \n\
+ } \n\
+ ";
+ }).join("\n");
+ var passedArguments = props.join(", ");
+ var name = "Holder$" + total;
+
+
+ var code = "return function(tryCatch, errorObj, Promise, async) { \n\
+ 'use strict'; \n\
+ function [TheName](fn) { \n\
+ [TheProperties] \n\
+ this.fn = fn; \n\
+ this.asyncNeeded = true; \n\
+ this.now = 0; \n\
+ } \n\
+ \n\
+ [TheName].prototype._callFunction = function(promise) { \n\
+ promise._pushContext(); \n\
+ var ret = tryCatch(this.fn)([ThePassedArguments]); \n\
+ promise._popContext(); \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(ret.e, false); \n\
+ } else { \n\
+ promise._resolveCallback(ret); \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype.checkFulfillment = function(promise) { \n\
+ var now = ++this.now; \n\
+ if (now === [TheTotal]) { \n\
+ if (this.asyncNeeded) { \n\
+ async.invoke(this._callFunction, this, promise); \n\
+ } else { \n\
+ this._callFunction(promise); \n\
+ } \n\
+ \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype._resultCancelled = function() { \n\
+ [CancellationCode] \n\
+ }; \n\
+ \n\
+ return [TheName]; \n\
+ }(tryCatch, errorObj, Promise, async); \n\
+ ";
+
+ code = code.replace(/\[TheName\]/g, name)
+ .replace(/\[TheTotal\]/g, total)
+ .replace(/\[ThePassedArguments\]/g, passedArguments)
+ .replace(/\[TheProperties\]/g, assignment)
+ .replace(/\[CancellationCode\]/g, cancellationCode);
+
+ return new Function("tryCatch", "errorObj", "Promise", "async", code)
+ (tryCatch, errorObj, Promise, async);
+ };
+
+ var holderClasses = [];
+ var thenCallbacks = [];
+ var promiseSetters = [];
+
+ for (var i = 0; i < 8; ++i) {
+ holderClasses.push(generateHolderClass(i + 1));
+ thenCallbacks.push(thenCallback(i + 1));
+ promiseSetters.push(promiseSetter(i + 1));
+ }
+
+ reject = function (reason) {
+ this._reject(reason);
+ };
+}}
+
+Promise.join = function () {
+ var last = arguments.length - 1;
+ var fn;
+ if (last > 0 && typeof arguments[last] === "function") {
+ fn = arguments[last];
+ if (!false) {
+ if (last <= 8 && canEvaluate) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var HolderClass = holderClasses[last - 1];
+ var holder = new HolderClass(fn);
+ var callbacks = thenCallbacks;
+
+ for (var i = 0; i < last; ++i) {
+ var maybePromise = tryConvertToPromise(arguments[i], ret);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._then(callbacks[i], reject,
+ undefined, ret, holder);
+ promiseSetters[i](maybePromise, holder);
+ holder.asyncNeeded = false;
+ } else if (((bitField & 33554432) !== 0)) {
+ callbacks[i].call(ret,
+ maybePromise._value(), holder);
+ } else if (((bitField & 16777216) !== 0)) {
+ ret._reject(maybePromise._reason());
+ } else {
+ ret._cancel();
+ }
+ } else {
+ callbacks[i].call(ret, maybePromise, holder);
+ }
+ }
+
+ if (!ret._isFateSealed()) {
+ if (holder.asyncNeeded) {
+ var domain = getDomain();
+ if (domain !== null) {
+ holder.fn = util.domainBind(domain, holder.fn);
+ }
+ }
+ ret._setAsyncGuaranteed();
+ ret._setOnCancel(holder);
+ }
+ return ret;
+ }
+ }
+ }
+ var $_len = arguments.length;var args = new Array($_len); for(var $_i = 0; $_i < $_len; ++$_i) {args[$_i] = arguments[$_i];};
+ if (fn) args.pop();
+ var ret = new PromiseArray(args).promise();
+ return fn !== undefined ? ret.spread(fn) : ret;
+};
+
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/map.js b/Restaurant/node_modules/bluebird/js/release/map.js
new file mode 100644
index 0000000..976f15e
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/map.js
@@ -0,0 +1,168 @@
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL,
+ debug) {
+var getDomain = Promise._getDomain;
+var util = require("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+function MappingPromiseArray(promises, fn, limit, _filter) {
+ this.constructor$(promises);
+ this._promise._captureStackTrace();
+ var domain = getDomain();
+ this._callback = domain === null ? fn : util.domainBind(domain, fn);
+ this._preservedValues = _filter === INTERNAL
+ ? new Array(this.length())
+ : null;
+ this._limit = limit;
+ this._inFlight = 0;
+ this._queue = [];
+ async.invoke(this._asyncInit, this, undefined);
+}
+util.inherits(MappingPromiseArray, PromiseArray);
+
+MappingPromiseArray.prototype._asyncInit = function() {
+ this._init$(undefined, -2);
+};
+
+MappingPromiseArray.prototype._init = function () {};
+
+MappingPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var values = this._values;
+ var length = this.length();
+ var preservedValues = this._preservedValues;
+ var limit = this._limit;
+
+ if (index < 0) {
+ index = (index * -1) - 1;
+ values[index] = value;
+ if (limit >= 1) {
+ this._inFlight--;
+ this._drainQueue();
+ if (this._isResolved()) return true;
+ }
+ } else {
+ if (limit >= 1 && this._inFlight >= limit) {
+ values[index] = value;
+ this._queue.push(index);
+ return false;
+ }
+ if (preservedValues !== null) preservedValues[index] = value;
+
+ var promise = this._promise;
+ var callback = this._callback;
+ var receiver = promise._boundValue();
+ promise._pushContext();
+ var ret = tryCatch(callback).call(receiver, value, index, length);
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret,
+ promiseCreated,
+ preservedValues !== null ? "Promise.filter" : "Promise.map",
+ promise
+ );
+ if (ret === errorObj) {
+ this._reject(ret.e);
+ return true;
+ }
+
+ var maybePromise = tryConvertToPromise(ret, this._promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ if (limit >= 1) this._inFlight++;
+ values[index] = maybePromise;
+ maybePromise._proxy(this, (index + 1) * -1);
+ return false;
+ } else if (((bitField & 33554432) !== 0)) {
+ ret = maybePromise._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(maybePromise._reason());
+ return true;
+ } else {
+ this._cancel();
+ return true;
+ }
+ }
+ values[index] = ret;
+ }
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= length) {
+ if (preservedValues !== null) {
+ this._filter(values, preservedValues);
+ } else {
+ this._resolve(values);
+ }
+ return true;
+ }
+ return false;
+};
+
+MappingPromiseArray.prototype._drainQueue = function () {
+ var queue = this._queue;
+ var limit = this._limit;
+ var values = this._values;
+ while (queue.length > 0 && this._inFlight < limit) {
+ if (this._isResolved()) return;
+ var index = queue.pop();
+ this._promiseFulfilled(values[index], index);
+ }
+};
+
+MappingPromiseArray.prototype._filter = function (booleans, values) {
+ var len = values.length;
+ var ret = new Array(len);
+ var j = 0;
+ for (var i = 0; i < len; ++i) {
+ if (booleans[i]) ret[j++] = values[i];
+ }
+ ret.length = j;
+ this._resolve(ret);
+};
+
+MappingPromiseArray.prototype.preservedValues = function () {
+ return this._preservedValues;
+};
+
+function map(promises, fn, options, _filter) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+
+ var limit = 0;
+ if (options !== undefined) {
+ if (typeof options === "object" && options !== null) {
+ if (typeof options.concurrency !== "number") {
+ return Promise.reject(
+ new TypeError("'concurrency' must be a number but it is " +
+ util.classString(options.concurrency)));
+ }
+ limit = options.concurrency;
+ } else {
+ return Promise.reject(new TypeError(
+ "options argument must be an object but it is " +
+ util.classString(options)));
+ }
+ }
+ limit = typeof limit === "number" &&
+ isFinite(limit) && limit >= 1 ? limit : 0;
+ return new MappingPromiseArray(promises, fn, limit, _filter).promise();
+}
+
+Promise.prototype.map = function (fn, options) {
+ return map(this, fn, options, null);
+};
+
+Promise.map = function (promises, fn, options, _filter) {
+ return map(promises, fn, options, _filter);
+};
+
+
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/method.js b/Restaurant/node_modules/bluebird/js/release/method.js
new file mode 100644
index 0000000..ce9e4db
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/method.js
@@ -0,0 +1,55 @@
+"use strict";
+module.exports =
+function(Promise, INTERNAL, tryConvertToPromise, apiRejection, debug) {
+var util = require("./util");
+var tryCatch = util.tryCatch;
+
+Promise.method = function (fn) {
+ if (typeof fn !== "function") {
+ throw new Promise.TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return function () {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = tryCatch(fn).apply(this, arguments);
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.method", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+ };
+};
+
+Promise.attempt = Promise["try"] = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value;
+ if (arguments.length > 1) {
+ debug.deprecated("calling Promise.try with more than 1 argument");
+ var arg = arguments[1];
+ var ctx = arguments[2];
+ value = util.isArray(arg) ? tryCatch(fn).apply(ctx, arg)
+ : tryCatch(fn).call(ctx, arg);
+ } else {
+ value = tryCatch(fn)();
+ }
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.try", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+};
+
+Promise.prototype._resolveFromSyncValue = function (value) {
+ if (value === util.errorObj) {
+ this._rejectCallback(value.e, false);
+ } else {
+ this._resolveCallback(value, true);
+ }
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/nodeback.js b/Restaurant/node_modules/bluebird/js/release/nodeback.js
new file mode 100644
index 0000000..71e69eb
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/nodeback.js
@@ -0,0 +1,51 @@
+"use strict";
+var util = require("./util");
+var maybeWrapAsError = util.maybeWrapAsError;
+var errors = require("./errors");
+var OperationalError = errors.OperationalError;
+var es5 = require("./es5");
+
+function isUntypedError(obj) {
+ return obj instanceof Error &&
+ es5.getPrototypeOf(obj) === Error.prototype;
+}
+
+var rErrorKey = /^(?:name|message|stack|cause)$/;
+function wrapAsOperationalError(obj) {
+ var ret;
+ if (isUntypedError(obj)) {
+ ret = new OperationalError(obj);
+ ret.name = obj.name;
+ ret.message = obj.message;
+ ret.stack = obj.stack;
+ var keys = es5.keys(obj);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (!rErrorKey.test(key)) {
+ ret[key] = obj[key];
+ }
+ }
+ return ret;
+ }
+ util.markAsOriginatingFromRejection(obj);
+ return obj;
+}
+
+function nodebackForPromise(promise, multiArgs) {
+ return function(err, value) {
+ if (promise === null) return;
+ if (err) {
+ var wrapped = wrapAsOperationalError(maybeWrapAsError(err));
+ promise._attachExtraTrace(wrapped);
+ promise._reject(wrapped);
+ } else if (!multiArgs) {
+ promise._fulfill(value);
+ } else {
+ var $_len = arguments.length;var args = new Array(Math.max($_len - 1, 0)); for(var $_i = 1; $_i < $_len; ++$_i) {args[$_i - 1] = arguments[$_i];};
+ promise._fulfill(args);
+ }
+ promise = null;
+ };
+}
+
+module.exports = nodebackForPromise;
diff --git a/Restaurant/node_modules/bluebird/js/release/nodeify.js b/Restaurant/node_modules/bluebird/js/release/nodeify.js
new file mode 100644
index 0000000..ce2b190
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/nodeify.js
@@ -0,0 +1,58 @@
+"use strict";
+module.exports = function(Promise) {
+var util = require("./util");
+var async = Promise._async;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function spreadAdapter(val, nodeback) {
+ var promise = this;
+ if (!util.isArray(val)) return successAdapter.call(promise, val, nodeback);
+ var ret =
+ tryCatch(nodeback).apply(promise._boundValue(), [null].concat(val));
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+function successAdapter(val, nodeback) {
+ var promise = this;
+ var receiver = promise._boundValue();
+ var ret = val === undefined
+ ? tryCatch(nodeback).call(receiver, null)
+ : tryCatch(nodeback).call(receiver, null, val);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+function errorAdapter(reason, nodeback) {
+ var promise = this;
+ if (!reason) {
+ var newReason = new Error(reason + "");
+ newReason.cause = reason;
+ reason = newReason;
+ }
+ var ret = tryCatch(nodeback).call(promise._boundValue(), reason);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+Promise.prototype.asCallback = Promise.prototype.nodeify = function (nodeback,
+ options) {
+ if (typeof nodeback == "function") {
+ var adapter = successAdapter;
+ if (options !== undefined && Object(options).spread) {
+ adapter = spreadAdapter;
+ }
+ this._then(
+ adapter,
+ errorAdapter,
+ undefined,
+ this,
+ nodeback
+ );
+ }
+ return this;
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/promise.js b/Restaurant/node_modules/bluebird/js/release/promise.js
new file mode 100644
index 0000000..f4a641c
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/promise.js
@@ -0,0 +1,775 @@
+"use strict";
+module.exports = function() {
+var makeSelfResolutionError = function () {
+ return new TypeError("circular promise resolution chain\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var reflectHandler = function() {
+ return new Promise.PromiseInspection(this._target());
+};
+var apiRejection = function(msg) {
+ return Promise.reject(new TypeError(msg));
+};
+function Proxyable() {}
+var UNDEFINED_BINDING = {};
+var util = require("./util");
+
+var getDomain;
+if (util.isNode) {
+ getDomain = function() {
+ var ret = process.domain;
+ if (ret === undefined) ret = null;
+ return ret;
+ };
+} else {
+ getDomain = function() {
+ return null;
+ };
+}
+util.notEnumerableProp(Promise, "_getDomain", getDomain);
+
+var es5 = require("./es5");
+var Async = require("./async");
+var async = new Async();
+es5.defineProperty(Promise, "_async", {value: async});
+var errors = require("./errors");
+var TypeError = Promise.TypeError = errors.TypeError;
+Promise.RangeError = errors.RangeError;
+var CancellationError = Promise.CancellationError = errors.CancellationError;
+Promise.TimeoutError = errors.TimeoutError;
+Promise.OperationalError = errors.OperationalError;
+Promise.RejectionError = errors.OperationalError;
+Promise.AggregateError = errors.AggregateError;
+var INTERNAL = function(){};
+var APPLY = {};
+var NEXT_FILTER = {};
+var tryConvertToPromise = require("./thenables")(Promise, INTERNAL);
+var PromiseArray =
+ require("./promise_array")(Promise, INTERNAL,
+ tryConvertToPromise, apiRejection, Proxyable);
+var Context = require("./context")(Promise);
+ /*jshint unused:false*/
+var createContext = Context.create;
+var debug = require("./debuggability")(Promise, Context);
+var CapturedTrace = debug.CapturedTrace;
+var PassThroughHandlerContext =
+ require("./finally")(Promise, tryConvertToPromise, NEXT_FILTER);
+var catchFilter = require("./catch_filter")(NEXT_FILTER);
+var nodebackForPromise = require("./nodeback");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+function check(self, executor) {
+ if (self == null || self.constructor !== Promise) {
+ throw new TypeError("the promise constructor cannot be invoked directly\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (typeof executor !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(executor));
+ }
+
+}
+
+function Promise(executor) {
+ if (executor !== INTERNAL) {
+ check(this, executor);
+ }
+ this._bitField = 0;
+ this._fulfillmentHandler0 = undefined;
+ this._rejectionHandler0 = undefined;
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._resolveFromExecutor(executor);
+ this._promiseCreated();
+ this._fireEvent("promiseCreated", this);
+}
+
+Promise.prototype.toString = function () {
+ return "[object Promise]";
+};
+
+Promise.prototype.caught = Promise.prototype["catch"] = function (fn) {
+ var len = arguments.length;
+ if (len > 1) {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return apiRejection("Catch statement predicate: " +
+ "expecting an object but got " + util.classString(item));
+ }
+ }
+ catchInstances.length = j;
+ fn = arguments[i];
+ return this.then(undefined, catchFilter(catchInstances, fn, this));
+ }
+ return this.then(undefined, fn);
+};
+
+Promise.prototype.reflect = function () {
+ return this._then(reflectHandler,
+ reflectHandler, undefined, this, undefined);
+};
+
+Promise.prototype.then = function (didFulfill, didReject) {
+ if (debug.warnings() && arguments.length > 0 &&
+ typeof didFulfill !== "function" &&
+ typeof didReject !== "function") {
+ var msg = ".then() only accepts functions but was passed: " +
+ util.classString(didFulfill);
+ if (arguments.length > 1) {
+ msg += ", " + util.classString(didReject);
+ }
+ this._warn(msg);
+ }
+ return this._then(didFulfill, didReject, undefined, undefined, undefined);
+};
+
+Promise.prototype.done = function (didFulfill, didReject) {
+ var promise =
+ this._then(didFulfill, didReject, undefined, undefined, undefined);
+ promise._setIsFinal();
+};
+
+Promise.prototype.spread = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ return this.all()._then(fn, undefined, undefined, APPLY, undefined);
+};
+
+Promise.prototype.toJSON = function () {
+ var ret = {
+ isFulfilled: false,
+ isRejected: false,
+ fulfillmentValue: undefined,
+ rejectionReason: undefined
+ };
+ if (this.isFulfilled()) {
+ ret.fulfillmentValue = this.value();
+ ret.isFulfilled = true;
+ } else if (this.isRejected()) {
+ ret.rejectionReason = this.reason();
+ ret.isRejected = true;
+ }
+ return ret;
+};
+
+Promise.prototype.all = function () {
+ if (arguments.length > 0) {
+ this._warn(".all() was passed arguments but it does not take any");
+ }
+ return new PromiseArray(this).promise();
+};
+
+Promise.prototype.error = function (fn) {
+ return this.caught(util.originatesFromRejection, fn);
+};
+
+Promise.getNewLibraryCopy = module.exports;
+
+Promise.is = function (val) {
+ return val instanceof Promise;
+};
+
+Promise.fromNode = Promise.fromCallback = function(fn) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var multiArgs = arguments.length > 1 ? !!Object(arguments[1]).multiArgs
+ : false;
+ var result = tryCatch(fn)(nodebackForPromise(ret, multiArgs));
+ if (result === errorObj) {
+ ret._rejectCallback(result.e, true);
+ }
+ if (!ret._isFateSealed()) ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.all = function (promises) {
+ return new PromiseArray(promises).promise();
+};
+
+Promise.cast = function (obj) {
+ var ret = tryConvertToPromise(obj);
+ if (!(ret instanceof Promise)) {
+ ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._setFulfilled();
+ ret._rejectionHandler0 = obj;
+ }
+ return ret;
+};
+
+Promise.resolve = Promise.fulfilled = Promise.cast;
+
+Promise.reject = Promise.rejected = function (reason) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._rejectCallback(reason, true);
+ return ret;
+};
+
+Promise.setScheduler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return async.setScheduler(fn);
+};
+
+Promise.prototype._then = function (
+ didFulfill,
+ didReject,
+ _, receiver,
+ internalData
+) {
+ var haveInternalData = internalData !== undefined;
+ var promise = haveInternalData ? internalData : new Promise(INTERNAL);
+ var target = this._target();
+ var bitField = target._bitField;
+
+ if (!haveInternalData) {
+ promise._propagateFrom(this, 3);
+ promise._captureStackTrace();
+ if (receiver === undefined &&
+ ((this._bitField & 2097152) !== 0)) {
+ if (!((bitField & 50397184) === 0)) {
+ receiver = this._boundValue();
+ } else {
+ receiver = target === this ? undefined : this._boundTo;
+ }
+ }
+ this._fireEvent("promiseChained", this, promise);
+ }
+
+ var domain = getDomain();
+ if (!((bitField & 50397184) === 0)) {
+ var handler, value, settler = target._settlePromiseCtx;
+ if (((bitField & 33554432) !== 0)) {
+ value = target._rejectionHandler0;
+ handler = didFulfill;
+ } else if (((bitField & 16777216) !== 0)) {
+ value = target._fulfillmentHandler0;
+ handler = didReject;
+ target._unsetRejectionIsUnhandled();
+ } else {
+ settler = target._settlePromiseLateCancellationObserver;
+ value = new CancellationError("late cancellation observer");
+ target._attachExtraTrace(value);
+ handler = didReject;
+ }
+
+ async.invoke(settler, target, {
+ handler: domain === null ? handler
+ : (typeof handler === "function" &&
+ util.domainBind(domain, handler)),
+ promise: promise,
+ receiver: receiver,
+ value: value
+ });
+ } else {
+ target._addCallbacks(didFulfill, didReject, promise, receiver, domain);
+ }
+
+ return promise;
+};
+
+Promise.prototype._length = function () {
+ return this._bitField & 65535;
+};
+
+Promise.prototype._isFateSealed = function () {
+ return (this._bitField & 117506048) !== 0;
+};
+
+Promise.prototype._isFollowing = function () {
+ return (this._bitField & 67108864) === 67108864;
+};
+
+Promise.prototype._setLength = function (len) {
+ this._bitField = (this._bitField & -65536) |
+ (len & 65535);
+};
+
+Promise.prototype._setFulfilled = function () {
+ this._bitField = this._bitField | 33554432;
+ this._fireEvent("promiseFulfilled", this);
+};
+
+Promise.prototype._setRejected = function () {
+ this._bitField = this._bitField | 16777216;
+ this._fireEvent("promiseRejected", this);
+};
+
+Promise.prototype._setFollowing = function () {
+ this._bitField = this._bitField | 67108864;
+ this._fireEvent("promiseResolved", this);
+};
+
+Promise.prototype._setIsFinal = function () {
+ this._bitField = this._bitField | 4194304;
+};
+
+Promise.prototype._isFinal = function () {
+ return (this._bitField & 4194304) > 0;
+};
+
+Promise.prototype._unsetCancelled = function() {
+ this._bitField = this._bitField & (~65536);
+};
+
+Promise.prototype._setCancelled = function() {
+ this._bitField = this._bitField | 65536;
+ this._fireEvent("promiseCancelled", this);
+};
+
+Promise.prototype._setWillBeCancelled = function() {
+ this._bitField = this._bitField | 8388608;
+};
+
+Promise.prototype._setAsyncGuaranteed = function() {
+ if (async.hasCustomScheduler()) return;
+ this._bitField = this._bitField | 134217728;
+};
+
+Promise.prototype._receiverAt = function (index) {
+ var ret = index === 0 ? this._receiver0 : this[
+ index * 4 - 4 + 3];
+ if (ret === UNDEFINED_BINDING) {
+ return undefined;
+ } else if (ret === undefined && this._isBound()) {
+ return this._boundValue();
+ }
+ return ret;
+};
+
+Promise.prototype._promiseAt = function (index) {
+ return this[
+ index * 4 - 4 + 2];
+};
+
+Promise.prototype._fulfillmentHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 0];
+};
+
+Promise.prototype._rejectionHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 1];
+};
+
+Promise.prototype._boundValue = function() {};
+
+Promise.prototype._migrateCallback0 = function (follower) {
+ var bitField = follower._bitField;
+ var fulfill = follower._fulfillmentHandler0;
+ var reject = follower._rejectionHandler0;
+ var promise = follower._promise0;
+ var receiver = follower._receiverAt(0);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._migrateCallbackAt = function (follower, index) {
+ var fulfill = follower._fulfillmentHandlerAt(index);
+ var reject = follower._rejectionHandlerAt(index);
+ var promise = follower._promiseAt(index);
+ var receiver = follower._receiverAt(index);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._addCallbacks = function (
+ fulfill,
+ reject,
+ promise,
+ receiver,
+ domain
+) {
+ var index = this._length();
+
+ if (index >= 65535 - 4) {
+ index = 0;
+ this._setLength(0);
+ }
+
+ if (index === 0) {
+ this._promise0 = promise;
+ this._receiver0 = receiver;
+ if (typeof fulfill === "function") {
+ this._fulfillmentHandler0 =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this._rejectionHandler0 =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ } else {
+ var base = index * 4 - 4;
+ this[base + 2] = promise;
+ this[base + 3] = receiver;
+ if (typeof fulfill === "function") {
+ this[base + 0] =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this[base + 1] =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ }
+ this._setLength(index + 1);
+ return index;
+};
+
+Promise.prototype._proxy = function (proxyable, arg) {
+ this._addCallbacks(undefined, undefined, arg, proxyable, null);
+};
+
+Promise.prototype._resolveCallback = function(value, shouldBind) {
+ if (((this._bitField & 117506048) !== 0)) return;
+ if (value === this)
+ return this._rejectCallback(makeSelfResolutionError(), false);
+ var maybePromise = tryConvertToPromise(value, this);
+ if (!(maybePromise instanceof Promise)) return this._fulfill(value);
+
+ if (shouldBind) this._propagateFrom(maybePromise, 2);
+
+ var promise = maybePromise._target();
+
+ if (promise === this) {
+ this._reject(makeSelfResolutionError());
+ return;
+ }
+
+ var bitField = promise._bitField;
+ if (((bitField & 50397184) === 0)) {
+ var len = this._length();
+ if (len > 0) promise._migrateCallback0(this);
+ for (var i = 1; i < len; ++i) {
+ promise._migrateCallbackAt(this, i);
+ }
+ this._setFollowing();
+ this._setLength(0);
+ this._setFollowee(promise);
+ } else if (((bitField & 33554432) !== 0)) {
+ this._fulfill(promise._value());
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(promise._reason());
+ } else {
+ var reason = new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ this._reject(reason);
+ }
+};
+
+Promise.prototype._rejectCallback =
+function(reason, synchronous, ignoreNonErrorWarnings) {
+ var trace = util.ensureErrorObject(reason);
+ var hasStack = trace === reason;
+ if (!hasStack && !ignoreNonErrorWarnings && debug.warnings()) {
+ var message = "a promise was rejected with a non-error: " +
+ util.classString(reason);
+ this._warn(message, true);
+ }
+ this._attachExtraTrace(trace, synchronous ? hasStack : false);
+ this._reject(reason);
+};
+
+Promise.prototype._resolveFromExecutor = function (executor) {
+ if (executor === INTERNAL) return;
+ var promise = this;
+ this._captureStackTrace();
+ this._pushContext();
+ var synchronous = true;
+ var r = this._execute(executor, function(value) {
+ promise._resolveCallback(value);
+ }, function (reason) {
+ promise._rejectCallback(reason, synchronous);
+ });
+ synchronous = false;
+ this._popContext();
+
+ if (r !== undefined) {
+ promise._rejectCallback(r, true);
+ }
+};
+
+Promise.prototype._settlePromiseFromHandler = function (
+ handler, receiver, value, promise
+) {
+ var bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+ promise._pushContext();
+ var x;
+ if (receiver === APPLY) {
+ if (!value || typeof value.length !== "number") {
+ x = errorObj;
+ x.e = new TypeError("cannot .spread() a non-array: " +
+ util.classString(value));
+ } else {
+ x = tryCatch(handler).apply(this._boundValue(), value);
+ }
+ } else {
+ x = tryCatch(handler).call(receiver, value);
+ }
+ var promiseCreated = promise._popContext();
+ bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+
+ if (x === NEXT_FILTER) {
+ promise._reject(value);
+ } else if (x === errorObj) {
+ promise._rejectCallback(x.e, false);
+ } else {
+ debug.checkForgottenReturns(x, promiseCreated, "", promise, this);
+ promise._resolveCallback(x);
+ }
+};
+
+Promise.prototype._target = function() {
+ var ret = this;
+ while (ret._isFollowing()) ret = ret._followee();
+ return ret;
+};
+
+Promise.prototype._followee = function() {
+ return this._rejectionHandler0;
+};
+
+Promise.prototype._setFollowee = function(promise) {
+ this._rejectionHandler0 = promise;
+};
+
+Promise.prototype._settlePromise = function(promise, handler, receiver, value) {
+ var isPromise = promise instanceof Promise;
+ var bitField = this._bitField;
+ var asyncGuaranteed = ((bitField & 134217728) !== 0);
+ if (((bitField & 65536) !== 0)) {
+ if (isPromise) promise._invokeInternalOnCancel();
+
+ if (receiver instanceof PassThroughHandlerContext &&
+ receiver.isFinallyHandler()) {
+ receiver.cancelPromise = promise;
+ if (tryCatch(handler).call(receiver, value) === errorObj) {
+ promise._reject(errorObj.e);
+ }
+ } else if (handler === reflectHandler) {
+ promise._fulfill(reflectHandler.call(receiver));
+ } else if (receiver instanceof Proxyable) {
+ receiver._promiseCancelled(promise);
+ } else if (isPromise || promise instanceof PromiseArray) {
+ promise._cancel();
+ } else {
+ receiver.cancel();
+ }
+ } else if (typeof handler === "function") {
+ if (!isPromise) {
+ handler.call(receiver, value, promise);
+ } else {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (receiver instanceof Proxyable) {
+ if (!receiver._isResolved()) {
+ if (((bitField & 33554432) !== 0)) {
+ receiver._promiseFulfilled(value, promise);
+ } else {
+ receiver._promiseRejected(value, promise);
+ }
+ }
+ } else if (isPromise) {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ if (((bitField & 33554432) !== 0)) {
+ promise._fulfill(value);
+ } else {
+ promise._reject(value);
+ }
+ }
+};
+
+Promise.prototype._settlePromiseLateCancellationObserver = function(ctx) {
+ var handler = ctx.handler;
+ var promise = ctx.promise;
+ var receiver = ctx.receiver;
+ var value = ctx.value;
+ if (typeof handler === "function") {
+ if (!(promise instanceof Promise)) {
+ handler.call(receiver, value, promise);
+ } else {
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (promise instanceof Promise) {
+ promise._reject(value);
+ }
+};
+
+Promise.prototype._settlePromiseCtx = function(ctx) {
+ this._settlePromise(ctx.promise, ctx.handler, ctx.receiver, ctx.value);
+};
+
+Promise.prototype._settlePromise0 = function(handler, value, bitField) {
+ var promise = this._promise0;
+ var receiver = this._receiverAt(0);
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._settlePromise(promise, handler, receiver, value);
+};
+
+Promise.prototype._clearCallbackDataAtIndex = function(index) {
+ var base = index * 4 - 4;
+ this[base + 2] =
+ this[base + 3] =
+ this[base + 0] =
+ this[base + 1] = undefined;
+};
+
+Promise.prototype._fulfill = function (value) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ if (value === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._reject(err);
+ }
+ this._setFulfilled();
+ this._rejectionHandler0 = value;
+
+ if ((bitField & 65535) > 0) {
+ if (((bitField & 134217728) !== 0)) {
+ this._settlePromises();
+ } else {
+ async.settlePromises(this);
+ }
+ }
+};
+
+Promise.prototype._reject = function (reason) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ this._setRejected();
+ this._fulfillmentHandler0 = reason;
+
+ if (this._isFinal()) {
+ return async.fatalError(reason, util.isNode);
+ }
+
+ if ((bitField & 65535) > 0) {
+ async.settlePromises(this);
+ } else {
+ this._ensurePossibleRejectionHandled();
+ }
+};
+
+Promise.prototype._fulfillPromises = function (len, value) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._fulfillmentHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, value);
+ }
+};
+
+Promise.prototype._rejectPromises = function (len, reason) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._rejectionHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, reason);
+ }
+};
+
+Promise.prototype._settlePromises = function () {
+ var bitField = this._bitField;
+ var len = (bitField & 65535);
+
+ if (len > 0) {
+ if (((bitField & 16842752) !== 0)) {
+ var reason = this._fulfillmentHandler0;
+ this._settlePromise0(this._rejectionHandler0, reason, bitField);
+ this._rejectPromises(len, reason);
+ } else {
+ var value = this._rejectionHandler0;
+ this._settlePromise0(this._fulfillmentHandler0, value, bitField);
+ this._fulfillPromises(len, value);
+ }
+ this._setLength(0);
+ }
+ this._clearCancellationData();
+};
+
+Promise.prototype._settledValue = function() {
+ var bitField = this._bitField;
+ if (((bitField & 33554432) !== 0)) {
+ return this._rejectionHandler0;
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._fulfillmentHandler0;
+ }
+};
+
+function deferResolve(v) {this.promise._resolveCallback(v);}
+function deferReject(v) {this.promise._rejectCallback(v, false);}
+
+Promise.defer = Promise.pending = function() {
+ debug.deprecated("Promise.defer", "new Promise");
+ var promise = new Promise(INTERNAL);
+ return {
+ promise: promise,
+ resolve: deferResolve,
+ reject: deferReject
+ };
+};
+
+util.notEnumerableProp(Promise,
+ "_makeSelfResolutionError",
+ makeSelfResolutionError);
+
+require("./method")(Promise, INTERNAL, tryConvertToPromise, apiRejection,
+ debug);
+require("./bind")(Promise, INTERNAL, tryConvertToPromise, debug);
+require("./cancel")(Promise, PromiseArray, apiRejection, debug);
+require("./direct_resolve")(Promise);
+require("./synchronous_inspection")(Promise);
+require("./join")(
+ Promise, PromiseArray, tryConvertToPromise, INTERNAL, async, getDomain);
+Promise.Promise = Promise;
+Promise.version = "3.5.1";
+require('./map.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL, debug);
+require('./call_get.js')(Promise);
+require('./using.js')(Promise, apiRejection, tryConvertToPromise, createContext, INTERNAL, debug);
+require('./timers.js')(Promise, INTERNAL, debug);
+require('./generators.js')(Promise, apiRejection, INTERNAL, tryConvertToPromise, Proxyable, debug);
+require('./nodeify.js')(Promise);
+require('./promisify.js')(Promise, INTERNAL);
+require('./props.js')(Promise, PromiseArray, tryConvertToPromise, apiRejection);
+require('./race.js')(Promise, INTERNAL, tryConvertToPromise, apiRejection);
+require('./reduce.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL, debug);
+require('./settle.js')(Promise, PromiseArray, debug);
+require('./some.js')(Promise, PromiseArray, apiRejection);
+require('./filter.js')(Promise, INTERNAL);
+require('./each.js')(Promise, INTERNAL);
+require('./any.js')(Promise);
+
+ util.toFastProperties(Promise);
+ util.toFastProperties(Promise.prototype);
+ function fillTypes(value) {
+ var p = new Promise(INTERNAL);
+ p._fulfillmentHandler0 = value;
+ p._rejectionHandler0 = value;
+ p._promise0 = value;
+ p._receiver0 = value;
+ }
+ // Complete slack tracking, opt out of field-type tracking and
+ // stabilize map
+ fillTypes({a: 1});
+ fillTypes({b: 2});
+ fillTypes({c: 3});
+ fillTypes(1);
+ fillTypes(function(){});
+ fillTypes(undefined);
+ fillTypes(false);
+ fillTypes(new Promise(INTERNAL));
+ debug.setBounds(Async.firstLineError, util.lastLineError);
+ return Promise;
+
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/promise_array.js b/Restaurant/node_modules/bluebird/js/release/promise_array.js
new file mode 100644
index 0000000..0fb303e
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/promise_array.js
@@ -0,0 +1,185 @@
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise,
+ apiRejection, Proxyable) {
+var util = require("./util");
+var isArray = util.isArray;
+
+function toResolutionValue(val) {
+ switch(val) {
+ case -2: return [];
+ case -3: return {};
+ case -6: return new Map();
+ }
+}
+
+function PromiseArray(values) {
+ var promise = this._promise = new Promise(INTERNAL);
+ if (values instanceof Promise) {
+ promise._propagateFrom(values, 3);
+ }
+ promise._setOnCancel(this);
+ this._values = values;
+ this._length = 0;
+ this._totalResolved = 0;
+ this._init(undefined, -2);
+}
+util.inherits(PromiseArray, Proxyable);
+
+PromiseArray.prototype.length = function () {
+ return this._length;
+};
+
+PromiseArray.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseArray.prototype._init = function init(_, resolveValueIfEmpty) {
+ var values = tryConvertToPromise(this._values, this._promise);
+ if (values instanceof Promise) {
+ values = values._target();
+ var bitField = values._bitField;
+ ;
+ this._values = values;
+
+ if (((bitField & 50397184) === 0)) {
+ this._promise._setAsyncGuaranteed();
+ return values._then(
+ init,
+ this._reject,
+ undefined,
+ this,
+ resolveValueIfEmpty
+ );
+ } else if (((bitField & 33554432) !== 0)) {
+ values = values._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._reject(values._reason());
+ } else {
+ return this._cancel();
+ }
+ }
+ values = util.asArray(values);
+ if (values === null) {
+ var err = apiRejection(
+ "expecting an array or an iterable object but got " + util.classString(values)).reason();
+ this._promise._rejectCallback(err, false);
+ return;
+ }
+
+ if (values.length === 0) {
+ if (resolveValueIfEmpty === -5) {
+ this._resolveEmptyArray();
+ }
+ else {
+ this._resolve(toResolutionValue(resolveValueIfEmpty));
+ }
+ return;
+ }
+ this._iterate(values);
+};
+
+PromiseArray.prototype._iterate = function(values) {
+ var len = this.getActualLength(values.length);
+ this._length = len;
+ this._values = this.shouldCopyValues() ? new Array(len) : this._values;
+ var result = this._promise;
+ var isResolved = false;
+ var bitField = null;
+ for (var i = 0; i < len; ++i) {
+ var maybePromise = tryConvertToPromise(values[i], result);
+
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ bitField = maybePromise._bitField;
+ } else {
+ bitField = null;
+ }
+
+ if (isResolved) {
+ if (bitField !== null) {
+ maybePromise.suppressUnhandledRejections();
+ }
+ } else if (bitField !== null) {
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._proxy(this, i);
+ this._values[i] = maybePromise;
+ } else if (((bitField & 33554432) !== 0)) {
+ isResolved = this._promiseFulfilled(maybePromise._value(), i);
+ } else if (((bitField & 16777216) !== 0)) {
+ isResolved = this._promiseRejected(maybePromise._reason(), i);
+ } else {
+ isResolved = this._promiseCancelled(i);
+ }
+ } else {
+ isResolved = this._promiseFulfilled(maybePromise, i);
+ }
+ }
+ if (!isResolved) result._setAsyncGuaranteed();
+};
+
+PromiseArray.prototype._isResolved = function () {
+ return this._values === null;
+};
+
+PromiseArray.prototype._resolve = function (value) {
+ this._values = null;
+ this._promise._fulfill(value);
+};
+
+PromiseArray.prototype._cancel = function() {
+ if (this._isResolved() || !this._promise._isCancellable()) return;
+ this._values = null;
+ this._promise._cancel();
+};
+
+PromiseArray.prototype._reject = function (reason) {
+ this._values = null;
+ this._promise._rejectCallback(reason, false);
+};
+
+PromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+PromiseArray.prototype._promiseCancelled = function() {
+ this._cancel();
+ return true;
+};
+
+PromiseArray.prototype._promiseRejected = function (reason) {
+ this._totalResolved++;
+ this._reject(reason);
+ return true;
+};
+
+PromiseArray.prototype._resultCancelled = function() {
+ if (this._isResolved()) return;
+ var values = this._values;
+ this._cancel();
+ if (values instanceof Promise) {
+ values.cancel();
+ } else {
+ for (var i = 0; i < values.length; ++i) {
+ if (values[i] instanceof Promise) {
+ values[i].cancel();
+ }
+ }
+ }
+};
+
+PromiseArray.prototype.shouldCopyValues = function () {
+ return true;
+};
+
+PromiseArray.prototype.getActualLength = function (len) {
+ return len;
+};
+
+return PromiseArray;
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/promisify.js b/Restaurant/node_modules/bluebird/js/release/promisify.js
new file mode 100644
index 0000000..aa98e5b
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/promisify.js
@@ -0,0 +1,314 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var THIS = {};
+var util = require("./util");
+var nodebackForPromise = require("./nodeback");
+var withAppended = util.withAppended;
+var maybeWrapAsError = util.maybeWrapAsError;
+var canEvaluate = util.canEvaluate;
+var TypeError = require("./errors").TypeError;
+var defaultSuffix = "Async";
+var defaultPromisified = {__isPromisified__: true};
+var noCopyProps = [
+ "arity", "length",
+ "name",
+ "arguments",
+ "caller",
+ "callee",
+ "prototype",
+ "__isPromisified__"
+];
+var noCopyPropsPattern = new RegExp("^(?:" + noCopyProps.join("|") + ")$");
+
+var defaultFilter = function(name) {
+ return util.isIdentifier(name) &&
+ name.charAt(0) !== "_" &&
+ name !== "constructor";
+};
+
+function propsFilter(key) {
+ return !noCopyPropsPattern.test(key);
+}
+
+function isPromisified(fn) {
+ try {
+ return fn.__isPromisified__ === true;
+ }
+ catch (e) {
+ return false;
+ }
+}
+
+function hasPromisified(obj, key, suffix) {
+ var val = util.getDataPropertyOrDefault(obj, key + suffix,
+ defaultPromisified);
+ return val ? isPromisified(val) : false;
+}
+function checkValid(ret, suffix, suffixRegexp) {
+ for (var i = 0; i < ret.length; i += 2) {
+ var key = ret[i];
+ if (suffixRegexp.test(key)) {
+ var keyWithoutAsyncSuffix = key.replace(suffixRegexp, "");
+ for (var j = 0; j < ret.length; j += 2) {
+ if (ret[j] === keyWithoutAsyncSuffix) {
+ throw new TypeError("Cannot promisify an API that has normal methods with '%s'-suffix\u000a\u000a See http://goo.gl/MqrFmX\u000a"
+ .replace("%s", suffix));
+ }
+ }
+ }
+ }
+}
+
+function promisifiableMethods(obj, suffix, suffixRegexp, filter) {
+ var keys = util.inheritedDataKeys(obj);
+ var ret = [];
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ var value = obj[key];
+ var passesDefaultFilter = filter === defaultFilter
+ ? true : defaultFilter(key, value, obj);
+ if (typeof value === "function" &&
+ !isPromisified(value) &&
+ !hasPromisified(obj, key, suffix) &&
+ filter(key, value, obj, passesDefaultFilter)) {
+ ret.push(key, value);
+ }
+ }
+ checkValid(ret, suffix, suffixRegexp);
+ return ret;
+}
+
+var escapeIdentRegex = function(str) {
+ return str.replace(/([$])/, "\\$");
+};
+
+var makeNodePromisifiedEval;
+if (!false) {
+var switchCaseArgumentOrder = function(likelyArgumentCount) {
+ var ret = [likelyArgumentCount];
+ var min = Math.max(0, likelyArgumentCount - 1 - 3);
+ for(var i = likelyArgumentCount - 1; i >= min; --i) {
+ ret.push(i);
+ }
+ for(var i = likelyArgumentCount + 1; i <= 3; ++i) {
+ ret.push(i);
+ }
+ return ret;
+};
+
+var argumentSequence = function(argumentCount) {
+ return util.filledRange(argumentCount, "_arg", "");
+};
+
+var parameterDeclaration = function(parameterCount) {
+ return util.filledRange(
+ Math.max(parameterCount, 3), "_arg", "");
+};
+
+var parameterCount = function(fn) {
+ if (typeof fn.length === "number") {
+ return Math.max(Math.min(fn.length, 1023 + 1), 0);
+ }
+ return 0;
+};
+
+makeNodePromisifiedEval =
+function(callback, receiver, originalName, fn, _, multiArgs) {
+ var newParameterCount = Math.max(0, parameterCount(fn) - 1);
+ var argumentOrder = switchCaseArgumentOrder(newParameterCount);
+ var shouldProxyThis = typeof callback === "string" || receiver === THIS;
+
+ function generateCallForArgumentCount(count) {
+ var args = argumentSequence(count).join(", ");
+ var comma = count > 0 ? ", " : "";
+ var ret;
+ if (shouldProxyThis) {
+ ret = "ret = callback.call(this, {{args}}, nodeback); break;\n";
+ } else {
+ ret = receiver === undefined
+ ? "ret = callback({{args}}, nodeback); break;\n"
+ : "ret = callback.call(receiver, {{args}}, nodeback); break;\n";
+ }
+ return ret.replace("{{args}}", args).replace(", ", comma);
+ }
+
+ function generateArgumentSwitchCase() {
+ var ret = "";
+ for (var i = 0; i < argumentOrder.length; ++i) {
+ ret += "case " + argumentOrder[i] +":" +
+ generateCallForArgumentCount(argumentOrder[i]);
+ }
+
+ ret += " \n\
+ default: \n\
+ var args = new Array(len + 1); \n\
+ var i = 0; \n\
+ for (var i = 0; i < len; ++i) { \n\
+ args[i] = arguments[i]; \n\
+ } \n\
+ args[i] = nodeback; \n\
+ [CodeForCall] \n\
+ break; \n\
+ ".replace("[CodeForCall]", (shouldProxyThis
+ ? "ret = callback.apply(this, args);\n"
+ : "ret = callback.apply(receiver, args);\n"));
+ return ret;
+ }
+
+ var getFunctionCode = typeof callback === "string"
+ ? ("this != null ? this['"+callback+"'] : fn")
+ : "fn";
+ var body = "'use strict'; \n\
+ var ret = function (Parameters) { \n\
+ 'use strict'; \n\
+ var len = arguments.length; \n\
+ var promise = new Promise(INTERNAL); \n\
+ promise._captureStackTrace(); \n\
+ var nodeback = nodebackForPromise(promise, " + multiArgs + "); \n\
+ var ret; \n\
+ var callback = tryCatch([GetFunctionCode]); \n\
+ switch(len) { \n\
+ [CodeForSwitchCase] \n\
+ } \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(maybeWrapAsError(ret.e), true, true);\n\
+ } \n\
+ if (!promise._isFateSealed()) promise._setAsyncGuaranteed(); \n\
+ return promise; \n\
+ }; \n\
+ notEnumerableProp(ret, '__isPromisified__', true); \n\
+ return ret; \n\
+ ".replace("[CodeForSwitchCase]", generateArgumentSwitchCase())
+ .replace("[GetFunctionCode]", getFunctionCode);
+ body = body.replace("Parameters", parameterDeclaration(newParameterCount));
+ return new Function("Promise",
+ "fn",
+ "receiver",
+ "withAppended",
+ "maybeWrapAsError",
+ "nodebackForPromise",
+ "tryCatch",
+ "errorObj",
+ "notEnumerableProp",
+ "INTERNAL",
+ body)(
+ Promise,
+ fn,
+ receiver,
+ withAppended,
+ maybeWrapAsError,
+ nodebackForPromise,
+ util.tryCatch,
+ util.errorObj,
+ util.notEnumerableProp,
+ INTERNAL);
+};
+}
+
+function makeNodePromisifiedClosure(callback, receiver, _, fn, __, multiArgs) {
+ var defaultThis = (function() {return this;})();
+ var method = callback;
+ if (typeof method === "string") {
+ callback = fn;
+ }
+ function promisified() {
+ var _receiver = receiver;
+ if (receiver === THIS) _receiver = this;
+ var promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ var cb = typeof method === "string" && this !== defaultThis
+ ? this[method] : callback;
+ var fn = nodebackForPromise(promise, multiArgs);
+ try {
+ cb.apply(_receiver, withAppended(arguments, fn));
+ } catch(e) {
+ promise._rejectCallback(maybeWrapAsError(e), true, true);
+ }
+ if (!promise._isFateSealed()) promise._setAsyncGuaranteed();
+ return promise;
+ }
+ util.notEnumerableProp(promisified, "__isPromisified__", true);
+ return promisified;
+}
+
+var makeNodePromisified = canEvaluate
+ ? makeNodePromisifiedEval
+ : makeNodePromisifiedClosure;
+
+function promisifyAll(obj, suffix, filter, promisifier, multiArgs) {
+ var suffixRegexp = new RegExp(escapeIdentRegex(suffix) + "$");
+ var methods =
+ promisifiableMethods(obj, suffix, suffixRegexp, filter);
+
+ for (var i = 0, len = methods.length; i < len; i+= 2) {
+ var key = methods[i];
+ var fn = methods[i+1];
+ var promisifiedKey = key + suffix;
+ if (promisifier === makeNodePromisified) {
+ obj[promisifiedKey] =
+ makeNodePromisified(key, THIS, key, fn, suffix, multiArgs);
+ } else {
+ var promisified = promisifier(fn, function() {
+ return makeNodePromisified(key, THIS, key,
+ fn, suffix, multiArgs);
+ });
+ util.notEnumerableProp(promisified, "__isPromisified__", true);
+ obj[promisifiedKey] = promisified;
+ }
+ }
+ util.toFastProperties(obj);
+ return obj;
+}
+
+function promisify(callback, receiver, multiArgs) {
+ return makeNodePromisified(callback, receiver, undefined,
+ callback, null, multiArgs);
+}
+
+Promise.promisify = function (fn, options) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ if (isPromisified(fn)) {
+ return fn;
+ }
+ options = Object(options);
+ var receiver = options.context === undefined ? THIS : options.context;
+ var multiArgs = !!options.multiArgs;
+ var ret = promisify(fn, receiver, multiArgs);
+ util.copyDescriptors(fn, ret, propsFilter);
+ return ret;
+};
+
+Promise.promisifyAll = function (target, options) {
+ if (typeof target !== "function" && typeof target !== "object") {
+ throw new TypeError("the target of promisifyAll must be an object or a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ options = Object(options);
+ var multiArgs = !!options.multiArgs;
+ var suffix = options.suffix;
+ if (typeof suffix !== "string") suffix = defaultSuffix;
+ var filter = options.filter;
+ if (typeof filter !== "function") filter = defaultFilter;
+ var promisifier = options.promisifier;
+ if (typeof promisifier !== "function") promisifier = makeNodePromisified;
+
+ if (!util.isIdentifier(suffix)) {
+ throw new RangeError("suffix must be a valid identifier\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+
+ var keys = util.inheritedDataKeys(target);
+ for (var i = 0; i < keys.length; ++i) {
+ var value = target[keys[i]];
+ if (keys[i] !== "constructor" &&
+ util.isClass(value)) {
+ promisifyAll(value.prototype, suffix, filter, promisifier,
+ multiArgs);
+ promisifyAll(value, suffix, filter, promisifier, multiArgs);
+ }
+ }
+
+ return promisifyAll(target, suffix, filter, promisifier, multiArgs);
+};
+};
+
diff --git a/Restaurant/node_modules/bluebird/js/release/props.js b/Restaurant/node_modules/bluebird/js/release/props.js
new file mode 100644
index 0000000..6a34aaf
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/props.js
@@ -0,0 +1,118 @@
+"use strict";
+module.exports = function(
+ Promise, PromiseArray, tryConvertToPromise, apiRejection) {
+var util = require("./util");
+var isObject = util.isObject;
+var es5 = require("./es5");
+var Es6Map;
+if (typeof Map === "function") Es6Map = Map;
+
+var mapToEntries = (function() {
+ var index = 0;
+ var size = 0;
+
+ function extractEntry(value, key) {
+ this[index] = value;
+ this[index + size] = key;
+ index++;
+ }
+
+ return function mapToEntries(map) {
+ size = map.size;
+ index = 0;
+ var ret = new Array(map.size * 2);
+ map.forEach(extractEntry, ret);
+ return ret;
+ };
+})();
+
+var entriesToMap = function(entries) {
+ var ret = new Es6Map();
+ var length = entries.length / 2 | 0;
+ for (var i = 0; i < length; ++i) {
+ var key = entries[length + i];
+ var value = entries[i];
+ ret.set(key, value);
+ }
+ return ret;
+};
+
+function PropertiesPromiseArray(obj) {
+ var isMap = false;
+ var entries;
+ if (Es6Map !== undefined && obj instanceof Es6Map) {
+ entries = mapToEntries(obj);
+ isMap = true;
+ } else {
+ var keys = es5.keys(obj);
+ var len = keys.length;
+ entries = new Array(len * 2);
+ for (var i = 0; i < len; ++i) {
+ var key = keys[i];
+ entries[i] = obj[key];
+ entries[i + len] = key;
+ }
+ }
+ this.constructor$(entries);
+ this._isMap = isMap;
+ this._init$(undefined, isMap ? -6 : -3);
+}
+util.inherits(PropertiesPromiseArray, PromiseArray);
+
+PropertiesPromiseArray.prototype._init = function () {};
+
+PropertiesPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ var val;
+ if (this._isMap) {
+ val = entriesToMap(this._values);
+ } else {
+ val = {};
+ var keyOffset = this.length();
+ for (var i = 0, len = this.length(); i < len; ++i) {
+ val[this._values[i + keyOffset]] = this._values[i];
+ }
+ }
+ this._resolve(val);
+ return true;
+ }
+ return false;
+};
+
+PropertiesPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+PropertiesPromiseArray.prototype.getActualLength = function (len) {
+ return len >> 1;
+};
+
+function props(promises) {
+ var ret;
+ var castValue = tryConvertToPromise(promises);
+
+ if (!isObject(castValue)) {
+ return apiRejection("cannot await properties of a non-object\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ } else if (castValue instanceof Promise) {
+ ret = castValue._then(
+ Promise.props, undefined, undefined, undefined, undefined);
+ } else {
+ ret = new PropertiesPromiseArray(castValue).promise();
+ }
+
+ if (castValue instanceof Promise) {
+ ret._propagateFrom(castValue, 2);
+ }
+ return ret;
+}
+
+Promise.prototype.props = function () {
+ return props(this);
+};
+
+Promise.props = function (promises) {
+ return props(promises);
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/queue.js b/Restaurant/node_modules/bluebird/js/release/queue.js
new file mode 100644
index 0000000..ffd36fd
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/queue.js
@@ -0,0 +1,73 @@
+"use strict";
+function arrayMove(src, srcIndex, dst, dstIndex, len) {
+ for (var j = 0; j < len; ++j) {
+ dst[j + dstIndex] = src[j + srcIndex];
+ src[j + srcIndex] = void 0;
+ }
+}
+
+function Queue(capacity) {
+ this._capacity = capacity;
+ this._length = 0;
+ this._front = 0;
+}
+
+Queue.prototype._willBeOverCapacity = function (size) {
+ return this._capacity < size;
+};
+
+Queue.prototype._pushOne = function (arg) {
+ var length = this.length();
+ this._checkCapacity(length + 1);
+ var i = (this._front + length) & (this._capacity - 1);
+ this[i] = arg;
+ this._length = length + 1;
+};
+
+Queue.prototype.push = function (fn, receiver, arg) {
+ var length = this.length() + 3;
+ if (this._willBeOverCapacity(length)) {
+ this._pushOne(fn);
+ this._pushOne(receiver);
+ this._pushOne(arg);
+ return;
+ }
+ var j = this._front + length - 3;
+ this._checkCapacity(length);
+ var wrapMask = this._capacity - 1;
+ this[(j + 0) & wrapMask] = fn;
+ this[(j + 1) & wrapMask] = receiver;
+ this[(j + 2) & wrapMask] = arg;
+ this._length = length;
+};
+
+Queue.prototype.shift = function () {
+ var front = this._front,
+ ret = this[front];
+
+ this[front] = undefined;
+ this._front = (front + 1) & (this._capacity - 1);
+ this._length--;
+ return ret;
+};
+
+Queue.prototype.length = function () {
+ return this._length;
+};
+
+Queue.prototype._checkCapacity = function (size) {
+ if (this._capacity < size) {
+ this._resizeTo(this._capacity << 1);
+ }
+};
+
+Queue.prototype._resizeTo = function (capacity) {
+ var oldCapacity = this._capacity;
+ this._capacity = capacity;
+ var front = this._front;
+ var length = this._length;
+ var moveItemsCount = (front + length) & (oldCapacity - 1);
+ arrayMove(this, 0, this, oldCapacity, moveItemsCount);
+};
+
+module.exports = Queue;
diff --git a/Restaurant/node_modules/bluebird/js/release/race.js b/Restaurant/node_modules/bluebird/js/release/race.js
new file mode 100644
index 0000000..b862f46
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/race.js
@@ -0,0 +1,49 @@
+"use strict";
+module.exports = function(
+ Promise, INTERNAL, tryConvertToPromise, apiRejection) {
+var util = require("./util");
+
+var raceLater = function (promise) {
+ return promise.then(function(array) {
+ return race(array, promise);
+ });
+};
+
+function race(promises, parent) {
+ var maybePromise = tryConvertToPromise(promises);
+
+ if (maybePromise instanceof Promise) {
+ return raceLater(maybePromise);
+ } else {
+ promises = util.asArray(promises);
+ if (promises === null)
+ return apiRejection("expecting an array or an iterable object but got " + util.classString(promises));
+ }
+
+ var ret = new Promise(INTERNAL);
+ if (parent !== undefined) {
+ ret._propagateFrom(parent, 3);
+ }
+ var fulfill = ret._fulfill;
+ var reject = ret._reject;
+ for (var i = 0, len = promises.length; i < len; ++i) {
+ var val = promises[i];
+
+ if (val === undefined && !(i in promises)) {
+ continue;
+ }
+
+ Promise.cast(val)._then(fulfill, reject, undefined, ret, null);
+ }
+ return ret;
+}
+
+Promise.race = function (promises) {
+ return race(promises, undefined);
+};
+
+Promise.prototype.race = function () {
+ return race(this, undefined);
+};
+
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/reduce.js b/Restaurant/node_modules/bluebird/js/release/reduce.js
new file mode 100644
index 0000000..26e2b1a
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/reduce.js
@@ -0,0 +1,172 @@
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL,
+ debug) {
+var getDomain = Promise._getDomain;
+var util = require("./util");
+var tryCatch = util.tryCatch;
+
+function ReductionPromiseArray(promises, fn, initialValue, _each) {
+ this.constructor$(promises);
+ var domain = getDomain();
+ this._fn = domain === null ? fn : util.domainBind(domain, fn);
+ if (initialValue !== undefined) {
+ initialValue = Promise.resolve(initialValue);
+ initialValue._attachCancellationCallback(this);
+ }
+ this._initialValue = initialValue;
+ this._currentCancellable = null;
+ if(_each === INTERNAL) {
+ this._eachValues = Array(this._length);
+ } else if (_each === 0) {
+ this._eachValues = null;
+ } else {
+ this._eachValues = undefined;
+ }
+ this._promise._captureStackTrace();
+ this._init$(undefined, -5);
+}
+util.inherits(ReductionPromiseArray, PromiseArray);
+
+ReductionPromiseArray.prototype._gotAccum = function(accum) {
+ if (this._eachValues !== undefined &&
+ this._eachValues !== null &&
+ accum !== INTERNAL) {
+ this._eachValues.push(accum);
+ }
+};
+
+ReductionPromiseArray.prototype._eachComplete = function(value) {
+ if (this._eachValues !== null) {
+ this._eachValues.push(value);
+ }
+ return this._eachValues;
+};
+
+ReductionPromiseArray.prototype._init = function() {};
+
+ReductionPromiseArray.prototype._resolveEmptyArray = function() {
+ this._resolve(this._eachValues !== undefined ? this._eachValues
+ : this._initialValue);
+};
+
+ReductionPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+ReductionPromiseArray.prototype._resolve = function(value) {
+ this._promise._resolveCallback(value);
+ this._values = null;
+};
+
+ReductionPromiseArray.prototype._resultCancelled = function(sender) {
+ if (sender === this._initialValue) return this._cancel();
+ if (this._isResolved()) return;
+ this._resultCancelled$();
+ if (this._currentCancellable instanceof Promise) {
+ this._currentCancellable.cancel();
+ }
+ if (this._initialValue instanceof Promise) {
+ this._initialValue.cancel();
+ }
+};
+
+ReductionPromiseArray.prototype._iterate = function (values) {
+ this._values = values;
+ var value;
+ var i;
+ var length = values.length;
+ if (this._initialValue !== undefined) {
+ value = this._initialValue;
+ i = 0;
+ } else {
+ value = Promise.resolve(values[0]);
+ i = 1;
+ }
+
+ this._currentCancellable = value;
+
+ if (!value.isRejected()) {
+ for (; i < length; ++i) {
+ var ctx = {
+ accum: null,
+ value: values[i],
+ index: i,
+ length: length,
+ array: this
+ };
+ value = value._then(gotAccum, undefined, undefined, ctx, undefined);
+ }
+ }
+
+ if (this._eachValues !== undefined) {
+ value = value
+ ._then(this._eachComplete, undefined, undefined, this, undefined);
+ }
+ value._then(completed, completed, undefined, value, this);
+};
+
+Promise.prototype.reduce = function (fn, initialValue) {
+ return reduce(this, fn, initialValue, null);
+};
+
+Promise.reduce = function (promises, fn, initialValue, _each) {
+ return reduce(promises, fn, initialValue, _each);
+};
+
+function completed(valueOrReason, array) {
+ if (this.isFulfilled()) {
+ array._resolve(valueOrReason);
+ } else {
+ array._reject(valueOrReason);
+ }
+}
+
+function reduce(promises, fn, initialValue, _each) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var array = new ReductionPromiseArray(promises, fn, initialValue, _each);
+ return array.promise();
+}
+
+function gotAccum(accum) {
+ this.accum = accum;
+ this.array._gotAccum(accum);
+ var value = tryConvertToPromise(this.value, this.array._promise);
+ if (value instanceof Promise) {
+ this.array._currentCancellable = value;
+ return value._then(gotValue, undefined, undefined, this, undefined);
+ } else {
+ return gotValue.call(this, value);
+ }
+}
+
+function gotValue(value) {
+ var array = this.array;
+ var promise = array._promise;
+ var fn = tryCatch(array._fn);
+ promise._pushContext();
+ var ret;
+ if (array._eachValues !== undefined) {
+ ret = fn.call(promise._boundValue(), value, this.index, this.length);
+ } else {
+ ret = fn.call(promise._boundValue(),
+ this.accum, value, this.index, this.length);
+ }
+ if (ret instanceof Promise) {
+ array._currentCancellable = ret;
+ }
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret,
+ promiseCreated,
+ array._eachValues !== undefined ? "Promise.each" : "Promise.reduce",
+ promise
+ );
+ return ret;
+}
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/schedule.js b/Restaurant/node_modules/bluebird/js/release/schedule.js
new file mode 100644
index 0000000..f70df9f
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/schedule.js
@@ -0,0 +1,61 @@
+"use strict";
+var util = require("./util");
+var schedule;
+var noAsyncScheduler = function() {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var NativePromise = util.getNativePromise();
+if (util.isNode && typeof MutationObserver === "undefined") {
+ var GlobalSetImmediate = global.setImmediate;
+ var ProcessNextTick = process.nextTick;
+ schedule = util.isRecentNode
+ ? function(fn) { GlobalSetImmediate.call(global, fn); }
+ : function(fn) { ProcessNextTick.call(process, fn); };
+} else if (typeof NativePromise === "function" &&
+ typeof NativePromise.resolve === "function") {
+ var nativePromise = NativePromise.resolve();
+ schedule = function(fn) {
+ nativePromise.then(fn);
+ };
+} else if ((typeof MutationObserver !== "undefined") &&
+ !(typeof window !== "undefined" &&
+ window.navigator &&
+ (window.navigator.standalone || window.cordova))) {
+ schedule = (function() {
+ var div = document.createElement("div");
+ var opts = {attributes: true};
+ var toggleScheduled = false;
+ var div2 = document.createElement("div");
+ var o2 = new MutationObserver(function() {
+ div.classList.toggle("foo");
+ toggleScheduled = false;
+ });
+ o2.observe(div2, opts);
+
+ var scheduleToggle = function() {
+ if (toggleScheduled) return;
+ toggleScheduled = true;
+ div2.classList.toggle("foo");
+ };
+
+ return function schedule(fn) {
+ var o = new MutationObserver(function() {
+ o.disconnect();
+ fn();
+ });
+ o.observe(div, opts);
+ scheduleToggle();
+ };
+ })();
+} else if (typeof setImmediate !== "undefined") {
+ schedule = function (fn) {
+ setImmediate(fn);
+ };
+} else if (typeof setTimeout !== "undefined") {
+ schedule = function (fn) {
+ setTimeout(fn, 0);
+ };
+} else {
+ schedule = noAsyncScheduler;
+}
+module.exports = schedule;
diff --git a/Restaurant/node_modules/bluebird/js/release/settle.js b/Restaurant/node_modules/bluebird/js/release/settle.js
new file mode 100644
index 0000000..fade3a1
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/settle.js
@@ -0,0 +1,43 @@
+"use strict";
+module.exports =
+ function(Promise, PromiseArray, debug) {
+var PromiseInspection = Promise.PromiseInspection;
+var util = require("./util");
+
+function SettledPromiseArray(values) {
+ this.constructor$(values);
+}
+util.inherits(SettledPromiseArray, PromiseArray);
+
+SettledPromiseArray.prototype._promiseResolved = function (index, inspection) {
+ this._values[index] = inspection;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+SettledPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 33554432;
+ ret._settledValueField = value;
+ return this._promiseResolved(index, ret);
+};
+SettledPromiseArray.prototype._promiseRejected = function (reason, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 16777216;
+ ret._settledValueField = reason;
+ return this._promiseResolved(index, ret);
+};
+
+Promise.settle = function (promises) {
+ debug.deprecated(".settle()", ".reflect()");
+ return new SettledPromiseArray(promises).promise();
+};
+
+Promise.prototype.settle = function () {
+ return Promise.settle(this);
+};
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/some.js b/Restaurant/node_modules/bluebird/js/release/some.js
new file mode 100644
index 0000000..400d852
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/some.js
@@ -0,0 +1,148 @@
+"use strict";
+module.exports =
+function(Promise, PromiseArray, apiRejection) {
+var util = require("./util");
+var RangeError = require("./errors").RangeError;
+var AggregateError = require("./errors").AggregateError;
+var isArray = util.isArray;
+var CANCELLATION = {};
+
+
+function SomePromiseArray(values) {
+ this.constructor$(values);
+ this._howMany = 0;
+ this._unwrap = false;
+ this._initialized = false;
+}
+util.inherits(SomePromiseArray, PromiseArray);
+
+SomePromiseArray.prototype._init = function () {
+ if (!this._initialized) {
+ return;
+ }
+ if (this._howMany === 0) {
+ this._resolve([]);
+ return;
+ }
+ this._init$(undefined, -5);
+ var isArrayResolved = isArray(this._values);
+ if (!this._isResolved() &&
+ isArrayResolved &&
+ this._howMany > this._canPossiblyFulfill()) {
+ this._reject(this._getRangeError(this.length()));
+ }
+};
+
+SomePromiseArray.prototype.init = function () {
+ this._initialized = true;
+ this._init();
+};
+
+SomePromiseArray.prototype.setUnwrap = function () {
+ this._unwrap = true;
+};
+
+SomePromiseArray.prototype.howMany = function () {
+ return this._howMany;
+};
+
+SomePromiseArray.prototype.setHowMany = function (count) {
+ this._howMany = count;
+};
+
+SomePromiseArray.prototype._promiseFulfilled = function (value) {
+ this._addFulfilled(value);
+ if (this._fulfilled() === this.howMany()) {
+ this._values.length = this.howMany();
+ if (this.howMany() === 1 && this._unwrap) {
+ this._resolve(this._values[0]);
+ } else {
+ this._resolve(this._values);
+ }
+ return true;
+ }
+ return false;
+
+};
+SomePromiseArray.prototype._promiseRejected = function (reason) {
+ this._addRejected(reason);
+ return this._checkOutcome();
+};
+
+SomePromiseArray.prototype._promiseCancelled = function () {
+ if (this._values instanceof Promise || this._values == null) {
+ return this._cancel();
+ }
+ this._addRejected(CANCELLATION);
+ return this._checkOutcome();
+};
+
+SomePromiseArray.prototype._checkOutcome = function() {
+ if (this.howMany() > this._canPossiblyFulfill()) {
+ var e = new AggregateError();
+ for (var i = this.length(); i < this._values.length; ++i) {
+ if (this._values[i] !== CANCELLATION) {
+ e.push(this._values[i]);
+ }
+ }
+ if (e.length > 0) {
+ this._reject(e);
+ } else {
+ this._cancel();
+ }
+ return true;
+ }
+ return false;
+};
+
+SomePromiseArray.prototype._fulfilled = function () {
+ return this._totalResolved;
+};
+
+SomePromiseArray.prototype._rejected = function () {
+ return this._values.length - this.length();
+};
+
+SomePromiseArray.prototype._addRejected = function (reason) {
+ this._values.push(reason);
+};
+
+SomePromiseArray.prototype._addFulfilled = function (value) {
+ this._values[this._totalResolved++] = value;
+};
+
+SomePromiseArray.prototype._canPossiblyFulfill = function () {
+ return this.length() - this._rejected();
+};
+
+SomePromiseArray.prototype._getRangeError = function (count) {
+ var message = "Input array must contain at least " +
+ this._howMany + " items but contains only " + count + " items";
+ return new RangeError(message);
+};
+
+SomePromiseArray.prototype._resolveEmptyArray = function () {
+ this._reject(this._getRangeError(0));
+};
+
+function some(promises, howMany) {
+ if ((howMany | 0) !== howMany || howMany < 0) {
+ return apiRejection("expecting a positive integer\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(howMany);
+ ret.init();
+ return promise;
+}
+
+Promise.some = function (promises, howMany) {
+ return some(promises, howMany);
+};
+
+Promise.prototype.some = function (howMany) {
+ return some(this, howMany);
+};
+
+Promise._SomePromiseArray = SomePromiseArray;
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/synchronous_inspection.js b/Restaurant/node_modules/bluebird/js/release/synchronous_inspection.js
new file mode 100644
index 0000000..9c49d2e
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/synchronous_inspection.js
@@ -0,0 +1,103 @@
+"use strict";
+module.exports = function(Promise) {
+function PromiseInspection(promise) {
+ if (promise !== undefined) {
+ promise = promise._target();
+ this._bitField = promise._bitField;
+ this._settledValueField = promise._isFateSealed()
+ ? promise._settledValue() : undefined;
+ }
+ else {
+ this._bitField = 0;
+ this._settledValueField = undefined;
+ }
+}
+
+PromiseInspection.prototype._settledValue = function() {
+ return this._settledValueField;
+};
+
+var value = PromiseInspection.prototype.value = function () {
+ if (!this.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var reason = PromiseInspection.prototype.error =
+PromiseInspection.prototype.reason = function () {
+ if (!this.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var isFulfilled = PromiseInspection.prototype.isFulfilled = function() {
+ return (this._bitField & 33554432) !== 0;
+};
+
+var isRejected = PromiseInspection.prototype.isRejected = function () {
+ return (this._bitField & 16777216) !== 0;
+};
+
+var isPending = PromiseInspection.prototype.isPending = function () {
+ return (this._bitField & 50397184) === 0;
+};
+
+var isResolved = PromiseInspection.prototype.isResolved = function () {
+ return (this._bitField & 50331648) !== 0;
+};
+
+PromiseInspection.prototype.isCancelled = function() {
+ return (this._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.__isCancelled = function() {
+ return (this._bitField & 65536) === 65536;
+};
+
+Promise.prototype._isCancelled = function() {
+ return this._target().__isCancelled();
+};
+
+Promise.prototype.isCancelled = function() {
+ return (this._target()._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.isPending = function() {
+ return isPending.call(this._target());
+};
+
+Promise.prototype.isRejected = function() {
+ return isRejected.call(this._target());
+};
+
+Promise.prototype.isFulfilled = function() {
+ return isFulfilled.call(this._target());
+};
+
+Promise.prototype.isResolved = function() {
+ return isResolved.call(this._target());
+};
+
+Promise.prototype.value = function() {
+ return value.call(this._target());
+};
+
+Promise.prototype.reason = function() {
+ var target = this._target();
+ target._unsetRejectionIsUnhandled();
+ return reason.call(target);
+};
+
+Promise.prototype._value = function() {
+ return this._settledValue();
+};
+
+Promise.prototype._reason = function() {
+ this._unsetRejectionIsUnhandled();
+ return this._settledValue();
+};
+
+Promise.PromiseInspection = PromiseInspection;
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/thenables.js b/Restaurant/node_modules/bluebird/js/release/thenables.js
new file mode 100644
index 0000000..d6ab9aa
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/thenables.js
@@ -0,0 +1,86 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = require("./util");
+var errorObj = util.errorObj;
+var isObject = util.isObject;
+
+function tryConvertToPromise(obj, context) {
+ if (isObject(obj)) {
+ if (obj instanceof Promise) return obj;
+ var then = getThen(obj);
+ if (then === errorObj) {
+ if (context) context._pushContext();
+ var ret = Promise.reject(then.e);
+ if (context) context._popContext();
+ return ret;
+ } else if (typeof then === "function") {
+ if (isAnyBluebirdPromise(obj)) {
+ var ret = new Promise(INTERNAL);
+ obj._then(
+ ret._fulfill,
+ ret._reject,
+ undefined,
+ ret,
+ null
+ );
+ return ret;
+ }
+ return doThenable(obj, then, context);
+ }
+ }
+ return obj;
+}
+
+function doGetThen(obj) {
+ return obj.then;
+}
+
+function getThen(obj) {
+ try {
+ return doGetThen(obj);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+
+var hasProp = {}.hasOwnProperty;
+function isAnyBluebirdPromise(obj) {
+ try {
+ return hasProp.call(obj, "_promise0");
+ } catch (e) {
+ return false;
+ }
+}
+
+function doThenable(x, then, context) {
+ var promise = new Promise(INTERNAL);
+ var ret = promise;
+ if (context) context._pushContext();
+ promise._captureStackTrace();
+ if (context) context._popContext();
+ var synchronous = true;
+ var result = util.tryCatch(then).call(x, resolve, reject);
+ synchronous = false;
+
+ if (promise && result === errorObj) {
+ promise._rejectCallback(result.e, true, true);
+ promise = null;
+ }
+
+ function resolve(value) {
+ if (!promise) return;
+ promise._resolveCallback(value);
+ promise = null;
+ }
+
+ function reject(reason) {
+ if (!promise) return;
+ promise._rejectCallback(reason, synchronous, true);
+ promise = null;
+ }
+ return ret;
+}
+
+return tryConvertToPromise;
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/timers.js b/Restaurant/node_modules/bluebird/js/release/timers.js
new file mode 100644
index 0000000..cb8f1f4
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/timers.js
@@ -0,0 +1,93 @@
+"use strict";
+module.exports = function(Promise, INTERNAL, debug) {
+var util = require("./util");
+var TimeoutError = Promise.TimeoutError;
+
+function HandleWrapper(handle) {
+ this.handle = handle;
+}
+
+HandleWrapper.prototype._resultCancelled = function() {
+ clearTimeout(this.handle);
+};
+
+var afterValue = function(value) { return delay(+this).thenReturn(value); };
+var delay = Promise.delay = function (ms, value) {
+ var ret;
+ var handle;
+ if (value !== undefined) {
+ ret = Promise.resolve(value)
+ ._then(afterValue, null, null, ms, undefined);
+ if (debug.cancellation() && value instanceof Promise) {
+ ret._setOnCancel(value);
+ }
+ } else {
+ ret = new Promise(INTERNAL);
+ handle = setTimeout(function() { ret._fulfill(); }, +ms);
+ if (debug.cancellation()) {
+ ret._setOnCancel(new HandleWrapper(handle));
+ }
+ ret._captureStackTrace();
+ }
+ ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.prototype.delay = function (ms) {
+ return delay(ms, this);
+};
+
+var afterTimeout = function (promise, message, parent) {
+ var err;
+ if (typeof message !== "string") {
+ if (message instanceof Error) {
+ err = message;
+ } else {
+ err = new TimeoutError("operation timed out");
+ }
+ } else {
+ err = new TimeoutError(message);
+ }
+ util.markAsOriginatingFromRejection(err);
+ promise._attachExtraTrace(err);
+ promise._reject(err);
+
+ if (parent != null) {
+ parent.cancel();
+ }
+};
+
+function successClear(value) {
+ clearTimeout(this.handle);
+ return value;
+}
+
+function failureClear(reason) {
+ clearTimeout(this.handle);
+ throw reason;
+}
+
+Promise.prototype.timeout = function (ms, message) {
+ ms = +ms;
+ var ret, parent;
+
+ var handleWrapper = new HandleWrapper(setTimeout(function timeoutTimeout() {
+ if (ret.isPending()) {
+ afterTimeout(ret, message, parent);
+ }
+ }, ms));
+
+ if (debug.cancellation()) {
+ parent = this.then();
+ ret = parent._then(successClear, failureClear,
+ undefined, handleWrapper, undefined);
+ ret._setOnCancel(handleWrapper);
+ } else {
+ ret = this._then(successClear, failureClear,
+ undefined, handleWrapper, undefined);
+ }
+
+ return ret;
+};
+
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/using.js b/Restaurant/node_modules/bluebird/js/release/using.js
new file mode 100644
index 0000000..65de531
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/using.js
@@ -0,0 +1,226 @@
+"use strict";
+module.exports = function (Promise, apiRejection, tryConvertToPromise,
+ createContext, INTERNAL, debug) {
+ var util = require("./util");
+ var TypeError = require("./errors").TypeError;
+ var inherits = require("./util").inherits;
+ var errorObj = util.errorObj;
+ var tryCatch = util.tryCatch;
+ var NULL = {};
+
+ function thrower(e) {
+ setTimeout(function(){throw e;}, 0);
+ }
+
+ function castPreservingDisposable(thenable) {
+ var maybePromise = tryConvertToPromise(thenable);
+ if (maybePromise !== thenable &&
+ typeof thenable._isDisposable === "function" &&
+ typeof thenable._getDisposer === "function" &&
+ thenable._isDisposable()) {
+ maybePromise._setDisposable(thenable._getDisposer());
+ }
+ return maybePromise;
+ }
+ function dispose(resources, inspection) {
+ var i = 0;
+ var len = resources.length;
+ var ret = new Promise(INTERNAL);
+ function iterator() {
+ if (i >= len) return ret._fulfill();
+ var maybePromise = castPreservingDisposable(resources[i++]);
+ if (maybePromise instanceof Promise &&
+ maybePromise._isDisposable()) {
+ try {
+ maybePromise = tryConvertToPromise(
+ maybePromise._getDisposer().tryDispose(inspection),
+ resources.promise);
+ } catch (e) {
+ return thrower(e);
+ }
+ if (maybePromise instanceof Promise) {
+ return maybePromise._then(iterator, thrower,
+ null, null, null);
+ }
+ }
+ iterator();
+ }
+ iterator();
+ return ret;
+ }
+
+ function Disposer(data, promise, context) {
+ this._data = data;
+ this._promise = promise;
+ this._context = context;
+ }
+
+ Disposer.prototype.data = function () {
+ return this._data;
+ };
+
+ Disposer.prototype.promise = function () {
+ return this._promise;
+ };
+
+ Disposer.prototype.resource = function () {
+ if (this.promise().isFulfilled()) {
+ return this.promise().value();
+ }
+ return NULL;
+ };
+
+ Disposer.prototype.tryDispose = function(inspection) {
+ var resource = this.resource();
+ var context = this._context;
+ if (context !== undefined) context._pushContext();
+ var ret = resource !== NULL
+ ? this.doDispose(resource, inspection) : null;
+ if (context !== undefined) context._popContext();
+ this._promise._unsetDisposable();
+ this._data = null;
+ return ret;
+ };
+
+ Disposer.isDisposer = function (d) {
+ return (d != null &&
+ typeof d.resource === "function" &&
+ typeof d.tryDispose === "function");
+ };
+
+ function FunctionDisposer(fn, promise, context) {
+ this.constructor$(fn, promise, context);
+ }
+ inherits(FunctionDisposer, Disposer);
+
+ FunctionDisposer.prototype.doDispose = function (resource, inspection) {
+ var fn = this.data();
+ return fn.call(resource, resource, inspection);
+ };
+
+ function maybeUnwrapDisposer(value) {
+ if (Disposer.isDisposer(value)) {
+ this.resources[this.index]._setDisposable(value);
+ return value.promise();
+ }
+ return value;
+ }
+
+ function ResourceList(length) {
+ this.length = length;
+ this.promise = null;
+ this[length-1] = null;
+ }
+
+ ResourceList.prototype._resultCancelled = function() {
+ var len = this.length;
+ for (var i = 0; i < len; ++i) {
+ var item = this[i];
+ if (item instanceof Promise) {
+ item.cancel();
+ }
+ }
+ };
+
+ Promise.using = function () {
+ var len = arguments.length;
+ if (len < 2) return apiRejection(
+ "you must pass at least 2 arguments to Promise.using");
+ var fn = arguments[len - 1];
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var input;
+ var spreadArgs = true;
+ if (len === 2 && Array.isArray(arguments[0])) {
+ input = arguments[0];
+ len = input.length;
+ spreadArgs = false;
+ } else {
+ input = arguments;
+ len--;
+ }
+ var resources = new ResourceList(len);
+ for (var i = 0; i < len; ++i) {
+ var resource = input[i];
+ if (Disposer.isDisposer(resource)) {
+ var disposer = resource;
+ resource = resource.promise();
+ resource._setDisposable(disposer);
+ } else {
+ var maybePromise = tryConvertToPromise(resource);
+ if (maybePromise instanceof Promise) {
+ resource =
+ maybePromise._then(maybeUnwrapDisposer, null, null, {
+ resources: resources,
+ index: i
+ }, undefined);
+ }
+ }
+ resources[i] = resource;
+ }
+
+ var reflectedResources = new Array(resources.length);
+ for (var i = 0; i < reflectedResources.length; ++i) {
+ reflectedResources[i] = Promise.resolve(resources[i]).reflect();
+ }
+
+ var resultPromise = Promise.all(reflectedResources)
+ .then(function(inspections) {
+ for (var i = 0; i < inspections.length; ++i) {
+ var inspection = inspections[i];
+ if (inspection.isRejected()) {
+ errorObj.e = inspection.error();
+ return errorObj;
+ } else if (!inspection.isFulfilled()) {
+ resultPromise.cancel();
+ return;
+ }
+ inspections[i] = inspection.value();
+ }
+ promise._pushContext();
+
+ fn = tryCatch(fn);
+ var ret = spreadArgs
+ ? fn.apply(undefined, inspections) : fn(inspections);
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret, promiseCreated, "Promise.using", promise);
+ return ret;
+ });
+
+ var promise = resultPromise.lastly(function() {
+ var inspection = new Promise.PromiseInspection(resultPromise);
+ return dispose(resources, inspection);
+ });
+ resources.promise = promise;
+ promise._setOnCancel(resources);
+ return promise;
+ };
+
+ Promise.prototype._setDisposable = function (disposer) {
+ this._bitField = this._bitField | 131072;
+ this._disposer = disposer;
+ };
+
+ Promise.prototype._isDisposable = function () {
+ return (this._bitField & 131072) > 0;
+ };
+
+ Promise.prototype._getDisposer = function () {
+ return this._disposer;
+ };
+
+ Promise.prototype._unsetDisposable = function () {
+ this._bitField = this._bitField & (~131072);
+ this._disposer = undefined;
+ };
+
+ Promise.prototype.disposer = function (fn) {
+ if (typeof fn === "function") {
+ return new FunctionDisposer(fn, this, createContext());
+ }
+ throw new TypeError();
+ };
+
+};
diff --git a/Restaurant/node_modules/bluebird/js/release/util.js b/Restaurant/node_modules/bluebird/js/release/util.js
new file mode 100644
index 0000000..7ac0e2f
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/js/release/util.js
@@ -0,0 +1,380 @@
+"use strict";
+var es5 = require("./es5");
+var canEvaluate = typeof navigator == "undefined";
+
+var errorObj = {e: {}};
+var tryCatchTarget;
+var globalObject = typeof self !== "undefined" ? self :
+ typeof window !== "undefined" ? window :
+ typeof global !== "undefined" ? global :
+ this !== undefined ? this : null;
+
+function tryCatcher() {
+ try {
+ var target = tryCatchTarget;
+ tryCatchTarget = null;
+ return target.apply(this, arguments);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+function tryCatch(fn) {
+ tryCatchTarget = fn;
+ return tryCatcher;
+}
+
+var inherits = function(Child, Parent) {
+ var hasProp = {}.hasOwnProperty;
+
+ function T() {
+ this.constructor = Child;
+ this.constructor$ = Parent;
+ for (var propertyName in Parent.prototype) {
+ if (hasProp.call(Parent.prototype, propertyName) &&
+ propertyName.charAt(propertyName.length-1) !== "$"
+ ) {
+ this[propertyName + "$"] = Parent.prototype[propertyName];
+ }
+ }
+ }
+ T.prototype = Parent.prototype;
+ Child.prototype = new T();
+ return Child.prototype;
+};
+
+
+function isPrimitive(val) {
+ return val == null || val === true || val === false ||
+ typeof val === "string" || typeof val === "number";
+
+}
+
+function isObject(value) {
+ return typeof value === "function" ||
+ typeof value === "object" && value !== null;
+}
+
+function maybeWrapAsError(maybeError) {
+ if (!isPrimitive(maybeError)) return maybeError;
+
+ return new Error(safeToString(maybeError));
+}
+
+function withAppended(target, appendee) {
+ var len = target.length;
+ var ret = new Array(len + 1);
+ var i;
+ for (i = 0; i < len; ++i) {
+ ret[i] = target[i];
+ }
+ ret[i] = appendee;
+ return ret;
+}
+
+function getDataPropertyOrDefault(obj, key, defaultValue) {
+ if (es5.isES5) {
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+
+ if (desc != null) {
+ return desc.get == null && desc.set == null
+ ? desc.value
+ : defaultValue;
+ }
+ } else {
+ return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined;
+ }
+}
+
+function notEnumerableProp(obj, name, value) {
+ if (isPrimitive(obj)) return obj;
+ var descriptor = {
+ value: value,
+ configurable: true,
+ enumerable: false,
+ writable: true
+ };
+ es5.defineProperty(obj, name, descriptor);
+ return obj;
+}
+
+function thrower(r) {
+ throw r;
+}
+
+var inheritedDataKeys = (function() {
+ var excludedPrototypes = [
+ Array.prototype,
+ Object.prototype,
+ Function.prototype
+ ];
+
+ var isExcludedProto = function(val) {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (excludedPrototypes[i] === val) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+ if (es5.isES5) {
+ var getKeys = Object.getOwnPropertyNames;
+ return function(obj) {
+ var ret = [];
+ var visitedKeys = Object.create(null);
+ while (obj != null && !isExcludedProto(obj)) {
+ var keys;
+ try {
+ keys = getKeys(obj);
+ } catch (e) {
+ return ret;
+ }
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (visitedKeys[key]) continue;
+ visitedKeys[key] = true;
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null && desc.get == null && desc.set == null) {
+ ret.push(key);
+ }
+ }
+ obj = es5.getPrototypeOf(obj);
+ }
+ return ret;
+ };
+ } else {
+ var hasProp = {}.hasOwnProperty;
+ return function(obj) {
+ if (isExcludedProto(obj)) return [];
+ var ret = [];
+
+ /*jshint forin:false */
+ enumeration: for (var key in obj) {
+ if (hasProp.call(obj, key)) {
+ ret.push(key);
+ } else {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (hasProp.call(excludedPrototypes[i], key)) {
+ continue enumeration;
+ }
+ }
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+ }
+
+})();
+
+var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/;
+function isClass(fn) {
+ try {
+ if (typeof fn === "function") {
+ var keys = es5.names(fn.prototype);
+
+ var hasMethods = es5.isES5 && keys.length > 1;
+ var hasMethodsOtherThanConstructor = keys.length > 0 &&
+ !(keys.length === 1 && keys[0] === "constructor");
+ var hasThisAssignmentAndStaticMethods =
+ thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0;
+
+ if (hasMethods || hasMethodsOtherThanConstructor ||
+ hasThisAssignmentAndStaticMethods) {
+ return true;
+ }
+ }
+ return false;
+ } catch (e) {
+ return false;
+ }
+}
+
+function toFastProperties(obj) {
+ /*jshint -W027,-W055,-W031*/
+ function FakeConstructor() {}
+ FakeConstructor.prototype = obj;
+ var l = 8;
+ while (l--) new FakeConstructor();
+ return obj;
+ eval(obj);
+}
+
+var rident = /^[a-z$_][a-z$_0-9]*$/i;
+function isIdentifier(str) {
+ return rident.test(str);
+}
+
+function filledRange(count, prefix, suffix) {
+ var ret = new Array(count);
+ for(var i = 0; i < count; ++i) {
+ ret[i] = prefix + i + suffix;
+ }
+ return ret;
+}
+
+function safeToString(obj) {
+ try {
+ return obj + "";
+ } catch (e) {
+ return "[no string representation]";
+ }
+}
+
+function isError(obj) {
+ return obj instanceof Error ||
+ (obj !== null &&
+ typeof obj === "object" &&
+ typeof obj.message === "string" &&
+ typeof obj.name === "string");
+}
+
+function markAsOriginatingFromRejection(e) {
+ try {
+ notEnumerableProp(e, "isOperational", true);
+ }
+ catch(ignore) {}
+}
+
+function originatesFromRejection(e) {
+ if (e == null) return false;
+ return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) ||
+ e["isOperational"] === true);
+}
+
+function canAttachTrace(obj) {
+ return isError(obj) && es5.propertyIsWritable(obj, "stack");
+}
+
+var ensureErrorObject = (function() {
+ if (!("stack" in new Error())) {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ try {throw new Error(safeToString(value));}
+ catch(err) {return err;}
+ };
+ } else {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ return new Error(safeToString(value));
+ };
+ }
+})();
+
+function classString(obj) {
+ return {}.toString.call(obj);
+}
+
+function copyDescriptors(from, to, filter) {
+ var keys = es5.names(from);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (filter(key)) {
+ try {
+ es5.defineProperty(to, key, es5.getDescriptor(from, key));
+ } catch (ignore) {}
+ }
+ }
+}
+
+var asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ }
+ return null;
+};
+
+if (typeof Symbol !== "undefined" && Symbol.iterator) {
+ var ArrayFrom = typeof Array.from === "function" ? function(v) {
+ return Array.from(v);
+ } : function(v) {
+ var ret = [];
+ var it = v[Symbol.iterator]();
+ var itResult;
+ while (!((itResult = it.next()).done)) {
+ ret.push(itResult.value);
+ }
+ return ret;
+ };
+
+ asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ } else if (v != null && typeof v[Symbol.iterator] === "function") {
+ return ArrayFrom(v);
+ }
+ return null;
+ };
+}
+
+var isNode = typeof process !== "undefined" &&
+ classString(process).toLowerCase() === "[object process]";
+
+var hasEnvVariables = typeof process !== "undefined" &&
+ typeof process.env !== "undefined";
+
+function env(key) {
+ return hasEnvVariables ? process.env[key] : undefined;
+}
+
+function getNativePromise() {
+ if (typeof Promise === "function") {
+ try {
+ var promise = new Promise(function(){});
+ if ({}.toString.call(promise) === "[object Promise]") {
+ return Promise;
+ }
+ } catch (e) {}
+ }
+}
+
+function domainBind(self, cb) {
+ return self.bind(cb);
+}
+
+var ret = {
+ isClass: isClass,
+ isIdentifier: isIdentifier,
+ inheritedDataKeys: inheritedDataKeys,
+ getDataPropertyOrDefault: getDataPropertyOrDefault,
+ thrower: thrower,
+ isArray: es5.isArray,
+ asArray: asArray,
+ notEnumerableProp: notEnumerableProp,
+ isPrimitive: isPrimitive,
+ isObject: isObject,
+ isError: isError,
+ canEvaluate: canEvaluate,
+ errorObj: errorObj,
+ tryCatch: tryCatch,
+ inherits: inherits,
+ withAppended: withAppended,
+ maybeWrapAsError: maybeWrapAsError,
+ toFastProperties: toFastProperties,
+ filledRange: filledRange,
+ toString: safeToString,
+ canAttachTrace: canAttachTrace,
+ ensureErrorObject: ensureErrorObject,
+ originatesFromRejection: originatesFromRejection,
+ markAsOriginatingFromRejection: markAsOriginatingFromRejection,
+ classString: classString,
+ copyDescriptors: copyDescriptors,
+ hasDevTools: typeof chrome !== "undefined" && chrome &&
+ typeof chrome.loadTimes === "function",
+ isNode: isNode,
+ hasEnvVariables: hasEnvVariables,
+ env: env,
+ global: globalObject,
+ getNativePromise: getNativePromise,
+ domainBind: domainBind
+};
+ret.isRecentNode = ret.isNode && (function() {
+ var version = process.versions.node.split(".").map(Number);
+ return (version[0] === 0 && version[1] > 10) || (version[0] > 0);
+})();
+
+if (ret.isNode) ret.toFastProperties(process);
+
+try {throw new Error(); } catch (e) {ret.lastLineError = e;}
+module.exports = ret;
diff --git a/Restaurant/node_modules/bluebird/package.json b/Restaurant/node_modules/bluebird/package.json
new file mode 100644
index 0000000..a09b093
--- /dev/null
+++ b/Restaurant/node_modules/bluebird/package.json
@@ -0,0 +1,101 @@
+{
+ "_from": "bluebird@3.5.1",
+ "_id": "bluebird@3.5.1",
+ "_inBundle": false,
+ "_integrity": "sha512-MKiLiV+I1AA596t9w1sQJ8jkiSr5+ZKi0WKrYGUn6d1Fx+Ij4tIj+m2WMQSGczs5jZVxV339chE8iwk6F64wjA==",
+ "_location": "/bluebird",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "bluebird@3.5.1",
+ "name": "bluebird",
+ "escapedName": "bluebird",
+ "rawSpec": "3.5.1",
+ "saveSpec": null,
+ "fetchSpec": "3.5.1"
+ },
+ "_requiredBy": [
+ "/mquery"
+ ],
+ "_resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.5.1.tgz",
+ "_shasum": "d9551f9de98f1fcda1e683d17ee91a0602ee2eb9",
+ "_spec": "bluebird@3.5.1",
+ "_where": "F:\\Restaurant\\node_modules\\mquery",
+ "author": {
+ "name": "Petka Antonov",
+ "email": "petka_antonov@hotmail.com",
+ "url": "http://github.com/petkaantonov/"
+ },
+ "browser": "./js/browser/bluebird.js",
+ "bugs": {
+ "url": "http://github.com/petkaantonov/bluebird/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Full featured Promises/A+ implementation with exceptionally good performance",
+ "devDependencies": {
+ "acorn": "~0.6.0",
+ "baconjs": "^0.7.43",
+ "bluebird": "^2.9.2",
+ "body-parser": "^1.10.2",
+ "browserify": "^8.1.1",
+ "cli-table": "~0.3.1",
+ "co": "^4.2.0",
+ "cross-spawn": "^0.2.3",
+ "glob": "^4.3.2",
+ "grunt-saucelabs": "~8.4.1",
+ "highland": "^2.3.0",
+ "istanbul": "^0.3.5",
+ "jshint": "^2.6.0",
+ "jshint-stylish": "~0.2.0",
+ "kefir": "^2.4.1",
+ "mkdirp": "~0.5.0",
+ "mocha": "~2.1",
+ "open": "~0.0.5",
+ "optimist": "~0.6.1",
+ "rimraf": "~2.2.6",
+ "rx": "^2.3.25",
+ "serve-static": "^1.7.1",
+ "sinon": "~1.7.3",
+ "uglify-js": "~2.4.16"
+ },
+ "files": [
+ "js/browser",
+ "js/release",
+ "LICENSE"
+ ],
+ "homepage": "https://github.com/petkaantonov/bluebird",
+ "keywords": [
+ "promise",
+ "performance",
+ "promises",
+ "promises-a",
+ "promises-aplus",
+ "async",
+ "await",
+ "deferred",
+ "deferreds",
+ "future",
+ "flow control",
+ "dsl",
+ "fluent interface"
+ ],
+ "license": "MIT",
+ "main": "./js/release/bluebird.js",
+ "name": "bluebird",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/petkaantonov/bluebird.git"
+ },
+ "scripts": {
+ "generate-browser-core": "node tools/build.js --features=core --no-debug --release --zalgo --browser --minify && mv js/browser/bluebird.js js/browser/bluebird.core.js && mv js/browser/bluebird.min.js js/browser/bluebird.core.min.js",
+ "generate-browser-full": "node tools/build.js --no-clean --no-debug --release --browser --minify",
+ "istanbul": "istanbul",
+ "lint": "node scripts/jshint.js",
+ "prepublish": "npm run generate-browser-core && npm run generate-browser-full",
+ "test": "node tools/test.js"
+ },
+ "version": "3.5.1",
+ "webpack": "./js/release/bluebird.js"
+}
diff --git a/Restaurant/node_modules/body-parser/HISTORY.md b/Restaurant/node_modules/body-parser/HISTORY.md
new file mode 100644
index 0000000..a1d3fbf
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/HISTORY.md
@@ -0,0 +1,609 @@
+1.19.0 / 2019-04-25
+===================
+
+ * deps: bytes@3.1.0
+ - Add petabyte (`pb`) support
+ * deps: http-errors@1.7.2
+ - Set constructor name when possible
+ - deps: setprototypeof@1.1.1
+ - deps: statuses@'>= 1.5.0 < 2'
+ * deps: iconv-lite@0.4.24
+ - Added encoding MIK
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: raw-body@2.4.0
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ * deps: type-is@~1.6.17
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+1.18.3 / 2018-05-14
+===================
+
+ * Fix stack trace for strict json parse error
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: http-errors@~1.6.3
+ - deps: depd@~1.1.2
+ - deps: setprototypeof@1.1.0
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.23
+ - Fix loading encoding with year appended
+ - Fix deprecation warnings on Node.js 10+
+ * deps: qs@6.5.2
+ * deps: raw-body@2.3.3
+ - deps: http-errors@1.6.3
+ - deps: iconv-lite@0.4.23
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+1.18.2 / 2017-09-22
+===================
+
+ * deps: debug@2.6.9
+ * perf: remove argument reassignment
+
+1.18.1 / 2017-09-12
+===================
+
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: iconv-lite@0.4.19
+ - Fix ISO-8859-1 regression
+ - Update Windows-1255
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: raw-body@2.3.2
+ - deps: iconv-lite@0.4.19
+
+1.18.0 / 2017-09-08
+===================
+
+ * Fix JSON strict violation error to match native parse error
+ * Include the `body` property on verify errors
+ * Include the `type` property on all generated errors
+ * Use `http-errors` to set status code on errors
+ * deps: bytes@3.0.0
+ * deps: debug@2.6.8
+ * deps: depd@~1.1.1
+ - Remove unnecessary `Buffer` loading
+ * deps: http-errors@~1.6.2
+ - deps: depd@1.1.1
+ * deps: iconv-lite@0.4.18
+ - Add support for React Native
+ - Add a warning if not loaded as utf-8
+ - Fix CESU-8 decoding in Node.js 8
+ - Improve speed of ISO-8859-1 encoding
+ * deps: qs@6.5.0
+ * deps: raw-body@2.3.1
+ - Use `http-errors` for standard emitted errors
+ - deps: bytes@3.0.0
+ - deps: iconv-lite@0.4.18
+ - perf: skip buffer decoding on overage chunk
+ * perf: prevent internal `throw` when missing charset
+
+1.17.2 / 2017-05-17
+===================
+
+ * deps: debug@2.6.7
+ - Fix `DEBUG_MAX_ARRAY_LENGTH`
+ - deps: ms@2.0.0
+ * deps: type-is@~1.6.15
+ - deps: mime-types@~2.1.15
+
+1.17.1 / 2017-03-06
+===================
+
+ * deps: qs@6.4.0
+ - Fix regression parsing keys starting with `[`
+
+1.17.0 / 2017-03-01
+===================
+
+ * deps: http-errors@~1.6.1
+ - Make `message` property enumerable for `HttpError`s
+ - deps: setprototypeof@1.0.3
+ * deps: qs@6.3.1
+ - Fix compacting nested arrays
+
+1.16.1 / 2017-02-10
+===================
+
+ * deps: debug@2.6.1
+ - Fix deprecation messages in WebStorm and other editors
+ - Undeprecate `DEBUG_FD` set to `1` or `2`
+
+1.16.0 / 2017-01-17
+===================
+
+ * deps: debug@2.6.0
+ - Allow colors in workers
+ - Deprecated `DEBUG_FD` environment variable
+ - Fix error when running under React Native
+ - Use same color for same namespace
+ - deps: ms@0.7.2
+ * deps: http-errors@~1.5.1
+ - deps: inherits@2.0.3
+ - deps: setprototypeof@1.0.2
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.15
+ - Added encoding MS-31J
+ - Added encoding MS-932
+ - Added encoding MS-936
+ - Added encoding MS-949
+ - Added encoding MS-950
+ - Fix GBK/GB18030 handling of Euro character
+ * deps: qs@6.2.1
+ - Fix array parsing from skipping empty values
+ * deps: raw-body@~2.2.0
+ - deps: iconv-lite@0.4.15
+ * deps: type-is@~1.6.14
+ - deps: mime-types@~2.1.13
+
+1.15.2 / 2016-06-19
+===================
+
+ * deps: bytes@2.4.0
+ * deps: content-type@~1.0.2
+ - perf: enable strict mode
+ * deps: http-errors@~1.5.0
+ - Use `setprototypeof` module to replace `__proto__` setting
+ - deps: statuses@'>= 1.3.0 < 2'
+ - perf: enable strict mode
+ * deps: qs@6.2.0
+ * deps: raw-body@~2.1.7
+ - deps: bytes@2.4.0
+ - perf: remove double-cleanup on happy path
+ * deps: type-is@~1.6.13
+ - deps: mime-types@~2.1.11
+
+1.15.1 / 2016-05-05
+===================
+
+ * deps: bytes@2.3.0
+ - Drop partial bytes on all parsed units
+ - Fix parsing byte string that looks like hex
+ * deps: raw-body@~2.1.6
+ - deps: bytes@2.3.0
+ * deps: type-is@~1.6.12
+ - deps: mime-types@~2.1.10
+
+1.15.0 / 2016-02-10
+===================
+
+ * deps: http-errors@~1.4.0
+ - Add `HttpError` export, for `err instanceof createError.HttpError`
+ - deps: inherits@2.0.1
+ - deps: statuses@'>= 1.2.1 < 2'
+ * deps: qs@6.1.0
+ * deps: type-is@~1.6.11
+ - deps: mime-types@~2.1.9
+
+1.14.2 / 2015-12-16
+===================
+
+ * deps: bytes@2.2.0
+ * deps: iconv-lite@0.4.13
+ * deps: qs@5.2.0
+ * deps: raw-body@~2.1.5
+ - deps: bytes@2.2.0
+ - deps: iconv-lite@0.4.13
+ * deps: type-is@~1.6.10
+ - deps: mime-types@~2.1.8
+
+1.14.1 / 2015-09-27
+===================
+
+ * Fix issue where invalid charset results in 400 when `verify` used
+ * deps: iconv-lite@0.4.12
+ - Fix CESU-8 decoding in Node.js 4.x
+ * deps: raw-body@~2.1.4
+ - Fix masking critical errors from `iconv-lite`
+ - deps: iconv-lite@0.4.12
+ * deps: type-is@~1.6.9
+ - deps: mime-types@~2.1.7
+
+1.14.0 / 2015-09-16
+===================
+
+ * Fix JSON strict parse error to match syntax errors
+ * Provide static `require` analysis in `urlencoded` parser
+ * deps: depd@~1.1.0
+ - Support web browser loading
+ * deps: qs@5.1.0
+ * deps: raw-body@~2.1.3
+ - Fix sync callback when attaching data listener causes sync read
+ * deps: type-is@~1.6.8
+ - Fix type error when given invalid type to match against
+ - deps: mime-types@~2.1.6
+
+1.13.3 / 2015-07-31
+===================
+
+ * deps: type-is@~1.6.6
+ - deps: mime-types@~2.1.4
+
+1.13.2 / 2015-07-05
+===================
+
+ * deps: iconv-lite@0.4.11
+ * deps: qs@4.0.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix user-visible incompatibilities from 3.1.0
+ - Fix various parsing edge cases
+ * deps: raw-body@~2.1.2
+ - Fix error stack traces to skip `makeError`
+ - deps: iconv-lite@0.4.11
+ * deps: type-is@~1.6.4
+ - deps: mime-types@~2.1.2
+ - perf: enable strict mode
+ - perf: remove argument reassignment
+
+1.13.1 / 2015-06-16
+===================
+
+ * deps: qs@2.4.2
+ - Downgraded from 3.1.0 because of user-visible incompatibilities
+
+1.13.0 / 2015-06-14
+===================
+
+ * Add `statusCode` property on `Error`s, in addition to `status`
+ * Change `type` default to `application/json` for JSON parser
+ * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser
+ * Provide static `require` analysis
+ * Use the `http-errors` module to generate errors
+ * deps: bytes@2.1.0
+ - Slight optimizations
+ * deps: iconv-lite@0.4.10
+ - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails
+ - Leading BOM is now removed when decoding
+ * deps: on-finished@~2.3.0
+ - Add defined behavior for HTTP `CONNECT` requests
+ - Add defined behavior for HTTP `Upgrade` requests
+ - deps: ee-first@1.1.1
+ * deps: qs@3.1.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix various parsing edge cases
+ - Parsed object now has `null` prototype
+ * deps: raw-body@~2.1.1
+ - Use `unpipe` module for unpiping requests
+ - deps: iconv-lite@0.4.10
+ * deps: type-is@~1.6.3
+ - deps: mime-types@~2.1.1
+ - perf: reduce try block size
+ - perf: remove bitwise operations
+ * perf: enable strict mode
+ * perf: remove argument reassignment
+ * perf: remove delete call
+
+1.12.4 / 2015-05-10
+===================
+
+ * deps: debug@~2.2.0
+ * deps: qs@2.4.2
+ - Fix allowing parameters like `constructor`
+ * deps: on-finished@~2.2.1
+ * deps: raw-body@~2.0.1
+ - Fix a false-positive when unpiping in Node.js 0.8
+ - deps: bytes@2.0.1
+ * deps: type-is@~1.6.2
+ - deps: mime-types@~2.0.11
+
+1.12.3 / 2015-04-15
+===================
+
+ * Slight efficiency improvement when not debugging
+ * deps: depd@~1.0.1
+ * deps: iconv-lite@0.4.8
+ - Add encoding alias UNICODE-1-1-UTF-7
+ * deps: raw-body@1.3.4
+ - Fix hanging callback if request aborts during read
+ - deps: iconv-lite@0.4.8
+
+1.12.2 / 2015-03-16
+===================
+
+ * deps: qs@2.4.1
+ - Fix error when parameter `hasOwnProperty` is present
+
+1.12.1 / 2015-03-15
+===================
+
+ * deps: debug@~2.1.3
+ - Fix high intensity foreground color for bold
+ - deps: ms@0.7.0
+ * deps: type-is@~1.6.1
+ - deps: mime-types@~2.0.10
+
+1.12.0 / 2015-02-13
+===================
+
+ * add `debug` messages
+ * accept a function for the `type` option
+ * use `content-type` to parse `Content-Type` headers
+ * deps: iconv-lite@0.4.7
+ - Gracefully support enumerables on `Object.prototype`
+ * deps: raw-body@1.3.3
+ - deps: iconv-lite@0.4.7
+ * deps: type-is@~1.6.0
+ - fix argument reassignment
+ - fix false-positives in `hasBody` `Transfer-Encoding` check
+ - support wildcard for both type and subtype (`*/*`)
+ - deps: mime-types@~2.0.9
+
+1.11.0 / 2015-01-30
+===================
+
+ * make internal `extended: true` depth limit infinity
+ * deps: type-is@~1.5.6
+ - deps: mime-types@~2.0.8
+
+1.10.2 / 2015-01-20
+===================
+
+ * deps: iconv-lite@0.4.6
+ - Fix rare aliases of single-byte encodings
+ * deps: raw-body@1.3.2
+ - deps: iconv-lite@0.4.6
+
+1.10.1 / 2015-01-01
+===================
+
+ * deps: on-finished@~2.2.0
+ * deps: type-is@~1.5.5
+ - deps: mime-types@~2.0.7
+
+1.10.0 / 2014-12-02
+===================
+
+ * make internal `extended: true` array limit dynamic
+
+1.9.3 / 2014-11-21
+==================
+
+ * deps: iconv-lite@0.4.5
+ - Fix Windows-31J and X-SJIS encoding support
+ * deps: qs@2.3.3
+ - Fix `arrayLimit` behavior
+ * deps: raw-body@1.3.1
+ - deps: iconv-lite@0.4.5
+ * deps: type-is@~1.5.3
+ - deps: mime-types@~2.0.3
+
+1.9.2 / 2014-10-27
+==================
+
+ * deps: qs@2.3.2
+ - Fix parsing of mixed objects and values
+
+1.9.1 / 2014-10-22
+==================
+
+ * deps: on-finished@~2.1.1
+ - Fix handling of pipelined requests
+ * deps: qs@2.3.0
+ - Fix parsing of mixed implicit and explicit arrays
+ * deps: type-is@~1.5.2
+ - deps: mime-types@~2.0.2
+
+1.9.0 / 2014-09-24
+==================
+
+ * include the charset in "unsupported charset" error message
+ * include the encoding in "unsupported content encoding" error message
+ * deps: depd@~1.0.0
+
+1.8.4 / 2014-09-23
+==================
+
+ * fix content encoding to be case-insensitive
+
+1.8.3 / 2014-09-19
+==================
+
+ * deps: qs@2.2.4
+ - Fix issue with object keys starting with numbers truncated
+
+1.8.2 / 2014-09-15
+==================
+
+ * deps: depd@0.4.5
+
+1.8.1 / 2014-09-07
+==================
+
+ * deps: media-typer@0.3.0
+ * deps: type-is@~1.5.1
+
+1.8.0 / 2014-09-05
+==================
+
+ * make empty-body-handling consistent between chunked requests
+ - empty `json` produces `{}`
+ - empty `raw` produces `new Buffer(0)`
+ - empty `text` produces `''`
+ - empty `urlencoded` produces `{}`
+ * deps: qs@2.2.3
+ - Fix issue where first empty value in array is discarded
+ * deps: type-is@~1.5.0
+ - fix `hasbody` to be true for `content-length: 0`
+
+1.7.0 / 2014-09-01
+==================
+
+ * add `parameterLimit` option to `urlencoded` parser
+ * change `urlencoded` extended array limit to 100
+ * respond with 413 when over `parameterLimit` in `urlencoded`
+
+1.6.7 / 2014-08-29
+==================
+
+ * deps: qs@2.2.2
+ - Remove unnecessary cloning
+
+1.6.6 / 2014-08-27
+==================
+
+ * deps: qs@2.2.0
+ - Array parsing fix
+ - Performance improvements
+
+1.6.5 / 2014-08-16
+==================
+
+ * deps: on-finished@2.1.0
+
+1.6.4 / 2014-08-14
+==================
+
+ * deps: qs@1.2.2
+
+1.6.3 / 2014-08-10
+==================
+
+ * deps: qs@1.2.1
+
+1.6.2 / 2014-08-07
+==================
+
+ * deps: qs@1.2.0
+ - Fix parsing array of objects
+
+1.6.1 / 2014-08-06
+==================
+
+ * deps: qs@1.1.0
+ - Accept urlencoded square brackets
+ - Accept empty values in implicit array notation
+
+1.6.0 / 2014-08-05
+==================
+
+ * deps: qs@1.0.2
+ - Complete rewrite
+ - Limits array length to 20
+ - Limits object depth to 5
+ - Limits parameters to 1,000
+
+1.5.2 / 2014-07-27
+==================
+
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+
+1.5.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+
+1.5.0 / 2014-07-20
+==================
+
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+ * deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ * deps: raw-body@1.3.0
+ - deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ - Fix `Cannot switch to old mode now` error on Node.js 0.10+
+ * deps: type-is@~1.3.2
+
+1.4.3 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.1
+ - fix global variable leak
+
+1.4.2 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.0
+ - improve type parsing
+
+1.4.1 / 2014-06-19
+==================
+
+ * fix urlencoded extended deprecation message
+
+1.4.0 / 2014-06-19
+==================
+
+ * add `text` parser
+ * add `raw` parser
+ * check accepted charset in content-type (accepts utf-8)
+ * check accepted encoding in content-encoding (accepts identity)
+ * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed
+ * deprecate `urlencoded()` without provided `extended` option
+ * lazy-load urlencoded parsers
+ * parsers split into files for reduced mem usage
+ * support gzip and deflate bodies
+ - set `inflate: false` to turn off
+ * deps: raw-body@1.2.2
+ - Support all encodings from `iconv-lite`
+
+1.3.1 / 2014-06-11
+==================
+
+ * deps: type-is@1.2.1
+ - Switch dependency from mime to mime-types@1.0.0
+
+1.3.0 / 2014-05-31
+==================
+
+ * add `extended` option to urlencoded parser
+
+1.2.2 / 2014-05-27
+==================
+
+ * deps: raw-body@1.1.6
+ - assert stream encoding on node.js 0.8
+ - assert stream encoding on node.js < 0.10.6
+ - deps: bytes@1
+
+1.2.1 / 2014-05-26
+==================
+
+ * invoke `next(err)` after request fully read
+ - prevents hung responses and socket hang ups
+
+1.2.0 / 2014-05-11
+==================
+
+ * add `verify` option
+ * deps: type-is@1.2.0
+ - support suffix matching
+
+1.1.2 / 2014-05-11
+==================
+
+ * improve json parser speed
+
+1.1.1 / 2014-05-11
+==================
+
+ * fix repeated limit parsing with every request
+
+1.1.0 / 2014-05-10
+==================
+
+ * add `type` option
+ * deps: pin for safety and consistency
+
+1.0.2 / 2014-04-14
+==================
+
+ * use `type-is` module
+
+1.0.1 / 2014-03-20
+==================
+
+ * lower default limits to 100kb
diff --git a/Restaurant/node_modules/body-parser/LICENSE b/Restaurant/node_modules/body-parser/LICENSE
new file mode 100644
index 0000000..386b7b6
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2014-2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/Restaurant/node_modules/body-parser/README.md b/Restaurant/node_modules/body-parser/README.md
new file mode 100644
index 0000000..aba6297
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/README.md
@@ -0,0 +1,443 @@
+# body-parser
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Node.js body parsing middleware.
+
+Parse incoming request bodies in a middleware before your handlers, available
+under the `req.body` property.
+
+**Note** As `req.body`'s shape is based on user-controlled input, all
+properties and values in this object are untrusted and should be validated
+before trusting. For example, `req.body.foo.toString()` may fail in multiple
+ways, for example the `foo` property may not be there or may not be a string,
+and `toString` may not be a function and instead a string or other user input.
+
+[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/).
+
+_This does not handle multipart bodies_, due to their complex and typically
+large nature. For multipart bodies, you may be interested in the following
+modules:
+
+ * [busboy](https://www.npmjs.org/package/busboy#readme) and
+ [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme)
+ * [multiparty](https://www.npmjs.org/package/multiparty#readme) and
+ [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme)
+ * [formidable](https://www.npmjs.org/package/formidable#readme)
+ * [multer](https://www.npmjs.org/package/multer#readme)
+
+This module provides the following parsers:
+
+ * [JSON body parser](#bodyparserjsonoptions)
+ * [Raw body parser](#bodyparserrawoptions)
+ * [Text body parser](#bodyparsertextoptions)
+ * [URL-encoded form body parser](#bodyparserurlencodedoptions)
+
+Other body parsers you might be interested in:
+
+- [body](https://www.npmjs.org/package/body#readme)
+- [co-body](https://www.npmjs.org/package/co-body#readme)
+
+## Installation
+
+```sh
+$ npm install body-parser
+```
+
+## API
+
+
+
+```js
+var bodyParser = require('body-parser')
+```
+
+The `bodyParser` object exposes various factories to create middlewares. All
+middlewares will populate the `req.body` property with the parsed body when
+the `Content-Type` request header matches the `type` option, or an empty
+object (`{}`) if there was no body to parse, the `Content-Type` was not matched,
+or an error occurred.
+
+The various errors returned by this module are described in the
+[errors section](#errors).
+
+### bodyParser.json([options])
+
+Returns middleware that only parses `json` and only looks at requests where
+the `Content-Type` header matches the `type` option. This parser accepts any
+Unicode encoding of the body and supports automatic inflation of `gzip` and
+`deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`).
+
+#### Options
+
+The `json` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### reviver
+
+The `reviver` option is passed directly to `JSON.parse` as the second
+argument. You can find more information on this argument
+[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter).
+
+##### strict
+
+When set to `true`, will only accept arrays and objects; when `false` will
+accept anything `JSON.parse` accepts. Defaults to `true`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not a
+function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `json`), a mime type (like `application/json`), or
+a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a truthy
+value. Defaults to `application/json`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.raw([options])
+
+Returns middleware that parses all bodies as a `Buffer` and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a `Buffer` object
+of the body.
+
+#### Options
+
+The `raw` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function.
+If not a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this
+can be an extension name (like `bin`), a mime type (like
+`application/octet-stream`), or a mime type with a wildcard (like `*/*` or
+`application/*`). If a function, the `type` option is called as `fn(req)`
+and the request is parsed if it returns a truthy value. Defaults to
+`application/octet-stream`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.text([options])
+
+Returns middleware that parses all bodies as a string and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` string containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a string of the
+body.
+
+#### Options
+
+The `text` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### defaultCharset
+
+Specify the default character set for the text content if the charset is not
+specified in the `Content-Type` header of the request. Defaults to `utf-8`.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `txt`), a mime type (like `text/plain`), or a mime
+type with a wildcard (like `*/*` or `text/*`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a
+truthy value. Defaults to `text/plain`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.urlencoded([options])
+
+Returns middleware that only parses `urlencoded` bodies and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser accepts only UTF-8 encoding of the body and supports automatic
+inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This object will contain
+key-value pairs, where the value can be a string or array (when `extended` is
+`false`), or any type (when `extended` is `true`).
+
+#### Options
+
+The `urlencoded` function takes an optional `options` object that may contain
+any of the following keys:
+
+##### extended
+
+The `extended` option allows to choose between parsing the URL-encoded data
+with the `querystring` library (when `false`) or the `qs` library (when
+`true`). The "extended" syntax allows for rich objects and arrays to be
+encoded into the URL-encoded format, allowing for a JSON-like experience
+with URL-encoded. For more information, please
+[see the qs library](https://www.npmjs.org/package/qs#readme).
+
+Defaults to `true`, but using the default has been deprecated. Please
+research into the difference between `qs` and `querystring` and choose the
+appropriate setting.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### parameterLimit
+
+The `parameterLimit` option controls the maximum number of parameters that
+are allowed in the URL-encoded data. If a request contains more parameters
+than this value, a 413 will be returned to the client. Defaults to `1000`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `urlencoded`), a mime type (like
+`application/x-www-form-urlencoded`), or a mime type with a wildcard (like
+`*/x-www-form-urlencoded`). If a function, the `type` option is called as
+`fn(req)` and the request is parsed if it returns a truthy value. Defaults
+to `application/x-www-form-urlencoded`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+## Errors
+
+The middlewares provided by this module create errors depending on the error
+condition during parsing. The errors will typically have a `status`/`statusCode`
+property that contains the suggested HTTP response code, an `expose` property
+to determine if the `message` property should be displayed to the client, a
+`type` property to determine the type of error without matching against the
+`message`, and a `body` property containing the read body, if available.
+
+The following are the common errors emitted, though any error can come through
+for various reasons.
+
+### content encoding unsupported
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an encoding but the "inflation" option was set to `false`. The
+`status` property is set to `415`, the `type` property is set to
+`'encoding.unsupported'`, and the `charset` property will be set to the
+encoding that is unsupported.
+
+### request aborted
+
+This error will occur when the request is aborted by the client before reading
+the body has finished. The `received` property will be set to the number of
+bytes received before the request was aborted and the `expected` property is
+set to the number of expected bytes. The `status` property is set to `400`
+and `type` property is set to `'request.aborted'`.
+
+### request entity too large
+
+This error will occur when the request body's size is larger than the "limit"
+option. The `limit` property will be set to the byte limit and the `length`
+property will be set to the request body's length. The `status` property is
+set to `413` and the `type` property is set to `'entity.too.large'`.
+
+### request size did not match content length
+
+This error will occur when the request's length did not match the length from
+the `Content-Length` header. This typically occurs when the request is malformed,
+typically when the `Content-Length` header was calculated based on characters
+instead of bytes. The `status` property is set to `400` and the `type` property
+is set to `'request.size.invalid'`.
+
+### stream encoding should not be set
+
+This error will occur when something called the `req.setEncoding` method prior
+to this middleware. This module operates directly on bytes only and you cannot
+call `req.setEncoding` when using this module. The `status` property is set to
+`500` and the `type` property is set to `'stream.encoding.set'`.
+
+### too many parameters
+
+This error will occur when the content of the request exceeds the configured
+`parameterLimit` for the `urlencoded` parser. The `status` property is set to
+`413` and the `type` property is set to `'parameters.too.many'`.
+
+### unsupported charset "BOGUS"
+
+This error will occur when the request had a charset parameter in the
+`Content-Type` header, but the `iconv-lite` module does not support it OR the
+parser does not support it. The charset is contained in the message as well
+as in the `charset` property. The `status` property is set to `415`, the
+`type` property is set to `'charset.unsupported'`, and the `charset` property
+is set to the charset that is unsupported.
+
+### unsupported content encoding "bogus"
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an unsupported encoding. The encoding is contained in the message
+as well as in the `encoding` property. The `status` property is set to `415`,
+the `type` property is set to `'encoding.unsupported'`, and the `encoding`
+property is set to the encoding that is unsupported.
+
+## Examples
+
+### Express/Connect top-level generic
+
+This example demonstrates adding a generic JSON and URL-encoded parser as a
+top-level middleware, which will parse the bodies of all incoming requests.
+This is the simplest setup.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse application/x-www-form-urlencoded
+app.use(bodyParser.urlencoded({ extended: false }))
+
+// parse application/json
+app.use(bodyParser.json())
+
+app.use(function (req, res) {
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('you posted:\n')
+ res.end(JSON.stringify(req.body, null, 2))
+})
+```
+
+### Express route-specific
+
+This example demonstrates adding body parsers specifically to the routes that
+need them. In general, this is the most recommended way to use body-parser with
+Express.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// create application/json parser
+var jsonParser = bodyParser.json()
+
+// create application/x-www-form-urlencoded parser
+var urlencodedParser = bodyParser.urlencoded({ extended: false })
+
+// POST /login gets urlencoded bodies
+app.post('/login', urlencodedParser, function (req, res) {
+ res.send('welcome, ' + req.body.username)
+})
+
+// POST /api/users gets JSON bodies
+app.post('/api/users', jsonParser, function (req, res) {
+ // create user in req.body
+})
+```
+
+### Change accepted type for parsers
+
+All the parsers accept a `type` option which allows you to change the
+`Content-Type` that the middleware will parse.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse various different custom JSON types as JSON
+app.use(bodyParser.json({ type: 'application/*+json' }))
+
+// parse some custom thing into a Buffer
+app.use(bodyParser.raw({ type: 'application/vnd.custom-type' }))
+
+// parse an HTML body into a string
+app.use(bodyParser.text({ type: 'text/html' }))
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/body-parser.svg
+[npm-url]: https://npmjs.org/package/body-parser
+[travis-image]: https://img.shields.io/travis/expressjs/body-parser/master.svg
+[travis-url]: https://travis-ci.org/expressjs/body-parser
+[coveralls-image]: https://img.shields.io/coveralls/expressjs/body-parser/master.svg
+[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/body-parser.svg
+[downloads-url]: https://npmjs.org/package/body-parser
diff --git a/Restaurant/node_modules/body-parser/index.js b/Restaurant/node_modules/body-parser/index.js
new file mode 100644
index 0000000..93c3a1f
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/index.js
@@ -0,0 +1,157 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var deprecate = require('depd')('body-parser')
+
+/**
+ * Cache of loaded parsers.
+ * @private
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * @typedef Parsers
+ * @type {function}
+ * @property {function} json
+ * @property {function} raw
+ * @property {function} text
+ * @property {function} urlencoded
+ */
+
+/**
+ * Module exports.
+ * @type {Parsers}
+ */
+
+exports = module.exports = deprecate.function(bodyParser,
+ 'bodyParser: use individual json/urlencoded middlewares')
+
+/**
+ * JSON parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'json', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('json')
+})
+
+/**
+ * Raw parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'raw', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('raw')
+})
+
+/**
+ * Text parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'text', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('text')
+})
+
+/**
+ * URL-encoded parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'urlencoded', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('urlencoded')
+})
+
+/**
+ * Create a middleware to parse json and urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @deprecated
+ * @public
+ */
+
+function bodyParser (options) {
+ var opts = {}
+
+ // exclude type option
+ if (options) {
+ for (var prop in options) {
+ if (prop !== 'type') {
+ opts[prop] = options[prop]
+ }
+ }
+ }
+
+ var _urlencoded = exports.urlencoded(opts)
+ var _json = exports.json(opts)
+
+ return function bodyParser (req, res, next) {
+ _json(req, res, function (err) {
+ if (err) return next(err)
+ _urlencoded(req, res, next)
+ })
+ }
+}
+
+/**
+ * Create a getter for loading a parser.
+ * @private
+ */
+
+function createParserGetter (name) {
+ return function get () {
+ return loadParser(name)
+ }
+}
+
+/**
+ * Load a parser module.
+ * @private
+ */
+
+function loadParser (parserName) {
+ var parser = parsers[parserName]
+
+ if (parser !== undefined) {
+ return parser
+ }
+
+ // this uses a switch for static require analysis
+ switch (parserName) {
+ case 'json':
+ parser = require('./lib/types/json')
+ break
+ case 'raw':
+ parser = require('./lib/types/raw')
+ break
+ case 'text':
+ parser = require('./lib/types/text')
+ break
+ case 'urlencoded':
+ parser = require('./lib/types/urlencoded')
+ break
+ }
+
+ // store to prevent invoking require()
+ return (parsers[parserName] = parser)
+}
diff --git a/Restaurant/node_modules/body-parser/lib/read.js b/Restaurant/node_modules/body-parser/lib/read.js
new file mode 100644
index 0000000..c102609
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/lib/read.js
@@ -0,0 +1,181 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var createError = require('http-errors')
+var getBody = require('raw-body')
+var iconv = require('iconv-lite')
+var onFinished = require('on-finished')
+var zlib = require('zlib')
+
+/**
+ * Module exports.
+ */
+
+module.exports = read
+
+/**
+ * Read a request into a buffer and parse.
+ *
+ * @param {object} req
+ * @param {object} res
+ * @param {function} next
+ * @param {function} parse
+ * @param {function} debug
+ * @param {object} options
+ * @private
+ */
+
+function read (req, res, next, parse, debug, options) {
+ var length
+ var opts = options
+ var stream
+
+ // flag as parsed
+ req._body = true
+
+ // read options
+ var encoding = opts.encoding !== null
+ ? opts.encoding
+ : null
+ var verify = opts.verify
+
+ try {
+ // get the content stream
+ stream = contentstream(req, debug, opts.inflate)
+ length = stream.length
+ stream.length = undefined
+ } catch (err) {
+ return next(err)
+ }
+
+ // set raw-body options
+ opts.length = length
+ opts.encoding = verify
+ ? null
+ : encoding
+
+ // assert charset is supported
+ if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) {
+ return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ }))
+ }
+
+ // read body
+ debug('read body')
+ getBody(stream, opts, function (error, body) {
+ if (error) {
+ var _error
+
+ if (error.type === 'encoding.unsupported') {
+ // echo back charset
+ _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ })
+ } else {
+ // set status code on error
+ _error = createError(400, error)
+ }
+
+ // read off entire request
+ stream.resume()
+ onFinished(req, function onfinished () {
+ next(createError(400, _error))
+ })
+ return
+ }
+
+ // verify
+ if (verify) {
+ try {
+ debug('verify body')
+ verify(req, res, body, encoding)
+ } catch (err) {
+ next(createError(403, err, {
+ body: body,
+ type: err.type || 'entity.verify.failed'
+ }))
+ return
+ }
+ }
+
+ // parse
+ var str = body
+ try {
+ debug('parse body')
+ str = typeof body !== 'string' && encoding !== null
+ ? iconv.decode(body, encoding)
+ : body
+ req.body = parse(str)
+ } catch (err) {
+ next(createError(400, err, {
+ body: str,
+ type: err.type || 'entity.parse.failed'
+ }))
+ return
+ }
+
+ next()
+ })
+}
+
+/**
+ * Get the content stream of the request.
+ *
+ * @param {object} req
+ * @param {function} debug
+ * @param {boolean} [inflate=true]
+ * @return {object}
+ * @api private
+ */
+
+function contentstream (req, debug, inflate) {
+ var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase()
+ var length = req.headers['content-length']
+ var stream
+
+ debug('content-encoding "%s"', encoding)
+
+ if (inflate === false && encoding !== 'identity') {
+ throw createError(415, 'content encoding unsupported', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ switch (encoding) {
+ case 'deflate':
+ stream = zlib.createInflate()
+ debug('inflate body')
+ req.pipe(stream)
+ break
+ case 'gzip':
+ stream = zlib.createGunzip()
+ debug('gunzip body')
+ req.pipe(stream)
+ break
+ case 'identity':
+ stream = req
+ stream.length = length
+ break
+ default:
+ throw createError(415, 'unsupported content encoding "' + encoding + '"', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ return stream
+}
diff --git a/Restaurant/node_modules/body-parser/lib/types/json.js b/Restaurant/node_modules/body-parser/lib/types/json.js
new file mode 100644
index 0000000..2971dc1
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/lib/types/json.js
@@ -0,0 +1,230 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:json')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = json
+
+/**
+ * RegExp to match the first non-space in a string.
+ *
+ * Allowed whitespace is defined in RFC 7159:
+ *
+ * ws = *(
+ * %x20 / ; Space
+ * %x09 / ; Horizontal tab
+ * %x0A / ; Line feed or New line
+ * %x0D ) ; Carriage return
+ */
+
+var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*(.)/ // eslint-disable-line no-control-regex
+
+/**
+ * Create a middleware to parse JSON bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function json (options) {
+ var opts = options || {}
+
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var inflate = opts.inflate !== false
+ var reviver = opts.reviver
+ var strict = opts.strict !== false
+ var type = opts.type || 'application/json'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ if (body.length === 0) {
+ // special-case empty json body, as it's a common client-side mistake
+ // TODO: maybe make this configurable or part of "strict" option
+ return {}
+ }
+
+ if (strict) {
+ var first = firstchar(body)
+
+ if (first !== '{' && first !== '[') {
+ debug('strict violation')
+ throw createStrictSyntaxError(body, first)
+ }
+ }
+
+ try {
+ debug('parse json')
+ return JSON.parse(body, reviver)
+ } catch (e) {
+ throw normalizeJsonSyntaxError(e, {
+ message: e.message,
+ stack: e.stack
+ })
+ }
+ }
+
+ return function jsonParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset per RFC 7159 sec 8.1
+ var charset = getCharset(req) || 'utf-8'
+ if (charset.substr(0, 4) !== 'utf-') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Create strict violation syntax error matching native error.
+ *
+ * @param {string} str
+ * @param {string} char
+ * @return {Error}
+ * @private
+ */
+
+function createStrictSyntaxError (str, char) {
+ var index = str.indexOf(char)
+ var partial = str.substring(0, index) + '#'
+
+ try {
+ JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation')
+ } catch (e) {
+ return normalizeJsonSyntaxError(e, {
+ message: e.message.replace('#', char),
+ stack: e.stack
+ })
+ }
+}
+
+/**
+ * Get the first non-whitespace character in a string.
+ *
+ * @param {string} str
+ * @return {function}
+ * @private
+ */
+
+function firstchar (str) {
+ return FIRST_CHAR_REGEXP.exec(str)[1]
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Normalize a SyntaxError for JSON.parse.
+ *
+ * @param {SyntaxError} error
+ * @param {object} obj
+ * @return {SyntaxError}
+ */
+
+function normalizeJsonSyntaxError (error, obj) {
+ var keys = Object.getOwnPropertyNames(error)
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i]
+ if (key !== 'stack' && key !== 'message') {
+ delete error[key]
+ }
+ }
+
+ // replace stack before message for Node.js 0.10 and below
+ error.stack = obj.stack.replace(error.message, obj.message)
+ error.message = obj.message
+
+ return error
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/Restaurant/node_modules/body-parser/lib/types/raw.js b/Restaurant/node_modules/body-parser/lib/types/raw.js
new file mode 100644
index 0000000..f5d1b67
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/lib/types/raw.js
@@ -0,0 +1,101 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var debug = require('debug')('body-parser:raw')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = raw
+
+/**
+ * Create a middleware to parse raw bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function raw (options) {
+ var opts = options || {}
+
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/octet-stream'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function rawParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: null,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/Restaurant/node_modules/body-parser/lib/types/text.js b/Restaurant/node_modules/body-parser/lib/types/text.js
new file mode 100644
index 0000000..083a009
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/lib/types/text.js
@@ -0,0 +1,121 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var debug = require('debug')('body-parser:text')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = text
+
+/**
+ * Create a middleware to parse text bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function text (options) {
+ var opts = options || {}
+
+ var defaultCharset = opts.defaultCharset || 'utf-8'
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'text/plain'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function textParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // get charset
+ var charset = getCharset(req) || defaultCharset
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/Restaurant/node_modules/body-parser/lib/types/urlencoded.js b/Restaurant/node_modules/body-parser/lib/types/urlencoded.js
new file mode 100644
index 0000000..b2ca8f1
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/lib/types/urlencoded.js
@@ -0,0 +1,284 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:urlencoded')
+var deprecate = require('depd')('body-parser')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = urlencoded
+
+/**
+ * Cache of parser modules.
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * Create a middleware to parse urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function urlencoded (options) {
+ var opts = options || {}
+
+ // notice because option default will flip in next major
+ if (opts.extended === undefined) {
+ deprecate('undefined extended: provide extended option')
+ }
+
+ var extended = opts.extended !== false
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/x-www-form-urlencoded'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate query parser
+ var queryparse = extended
+ ? extendedparser(opts)
+ : simpleparser(opts)
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ return body.length
+ ? queryparse(body)
+ : {}
+ }
+
+ return function urlencodedParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset
+ var charset = getCharset(req) || 'utf-8'
+ if (charset !== 'utf-8') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ debug: debug,
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the extended query parser.
+ *
+ * @param {object} options
+ */
+
+function extendedparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+ var parse = parser('qs')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ var arrayLimit = Math.max(100, paramCount)
+
+ debug('parse extended urlencoding')
+ return parse(body, {
+ allowPrototypes: true,
+ arrayLimit: arrayLimit,
+ depth: Infinity,
+ parameterLimit: parameterLimit
+ })
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Count the number of parameters, stopping once limit reached
+ *
+ * @param {string} body
+ * @param {number} limit
+ * @api private
+ */
+
+function parameterCount (body, limit) {
+ var count = 0
+ var index = 0
+
+ while ((index = body.indexOf('&', index)) !== -1) {
+ count++
+ index++
+
+ if (count === limit) {
+ return undefined
+ }
+ }
+
+ return count
+}
+
+/**
+ * Get parser for module name dynamically.
+ *
+ * @param {string} name
+ * @return {function}
+ * @api private
+ */
+
+function parser (name) {
+ var mod = parsers[name]
+
+ if (mod !== undefined) {
+ return mod.parse
+ }
+
+ // this uses a switch for static require analysis
+ switch (name) {
+ case 'qs':
+ mod = require('qs')
+ break
+ case 'querystring':
+ mod = require('querystring')
+ break
+ }
+
+ // store to prevent invoking require()
+ parsers[name] = mod
+
+ return mod.parse
+}
+
+/**
+ * Get the simple query parser.
+ *
+ * @param {object} options
+ */
+
+function simpleparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+ var parse = parser('querystring')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ debug('parse urlencoding')
+ return parse(body, undefined, undefined, { maxKeys: parameterLimit })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/Restaurant/node_modules/body-parser/package.json b/Restaurant/node_modules/body-parser/package.json
new file mode 100644
index 0000000..c10582f
--- /dev/null
+++ b/Restaurant/node_modules/body-parser/package.json
@@ -0,0 +1,93 @@
+{
+ "_from": "body-parser",
+ "_id": "body-parser@1.19.0",
+ "_inBundle": false,
+ "_integrity": "sha512-dhEPs72UPbDnAQJ9ZKMNTP6ptJaionhP5cBb541nXPlW60Jepo9RV/a4fX4XWW9CuFNK22krhrj1+rgzifNCsw==",
+ "_location": "/body-parser",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "tag",
+ "registry": true,
+ "raw": "body-parser",
+ "name": "body-parser",
+ "escapedName": "body-parser",
+ "rawSpec": "",
+ "saveSpec": null,
+ "fetchSpec": "latest"
+ },
+ "_requiredBy": [
+ "#USER",
+ "/",
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.19.0.tgz",
+ "_shasum": "96b2709e57c9c4e09a6fd66a8fd979844f69f08a",
+ "_spec": "body-parser",
+ "_where": "F:\\Restaurant",
+ "bugs": {
+ "url": "https://github.com/expressjs/body-parser/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ }
+ ],
+ "dependencies": {
+ "bytes": "3.1.0",
+ "content-type": "~1.0.4",
+ "debug": "2.6.9",
+ "depd": "~1.1.2",
+ "http-errors": "1.7.2",
+ "iconv-lite": "0.4.24",
+ "on-finished": "~2.3.0",
+ "qs": "6.7.0",
+ "raw-body": "2.4.0",
+ "type-is": "~1.6.17"
+ },
+ "deprecated": false,
+ "description": "Node.js body parsing middleware",
+ "devDependencies": {
+ "eslint": "5.16.0",
+ "eslint-config-standard": "12.0.0",
+ "eslint-plugin-import": "2.17.2",
+ "eslint-plugin-markdown": "1.0.0",
+ "eslint-plugin-node": "8.0.1",
+ "eslint-plugin-promise": "4.1.1",
+ "eslint-plugin-standard": "4.0.0",
+ "istanbul": "0.4.5",
+ "methods": "1.1.2",
+ "mocha": "6.1.4",
+ "safe-buffer": "5.1.2",
+ "supertest": "4.0.2"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "files": [
+ "lib/",
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/expressjs/body-parser#readme",
+ "license": "MIT",
+ "name": "body-parser",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/expressjs/body-parser.git"
+ },
+ "scripts": {
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --require test/support/env --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/"
+ },
+ "version": "1.19.0"
+}
diff --git a/Restaurant/node_modules/bson/HISTORY.md b/Restaurant/node_modules/bson/HISTORY.md
new file mode 100644
index 0000000..36b90e2
--- /dev/null
+++ b/Restaurant/node_modules/bson/HISTORY.md
@@ -0,0 +1,283 @@
+",
+ "main": "./browser_build/bson.js",
+ "license": "Apache-2.0",
+ "moduleType": [
+ "globals",
+ "node"
+ ],
+ "ignore": [
+ "**/.*",
+ "alternate_parsers",
+ "benchmarks",
+ "bower_components",
+ "node_modules",
+ "test",
+ "tools"
+ ]
+}
diff --git a/Restaurant/node_modules/bson/browser_build/bson.js b/Restaurant/node_modules/bson/browser_build/bson.js
new file mode 100644
index 0000000..6984059
--- /dev/null
+++ b/Restaurant/node_modules/bson/browser_build/bson.js
@@ -0,0 +1,18212 @@
+(function webpackUniversalModuleDefinition(root, factory) {
+ if(typeof exports === 'object' && typeof module === 'object')
+ module.exports = factory();
+ else if(typeof define === 'function' && define.amd)
+ define([], factory);
+ else {
+ var a = factory();
+ for(var i in a) (typeof exports === 'object' ? exports : root)[i] = a[i];
+ }
+})(this, function() {
+return /******/ (function(modules) { // webpackBootstrap
+/******/ // The module cache
+/******/ var installedModules = {};
+
+/******/ // The require function
+/******/ function __webpack_require__(moduleId) {
+
+/******/ // Check if module is in cache
+/******/ if(installedModules[moduleId])
+/******/ return installedModules[moduleId].exports;
+
+/******/ // Create a new module (and put it into the cache)
+/******/ var module = installedModules[moduleId] = {
+/******/ exports: {},
+/******/ id: moduleId,
+/******/ loaded: false
+/******/ };
+
+/******/ // Execute the module function
+/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
+
+/******/ // Flag the module as loaded
+/******/ module.loaded = true;
+
+/******/ // Return the exports of the module
+/******/ return module.exports;
+/******/ }
+
+
+/******/ // expose the modules object (__webpack_modules__)
+/******/ __webpack_require__.m = modules;
+
+/******/ // expose the module cache
+/******/ __webpack_require__.c = installedModules;
+
+/******/ // __webpack_public_path__
+/******/ __webpack_require__.p = "/";
+
+/******/ // Load entry module and return exports
+/******/ return __webpack_require__(0);
+/******/ })
+/************************************************************************/
+/******/ ([
+/* 0 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(1);
+ module.exports = __webpack_require__(332);
+
+
+/***/ }),
+/* 1 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(global) {"use strict";
+
+ __webpack_require__(2);
+
+ __webpack_require__(328);
+
+ __webpack_require__(329);
+
+ if (global._babelPolyfill) {
+ throw new Error("only one instance of babel-polyfill is allowed");
+ }
+ global._babelPolyfill = true;
+
+ var DEFINE_PROPERTY = "defineProperty";
+ function define(O, key, value) {
+ O[key] || Object[DEFINE_PROPERTY](O, key, {
+ writable: true,
+ configurable: true,
+ value: value
+ });
+ }
+
+ define(String.prototype, "padLeft", "".padStart);
+ define(String.prototype, "padRight", "".padEnd);
+
+ "pop,reverse,shift,keys,values,entries,indexOf,every,some,forEach,map,filter,find,findIndex,includes,join,slice,concat,push,splice,unshift,sort,lastIndexOf,reduce,reduceRight,copyWithin,fill".split(",").forEach(function (key) {
+ [][key] && define(Array, key, Function.call.bind([][key]));
+ });
+ /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }())))
+
+/***/ }),
+/* 2 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(3);
+ __webpack_require__(53);
+ __webpack_require__(54);
+ __webpack_require__(55);
+ __webpack_require__(56);
+ __webpack_require__(58);
+ __webpack_require__(60);
+ __webpack_require__(61);
+ __webpack_require__(62);
+ __webpack_require__(63);
+ __webpack_require__(64);
+ __webpack_require__(65);
+ __webpack_require__(66);
+ __webpack_require__(67);
+ __webpack_require__(68);
+ __webpack_require__(70);
+ __webpack_require__(72);
+ __webpack_require__(74);
+ __webpack_require__(76);
+ __webpack_require__(79);
+ __webpack_require__(80);
+ __webpack_require__(81);
+ __webpack_require__(85);
+ __webpack_require__(87);
+ __webpack_require__(89);
+ __webpack_require__(92);
+ __webpack_require__(93);
+ __webpack_require__(94);
+ __webpack_require__(95);
+ __webpack_require__(97);
+ __webpack_require__(98);
+ __webpack_require__(99);
+ __webpack_require__(100);
+ __webpack_require__(101);
+ __webpack_require__(102);
+ __webpack_require__(103);
+ __webpack_require__(105);
+ __webpack_require__(106);
+ __webpack_require__(107);
+ __webpack_require__(109);
+ __webpack_require__(110);
+ __webpack_require__(111);
+ __webpack_require__(113);
+ __webpack_require__(115);
+ __webpack_require__(116);
+ __webpack_require__(117);
+ __webpack_require__(118);
+ __webpack_require__(119);
+ __webpack_require__(120);
+ __webpack_require__(121);
+ __webpack_require__(122);
+ __webpack_require__(123);
+ __webpack_require__(124);
+ __webpack_require__(125);
+ __webpack_require__(126);
+ __webpack_require__(127);
+ __webpack_require__(132);
+ __webpack_require__(133);
+ __webpack_require__(137);
+ __webpack_require__(138);
+ __webpack_require__(139);
+ __webpack_require__(140);
+ __webpack_require__(142);
+ __webpack_require__(143);
+ __webpack_require__(144);
+ __webpack_require__(145);
+ __webpack_require__(146);
+ __webpack_require__(147);
+ __webpack_require__(148);
+ __webpack_require__(149);
+ __webpack_require__(150);
+ __webpack_require__(151);
+ __webpack_require__(152);
+ __webpack_require__(153);
+ __webpack_require__(154);
+ __webpack_require__(155);
+ __webpack_require__(156);
+ __webpack_require__(158);
+ __webpack_require__(159);
+ __webpack_require__(161);
+ __webpack_require__(162);
+ __webpack_require__(168);
+ __webpack_require__(169);
+ __webpack_require__(171);
+ __webpack_require__(172);
+ __webpack_require__(173);
+ __webpack_require__(177);
+ __webpack_require__(178);
+ __webpack_require__(179);
+ __webpack_require__(180);
+ __webpack_require__(181);
+ __webpack_require__(183);
+ __webpack_require__(184);
+ __webpack_require__(185);
+ __webpack_require__(186);
+ __webpack_require__(189);
+ __webpack_require__(191);
+ __webpack_require__(192);
+ __webpack_require__(193);
+ __webpack_require__(195);
+ __webpack_require__(197);
+ __webpack_require__(199);
+ __webpack_require__(201);
+ __webpack_require__(202);
+ __webpack_require__(203);
+ __webpack_require__(207);
+ __webpack_require__(208);
+ __webpack_require__(209);
+ __webpack_require__(211);
+ __webpack_require__(221);
+ __webpack_require__(225);
+ __webpack_require__(226);
+ __webpack_require__(228);
+ __webpack_require__(229);
+ __webpack_require__(233);
+ __webpack_require__(234);
+ __webpack_require__(236);
+ __webpack_require__(237);
+ __webpack_require__(238);
+ __webpack_require__(239);
+ __webpack_require__(240);
+ __webpack_require__(241);
+ __webpack_require__(242);
+ __webpack_require__(243);
+ __webpack_require__(244);
+ __webpack_require__(245);
+ __webpack_require__(246);
+ __webpack_require__(247);
+ __webpack_require__(248);
+ __webpack_require__(249);
+ __webpack_require__(250);
+ __webpack_require__(251);
+ __webpack_require__(252);
+ __webpack_require__(253);
+ __webpack_require__(254);
+ __webpack_require__(256);
+ __webpack_require__(257);
+ __webpack_require__(258);
+ __webpack_require__(259);
+ __webpack_require__(260);
+ __webpack_require__(262);
+ __webpack_require__(263);
+ __webpack_require__(264);
+ __webpack_require__(266);
+ __webpack_require__(267);
+ __webpack_require__(268);
+ __webpack_require__(269);
+ __webpack_require__(270);
+ __webpack_require__(271);
+ __webpack_require__(272);
+ __webpack_require__(273);
+ __webpack_require__(275);
+ __webpack_require__(276);
+ __webpack_require__(278);
+ __webpack_require__(279);
+ __webpack_require__(280);
+ __webpack_require__(281);
+ __webpack_require__(284);
+ __webpack_require__(285);
+ __webpack_require__(287);
+ __webpack_require__(288);
+ __webpack_require__(289);
+ __webpack_require__(290);
+ __webpack_require__(292);
+ __webpack_require__(293);
+ __webpack_require__(294);
+ __webpack_require__(295);
+ __webpack_require__(296);
+ __webpack_require__(297);
+ __webpack_require__(298);
+ __webpack_require__(299);
+ __webpack_require__(300);
+ __webpack_require__(301);
+ __webpack_require__(303);
+ __webpack_require__(304);
+ __webpack_require__(305);
+ __webpack_require__(306);
+ __webpack_require__(307);
+ __webpack_require__(308);
+ __webpack_require__(309);
+ __webpack_require__(310);
+ __webpack_require__(311);
+ __webpack_require__(312);
+ __webpack_require__(313);
+ __webpack_require__(315);
+ __webpack_require__(316);
+ __webpack_require__(317);
+ __webpack_require__(318);
+ __webpack_require__(319);
+ __webpack_require__(320);
+ __webpack_require__(321);
+ __webpack_require__(322);
+ __webpack_require__(323);
+ __webpack_require__(324);
+ __webpack_require__(325);
+ __webpack_require__(326);
+ __webpack_require__(327);
+ module.exports = __webpack_require__(9);
+
+
+/***/ }),
+/* 3 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // ECMAScript 6 symbols shim
+ var global = __webpack_require__(4);
+ var has = __webpack_require__(5);
+ var DESCRIPTORS = __webpack_require__(6);
+ var $export = __webpack_require__(8);
+ var redefine = __webpack_require__(18);
+ var META = __webpack_require__(25).KEY;
+ var $fails = __webpack_require__(7);
+ var shared = __webpack_require__(21);
+ var setToStringTag = __webpack_require__(26);
+ var uid = __webpack_require__(19);
+ var wks = __webpack_require__(27);
+ var wksExt = __webpack_require__(28);
+ var wksDefine = __webpack_require__(29);
+ var enumKeys = __webpack_require__(30);
+ var isArray = __webpack_require__(45);
+ var anObject = __webpack_require__(12);
+ var isObject = __webpack_require__(13);
+ var toObject = __webpack_require__(46);
+ var toIObject = __webpack_require__(33);
+ var toPrimitive = __webpack_require__(16);
+ var createDesc = __webpack_require__(17);
+ var _create = __webpack_require__(47);
+ var gOPNExt = __webpack_require__(50);
+ var $GOPD = __webpack_require__(52);
+ var $GOPS = __webpack_require__(43);
+ var $DP = __webpack_require__(11);
+ var $keys = __webpack_require__(31);
+ var gOPD = $GOPD.f;
+ var dP = $DP.f;
+ var gOPN = gOPNExt.f;
+ var $Symbol = global.Symbol;
+ var $JSON = global.JSON;
+ var _stringify = $JSON && $JSON.stringify;
+ var PROTOTYPE = 'prototype';
+ var HIDDEN = wks('_hidden');
+ var TO_PRIMITIVE = wks('toPrimitive');
+ var isEnum = {}.propertyIsEnumerable;
+ var SymbolRegistry = shared('symbol-registry');
+ var AllSymbols = shared('symbols');
+ var OPSymbols = shared('op-symbols');
+ var ObjectProto = Object[PROTOTYPE];
+ var USE_NATIVE = typeof $Symbol == 'function' && !!$GOPS.f;
+ var QObject = global.QObject;
+ // Don't use setters in Qt Script, https://github.com/zloirock/core-js/issues/173
+ var setter = !QObject || !QObject[PROTOTYPE] || !QObject[PROTOTYPE].findChild;
+
+ // fallback for old Android, https://code.google.com/p/v8/issues/detail?id=687
+ var setSymbolDesc = DESCRIPTORS && $fails(function () {
+ return _create(dP({}, 'a', {
+ get: function () { return dP(this, 'a', { value: 7 }).a; }
+ })).a != 7;
+ }) ? function (it, key, D) {
+ var protoDesc = gOPD(ObjectProto, key);
+ if (protoDesc) delete ObjectProto[key];
+ dP(it, key, D);
+ if (protoDesc && it !== ObjectProto) dP(ObjectProto, key, protoDesc);
+ } : dP;
+
+ var wrap = function (tag) {
+ var sym = AllSymbols[tag] = _create($Symbol[PROTOTYPE]);
+ sym._k = tag;
+ return sym;
+ };
+
+ var isSymbol = USE_NATIVE && typeof $Symbol.iterator == 'symbol' ? function (it) {
+ return typeof it == 'symbol';
+ } : function (it) {
+ return it instanceof $Symbol;
+ };
+
+ var $defineProperty = function defineProperty(it, key, D) {
+ if (it === ObjectProto) $defineProperty(OPSymbols, key, D);
+ anObject(it);
+ key = toPrimitive(key, true);
+ anObject(D);
+ if (has(AllSymbols, key)) {
+ if (!D.enumerable) {
+ if (!has(it, HIDDEN)) dP(it, HIDDEN, createDesc(1, {}));
+ it[HIDDEN][key] = true;
+ } else {
+ if (has(it, HIDDEN) && it[HIDDEN][key]) it[HIDDEN][key] = false;
+ D = _create(D, { enumerable: createDesc(0, false) });
+ } return setSymbolDesc(it, key, D);
+ } return dP(it, key, D);
+ };
+ var $defineProperties = function defineProperties(it, P) {
+ anObject(it);
+ var keys = enumKeys(P = toIObject(P));
+ var i = 0;
+ var l = keys.length;
+ var key;
+ while (l > i) $defineProperty(it, key = keys[i++], P[key]);
+ return it;
+ };
+ var $create = function create(it, P) {
+ return P === undefined ? _create(it) : $defineProperties(_create(it), P);
+ };
+ var $propertyIsEnumerable = function propertyIsEnumerable(key) {
+ var E = isEnum.call(this, key = toPrimitive(key, true));
+ if (this === ObjectProto && has(AllSymbols, key) && !has(OPSymbols, key)) return false;
+ return E || !has(this, key) || !has(AllSymbols, key) || has(this, HIDDEN) && this[HIDDEN][key] ? E : true;
+ };
+ var $getOwnPropertyDescriptor = function getOwnPropertyDescriptor(it, key) {
+ it = toIObject(it);
+ key = toPrimitive(key, true);
+ if (it === ObjectProto && has(AllSymbols, key) && !has(OPSymbols, key)) return;
+ var D = gOPD(it, key);
+ if (D && has(AllSymbols, key) && !(has(it, HIDDEN) && it[HIDDEN][key])) D.enumerable = true;
+ return D;
+ };
+ var $getOwnPropertyNames = function getOwnPropertyNames(it) {
+ var names = gOPN(toIObject(it));
+ var result = [];
+ var i = 0;
+ var key;
+ while (names.length > i) {
+ if (!has(AllSymbols, key = names[i++]) && key != HIDDEN && key != META) result.push(key);
+ } return result;
+ };
+ var $getOwnPropertySymbols = function getOwnPropertySymbols(it) {
+ var IS_OP = it === ObjectProto;
+ var names = gOPN(IS_OP ? OPSymbols : toIObject(it));
+ var result = [];
+ var i = 0;
+ var key;
+ while (names.length > i) {
+ if (has(AllSymbols, key = names[i++]) && (IS_OP ? has(ObjectProto, key) : true)) result.push(AllSymbols[key]);
+ } return result;
+ };
+
+ // 19.4.1.1 Symbol([description])
+ if (!USE_NATIVE) {
+ $Symbol = function Symbol() {
+ if (this instanceof $Symbol) throw TypeError('Symbol is not a constructor!');
+ var tag = uid(arguments.length > 0 ? arguments[0] : undefined);
+ var $set = function (value) {
+ if (this === ObjectProto) $set.call(OPSymbols, value);
+ if (has(this, HIDDEN) && has(this[HIDDEN], tag)) this[HIDDEN][tag] = false;
+ setSymbolDesc(this, tag, createDesc(1, value));
+ };
+ if (DESCRIPTORS && setter) setSymbolDesc(ObjectProto, tag, { configurable: true, set: $set });
+ return wrap(tag);
+ };
+ redefine($Symbol[PROTOTYPE], 'toString', function toString() {
+ return this._k;
+ });
+
+ $GOPD.f = $getOwnPropertyDescriptor;
+ $DP.f = $defineProperty;
+ __webpack_require__(51).f = gOPNExt.f = $getOwnPropertyNames;
+ __webpack_require__(44).f = $propertyIsEnumerable;
+ $GOPS.f = $getOwnPropertySymbols;
+
+ if (DESCRIPTORS && !__webpack_require__(22)) {
+ redefine(ObjectProto, 'propertyIsEnumerable', $propertyIsEnumerable, true);
+ }
+
+ wksExt.f = function (name) {
+ return wrap(wks(name));
+ };
+ }
+
+ $export($export.G + $export.W + $export.F * !USE_NATIVE, { Symbol: $Symbol });
+
+ for (var es6Symbols = (
+ // 19.4.2.2, 19.4.2.3, 19.4.2.4, 19.4.2.6, 19.4.2.8, 19.4.2.9, 19.4.2.10, 19.4.2.11, 19.4.2.12, 19.4.2.13, 19.4.2.14
+ 'hasInstance,isConcatSpreadable,iterator,match,replace,search,species,split,toPrimitive,toStringTag,unscopables'
+ ).split(','), j = 0; es6Symbols.length > j;)wks(es6Symbols[j++]);
+
+ for (var wellKnownSymbols = $keys(wks.store), k = 0; wellKnownSymbols.length > k;) wksDefine(wellKnownSymbols[k++]);
+
+ $export($export.S + $export.F * !USE_NATIVE, 'Symbol', {
+ // 19.4.2.1 Symbol.for(key)
+ 'for': function (key) {
+ return has(SymbolRegistry, key += '')
+ ? SymbolRegistry[key]
+ : SymbolRegistry[key] = $Symbol(key);
+ },
+ // 19.4.2.5 Symbol.keyFor(sym)
+ keyFor: function keyFor(sym) {
+ if (!isSymbol(sym)) throw TypeError(sym + ' is not a symbol!');
+ for (var key in SymbolRegistry) if (SymbolRegistry[key] === sym) return key;
+ },
+ useSetter: function () { setter = true; },
+ useSimple: function () { setter = false; }
+ });
+
+ $export($export.S + $export.F * !USE_NATIVE, 'Object', {
+ // 19.1.2.2 Object.create(O [, Properties])
+ create: $create,
+ // 19.1.2.4 Object.defineProperty(O, P, Attributes)
+ defineProperty: $defineProperty,
+ // 19.1.2.3 Object.defineProperties(O, Properties)
+ defineProperties: $defineProperties,
+ // 19.1.2.6 Object.getOwnPropertyDescriptor(O, P)
+ getOwnPropertyDescriptor: $getOwnPropertyDescriptor,
+ // 19.1.2.7 Object.getOwnPropertyNames(O)
+ getOwnPropertyNames: $getOwnPropertyNames,
+ // 19.1.2.8 Object.getOwnPropertySymbols(O)
+ getOwnPropertySymbols: $getOwnPropertySymbols
+ });
+
+ // Chrome 38 and 39 `Object.getOwnPropertySymbols` fails on primitives
+ // https://bugs.chromium.org/p/v8/issues/detail?id=3443
+ var FAILS_ON_PRIMITIVES = $fails(function () { $GOPS.f(1); });
+
+ $export($export.S + $export.F * FAILS_ON_PRIMITIVES, 'Object', {
+ getOwnPropertySymbols: function getOwnPropertySymbols(it) {
+ return $GOPS.f(toObject(it));
+ }
+ });
+
+ // 24.3.2 JSON.stringify(value [, replacer [, space]])
+ $JSON && $export($export.S + $export.F * (!USE_NATIVE || $fails(function () {
+ var S = $Symbol();
+ // MS Edge converts symbol values to JSON as {}
+ // WebKit converts symbol values to JSON as null
+ // V8 throws on boxed symbols
+ return _stringify([S]) != '[null]' || _stringify({ a: S }) != '{}' || _stringify(Object(S)) != '{}';
+ })), 'JSON', {
+ stringify: function stringify(it) {
+ var args = [it];
+ var i = 1;
+ var replacer, $replacer;
+ while (arguments.length > i) args.push(arguments[i++]);
+ $replacer = replacer = args[1];
+ if (!isObject(replacer) && it === undefined || isSymbol(it)) return; // IE8 returns string on undefined
+ if (!isArray(replacer)) replacer = function (key, value) {
+ if (typeof $replacer == 'function') value = $replacer.call(this, key, value);
+ if (!isSymbol(value)) return value;
+ };
+ args[1] = replacer;
+ return _stringify.apply($JSON, args);
+ }
+ });
+
+ // 19.4.3.4 Symbol.prototype[@@toPrimitive](hint)
+ $Symbol[PROTOTYPE][TO_PRIMITIVE] || __webpack_require__(10)($Symbol[PROTOTYPE], TO_PRIMITIVE, $Symbol[PROTOTYPE].valueOf);
+ // 19.4.3.5 Symbol.prototype[@@toStringTag]
+ setToStringTag($Symbol, 'Symbol');
+ // 20.2.1.9 Math[@@toStringTag]
+ setToStringTag(Math, 'Math', true);
+ // 24.3.3 JSON[@@toStringTag]
+ setToStringTag(global.JSON, 'JSON', true);
+
+
+/***/ }),
+/* 4 */
+/***/ (function(module, exports) {
+
+ // https://github.com/zloirock/core-js/issues/86#issuecomment-115759028
+ var global = module.exports = typeof window != 'undefined' && window.Math == Math
+ ? window : typeof self != 'undefined' && self.Math == Math ? self
+ // eslint-disable-next-line no-new-func
+ : Function('return this')();
+ if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef
+
+
+/***/ }),
+/* 5 */
+/***/ (function(module, exports) {
+
+ var hasOwnProperty = {}.hasOwnProperty;
+ module.exports = function (it, key) {
+ return hasOwnProperty.call(it, key);
+ };
+
+
+/***/ }),
+/* 6 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // Thank's IE8 for his funny defineProperty
+ module.exports = !__webpack_require__(7)(function () {
+ return Object.defineProperty({}, 'a', { get: function () { return 7; } }).a != 7;
+ });
+
+
+/***/ }),
+/* 7 */
+/***/ (function(module, exports) {
+
+ module.exports = function (exec) {
+ try {
+ return !!exec();
+ } catch (e) {
+ return true;
+ }
+ };
+
+
+/***/ }),
+/* 8 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var global = __webpack_require__(4);
+ var core = __webpack_require__(9);
+ var hide = __webpack_require__(10);
+ var redefine = __webpack_require__(18);
+ var ctx = __webpack_require__(23);
+ var PROTOTYPE = 'prototype';
+
+ var $export = function (type, name, source) {
+ var IS_FORCED = type & $export.F;
+ var IS_GLOBAL = type & $export.G;
+ var IS_STATIC = type & $export.S;
+ var IS_PROTO = type & $export.P;
+ var IS_BIND = type & $export.B;
+ var target = IS_GLOBAL ? global : IS_STATIC ? global[name] || (global[name] = {}) : (global[name] || {})[PROTOTYPE];
+ var exports = IS_GLOBAL ? core : core[name] || (core[name] = {});
+ var expProto = exports[PROTOTYPE] || (exports[PROTOTYPE] = {});
+ var key, own, out, exp;
+ if (IS_GLOBAL) source = name;
+ for (key in source) {
+ // contains in native
+ own = !IS_FORCED && target && target[key] !== undefined;
+ // export native or passed
+ out = (own ? target : source)[key];
+ // bind timers to global for call from export context
+ exp = IS_BIND && own ? ctx(out, global) : IS_PROTO && typeof out == 'function' ? ctx(Function.call, out) : out;
+ // extend global
+ if (target) redefine(target, key, out, type & $export.U);
+ // export
+ if (exports[key] != out) hide(exports, key, exp);
+ if (IS_PROTO && expProto[key] != out) expProto[key] = out;
+ }
+ };
+ global.core = core;
+ // type bitmap
+ $export.F = 1; // forced
+ $export.G = 2; // global
+ $export.S = 4; // static
+ $export.P = 8; // proto
+ $export.B = 16; // bind
+ $export.W = 32; // wrap
+ $export.U = 64; // safe
+ $export.R = 128; // real proto method for `library`
+ module.exports = $export;
+
+
+/***/ }),
+/* 9 */
+/***/ (function(module, exports) {
+
+ var core = module.exports = { version: '2.6.10' };
+ if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef
+
+
+/***/ }),
+/* 10 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var dP = __webpack_require__(11);
+ var createDesc = __webpack_require__(17);
+ module.exports = __webpack_require__(6) ? function (object, key, value) {
+ return dP.f(object, key, createDesc(1, value));
+ } : function (object, key, value) {
+ object[key] = value;
+ return object;
+ };
+
+
+/***/ }),
+/* 11 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var anObject = __webpack_require__(12);
+ var IE8_DOM_DEFINE = __webpack_require__(14);
+ var toPrimitive = __webpack_require__(16);
+ var dP = Object.defineProperty;
+
+ exports.f = __webpack_require__(6) ? Object.defineProperty : function defineProperty(O, P, Attributes) {
+ anObject(O);
+ P = toPrimitive(P, true);
+ anObject(Attributes);
+ if (IE8_DOM_DEFINE) try {
+ return dP(O, P, Attributes);
+ } catch (e) { /* empty */ }
+ if ('get' in Attributes || 'set' in Attributes) throw TypeError('Accessors not supported!');
+ if ('value' in Attributes) O[P] = Attributes.value;
+ return O;
+ };
+
+
+/***/ }),
+/* 12 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var isObject = __webpack_require__(13);
+ module.exports = function (it) {
+ if (!isObject(it)) throw TypeError(it + ' is not an object!');
+ return it;
+ };
+
+
+/***/ }),
+/* 13 */
+/***/ (function(module, exports) {
+
+ module.exports = function (it) {
+ return typeof it === 'object' ? it !== null : typeof it === 'function';
+ };
+
+
+/***/ }),
+/* 14 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ module.exports = !__webpack_require__(6) && !__webpack_require__(7)(function () {
+ return Object.defineProperty(__webpack_require__(15)('div'), 'a', { get: function () { return 7; } }).a != 7;
+ });
+
+
+/***/ }),
+/* 15 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var isObject = __webpack_require__(13);
+ var document = __webpack_require__(4).document;
+ // typeof document.createElement is 'object' in old IE
+ var is = isObject(document) && isObject(document.createElement);
+ module.exports = function (it) {
+ return is ? document.createElement(it) : {};
+ };
+
+
+/***/ }),
+/* 16 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 7.1.1 ToPrimitive(input [, PreferredType])
+ var isObject = __webpack_require__(13);
+ // instead of the ES6 spec version, we didn't implement @@toPrimitive case
+ // and the second argument - flag - preferred type is a string
+ module.exports = function (it, S) {
+ if (!isObject(it)) return it;
+ var fn, val;
+ if (S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;
+ if (typeof (fn = it.valueOf) == 'function' && !isObject(val = fn.call(it))) return val;
+ if (!S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;
+ throw TypeError("Can't convert object to primitive value");
+ };
+
+
+/***/ }),
+/* 17 */
+/***/ (function(module, exports) {
+
+ module.exports = function (bitmap, value) {
+ return {
+ enumerable: !(bitmap & 1),
+ configurable: !(bitmap & 2),
+ writable: !(bitmap & 4),
+ value: value
+ };
+ };
+
+
+/***/ }),
+/* 18 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var global = __webpack_require__(4);
+ var hide = __webpack_require__(10);
+ var has = __webpack_require__(5);
+ var SRC = __webpack_require__(19)('src');
+ var $toString = __webpack_require__(20);
+ var TO_STRING = 'toString';
+ var TPL = ('' + $toString).split(TO_STRING);
+
+ __webpack_require__(9).inspectSource = function (it) {
+ return $toString.call(it);
+ };
+
+ (module.exports = function (O, key, val, safe) {
+ var isFunction = typeof val == 'function';
+ if (isFunction) has(val, 'name') || hide(val, 'name', key);
+ if (O[key] === val) return;
+ if (isFunction) has(val, SRC) || hide(val, SRC, O[key] ? '' + O[key] : TPL.join(String(key)));
+ if (O === global) {
+ O[key] = val;
+ } else if (!safe) {
+ delete O[key];
+ hide(O, key, val);
+ } else if (O[key]) {
+ O[key] = val;
+ } else {
+ hide(O, key, val);
+ }
+ // add fake Function#toString for correct work wrapped methods / constructors with methods like LoDash isNative
+ })(Function.prototype, TO_STRING, function toString() {
+ return typeof this == 'function' && this[SRC] || $toString.call(this);
+ });
+
+
+/***/ }),
+/* 19 */
+/***/ (function(module, exports) {
+
+ var id = 0;
+ var px = Math.random();
+ module.exports = function (key) {
+ return 'Symbol('.concat(key === undefined ? '' : key, ')_', (++id + px).toString(36));
+ };
+
+
+/***/ }),
+/* 20 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ module.exports = __webpack_require__(21)('native-function-to-string', Function.toString);
+
+
+/***/ }),
+/* 21 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var core = __webpack_require__(9);
+ var global = __webpack_require__(4);
+ var SHARED = '__core-js_shared__';
+ var store = global[SHARED] || (global[SHARED] = {});
+
+ (module.exports = function (key, value) {
+ return store[key] || (store[key] = value !== undefined ? value : {});
+ })('versions', []).push({
+ version: core.version,
+ mode: __webpack_require__(22) ? 'pure' : 'global',
+ copyright: '© 2019 Denis Pushkarev (zloirock.ru)'
+ });
+
+
+/***/ }),
+/* 22 */
+/***/ (function(module, exports) {
+
+ module.exports = false;
+
+
+/***/ }),
+/* 23 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // optional / simple context binding
+ var aFunction = __webpack_require__(24);
+ module.exports = function (fn, that, length) {
+ aFunction(fn);
+ if (that === undefined) return fn;
+ switch (length) {
+ case 1: return function (a) {
+ return fn.call(that, a);
+ };
+ case 2: return function (a, b) {
+ return fn.call(that, a, b);
+ };
+ case 3: return function (a, b, c) {
+ return fn.call(that, a, b, c);
+ };
+ }
+ return function (/* ...args */) {
+ return fn.apply(that, arguments);
+ };
+ };
+
+
+/***/ }),
+/* 24 */
+/***/ (function(module, exports) {
+
+ module.exports = function (it) {
+ if (typeof it != 'function') throw TypeError(it + ' is not a function!');
+ return it;
+ };
+
+
+/***/ }),
+/* 25 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var META = __webpack_require__(19)('meta');
+ var isObject = __webpack_require__(13);
+ var has = __webpack_require__(5);
+ var setDesc = __webpack_require__(11).f;
+ var id = 0;
+ var isExtensible = Object.isExtensible || function () {
+ return true;
+ };
+ var FREEZE = !__webpack_require__(7)(function () {
+ return isExtensible(Object.preventExtensions({}));
+ });
+ var setMeta = function (it) {
+ setDesc(it, META, { value: {
+ i: 'O' + ++id, // object ID
+ w: {} // weak collections IDs
+ } });
+ };
+ var fastKey = function (it, create) {
+ // return primitive with prefix
+ if (!isObject(it)) return typeof it == 'symbol' ? it : (typeof it == 'string' ? 'S' : 'P') + it;
+ if (!has(it, META)) {
+ // can't set metadata to uncaught frozen object
+ if (!isExtensible(it)) return 'F';
+ // not necessary to add metadata
+ if (!create) return 'E';
+ // add missing metadata
+ setMeta(it);
+ // return object ID
+ } return it[META].i;
+ };
+ var getWeak = function (it, create) {
+ if (!has(it, META)) {
+ // can't set metadata to uncaught frozen object
+ if (!isExtensible(it)) return true;
+ // not necessary to add metadata
+ if (!create) return false;
+ // add missing metadata
+ setMeta(it);
+ // return hash weak collections IDs
+ } return it[META].w;
+ };
+ // add metadata on freeze-family methods calling
+ var onFreeze = function (it) {
+ if (FREEZE && meta.NEED && isExtensible(it) && !has(it, META)) setMeta(it);
+ return it;
+ };
+ var meta = module.exports = {
+ KEY: META,
+ NEED: false,
+ fastKey: fastKey,
+ getWeak: getWeak,
+ onFreeze: onFreeze
+ };
+
+
+/***/ }),
+/* 26 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var def = __webpack_require__(11).f;
+ var has = __webpack_require__(5);
+ var TAG = __webpack_require__(27)('toStringTag');
+
+ module.exports = function (it, tag, stat) {
+ if (it && !has(it = stat ? it : it.prototype, TAG)) def(it, TAG, { configurable: true, value: tag });
+ };
+
+
+/***/ }),
+/* 27 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var store = __webpack_require__(21)('wks');
+ var uid = __webpack_require__(19);
+ var Symbol = __webpack_require__(4).Symbol;
+ var USE_SYMBOL = typeof Symbol == 'function';
+
+ var $exports = module.exports = function (name) {
+ return store[name] || (store[name] =
+ USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name));
+ };
+
+ $exports.store = store;
+
+
+/***/ }),
+/* 28 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ exports.f = __webpack_require__(27);
+
+
+/***/ }),
+/* 29 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var global = __webpack_require__(4);
+ var core = __webpack_require__(9);
+ var LIBRARY = __webpack_require__(22);
+ var wksExt = __webpack_require__(28);
+ var defineProperty = __webpack_require__(11).f;
+ module.exports = function (name) {
+ var $Symbol = core.Symbol || (core.Symbol = LIBRARY ? {} : global.Symbol || {});
+ if (name.charAt(0) != '_' && !(name in $Symbol)) defineProperty($Symbol, name, { value: wksExt.f(name) });
+ };
+
+
+/***/ }),
+/* 30 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // all enumerable object keys, includes symbols
+ var getKeys = __webpack_require__(31);
+ var gOPS = __webpack_require__(43);
+ var pIE = __webpack_require__(44);
+ module.exports = function (it) {
+ var result = getKeys(it);
+ var getSymbols = gOPS.f;
+ if (getSymbols) {
+ var symbols = getSymbols(it);
+ var isEnum = pIE.f;
+ var i = 0;
+ var key;
+ while (symbols.length > i) if (isEnum.call(it, key = symbols[i++])) result.push(key);
+ } return result;
+ };
+
+
+/***/ }),
+/* 31 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.14 / 15.2.3.14 Object.keys(O)
+ var $keys = __webpack_require__(32);
+ var enumBugKeys = __webpack_require__(42);
+
+ module.exports = Object.keys || function keys(O) {
+ return $keys(O, enumBugKeys);
+ };
+
+
+/***/ }),
+/* 32 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var has = __webpack_require__(5);
+ var toIObject = __webpack_require__(33);
+ var arrayIndexOf = __webpack_require__(37)(false);
+ var IE_PROTO = __webpack_require__(41)('IE_PROTO');
+
+ module.exports = function (object, names) {
+ var O = toIObject(object);
+ var i = 0;
+ var result = [];
+ var key;
+ for (key in O) if (key != IE_PROTO) has(O, key) && result.push(key);
+ // Don't enum bug & hidden keys
+ while (names.length > i) if (has(O, key = names[i++])) {
+ ~arrayIndexOf(result, key) || result.push(key);
+ }
+ return result;
+ };
+
+
+/***/ }),
+/* 33 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // to indexed object, toObject with fallback for non-array-like ES3 strings
+ var IObject = __webpack_require__(34);
+ var defined = __webpack_require__(36);
+ module.exports = function (it) {
+ return IObject(defined(it));
+ };
+
+
+/***/ }),
+/* 34 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // fallback for non-array-like ES3 and non-enumerable old V8 strings
+ var cof = __webpack_require__(35);
+ // eslint-disable-next-line no-prototype-builtins
+ module.exports = Object('z').propertyIsEnumerable(0) ? Object : function (it) {
+ return cof(it) == 'String' ? it.split('') : Object(it);
+ };
+
+
+/***/ }),
+/* 35 */
+/***/ (function(module, exports) {
+
+ var toString = {}.toString;
+
+ module.exports = function (it) {
+ return toString.call(it).slice(8, -1);
+ };
+
+
+/***/ }),
+/* 36 */
+/***/ (function(module, exports) {
+
+ // 7.2.1 RequireObjectCoercible(argument)
+ module.exports = function (it) {
+ if (it == undefined) throw TypeError("Can't call method on " + it);
+ return it;
+ };
+
+
+/***/ }),
+/* 37 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // false -> Array#indexOf
+ // true -> Array#includes
+ var toIObject = __webpack_require__(33);
+ var toLength = __webpack_require__(38);
+ var toAbsoluteIndex = __webpack_require__(40);
+ module.exports = function (IS_INCLUDES) {
+ return function ($this, el, fromIndex) {
+ var O = toIObject($this);
+ var length = toLength(O.length);
+ var index = toAbsoluteIndex(fromIndex, length);
+ var value;
+ // Array#includes uses SameValueZero equality algorithm
+ // eslint-disable-next-line no-self-compare
+ if (IS_INCLUDES && el != el) while (length > index) {
+ value = O[index++];
+ // eslint-disable-next-line no-self-compare
+ if (value != value) return true;
+ // Array#indexOf ignores holes, Array#includes - not
+ } else for (;length > index; index++) if (IS_INCLUDES || index in O) {
+ if (O[index] === el) return IS_INCLUDES || index || 0;
+ } return !IS_INCLUDES && -1;
+ };
+ };
+
+
+/***/ }),
+/* 38 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 7.1.15 ToLength
+ var toInteger = __webpack_require__(39);
+ var min = Math.min;
+ module.exports = function (it) {
+ return it > 0 ? min(toInteger(it), 0x1fffffffffffff) : 0; // pow(2, 53) - 1 == 9007199254740991
+ };
+
+
+/***/ }),
+/* 39 */
+/***/ (function(module, exports) {
+
+ // 7.1.4 ToInteger
+ var ceil = Math.ceil;
+ var floor = Math.floor;
+ module.exports = function (it) {
+ return isNaN(it = +it) ? 0 : (it > 0 ? floor : ceil)(it);
+ };
+
+
+/***/ }),
+/* 40 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var toInteger = __webpack_require__(39);
+ var max = Math.max;
+ var min = Math.min;
+ module.exports = function (index, length) {
+ index = toInteger(index);
+ return index < 0 ? max(index + length, 0) : min(index, length);
+ };
+
+
+/***/ }),
+/* 41 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var shared = __webpack_require__(21)('keys');
+ var uid = __webpack_require__(19);
+ module.exports = function (key) {
+ return shared[key] || (shared[key] = uid(key));
+ };
+
+
+/***/ }),
+/* 42 */
+/***/ (function(module, exports) {
+
+ // IE 8- don't enum bug keys
+ module.exports = (
+ 'constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf'
+ ).split(',');
+
+
+/***/ }),
+/* 43 */
+/***/ (function(module, exports) {
+
+ exports.f = Object.getOwnPropertySymbols;
+
+
+/***/ }),
+/* 44 */
+/***/ (function(module, exports) {
+
+ exports.f = {}.propertyIsEnumerable;
+
+
+/***/ }),
+/* 45 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 7.2.2 IsArray(argument)
+ var cof = __webpack_require__(35);
+ module.exports = Array.isArray || function isArray(arg) {
+ return cof(arg) == 'Array';
+ };
+
+
+/***/ }),
+/* 46 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 7.1.13 ToObject(argument)
+ var defined = __webpack_require__(36);
+ module.exports = function (it) {
+ return Object(defined(it));
+ };
+
+
+/***/ }),
+/* 47 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties])
+ var anObject = __webpack_require__(12);
+ var dPs = __webpack_require__(48);
+ var enumBugKeys = __webpack_require__(42);
+ var IE_PROTO = __webpack_require__(41)('IE_PROTO');
+ var Empty = function () { /* empty */ };
+ var PROTOTYPE = 'prototype';
+
+ // Create object with fake `null` prototype: use iframe Object with cleared prototype
+ var createDict = function () {
+ // Thrash, waste and sodomy: IE GC bug
+ var iframe = __webpack_require__(15)('iframe');
+ var i = enumBugKeys.length;
+ var lt = '<';
+ var gt = '>';
+ var iframeDocument;
+ iframe.style.display = 'none';
+ __webpack_require__(49).appendChild(iframe);
+ iframe.src = 'javascript:'; // eslint-disable-line no-script-url
+ // createDict = iframe.contentWindow.Object;
+ // html.removeChild(iframe);
+ iframeDocument = iframe.contentWindow.document;
+ iframeDocument.open();
+ iframeDocument.write(lt + 'script' + gt + 'document.F=Object' + lt + '/script' + gt);
+ iframeDocument.close();
+ createDict = iframeDocument.F;
+ while (i--) delete createDict[PROTOTYPE][enumBugKeys[i]];
+ return createDict();
+ };
+
+ module.exports = Object.create || function create(O, Properties) {
+ var result;
+ if (O !== null) {
+ Empty[PROTOTYPE] = anObject(O);
+ result = new Empty();
+ Empty[PROTOTYPE] = null;
+ // add "__proto__" for Object.getPrototypeOf polyfill
+ result[IE_PROTO] = O;
+ } else result = createDict();
+ return Properties === undefined ? result : dPs(result, Properties);
+ };
+
+
+/***/ }),
+/* 48 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var dP = __webpack_require__(11);
+ var anObject = __webpack_require__(12);
+ var getKeys = __webpack_require__(31);
+
+ module.exports = __webpack_require__(6) ? Object.defineProperties : function defineProperties(O, Properties) {
+ anObject(O);
+ var keys = getKeys(Properties);
+ var length = keys.length;
+ var i = 0;
+ var P;
+ while (length > i) dP.f(O, P = keys[i++], Properties[P]);
+ return O;
+ };
+
+
+/***/ }),
+/* 49 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var document = __webpack_require__(4).document;
+ module.exports = document && document.documentElement;
+
+
+/***/ }),
+/* 50 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // fallback for IE11 buggy Object.getOwnPropertyNames with iframe and window
+ var toIObject = __webpack_require__(33);
+ var gOPN = __webpack_require__(51).f;
+ var toString = {}.toString;
+
+ var windowNames = typeof window == 'object' && window && Object.getOwnPropertyNames
+ ? Object.getOwnPropertyNames(window) : [];
+
+ var getWindowNames = function (it) {
+ try {
+ return gOPN(it);
+ } catch (e) {
+ return windowNames.slice();
+ }
+ };
+
+ module.exports.f = function getOwnPropertyNames(it) {
+ return windowNames && toString.call(it) == '[object Window]' ? getWindowNames(it) : gOPN(toIObject(it));
+ };
+
+
+/***/ }),
+/* 51 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.7 / 15.2.3.4 Object.getOwnPropertyNames(O)
+ var $keys = __webpack_require__(32);
+ var hiddenKeys = __webpack_require__(42).concat('length', 'prototype');
+
+ exports.f = Object.getOwnPropertyNames || function getOwnPropertyNames(O) {
+ return $keys(O, hiddenKeys);
+ };
+
+
+/***/ }),
+/* 52 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var pIE = __webpack_require__(44);
+ var createDesc = __webpack_require__(17);
+ var toIObject = __webpack_require__(33);
+ var toPrimitive = __webpack_require__(16);
+ var has = __webpack_require__(5);
+ var IE8_DOM_DEFINE = __webpack_require__(14);
+ var gOPD = Object.getOwnPropertyDescriptor;
+
+ exports.f = __webpack_require__(6) ? gOPD : function getOwnPropertyDescriptor(O, P) {
+ O = toIObject(O);
+ P = toPrimitive(P, true);
+ if (IE8_DOM_DEFINE) try {
+ return gOPD(O, P);
+ } catch (e) { /* empty */ }
+ if (has(O, P)) return createDesc(!pIE.f.call(O, P), O[P]);
+ };
+
+
+/***/ }),
+/* 53 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ // 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties])
+ $export($export.S, 'Object', { create: __webpack_require__(47) });
+
+
+/***/ }),
+/* 54 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ // 19.1.2.4 / 15.2.3.6 Object.defineProperty(O, P, Attributes)
+ $export($export.S + $export.F * !__webpack_require__(6), 'Object', { defineProperty: __webpack_require__(11).f });
+
+
+/***/ }),
+/* 55 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ // 19.1.2.3 / 15.2.3.7 Object.defineProperties(O, Properties)
+ $export($export.S + $export.F * !__webpack_require__(6), 'Object', { defineProperties: __webpack_require__(48) });
+
+
+/***/ }),
+/* 56 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.6 Object.getOwnPropertyDescriptor(O, P)
+ var toIObject = __webpack_require__(33);
+ var $getOwnPropertyDescriptor = __webpack_require__(52).f;
+
+ __webpack_require__(57)('getOwnPropertyDescriptor', function () {
+ return function getOwnPropertyDescriptor(it, key) {
+ return $getOwnPropertyDescriptor(toIObject(it), key);
+ };
+ });
+
+
+/***/ }),
+/* 57 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // most Object methods by ES6 should accept primitives
+ var $export = __webpack_require__(8);
+ var core = __webpack_require__(9);
+ var fails = __webpack_require__(7);
+ module.exports = function (KEY, exec) {
+ var fn = (core.Object || {})[KEY] || Object[KEY];
+ var exp = {};
+ exp[KEY] = exec(fn);
+ $export($export.S + $export.F * fails(function () { fn(1); }), 'Object', exp);
+ };
+
+
+/***/ }),
+/* 58 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.9 Object.getPrototypeOf(O)
+ var toObject = __webpack_require__(46);
+ var $getPrototypeOf = __webpack_require__(59);
+
+ __webpack_require__(57)('getPrototypeOf', function () {
+ return function getPrototypeOf(it) {
+ return $getPrototypeOf(toObject(it));
+ };
+ });
+
+
+/***/ }),
+/* 59 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.9 / 15.2.3.2 Object.getPrototypeOf(O)
+ var has = __webpack_require__(5);
+ var toObject = __webpack_require__(46);
+ var IE_PROTO = __webpack_require__(41)('IE_PROTO');
+ var ObjectProto = Object.prototype;
+
+ module.exports = Object.getPrototypeOf || function (O) {
+ O = toObject(O);
+ if (has(O, IE_PROTO)) return O[IE_PROTO];
+ if (typeof O.constructor == 'function' && O instanceof O.constructor) {
+ return O.constructor.prototype;
+ } return O instanceof Object ? ObjectProto : null;
+ };
+
+
+/***/ }),
+/* 60 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.14 Object.keys(O)
+ var toObject = __webpack_require__(46);
+ var $keys = __webpack_require__(31);
+
+ __webpack_require__(57)('keys', function () {
+ return function keys(it) {
+ return $keys(toObject(it));
+ };
+ });
+
+
+/***/ }),
+/* 61 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.7 Object.getOwnPropertyNames(O)
+ __webpack_require__(57)('getOwnPropertyNames', function () {
+ return __webpack_require__(50).f;
+ });
+
+
+/***/ }),
+/* 62 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.5 Object.freeze(O)
+ var isObject = __webpack_require__(13);
+ var meta = __webpack_require__(25).onFreeze;
+
+ __webpack_require__(57)('freeze', function ($freeze) {
+ return function freeze(it) {
+ return $freeze && isObject(it) ? $freeze(meta(it)) : it;
+ };
+ });
+
+
+/***/ }),
+/* 63 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.17 Object.seal(O)
+ var isObject = __webpack_require__(13);
+ var meta = __webpack_require__(25).onFreeze;
+
+ __webpack_require__(57)('seal', function ($seal) {
+ return function seal(it) {
+ return $seal && isObject(it) ? $seal(meta(it)) : it;
+ };
+ });
+
+
+/***/ }),
+/* 64 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.15 Object.preventExtensions(O)
+ var isObject = __webpack_require__(13);
+ var meta = __webpack_require__(25).onFreeze;
+
+ __webpack_require__(57)('preventExtensions', function ($preventExtensions) {
+ return function preventExtensions(it) {
+ return $preventExtensions && isObject(it) ? $preventExtensions(meta(it)) : it;
+ };
+ });
+
+
+/***/ }),
+/* 65 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.12 Object.isFrozen(O)
+ var isObject = __webpack_require__(13);
+
+ __webpack_require__(57)('isFrozen', function ($isFrozen) {
+ return function isFrozen(it) {
+ return isObject(it) ? $isFrozen ? $isFrozen(it) : false : true;
+ };
+ });
+
+
+/***/ }),
+/* 66 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.13 Object.isSealed(O)
+ var isObject = __webpack_require__(13);
+
+ __webpack_require__(57)('isSealed', function ($isSealed) {
+ return function isSealed(it) {
+ return isObject(it) ? $isSealed ? $isSealed(it) : false : true;
+ };
+ });
+
+
+/***/ }),
+/* 67 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.2.11 Object.isExtensible(O)
+ var isObject = __webpack_require__(13);
+
+ __webpack_require__(57)('isExtensible', function ($isExtensible) {
+ return function isExtensible(it) {
+ return isObject(it) ? $isExtensible ? $isExtensible(it) : true : false;
+ };
+ });
+
+
+/***/ }),
+/* 68 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.3.1 Object.assign(target, source)
+ var $export = __webpack_require__(8);
+
+ $export($export.S + $export.F, 'Object', { assign: __webpack_require__(69) });
+
+
+/***/ }),
+/* 69 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 19.1.2.1 Object.assign(target, source, ...)
+ var DESCRIPTORS = __webpack_require__(6);
+ var getKeys = __webpack_require__(31);
+ var gOPS = __webpack_require__(43);
+ var pIE = __webpack_require__(44);
+ var toObject = __webpack_require__(46);
+ var IObject = __webpack_require__(34);
+ var $assign = Object.assign;
+
+ // should work with symbols and should have deterministic property order (V8 bug)
+ module.exports = !$assign || __webpack_require__(7)(function () {
+ var A = {};
+ var B = {};
+ // eslint-disable-next-line no-undef
+ var S = Symbol();
+ var K = 'abcdefghijklmnopqrst';
+ A[S] = 7;
+ K.split('').forEach(function (k) { B[k] = k; });
+ return $assign({}, A)[S] != 7 || Object.keys($assign({}, B)).join('') != K;
+ }) ? function assign(target, source) { // eslint-disable-line no-unused-vars
+ var T = toObject(target);
+ var aLen = arguments.length;
+ var index = 1;
+ var getSymbols = gOPS.f;
+ var isEnum = pIE.f;
+ while (aLen > index) {
+ var S = IObject(arguments[index++]);
+ var keys = getSymbols ? getKeys(S).concat(getSymbols(S)) : getKeys(S);
+ var length = keys.length;
+ var j = 0;
+ var key;
+ while (length > j) {
+ key = keys[j++];
+ if (!DESCRIPTORS || isEnum.call(S, key)) T[key] = S[key];
+ }
+ } return T;
+ } : $assign;
+
+
+/***/ }),
+/* 70 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.3.10 Object.is(value1, value2)
+ var $export = __webpack_require__(8);
+ $export($export.S, 'Object', { is: __webpack_require__(71) });
+
+
+/***/ }),
+/* 71 */
+/***/ (function(module, exports) {
+
+ // 7.2.9 SameValue(x, y)
+ module.exports = Object.is || function is(x, y) {
+ // eslint-disable-next-line no-self-compare
+ return x === y ? x !== 0 || 1 / x === 1 / y : x != x && y != y;
+ };
+
+
+/***/ }),
+/* 72 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.1.3.19 Object.setPrototypeOf(O, proto)
+ var $export = __webpack_require__(8);
+ $export($export.S, 'Object', { setPrototypeOf: __webpack_require__(73).set });
+
+
+/***/ }),
+/* 73 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // Works with __proto__ only. Old v8 can't work with null proto objects.
+ /* eslint-disable no-proto */
+ var isObject = __webpack_require__(13);
+ var anObject = __webpack_require__(12);
+ var check = function (O, proto) {
+ anObject(O);
+ if (!isObject(proto) && proto !== null) throw TypeError(proto + ": can't set as prototype!");
+ };
+ module.exports = {
+ set: Object.setPrototypeOf || ('__proto__' in {} ? // eslint-disable-line
+ function (test, buggy, set) {
+ try {
+ set = __webpack_require__(23)(Function.call, __webpack_require__(52).f(Object.prototype, '__proto__').set, 2);
+ set(test, []);
+ buggy = !(test instanceof Array);
+ } catch (e) { buggy = true; }
+ return function setPrototypeOf(O, proto) {
+ check(O, proto);
+ if (buggy) O.__proto__ = proto;
+ else set(O, proto);
+ return O;
+ };
+ }({}, false) : undefined),
+ check: check
+ };
+
+
+/***/ }),
+/* 74 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 19.1.3.6 Object.prototype.toString()
+ var classof = __webpack_require__(75);
+ var test = {};
+ test[__webpack_require__(27)('toStringTag')] = 'z';
+ if (test + '' != '[object z]') {
+ __webpack_require__(18)(Object.prototype, 'toString', function toString() {
+ return '[object ' + classof(this) + ']';
+ }, true);
+ }
+
+
+/***/ }),
+/* 75 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // getting tag from 19.1.3.6 Object.prototype.toString()
+ var cof = __webpack_require__(35);
+ var TAG = __webpack_require__(27)('toStringTag');
+ // ES3 wrong here
+ var ARG = cof(function () { return arguments; }()) == 'Arguments';
+
+ // fallback for IE11 Script Access Denied error
+ var tryGet = function (it, key) {
+ try {
+ return it[key];
+ } catch (e) { /* empty */ }
+ };
+
+ module.exports = function (it) {
+ var O, T, B;
+ return it === undefined ? 'Undefined' : it === null ? 'Null'
+ // @@toStringTag case
+ : typeof (T = tryGet(O = Object(it), TAG)) == 'string' ? T
+ // builtinTag case
+ : ARG ? cof(O)
+ // ES3 arguments fallback
+ : (B = cof(O)) == 'Object' && typeof O.callee == 'function' ? 'Arguments' : B;
+ };
+
+
+/***/ }),
+/* 76 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 19.2.3.2 / 15.3.4.5 Function.prototype.bind(thisArg, args...)
+ var $export = __webpack_require__(8);
+
+ $export($export.P, 'Function', { bind: __webpack_require__(77) });
+
+
+/***/ }),
+/* 77 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var aFunction = __webpack_require__(24);
+ var isObject = __webpack_require__(13);
+ var invoke = __webpack_require__(78);
+ var arraySlice = [].slice;
+ var factories = {};
+
+ var construct = function (F, len, args) {
+ if (!(len in factories)) {
+ for (var n = [], i = 0; i < len; i++) n[i] = 'a[' + i + ']';
+ // eslint-disable-next-line no-new-func
+ factories[len] = Function('F,a', 'return new F(' + n.join(',') + ')');
+ } return factories[len](F, args);
+ };
+
+ module.exports = Function.bind || function bind(that /* , ...args */) {
+ var fn = aFunction(this);
+ var partArgs = arraySlice.call(arguments, 1);
+ var bound = function (/* args... */) {
+ var args = partArgs.concat(arraySlice.call(arguments));
+ return this instanceof bound ? construct(fn, args.length, args) : invoke(fn, args, that);
+ };
+ if (isObject(fn.prototype)) bound.prototype = fn.prototype;
+ return bound;
+ };
+
+
+/***/ }),
+/* 78 */
+/***/ (function(module, exports) {
+
+ // fast apply, http://jsperf.lnkit.com/fast-apply/5
+ module.exports = function (fn, args, that) {
+ var un = that === undefined;
+ switch (args.length) {
+ case 0: return un ? fn()
+ : fn.call(that);
+ case 1: return un ? fn(args[0])
+ : fn.call(that, args[0]);
+ case 2: return un ? fn(args[0], args[1])
+ : fn.call(that, args[0], args[1]);
+ case 3: return un ? fn(args[0], args[1], args[2])
+ : fn.call(that, args[0], args[1], args[2]);
+ case 4: return un ? fn(args[0], args[1], args[2], args[3])
+ : fn.call(that, args[0], args[1], args[2], args[3]);
+ } return fn.apply(that, args);
+ };
+
+
+/***/ }),
+/* 79 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var dP = __webpack_require__(11).f;
+ var FProto = Function.prototype;
+ var nameRE = /^\s*function ([^ (]*)/;
+ var NAME = 'name';
+
+ // 19.2.4.2 name
+ NAME in FProto || __webpack_require__(6) && dP(FProto, NAME, {
+ configurable: true,
+ get: function () {
+ try {
+ return ('' + this).match(nameRE)[1];
+ } catch (e) {
+ return '';
+ }
+ }
+ });
+
+
+/***/ }),
+/* 80 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var isObject = __webpack_require__(13);
+ var getPrototypeOf = __webpack_require__(59);
+ var HAS_INSTANCE = __webpack_require__(27)('hasInstance');
+ var FunctionProto = Function.prototype;
+ // 19.2.3.6 Function.prototype[@@hasInstance](V)
+ if (!(HAS_INSTANCE in FunctionProto)) __webpack_require__(11).f(FunctionProto, HAS_INSTANCE, { value: function (O) {
+ if (typeof this != 'function' || !isObject(O)) return false;
+ if (!isObject(this.prototype)) return O instanceof this;
+ // for environment w/o native `@@hasInstance` logic enough `instanceof`, but add this:
+ while (O = getPrototypeOf(O)) if (this.prototype === O) return true;
+ return false;
+ } });
+
+
+/***/ }),
+/* 81 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var $parseInt = __webpack_require__(82);
+ // 18.2.5 parseInt(string, radix)
+ $export($export.G + $export.F * (parseInt != $parseInt), { parseInt: $parseInt });
+
+
+/***/ }),
+/* 82 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $parseInt = __webpack_require__(4).parseInt;
+ var $trim = __webpack_require__(83).trim;
+ var ws = __webpack_require__(84);
+ var hex = /^[-+]?0[xX]/;
+
+ module.exports = $parseInt(ws + '08') !== 8 || $parseInt(ws + '0x16') !== 22 ? function parseInt(str, radix) {
+ var string = $trim(String(str), 3);
+ return $parseInt(string, (radix >>> 0) || (hex.test(string) ? 16 : 10));
+ } : $parseInt;
+
+
+/***/ }),
+/* 83 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var defined = __webpack_require__(36);
+ var fails = __webpack_require__(7);
+ var spaces = __webpack_require__(84);
+ var space = '[' + spaces + ']';
+ var non = '\u200b\u0085';
+ var ltrim = RegExp('^' + space + space + '*');
+ var rtrim = RegExp(space + space + '*$');
+
+ var exporter = function (KEY, exec, ALIAS) {
+ var exp = {};
+ var FORCE = fails(function () {
+ return !!spaces[KEY]() || non[KEY]() != non;
+ });
+ var fn = exp[KEY] = FORCE ? exec(trim) : spaces[KEY];
+ if (ALIAS) exp[ALIAS] = fn;
+ $export($export.P + $export.F * FORCE, 'String', exp);
+ };
+
+ // 1 -> String#trimLeft
+ // 2 -> String#trimRight
+ // 3 -> String#trim
+ var trim = exporter.trim = function (string, TYPE) {
+ string = String(defined(string));
+ if (TYPE & 1) string = string.replace(ltrim, '');
+ if (TYPE & 2) string = string.replace(rtrim, '');
+ return string;
+ };
+
+ module.exports = exporter;
+
+
+/***/ }),
+/* 84 */
+/***/ (function(module, exports) {
+
+ module.exports = '\x09\x0A\x0B\x0C\x0D\x20\xA0\u1680\u180E\u2000\u2001\u2002\u2003' +
+ '\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\u2028\u2029\uFEFF';
+
+
+/***/ }),
+/* 85 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var $parseFloat = __webpack_require__(86);
+ // 18.2.4 parseFloat(string)
+ $export($export.G + $export.F * (parseFloat != $parseFloat), { parseFloat: $parseFloat });
+
+
+/***/ }),
+/* 86 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $parseFloat = __webpack_require__(4).parseFloat;
+ var $trim = __webpack_require__(83).trim;
+
+ module.exports = 1 / $parseFloat(__webpack_require__(84) + '-0') !== -Infinity ? function parseFloat(str) {
+ var string = $trim(String(str), 3);
+ var result = $parseFloat(string);
+ return result === 0 && string.charAt(0) == '-' ? -0 : result;
+ } : $parseFloat;
+
+
+/***/ }),
+/* 87 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var global = __webpack_require__(4);
+ var has = __webpack_require__(5);
+ var cof = __webpack_require__(35);
+ var inheritIfRequired = __webpack_require__(88);
+ var toPrimitive = __webpack_require__(16);
+ var fails = __webpack_require__(7);
+ var gOPN = __webpack_require__(51).f;
+ var gOPD = __webpack_require__(52).f;
+ var dP = __webpack_require__(11).f;
+ var $trim = __webpack_require__(83).trim;
+ var NUMBER = 'Number';
+ var $Number = global[NUMBER];
+ var Base = $Number;
+ var proto = $Number.prototype;
+ // Opera ~12 has broken Object#toString
+ var BROKEN_COF = cof(__webpack_require__(47)(proto)) == NUMBER;
+ var TRIM = 'trim' in String.prototype;
+
+ // 7.1.3 ToNumber(argument)
+ var toNumber = function (argument) {
+ var it = toPrimitive(argument, false);
+ if (typeof it == 'string' && it.length > 2) {
+ it = TRIM ? it.trim() : $trim(it, 3);
+ var first = it.charCodeAt(0);
+ var third, radix, maxCode;
+ if (first === 43 || first === 45) {
+ third = it.charCodeAt(2);
+ if (third === 88 || third === 120) return NaN; // Number('+0x1') should be NaN, old V8 fix
+ } else if (first === 48) {
+ switch (it.charCodeAt(1)) {
+ case 66: case 98: radix = 2; maxCode = 49; break; // fast equal /^0b[01]+$/i
+ case 79: case 111: radix = 8; maxCode = 55; break; // fast equal /^0o[0-7]+$/i
+ default: return +it;
+ }
+ for (var digits = it.slice(2), i = 0, l = digits.length, code; i < l; i++) {
+ code = digits.charCodeAt(i);
+ // parseInt parses a string to a first unavailable symbol
+ // but ToNumber should return NaN if a string contains unavailable symbols
+ if (code < 48 || code > maxCode) return NaN;
+ } return parseInt(digits, radix);
+ }
+ } return +it;
+ };
+
+ if (!$Number(' 0o1') || !$Number('0b1') || $Number('+0x1')) {
+ $Number = function Number(value) {
+ var it = arguments.length < 1 ? 0 : value;
+ var that = this;
+ return that instanceof $Number
+ // check on 1..constructor(foo) case
+ && (BROKEN_COF ? fails(function () { proto.valueOf.call(that); }) : cof(that) != NUMBER)
+ ? inheritIfRequired(new Base(toNumber(it)), that, $Number) : toNumber(it);
+ };
+ for (var keys = __webpack_require__(6) ? gOPN(Base) : (
+ // ES3:
+ 'MAX_VALUE,MIN_VALUE,NaN,NEGATIVE_INFINITY,POSITIVE_INFINITY,' +
+ // ES6 (in case, if modules with ES6 Number statics required before):
+ 'EPSILON,isFinite,isInteger,isNaN,isSafeInteger,MAX_SAFE_INTEGER,' +
+ 'MIN_SAFE_INTEGER,parseFloat,parseInt,isInteger'
+ ).split(','), j = 0, key; keys.length > j; j++) {
+ if (has(Base, key = keys[j]) && !has($Number, key)) {
+ dP($Number, key, gOPD(Base, key));
+ }
+ }
+ $Number.prototype = proto;
+ proto.constructor = $Number;
+ __webpack_require__(18)(global, NUMBER, $Number);
+ }
+
+
+/***/ }),
+/* 88 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var isObject = __webpack_require__(13);
+ var setPrototypeOf = __webpack_require__(73).set;
+ module.exports = function (that, target, C) {
+ var S = target.constructor;
+ var P;
+ if (S !== C && typeof S == 'function' && (P = S.prototype) !== C.prototype && isObject(P) && setPrototypeOf) {
+ setPrototypeOf(that, P);
+ } return that;
+ };
+
+
+/***/ }),
+/* 89 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toInteger = __webpack_require__(39);
+ var aNumberValue = __webpack_require__(90);
+ var repeat = __webpack_require__(91);
+ var $toFixed = 1.0.toFixed;
+ var floor = Math.floor;
+ var data = [0, 0, 0, 0, 0, 0];
+ var ERROR = 'Number.toFixed: incorrect invocation!';
+ var ZERO = '0';
+
+ var multiply = function (n, c) {
+ var i = -1;
+ var c2 = c;
+ while (++i < 6) {
+ c2 += n * data[i];
+ data[i] = c2 % 1e7;
+ c2 = floor(c2 / 1e7);
+ }
+ };
+ var divide = function (n) {
+ var i = 6;
+ var c = 0;
+ while (--i >= 0) {
+ c += data[i];
+ data[i] = floor(c / n);
+ c = (c % n) * 1e7;
+ }
+ };
+ var numToString = function () {
+ var i = 6;
+ var s = '';
+ while (--i >= 0) {
+ if (s !== '' || i === 0 || data[i] !== 0) {
+ var t = String(data[i]);
+ s = s === '' ? t : s + repeat.call(ZERO, 7 - t.length) + t;
+ }
+ } return s;
+ };
+ var pow = function (x, n, acc) {
+ return n === 0 ? acc : n % 2 === 1 ? pow(x, n - 1, acc * x) : pow(x * x, n / 2, acc);
+ };
+ var log = function (x) {
+ var n = 0;
+ var x2 = x;
+ while (x2 >= 4096) {
+ n += 12;
+ x2 /= 4096;
+ }
+ while (x2 >= 2) {
+ n += 1;
+ x2 /= 2;
+ } return n;
+ };
+
+ $export($export.P + $export.F * (!!$toFixed && (
+ 0.00008.toFixed(3) !== '0.000' ||
+ 0.9.toFixed(0) !== '1' ||
+ 1.255.toFixed(2) !== '1.25' ||
+ 1000000000000000128.0.toFixed(0) !== '1000000000000000128'
+ ) || !__webpack_require__(7)(function () {
+ // V8 ~ Android 4.3-
+ $toFixed.call({});
+ })), 'Number', {
+ toFixed: function toFixed(fractionDigits) {
+ var x = aNumberValue(this, ERROR);
+ var f = toInteger(fractionDigits);
+ var s = '';
+ var m = ZERO;
+ var e, z, j, k;
+ if (f < 0 || f > 20) throw RangeError(ERROR);
+ // eslint-disable-next-line no-self-compare
+ if (x != x) return 'NaN';
+ if (x <= -1e21 || x >= 1e21) return String(x);
+ if (x < 0) {
+ s = '-';
+ x = -x;
+ }
+ if (x > 1e-21) {
+ e = log(x * pow(2, 69, 1)) - 69;
+ z = e < 0 ? x * pow(2, -e, 1) : x / pow(2, e, 1);
+ z *= 0x10000000000000;
+ e = 52 - e;
+ if (e > 0) {
+ multiply(0, z);
+ j = f;
+ while (j >= 7) {
+ multiply(1e7, 0);
+ j -= 7;
+ }
+ multiply(pow(10, j, 1), 0);
+ j = e - 1;
+ while (j >= 23) {
+ divide(1 << 23);
+ j -= 23;
+ }
+ divide(1 << j);
+ multiply(1, 1);
+ divide(2);
+ m = numToString();
+ } else {
+ multiply(0, z);
+ multiply(1 << -e, 0);
+ m = numToString() + repeat.call(ZERO, f);
+ }
+ }
+ if (f > 0) {
+ k = m.length;
+ m = s + (k <= f ? '0.' + repeat.call(ZERO, f - k) + m : m.slice(0, k - f) + '.' + m.slice(k - f));
+ } else {
+ m = s + m;
+ } return m;
+ }
+ });
+
+
+/***/ }),
+/* 90 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var cof = __webpack_require__(35);
+ module.exports = function (it, msg) {
+ if (typeof it != 'number' && cof(it) != 'Number') throw TypeError(msg);
+ return +it;
+ };
+
+
+/***/ }),
+/* 91 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var toInteger = __webpack_require__(39);
+ var defined = __webpack_require__(36);
+
+ module.exports = function repeat(count) {
+ var str = String(defined(this));
+ var res = '';
+ var n = toInteger(count);
+ if (n < 0 || n == Infinity) throw RangeError("Count can't be negative");
+ for (;n > 0; (n >>>= 1) && (str += str)) if (n & 1) res += str;
+ return res;
+ };
+
+
+/***/ }),
+/* 92 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $fails = __webpack_require__(7);
+ var aNumberValue = __webpack_require__(90);
+ var $toPrecision = 1.0.toPrecision;
+
+ $export($export.P + $export.F * ($fails(function () {
+ // IE7-
+ return $toPrecision.call(1, undefined) !== '1';
+ }) || !$fails(function () {
+ // V8 ~ Android 4.3-
+ $toPrecision.call({});
+ })), 'Number', {
+ toPrecision: function toPrecision(precision) {
+ var that = aNumberValue(this, 'Number#toPrecision: incorrect invocation!');
+ return precision === undefined ? $toPrecision.call(that) : $toPrecision.call(that, precision);
+ }
+ });
+
+
+/***/ }),
+/* 93 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.1.2.1 Number.EPSILON
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Number', { EPSILON: Math.pow(2, -52) });
+
+
+/***/ }),
+/* 94 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.1.2.2 Number.isFinite(number)
+ var $export = __webpack_require__(8);
+ var _isFinite = __webpack_require__(4).isFinite;
+
+ $export($export.S, 'Number', {
+ isFinite: function isFinite(it) {
+ return typeof it == 'number' && _isFinite(it);
+ }
+ });
+
+
+/***/ }),
+/* 95 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.1.2.3 Number.isInteger(number)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Number', { isInteger: __webpack_require__(96) });
+
+
+/***/ }),
+/* 96 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.1.2.3 Number.isInteger(number)
+ var isObject = __webpack_require__(13);
+ var floor = Math.floor;
+ module.exports = function isInteger(it) {
+ return !isObject(it) && isFinite(it) && floor(it) === it;
+ };
+
+
+/***/ }),
+/* 97 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.1.2.4 Number.isNaN(number)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Number', {
+ isNaN: function isNaN(number) {
+ // eslint-disable-next-line no-self-compare
+ return number != number;
+ }
+ });
+
+
+/***/ }),
+/* 98 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.1.2.5 Number.isSafeInteger(number)
+ var $export = __webpack_require__(8);
+ var isInteger = __webpack_require__(96);
+ var abs = Math.abs;
+
+ $export($export.S, 'Number', {
+ isSafeInteger: function isSafeInteger(number) {
+ return isInteger(number) && abs(number) <= 0x1fffffffffffff;
+ }
+ });
+
+
+/***/ }),
+/* 99 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.1.2.6 Number.MAX_SAFE_INTEGER
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Number', { MAX_SAFE_INTEGER: 0x1fffffffffffff });
+
+
+/***/ }),
+/* 100 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.1.2.10 Number.MIN_SAFE_INTEGER
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Number', { MIN_SAFE_INTEGER: -0x1fffffffffffff });
+
+
+/***/ }),
+/* 101 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var $parseFloat = __webpack_require__(86);
+ // 20.1.2.12 Number.parseFloat(string)
+ $export($export.S + $export.F * (Number.parseFloat != $parseFloat), 'Number', { parseFloat: $parseFloat });
+
+
+/***/ }),
+/* 102 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var $parseInt = __webpack_require__(82);
+ // 20.1.2.13 Number.parseInt(string, radix)
+ $export($export.S + $export.F * (Number.parseInt != $parseInt), 'Number', { parseInt: $parseInt });
+
+
+/***/ }),
+/* 103 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.3 Math.acosh(x)
+ var $export = __webpack_require__(8);
+ var log1p = __webpack_require__(104);
+ var sqrt = Math.sqrt;
+ var $acosh = Math.acosh;
+
+ $export($export.S + $export.F * !($acosh
+ // V8 bug: https://code.google.com/p/v8/issues/detail?id=3509
+ && Math.floor($acosh(Number.MAX_VALUE)) == 710
+ // Tor Browser bug: Math.acosh(Infinity) -> NaN
+ && $acosh(Infinity) == Infinity
+ ), 'Math', {
+ acosh: function acosh(x) {
+ return (x = +x) < 1 ? NaN : x > 94906265.62425156
+ ? Math.log(x) + Math.LN2
+ : log1p(x - 1 + sqrt(x - 1) * sqrt(x + 1));
+ }
+ });
+
+
+/***/ }),
+/* 104 */
+/***/ (function(module, exports) {
+
+ // 20.2.2.20 Math.log1p(x)
+ module.exports = Math.log1p || function log1p(x) {
+ return (x = +x) > -1e-8 && x < 1e-8 ? x - x * x / 2 : Math.log(1 + x);
+ };
+
+
+/***/ }),
+/* 105 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.5 Math.asinh(x)
+ var $export = __webpack_require__(8);
+ var $asinh = Math.asinh;
+
+ function asinh(x) {
+ return !isFinite(x = +x) || x == 0 ? x : x < 0 ? -asinh(-x) : Math.log(x + Math.sqrt(x * x + 1));
+ }
+
+ // Tor Browser bug: Math.asinh(0) -> -0
+ $export($export.S + $export.F * !($asinh && 1 / $asinh(0) > 0), 'Math', { asinh: asinh });
+
+
+/***/ }),
+/* 106 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.7 Math.atanh(x)
+ var $export = __webpack_require__(8);
+ var $atanh = Math.atanh;
+
+ // Tor Browser bug: Math.atanh(-0) -> 0
+ $export($export.S + $export.F * !($atanh && 1 / $atanh(-0) < 0), 'Math', {
+ atanh: function atanh(x) {
+ return (x = +x) == 0 ? x : Math.log((1 + x) / (1 - x)) / 2;
+ }
+ });
+
+
+/***/ }),
+/* 107 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.9 Math.cbrt(x)
+ var $export = __webpack_require__(8);
+ var sign = __webpack_require__(108);
+
+ $export($export.S, 'Math', {
+ cbrt: function cbrt(x) {
+ return sign(x = +x) * Math.pow(Math.abs(x), 1 / 3);
+ }
+ });
+
+
+/***/ }),
+/* 108 */
+/***/ (function(module, exports) {
+
+ // 20.2.2.28 Math.sign(x)
+ module.exports = Math.sign || function sign(x) {
+ // eslint-disable-next-line no-self-compare
+ return (x = +x) == 0 || x != x ? x : x < 0 ? -1 : 1;
+ };
+
+
+/***/ }),
+/* 109 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.11 Math.clz32(x)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ clz32: function clz32(x) {
+ return (x >>>= 0) ? 31 - Math.floor(Math.log(x + 0.5) * Math.LOG2E) : 32;
+ }
+ });
+
+
+/***/ }),
+/* 110 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.12 Math.cosh(x)
+ var $export = __webpack_require__(8);
+ var exp = Math.exp;
+
+ $export($export.S, 'Math', {
+ cosh: function cosh(x) {
+ return (exp(x = +x) + exp(-x)) / 2;
+ }
+ });
+
+
+/***/ }),
+/* 111 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.14 Math.expm1(x)
+ var $export = __webpack_require__(8);
+ var $expm1 = __webpack_require__(112);
+
+ $export($export.S + $export.F * ($expm1 != Math.expm1), 'Math', { expm1: $expm1 });
+
+
+/***/ }),
+/* 112 */
+/***/ (function(module, exports) {
+
+ // 20.2.2.14 Math.expm1(x)
+ var $expm1 = Math.expm1;
+ module.exports = (!$expm1
+ // Old FF bug
+ || $expm1(10) > 22025.465794806719 || $expm1(10) < 22025.4657948067165168
+ // Tor Browser bug
+ || $expm1(-2e-17) != -2e-17
+ ) ? function expm1(x) {
+ return (x = +x) == 0 ? x : x > -1e-6 && x < 1e-6 ? x + x * x / 2 : Math.exp(x) - 1;
+ } : $expm1;
+
+
+/***/ }),
+/* 113 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.16 Math.fround(x)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', { fround: __webpack_require__(114) });
+
+
+/***/ }),
+/* 114 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.16 Math.fround(x)
+ var sign = __webpack_require__(108);
+ var pow = Math.pow;
+ var EPSILON = pow(2, -52);
+ var EPSILON32 = pow(2, -23);
+ var MAX32 = pow(2, 127) * (2 - EPSILON32);
+ var MIN32 = pow(2, -126);
+
+ var roundTiesToEven = function (n) {
+ return n + 1 / EPSILON - 1 / EPSILON;
+ };
+
+ module.exports = Math.fround || function fround(x) {
+ var $abs = Math.abs(x);
+ var $sign = sign(x);
+ var a, result;
+ if ($abs < MIN32) return $sign * roundTiesToEven($abs / MIN32 / EPSILON32) * MIN32 * EPSILON32;
+ a = (1 + EPSILON32 / EPSILON) * $abs;
+ result = a - (a - $abs);
+ // eslint-disable-next-line no-self-compare
+ if (result > MAX32 || result != result) return $sign * Infinity;
+ return $sign * result;
+ };
+
+
+/***/ }),
+/* 115 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.17 Math.hypot([value1[, value2[, … ]]])
+ var $export = __webpack_require__(8);
+ var abs = Math.abs;
+
+ $export($export.S, 'Math', {
+ hypot: function hypot(value1, value2) { // eslint-disable-line no-unused-vars
+ var sum = 0;
+ var i = 0;
+ var aLen = arguments.length;
+ var larg = 0;
+ var arg, div;
+ while (i < aLen) {
+ arg = abs(arguments[i++]);
+ if (larg < arg) {
+ div = larg / arg;
+ sum = sum * div * div + 1;
+ larg = arg;
+ } else if (arg > 0) {
+ div = arg / larg;
+ sum += div * div;
+ } else sum += arg;
+ }
+ return larg === Infinity ? Infinity : larg * Math.sqrt(sum);
+ }
+ });
+
+
+/***/ }),
+/* 116 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.18 Math.imul(x, y)
+ var $export = __webpack_require__(8);
+ var $imul = Math.imul;
+
+ // some WebKit versions fails with big numbers, some has wrong arity
+ $export($export.S + $export.F * __webpack_require__(7)(function () {
+ return $imul(0xffffffff, 5) != -5 || $imul.length != 2;
+ }), 'Math', {
+ imul: function imul(x, y) {
+ var UINT16 = 0xffff;
+ var xn = +x;
+ var yn = +y;
+ var xl = UINT16 & xn;
+ var yl = UINT16 & yn;
+ return 0 | xl * yl + ((UINT16 & xn >>> 16) * yl + xl * (UINT16 & yn >>> 16) << 16 >>> 0);
+ }
+ });
+
+
+/***/ }),
+/* 117 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.21 Math.log10(x)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ log10: function log10(x) {
+ return Math.log(x) * Math.LOG10E;
+ }
+ });
+
+
+/***/ }),
+/* 118 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.20 Math.log1p(x)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', { log1p: __webpack_require__(104) });
+
+
+/***/ }),
+/* 119 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.22 Math.log2(x)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ log2: function log2(x) {
+ return Math.log(x) / Math.LN2;
+ }
+ });
+
+
+/***/ }),
+/* 120 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.28 Math.sign(x)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', { sign: __webpack_require__(108) });
+
+
+/***/ }),
+/* 121 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.30 Math.sinh(x)
+ var $export = __webpack_require__(8);
+ var expm1 = __webpack_require__(112);
+ var exp = Math.exp;
+
+ // V8 near Chromium 38 has a problem with very small numbers
+ $export($export.S + $export.F * __webpack_require__(7)(function () {
+ return !Math.sinh(-2e-17) != -2e-17;
+ }), 'Math', {
+ sinh: function sinh(x) {
+ return Math.abs(x = +x) < 1
+ ? (expm1(x) - expm1(-x)) / 2
+ : (exp(x - 1) - exp(-x - 1)) * (Math.E / 2);
+ }
+ });
+
+
+/***/ }),
+/* 122 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.33 Math.tanh(x)
+ var $export = __webpack_require__(8);
+ var expm1 = __webpack_require__(112);
+ var exp = Math.exp;
+
+ $export($export.S, 'Math', {
+ tanh: function tanh(x) {
+ var a = expm1(x = +x);
+ var b = expm1(-x);
+ return a == Infinity ? 1 : b == Infinity ? -1 : (a - b) / (exp(x) + exp(-x));
+ }
+ });
+
+
+/***/ }),
+/* 123 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.2.2.34 Math.trunc(x)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ trunc: function trunc(it) {
+ return (it > 0 ? Math.floor : Math.ceil)(it);
+ }
+ });
+
+
+/***/ }),
+/* 124 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var toAbsoluteIndex = __webpack_require__(40);
+ var fromCharCode = String.fromCharCode;
+ var $fromCodePoint = String.fromCodePoint;
+
+ // length should be 1, old FF problem
+ $export($export.S + $export.F * (!!$fromCodePoint && $fromCodePoint.length != 1), 'String', {
+ // 21.1.2.2 String.fromCodePoint(...codePoints)
+ fromCodePoint: function fromCodePoint(x) { // eslint-disable-line no-unused-vars
+ var res = [];
+ var aLen = arguments.length;
+ var i = 0;
+ var code;
+ while (aLen > i) {
+ code = +arguments[i++];
+ if (toAbsoluteIndex(code, 0x10ffff) !== code) throw RangeError(code + ' is not a valid code point');
+ res.push(code < 0x10000
+ ? fromCharCode(code)
+ : fromCharCode(((code -= 0x10000) >> 10) + 0xd800, code % 0x400 + 0xdc00)
+ );
+ } return res.join('');
+ }
+ });
+
+
+/***/ }),
+/* 125 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var toIObject = __webpack_require__(33);
+ var toLength = __webpack_require__(38);
+
+ $export($export.S, 'String', {
+ // 21.1.2.4 String.raw(callSite, ...substitutions)
+ raw: function raw(callSite) {
+ var tpl = toIObject(callSite.raw);
+ var len = toLength(tpl.length);
+ var aLen = arguments.length;
+ var res = [];
+ var i = 0;
+ while (len > i) {
+ res.push(String(tpl[i++]));
+ if (i < aLen) res.push(String(arguments[i]));
+ } return res.join('');
+ }
+ });
+
+
+/***/ }),
+/* 126 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 21.1.3.25 String.prototype.trim()
+ __webpack_require__(83)('trim', function ($trim) {
+ return function trim() {
+ return $trim(this, 3);
+ };
+ });
+
+
+/***/ }),
+/* 127 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $at = __webpack_require__(128)(true);
+
+ // 21.1.3.27 String.prototype[@@iterator]()
+ __webpack_require__(129)(String, 'String', function (iterated) {
+ this._t = String(iterated); // target
+ this._i = 0; // next index
+ // 21.1.5.2.1 %StringIteratorPrototype%.next()
+ }, function () {
+ var O = this._t;
+ var index = this._i;
+ var point;
+ if (index >= O.length) return { value: undefined, done: true };
+ point = $at(O, index);
+ this._i += point.length;
+ return { value: point, done: false };
+ });
+
+
+/***/ }),
+/* 128 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var toInteger = __webpack_require__(39);
+ var defined = __webpack_require__(36);
+ // true -> String#at
+ // false -> String#codePointAt
+ module.exports = function (TO_STRING) {
+ return function (that, pos) {
+ var s = String(defined(that));
+ var i = toInteger(pos);
+ var l = s.length;
+ var a, b;
+ if (i < 0 || i >= l) return TO_STRING ? '' : undefined;
+ a = s.charCodeAt(i);
+ return a < 0xd800 || a > 0xdbff || i + 1 === l || (b = s.charCodeAt(i + 1)) < 0xdc00 || b > 0xdfff
+ ? TO_STRING ? s.charAt(i) : a
+ : TO_STRING ? s.slice(i, i + 2) : (a - 0xd800 << 10) + (b - 0xdc00) + 0x10000;
+ };
+ };
+
+
+/***/ }),
+/* 129 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var LIBRARY = __webpack_require__(22);
+ var $export = __webpack_require__(8);
+ var redefine = __webpack_require__(18);
+ var hide = __webpack_require__(10);
+ var Iterators = __webpack_require__(130);
+ var $iterCreate = __webpack_require__(131);
+ var setToStringTag = __webpack_require__(26);
+ var getPrototypeOf = __webpack_require__(59);
+ var ITERATOR = __webpack_require__(27)('iterator');
+ var BUGGY = !([].keys && 'next' in [].keys()); // Safari has buggy iterators w/o `next`
+ var FF_ITERATOR = '@@iterator';
+ var KEYS = 'keys';
+ var VALUES = 'values';
+
+ var returnThis = function () { return this; };
+
+ module.exports = function (Base, NAME, Constructor, next, DEFAULT, IS_SET, FORCED) {
+ $iterCreate(Constructor, NAME, next);
+ var getMethod = function (kind) {
+ if (!BUGGY && kind in proto) return proto[kind];
+ switch (kind) {
+ case KEYS: return function keys() { return new Constructor(this, kind); };
+ case VALUES: return function values() { return new Constructor(this, kind); };
+ } return function entries() { return new Constructor(this, kind); };
+ };
+ var TAG = NAME + ' Iterator';
+ var DEF_VALUES = DEFAULT == VALUES;
+ var VALUES_BUG = false;
+ var proto = Base.prototype;
+ var $native = proto[ITERATOR] || proto[FF_ITERATOR] || DEFAULT && proto[DEFAULT];
+ var $default = $native || getMethod(DEFAULT);
+ var $entries = DEFAULT ? !DEF_VALUES ? $default : getMethod('entries') : undefined;
+ var $anyNative = NAME == 'Array' ? proto.entries || $native : $native;
+ var methods, key, IteratorPrototype;
+ // Fix native
+ if ($anyNative) {
+ IteratorPrototype = getPrototypeOf($anyNative.call(new Base()));
+ if (IteratorPrototype !== Object.prototype && IteratorPrototype.next) {
+ // Set @@toStringTag to native iterators
+ setToStringTag(IteratorPrototype, TAG, true);
+ // fix for some old engines
+ if (!LIBRARY && typeof IteratorPrototype[ITERATOR] != 'function') hide(IteratorPrototype, ITERATOR, returnThis);
+ }
+ }
+ // fix Array#{values, @@iterator}.name in V8 / FF
+ if (DEF_VALUES && $native && $native.name !== VALUES) {
+ VALUES_BUG = true;
+ $default = function values() { return $native.call(this); };
+ }
+ // Define iterator
+ if ((!LIBRARY || FORCED) && (BUGGY || VALUES_BUG || !proto[ITERATOR])) {
+ hide(proto, ITERATOR, $default);
+ }
+ // Plug for library
+ Iterators[NAME] = $default;
+ Iterators[TAG] = returnThis;
+ if (DEFAULT) {
+ methods = {
+ values: DEF_VALUES ? $default : getMethod(VALUES),
+ keys: IS_SET ? $default : getMethod(KEYS),
+ entries: $entries
+ };
+ if (FORCED) for (key in methods) {
+ if (!(key in proto)) redefine(proto, key, methods[key]);
+ } else $export($export.P + $export.F * (BUGGY || VALUES_BUG), NAME, methods);
+ }
+ return methods;
+ };
+
+
+/***/ }),
+/* 130 */
+/***/ (function(module, exports) {
+
+ module.exports = {};
+
+
+/***/ }),
+/* 131 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var create = __webpack_require__(47);
+ var descriptor = __webpack_require__(17);
+ var setToStringTag = __webpack_require__(26);
+ var IteratorPrototype = {};
+
+ // 25.1.2.1.1 %IteratorPrototype%[@@iterator]()
+ __webpack_require__(10)(IteratorPrototype, __webpack_require__(27)('iterator'), function () { return this; });
+
+ module.exports = function (Constructor, NAME, next) {
+ Constructor.prototype = create(IteratorPrototype, { next: descriptor(1, next) });
+ setToStringTag(Constructor, NAME + ' Iterator');
+ };
+
+
+/***/ }),
+/* 132 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $at = __webpack_require__(128)(false);
+ $export($export.P, 'String', {
+ // 21.1.3.3 String.prototype.codePointAt(pos)
+ codePointAt: function codePointAt(pos) {
+ return $at(this, pos);
+ }
+ });
+
+
+/***/ }),
+/* 133 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 21.1.3.6 String.prototype.endsWith(searchString [, endPosition])
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toLength = __webpack_require__(38);
+ var context = __webpack_require__(134);
+ var ENDS_WITH = 'endsWith';
+ var $endsWith = ''[ENDS_WITH];
+
+ $export($export.P + $export.F * __webpack_require__(136)(ENDS_WITH), 'String', {
+ endsWith: function endsWith(searchString /* , endPosition = @length */) {
+ var that = context(this, searchString, ENDS_WITH);
+ var endPosition = arguments.length > 1 ? arguments[1] : undefined;
+ var len = toLength(that.length);
+ var end = endPosition === undefined ? len : Math.min(toLength(endPosition), len);
+ var search = String(searchString);
+ return $endsWith
+ ? $endsWith.call(that, search, end)
+ : that.slice(end - search.length, end) === search;
+ }
+ });
+
+
+/***/ }),
+/* 134 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // helper for String#{startsWith, endsWith, includes}
+ var isRegExp = __webpack_require__(135);
+ var defined = __webpack_require__(36);
+
+ module.exports = function (that, searchString, NAME) {
+ if (isRegExp(searchString)) throw TypeError('String#' + NAME + " doesn't accept regex!");
+ return String(defined(that));
+ };
+
+
+/***/ }),
+/* 135 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 7.2.8 IsRegExp(argument)
+ var isObject = __webpack_require__(13);
+ var cof = __webpack_require__(35);
+ var MATCH = __webpack_require__(27)('match');
+ module.exports = function (it) {
+ var isRegExp;
+ return isObject(it) && ((isRegExp = it[MATCH]) !== undefined ? !!isRegExp : cof(it) == 'RegExp');
+ };
+
+
+/***/ }),
+/* 136 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var MATCH = __webpack_require__(27)('match');
+ module.exports = function (KEY) {
+ var re = /./;
+ try {
+ '/./'[KEY](re);
+ } catch (e) {
+ try {
+ re[MATCH] = false;
+ return !'/./'[KEY](re);
+ } catch (f) { /* empty */ }
+ } return true;
+ };
+
+
+/***/ }),
+/* 137 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 21.1.3.7 String.prototype.includes(searchString, position = 0)
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var context = __webpack_require__(134);
+ var INCLUDES = 'includes';
+
+ $export($export.P + $export.F * __webpack_require__(136)(INCLUDES), 'String', {
+ includes: function includes(searchString /* , position = 0 */) {
+ return !!~context(this, searchString, INCLUDES)
+ .indexOf(searchString, arguments.length > 1 ? arguments[1] : undefined);
+ }
+ });
+
+
+/***/ }),
+/* 138 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+
+ $export($export.P, 'String', {
+ // 21.1.3.13 String.prototype.repeat(count)
+ repeat: __webpack_require__(91)
+ });
+
+
+/***/ }),
+/* 139 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 21.1.3.18 String.prototype.startsWith(searchString [, position ])
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toLength = __webpack_require__(38);
+ var context = __webpack_require__(134);
+ var STARTS_WITH = 'startsWith';
+ var $startsWith = ''[STARTS_WITH];
+
+ $export($export.P + $export.F * __webpack_require__(136)(STARTS_WITH), 'String', {
+ startsWith: function startsWith(searchString /* , position = 0 */) {
+ var that = context(this, searchString, STARTS_WITH);
+ var index = toLength(Math.min(arguments.length > 1 ? arguments[1] : undefined, that.length));
+ var search = String(searchString);
+ return $startsWith
+ ? $startsWith.call(that, search, index)
+ : that.slice(index, index + search.length) === search;
+ }
+ });
+
+
+/***/ }),
+/* 140 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.2 String.prototype.anchor(name)
+ __webpack_require__(141)('anchor', function (createHTML) {
+ return function anchor(name) {
+ return createHTML(this, 'a', 'name', name);
+ };
+ });
+
+
+/***/ }),
+/* 141 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var fails = __webpack_require__(7);
+ var defined = __webpack_require__(36);
+ var quot = /"/g;
+ // B.2.3.2.1 CreateHTML(string, tag, attribute, value)
+ var createHTML = function (string, tag, attribute, value) {
+ var S = String(defined(string));
+ var p1 = '<' + tag;
+ if (attribute !== '') p1 += ' ' + attribute + '="' + String(value).replace(quot, '"') + '"';
+ return p1 + '>' + S + '';
+ };
+ module.exports = function (NAME, exec) {
+ var O = {};
+ O[NAME] = exec(createHTML);
+ $export($export.P + $export.F * fails(function () {
+ var test = ''[NAME]('"');
+ return test !== test.toLowerCase() || test.split('"').length > 3;
+ }), 'String', O);
+ };
+
+
+/***/ }),
+/* 142 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.3 String.prototype.big()
+ __webpack_require__(141)('big', function (createHTML) {
+ return function big() {
+ return createHTML(this, 'big', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 143 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.4 String.prototype.blink()
+ __webpack_require__(141)('blink', function (createHTML) {
+ return function blink() {
+ return createHTML(this, 'blink', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 144 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.5 String.prototype.bold()
+ __webpack_require__(141)('bold', function (createHTML) {
+ return function bold() {
+ return createHTML(this, 'b', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 145 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.6 String.prototype.fixed()
+ __webpack_require__(141)('fixed', function (createHTML) {
+ return function fixed() {
+ return createHTML(this, 'tt', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 146 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.7 String.prototype.fontcolor(color)
+ __webpack_require__(141)('fontcolor', function (createHTML) {
+ return function fontcolor(color) {
+ return createHTML(this, 'font', 'color', color);
+ };
+ });
+
+
+/***/ }),
+/* 147 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.8 String.prototype.fontsize(size)
+ __webpack_require__(141)('fontsize', function (createHTML) {
+ return function fontsize(size) {
+ return createHTML(this, 'font', 'size', size);
+ };
+ });
+
+
+/***/ }),
+/* 148 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.9 String.prototype.italics()
+ __webpack_require__(141)('italics', function (createHTML) {
+ return function italics() {
+ return createHTML(this, 'i', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 149 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.10 String.prototype.link(url)
+ __webpack_require__(141)('link', function (createHTML) {
+ return function link(url) {
+ return createHTML(this, 'a', 'href', url);
+ };
+ });
+
+
+/***/ }),
+/* 150 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.11 String.prototype.small()
+ __webpack_require__(141)('small', function (createHTML) {
+ return function small() {
+ return createHTML(this, 'small', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 151 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.12 String.prototype.strike()
+ __webpack_require__(141)('strike', function (createHTML) {
+ return function strike() {
+ return createHTML(this, 'strike', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 152 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.13 String.prototype.sub()
+ __webpack_require__(141)('sub', function (createHTML) {
+ return function sub() {
+ return createHTML(this, 'sub', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 153 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // B.2.3.14 String.prototype.sup()
+ __webpack_require__(141)('sup', function (createHTML) {
+ return function sup() {
+ return createHTML(this, 'sup', '', '');
+ };
+ });
+
+
+/***/ }),
+/* 154 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.3.3.1 / 15.9.4.4 Date.now()
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Date', { now: function () { return new Date().getTime(); } });
+
+
+/***/ }),
+/* 155 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toObject = __webpack_require__(46);
+ var toPrimitive = __webpack_require__(16);
+
+ $export($export.P + $export.F * __webpack_require__(7)(function () {
+ return new Date(NaN).toJSON() !== null
+ || Date.prototype.toJSON.call({ toISOString: function () { return 1; } }) !== 1;
+ }), 'Date', {
+ // eslint-disable-next-line no-unused-vars
+ toJSON: function toJSON(key) {
+ var O = toObject(this);
+ var pv = toPrimitive(O);
+ return typeof pv == 'number' && !isFinite(pv) ? null : O.toISOString();
+ }
+ });
+
+
+/***/ }),
+/* 156 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 20.3.4.36 / 15.9.5.43 Date.prototype.toISOString()
+ var $export = __webpack_require__(8);
+ var toISOString = __webpack_require__(157);
+
+ // PhantomJS / old WebKit has a broken implementations
+ $export($export.P + $export.F * (Date.prototype.toISOString !== toISOString), 'Date', {
+ toISOString: toISOString
+ });
+
+
+/***/ }),
+/* 157 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 20.3.4.36 / 15.9.5.43 Date.prototype.toISOString()
+ var fails = __webpack_require__(7);
+ var getTime = Date.prototype.getTime;
+ var $toISOString = Date.prototype.toISOString;
+
+ var lz = function (num) {
+ return num > 9 ? num : '0' + num;
+ };
+
+ // PhantomJS / old WebKit has a broken implementations
+ module.exports = (fails(function () {
+ return $toISOString.call(new Date(-5e13 - 1)) != '0385-07-25T07:06:39.999Z';
+ }) || !fails(function () {
+ $toISOString.call(new Date(NaN));
+ })) ? function toISOString() {
+ if (!isFinite(getTime.call(this))) throw RangeError('Invalid time value');
+ var d = this;
+ var y = d.getUTCFullYear();
+ var m = d.getUTCMilliseconds();
+ var s = y < 0 ? '-' : y > 9999 ? '+' : '';
+ return s + ('00000' + Math.abs(y)).slice(s ? -6 : -4) +
+ '-' + lz(d.getUTCMonth() + 1) + '-' + lz(d.getUTCDate()) +
+ 'T' + lz(d.getUTCHours()) + ':' + lz(d.getUTCMinutes()) +
+ ':' + lz(d.getUTCSeconds()) + '.' + (m > 99 ? m : '0' + lz(m)) + 'Z';
+ } : $toISOString;
+
+
+/***/ }),
+/* 158 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var DateProto = Date.prototype;
+ var INVALID_DATE = 'Invalid Date';
+ var TO_STRING = 'toString';
+ var $toString = DateProto[TO_STRING];
+ var getTime = DateProto.getTime;
+ if (new Date(NaN) + '' != INVALID_DATE) {
+ __webpack_require__(18)(DateProto, TO_STRING, function toString() {
+ var value = getTime.call(this);
+ // eslint-disable-next-line no-self-compare
+ return value === value ? $toString.call(this) : INVALID_DATE;
+ });
+ }
+
+
+/***/ }),
+/* 159 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var TO_PRIMITIVE = __webpack_require__(27)('toPrimitive');
+ var proto = Date.prototype;
+
+ if (!(TO_PRIMITIVE in proto)) __webpack_require__(10)(proto, TO_PRIMITIVE, __webpack_require__(160));
+
+
+/***/ }),
+/* 160 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var anObject = __webpack_require__(12);
+ var toPrimitive = __webpack_require__(16);
+ var NUMBER = 'number';
+
+ module.exports = function (hint) {
+ if (hint !== 'string' && hint !== NUMBER && hint !== 'default') throw TypeError('Incorrect hint');
+ return toPrimitive(anObject(this), hint != NUMBER);
+ };
+
+
+/***/ }),
+/* 161 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 22.1.2.2 / 15.4.3.2 Array.isArray(arg)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Array', { isArray: __webpack_require__(45) });
+
+
+/***/ }),
+/* 162 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var ctx = __webpack_require__(23);
+ var $export = __webpack_require__(8);
+ var toObject = __webpack_require__(46);
+ var call = __webpack_require__(163);
+ var isArrayIter = __webpack_require__(164);
+ var toLength = __webpack_require__(38);
+ var createProperty = __webpack_require__(165);
+ var getIterFn = __webpack_require__(166);
+
+ $export($export.S + $export.F * !__webpack_require__(167)(function (iter) { Array.from(iter); }), 'Array', {
+ // 22.1.2.1 Array.from(arrayLike, mapfn = undefined, thisArg = undefined)
+ from: function from(arrayLike /* , mapfn = undefined, thisArg = undefined */) {
+ var O = toObject(arrayLike);
+ var C = typeof this == 'function' ? this : Array;
+ var aLen = arguments.length;
+ var mapfn = aLen > 1 ? arguments[1] : undefined;
+ var mapping = mapfn !== undefined;
+ var index = 0;
+ var iterFn = getIterFn(O);
+ var length, result, step, iterator;
+ if (mapping) mapfn = ctx(mapfn, aLen > 2 ? arguments[2] : undefined, 2);
+ // if object isn't iterable or it's array with default iterator - use simple case
+ if (iterFn != undefined && !(C == Array && isArrayIter(iterFn))) {
+ for (iterator = iterFn.call(O), result = new C(); !(step = iterator.next()).done; index++) {
+ createProperty(result, index, mapping ? call(iterator, mapfn, [step.value, index], true) : step.value);
+ }
+ } else {
+ length = toLength(O.length);
+ for (result = new C(length); length > index; index++) {
+ createProperty(result, index, mapping ? mapfn(O[index], index) : O[index]);
+ }
+ }
+ result.length = index;
+ return result;
+ }
+ });
+
+
+/***/ }),
+/* 163 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // call something on iterator step with safe closing on error
+ var anObject = __webpack_require__(12);
+ module.exports = function (iterator, fn, value, entries) {
+ try {
+ return entries ? fn(anObject(value)[0], value[1]) : fn(value);
+ // 7.4.6 IteratorClose(iterator, completion)
+ } catch (e) {
+ var ret = iterator['return'];
+ if (ret !== undefined) anObject(ret.call(iterator));
+ throw e;
+ }
+ };
+
+
+/***/ }),
+/* 164 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // check on default Array iterator
+ var Iterators = __webpack_require__(130);
+ var ITERATOR = __webpack_require__(27)('iterator');
+ var ArrayProto = Array.prototype;
+
+ module.exports = function (it) {
+ return it !== undefined && (Iterators.Array === it || ArrayProto[ITERATOR] === it);
+ };
+
+
+/***/ }),
+/* 165 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $defineProperty = __webpack_require__(11);
+ var createDesc = __webpack_require__(17);
+
+ module.exports = function (object, index, value) {
+ if (index in object) $defineProperty.f(object, index, createDesc(0, value));
+ else object[index] = value;
+ };
+
+
+/***/ }),
+/* 166 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var classof = __webpack_require__(75);
+ var ITERATOR = __webpack_require__(27)('iterator');
+ var Iterators = __webpack_require__(130);
+ module.exports = __webpack_require__(9).getIteratorMethod = function (it) {
+ if (it != undefined) return it[ITERATOR]
+ || it['@@iterator']
+ || Iterators[classof(it)];
+ };
+
+
+/***/ }),
+/* 167 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var ITERATOR = __webpack_require__(27)('iterator');
+ var SAFE_CLOSING = false;
+
+ try {
+ var riter = [7][ITERATOR]();
+ riter['return'] = function () { SAFE_CLOSING = true; };
+ // eslint-disable-next-line no-throw-literal
+ Array.from(riter, function () { throw 2; });
+ } catch (e) { /* empty */ }
+
+ module.exports = function (exec, skipClosing) {
+ if (!skipClosing && !SAFE_CLOSING) return false;
+ var safe = false;
+ try {
+ var arr = [7];
+ var iter = arr[ITERATOR]();
+ iter.next = function () { return { done: safe = true }; };
+ arr[ITERATOR] = function () { return iter; };
+ exec(arr);
+ } catch (e) { /* empty */ }
+ return safe;
+ };
+
+
+/***/ }),
+/* 168 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var createProperty = __webpack_require__(165);
+
+ // WebKit Array.of isn't generic
+ $export($export.S + $export.F * __webpack_require__(7)(function () {
+ function F() { /* empty */ }
+ return !(Array.of.call(F) instanceof F);
+ }), 'Array', {
+ // 22.1.2.3 Array.of( ...items)
+ of: function of(/* ...args */) {
+ var index = 0;
+ var aLen = arguments.length;
+ var result = new (typeof this == 'function' ? this : Array)(aLen);
+ while (aLen > index) createProperty(result, index, arguments[index++]);
+ result.length = aLen;
+ return result;
+ }
+ });
+
+
+/***/ }),
+/* 169 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 22.1.3.13 Array.prototype.join(separator)
+ var $export = __webpack_require__(8);
+ var toIObject = __webpack_require__(33);
+ var arrayJoin = [].join;
+
+ // fallback for not array-like strings
+ $export($export.P + $export.F * (__webpack_require__(34) != Object || !__webpack_require__(170)(arrayJoin)), 'Array', {
+ join: function join(separator) {
+ return arrayJoin.call(toIObject(this), separator === undefined ? ',' : separator);
+ }
+ });
+
+
+/***/ }),
+/* 170 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var fails = __webpack_require__(7);
+
+ module.exports = function (method, arg) {
+ return !!method && fails(function () {
+ // eslint-disable-next-line no-useless-call
+ arg ? method.call(null, function () { /* empty */ }, 1) : method.call(null);
+ });
+ };
+
+
+/***/ }),
+/* 171 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var html = __webpack_require__(49);
+ var cof = __webpack_require__(35);
+ var toAbsoluteIndex = __webpack_require__(40);
+ var toLength = __webpack_require__(38);
+ var arraySlice = [].slice;
+
+ // fallback for not array-like ES3 strings and DOM objects
+ $export($export.P + $export.F * __webpack_require__(7)(function () {
+ if (html) arraySlice.call(html);
+ }), 'Array', {
+ slice: function slice(begin, end) {
+ var len = toLength(this.length);
+ var klass = cof(this);
+ end = end === undefined ? len : end;
+ if (klass == 'Array') return arraySlice.call(this, begin, end);
+ var start = toAbsoluteIndex(begin, len);
+ var upTo = toAbsoluteIndex(end, len);
+ var size = toLength(upTo - start);
+ var cloned = new Array(size);
+ var i = 0;
+ for (; i < size; i++) cloned[i] = klass == 'String'
+ ? this.charAt(start + i)
+ : this[start + i];
+ return cloned;
+ }
+ });
+
+
+/***/ }),
+/* 172 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var aFunction = __webpack_require__(24);
+ var toObject = __webpack_require__(46);
+ var fails = __webpack_require__(7);
+ var $sort = [].sort;
+ var test = [1, 2, 3];
+
+ $export($export.P + $export.F * (fails(function () {
+ // IE8-
+ test.sort(undefined);
+ }) || !fails(function () {
+ // V8 bug
+ test.sort(null);
+ // Old WebKit
+ }) || !__webpack_require__(170)($sort)), 'Array', {
+ // 22.1.3.25 Array.prototype.sort(comparefn)
+ sort: function sort(comparefn) {
+ return comparefn === undefined
+ ? $sort.call(toObject(this))
+ : $sort.call(toObject(this), aFunction(comparefn));
+ }
+ });
+
+
+/***/ }),
+/* 173 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $forEach = __webpack_require__(174)(0);
+ var STRICT = __webpack_require__(170)([].forEach, true);
+
+ $export($export.P + $export.F * !STRICT, 'Array', {
+ // 22.1.3.10 / 15.4.4.18 Array.prototype.forEach(callbackfn [, thisArg])
+ forEach: function forEach(callbackfn /* , thisArg */) {
+ return $forEach(this, callbackfn, arguments[1]);
+ }
+ });
+
+
+/***/ }),
+/* 174 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 0 -> Array#forEach
+ // 1 -> Array#map
+ // 2 -> Array#filter
+ // 3 -> Array#some
+ // 4 -> Array#every
+ // 5 -> Array#find
+ // 6 -> Array#findIndex
+ var ctx = __webpack_require__(23);
+ var IObject = __webpack_require__(34);
+ var toObject = __webpack_require__(46);
+ var toLength = __webpack_require__(38);
+ var asc = __webpack_require__(175);
+ module.exports = function (TYPE, $create) {
+ var IS_MAP = TYPE == 1;
+ var IS_FILTER = TYPE == 2;
+ var IS_SOME = TYPE == 3;
+ var IS_EVERY = TYPE == 4;
+ var IS_FIND_INDEX = TYPE == 6;
+ var NO_HOLES = TYPE == 5 || IS_FIND_INDEX;
+ var create = $create || asc;
+ return function ($this, callbackfn, that) {
+ var O = toObject($this);
+ var self = IObject(O);
+ var f = ctx(callbackfn, that, 3);
+ var length = toLength(self.length);
+ var index = 0;
+ var result = IS_MAP ? create($this, length) : IS_FILTER ? create($this, 0) : undefined;
+ var val, res;
+ for (;length > index; index++) if (NO_HOLES || index in self) {
+ val = self[index];
+ res = f(val, index, O);
+ if (TYPE) {
+ if (IS_MAP) result[index] = res; // map
+ else if (res) switch (TYPE) {
+ case 3: return true; // some
+ case 5: return val; // find
+ case 6: return index; // findIndex
+ case 2: result.push(val); // filter
+ } else if (IS_EVERY) return false; // every
+ }
+ }
+ return IS_FIND_INDEX ? -1 : IS_SOME || IS_EVERY ? IS_EVERY : result;
+ };
+ };
+
+
+/***/ }),
+/* 175 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 9.4.2.3 ArraySpeciesCreate(originalArray, length)
+ var speciesConstructor = __webpack_require__(176);
+
+ module.exports = function (original, length) {
+ return new (speciesConstructor(original))(length);
+ };
+
+
+/***/ }),
+/* 176 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var isObject = __webpack_require__(13);
+ var isArray = __webpack_require__(45);
+ var SPECIES = __webpack_require__(27)('species');
+
+ module.exports = function (original) {
+ var C;
+ if (isArray(original)) {
+ C = original.constructor;
+ // cross-realm fallback
+ if (typeof C == 'function' && (C === Array || isArray(C.prototype))) C = undefined;
+ if (isObject(C)) {
+ C = C[SPECIES];
+ if (C === null) C = undefined;
+ }
+ } return C === undefined ? Array : C;
+ };
+
+
+/***/ }),
+/* 177 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $map = __webpack_require__(174)(1);
+
+ $export($export.P + $export.F * !__webpack_require__(170)([].map, true), 'Array', {
+ // 22.1.3.15 / 15.4.4.19 Array.prototype.map(callbackfn [, thisArg])
+ map: function map(callbackfn /* , thisArg */) {
+ return $map(this, callbackfn, arguments[1]);
+ }
+ });
+
+
+/***/ }),
+/* 178 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $filter = __webpack_require__(174)(2);
+
+ $export($export.P + $export.F * !__webpack_require__(170)([].filter, true), 'Array', {
+ // 22.1.3.7 / 15.4.4.20 Array.prototype.filter(callbackfn [, thisArg])
+ filter: function filter(callbackfn /* , thisArg */) {
+ return $filter(this, callbackfn, arguments[1]);
+ }
+ });
+
+
+/***/ }),
+/* 179 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $some = __webpack_require__(174)(3);
+
+ $export($export.P + $export.F * !__webpack_require__(170)([].some, true), 'Array', {
+ // 22.1.3.23 / 15.4.4.17 Array.prototype.some(callbackfn [, thisArg])
+ some: function some(callbackfn /* , thisArg */) {
+ return $some(this, callbackfn, arguments[1]);
+ }
+ });
+
+
+/***/ }),
+/* 180 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $every = __webpack_require__(174)(4);
+
+ $export($export.P + $export.F * !__webpack_require__(170)([].every, true), 'Array', {
+ // 22.1.3.5 / 15.4.4.16 Array.prototype.every(callbackfn [, thisArg])
+ every: function every(callbackfn /* , thisArg */) {
+ return $every(this, callbackfn, arguments[1]);
+ }
+ });
+
+
+/***/ }),
+/* 181 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $reduce = __webpack_require__(182);
+
+ $export($export.P + $export.F * !__webpack_require__(170)([].reduce, true), 'Array', {
+ // 22.1.3.18 / 15.4.4.21 Array.prototype.reduce(callbackfn [, initialValue])
+ reduce: function reduce(callbackfn /* , initialValue */) {
+ return $reduce(this, callbackfn, arguments.length, arguments[1], false);
+ }
+ });
+
+
+/***/ }),
+/* 182 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var aFunction = __webpack_require__(24);
+ var toObject = __webpack_require__(46);
+ var IObject = __webpack_require__(34);
+ var toLength = __webpack_require__(38);
+
+ module.exports = function (that, callbackfn, aLen, memo, isRight) {
+ aFunction(callbackfn);
+ var O = toObject(that);
+ var self = IObject(O);
+ var length = toLength(O.length);
+ var index = isRight ? length - 1 : 0;
+ var i = isRight ? -1 : 1;
+ if (aLen < 2) for (;;) {
+ if (index in self) {
+ memo = self[index];
+ index += i;
+ break;
+ }
+ index += i;
+ if (isRight ? index < 0 : length <= index) {
+ throw TypeError('Reduce of empty array with no initial value');
+ }
+ }
+ for (;isRight ? index >= 0 : length > index; index += i) if (index in self) {
+ memo = callbackfn(memo, self[index], index, O);
+ }
+ return memo;
+ };
+
+
+/***/ }),
+/* 183 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $reduce = __webpack_require__(182);
+
+ $export($export.P + $export.F * !__webpack_require__(170)([].reduceRight, true), 'Array', {
+ // 22.1.3.19 / 15.4.4.22 Array.prototype.reduceRight(callbackfn [, initialValue])
+ reduceRight: function reduceRight(callbackfn /* , initialValue */) {
+ return $reduce(this, callbackfn, arguments.length, arguments[1], true);
+ }
+ });
+
+
+/***/ }),
+/* 184 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $indexOf = __webpack_require__(37)(false);
+ var $native = [].indexOf;
+ var NEGATIVE_ZERO = !!$native && 1 / [1].indexOf(1, -0) < 0;
+
+ $export($export.P + $export.F * (NEGATIVE_ZERO || !__webpack_require__(170)($native)), 'Array', {
+ // 22.1.3.11 / 15.4.4.14 Array.prototype.indexOf(searchElement [, fromIndex])
+ indexOf: function indexOf(searchElement /* , fromIndex = 0 */) {
+ return NEGATIVE_ZERO
+ // convert -0 to +0
+ ? $native.apply(this, arguments) || 0
+ : $indexOf(this, searchElement, arguments[1]);
+ }
+ });
+
+
+/***/ }),
+/* 185 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toIObject = __webpack_require__(33);
+ var toInteger = __webpack_require__(39);
+ var toLength = __webpack_require__(38);
+ var $native = [].lastIndexOf;
+ var NEGATIVE_ZERO = !!$native && 1 / [1].lastIndexOf(1, -0) < 0;
+
+ $export($export.P + $export.F * (NEGATIVE_ZERO || !__webpack_require__(170)($native)), 'Array', {
+ // 22.1.3.14 / 15.4.4.15 Array.prototype.lastIndexOf(searchElement [, fromIndex])
+ lastIndexOf: function lastIndexOf(searchElement /* , fromIndex = @[*-1] */) {
+ // convert -0 to +0
+ if (NEGATIVE_ZERO) return $native.apply(this, arguments) || 0;
+ var O = toIObject(this);
+ var length = toLength(O.length);
+ var index = length - 1;
+ if (arguments.length > 1) index = Math.min(index, toInteger(arguments[1]));
+ if (index < 0) index = length + index;
+ for (;index >= 0; index--) if (index in O) if (O[index] === searchElement) return index || 0;
+ return -1;
+ }
+ });
+
+
+/***/ }),
+/* 186 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 22.1.3.3 Array.prototype.copyWithin(target, start, end = this.length)
+ var $export = __webpack_require__(8);
+
+ $export($export.P, 'Array', { copyWithin: __webpack_require__(187) });
+
+ __webpack_require__(188)('copyWithin');
+
+
+/***/ }),
+/* 187 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 22.1.3.3 Array.prototype.copyWithin(target, start, end = this.length)
+ 'use strict';
+ var toObject = __webpack_require__(46);
+ var toAbsoluteIndex = __webpack_require__(40);
+ var toLength = __webpack_require__(38);
+
+ module.exports = [].copyWithin || function copyWithin(target /* = 0 */, start /* = 0, end = @length */) {
+ var O = toObject(this);
+ var len = toLength(O.length);
+ var to = toAbsoluteIndex(target, len);
+ var from = toAbsoluteIndex(start, len);
+ var end = arguments.length > 2 ? arguments[2] : undefined;
+ var count = Math.min((end === undefined ? len : toAbsoluteIndex(end, len)) - from, len - to);
+ var inc = 1;
+ if (from < to && to < from + count) {
+ inc = -1;
+ from += count - 1;
+ to += count - 1;
+ }
+ while (count-- > 0) {
+ if (from in O) O[to] = O[from];
+ else delete O[to];
+ to += inc;
+ from += inc;
+ } return O;
+ };
+
+
+/***/ }),
+/* 188 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 22.1.3.31 Array.prototype[@@unscopables]
+ var UNSCOPABLES = __webpack_require__(27)('unscopables');
+ var ArrayProto = Array.prototype;
+ if (ArrayProto[UNSCOPABLES] == undefined) __webpack_require__(10)(ArrayProto, UNSCOPABLES, {});
+ module.exports = function (key) {
+ ArrayProto[UNSCOPABLES][key] = true;
+ };
+
+
+/***/ }),
+/* 189 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 22.1.3.6 Array.prototype.fill(value, start = 0, end = this.length)
+ var $export = __webpack_require__(8);
+
+ $export($export.P, 'Array', { fill: __webpack_require__(190) });
+
+ __webpack_require__(188)('fill');
+
+
+/***/ }),
+/* 190 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 22.1.3.6 Array.prototype.fill(value, start = 0, end = this.length)
+ 'use strict';
+ var toObject = __webpack_require__(46);
+ var toAbsoluteIndex = __webpack_require__(40);
+ var toLength = __webpack_require__(38);
+ module.exports = function fill(value /* , start = 0, end = @length */) {
+ var O = toObject(this);
+ var length = toLength(O.length);
+ var aLen = arguments.length;
+ var index = toAbsoluteIndex(aLen > 1 ? arguments[1] : undefined, length);
+ var end = aLen > 2 ? arguments[2] : undefined;
+ var endPos = end === undefined ? length : toAbsoluteIndex(end, length);
+ while (endPos > index) O[index++] = value;
+ return O;
+ };
+
+
+/***/ }),
+/* 191 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 22.1.3.8 Array.prototype.find(predicate, thisArg = undefined)
+ var $export = __webpack_require__(8);
+ var $find = __webpack_require__(174)(5);
+ var KEY = 'find';
+ var forced = true;
+ // Shouldn't skip holes
+ if (KEY in []) Array(1)[KEY](function () { forced = false; });
+ $export($export.P + $export.F * forced, 'Array', {
+ find: function find(callbackfn /* , that = undefined */) {
+ return $find(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined);
+ }
+ });
+ __webpack_require__(188)(KEY);
+
+
+/***/ }),
+/* 192 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 22.1.3.9 Array.prototype.findIndex(predicate, thisArg = undefined)
+ var $export = __webpack_require__(8);
+ var $find = __webpack_require__(174)(6);
+ var KEY = 'findIndex';
+ var forced = true;
+ // Shouldn't skip holes
+ if (KEY in []) Array(1)[KEY](function () { forced = false; });
+ $export($export.P + $export.F * forced, 'Array', {
+ findIndex: function findIndex(callbackfn /* , that = undefined */) {
+ return $find(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined);
+ }
+ });
+ __webpack_require__(188)(KEY);
+
+
+/***/ }),
+/* 193 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(194)('Array');
+
+
+/***/ }),
+/* 194 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var global = __webpack_require__(4);
+ var dP = __webpack_require__(11);
+ var DESCRIPTORS = __webpack_require__(6);
+ var SPECIES = __webpack_require__(27)('species');
+
+ module.exports = function (KEY) {
+ var C = global[KEY];
+ if (DESCRIPTORS && C && !C[SPECIES]) dP.f(C, SPECIES, {
+ configurable: true,
+ get: function () { return this; }
+ });
+ };
+
+
+/***/ }),
+/* 195 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var addToUnscopables = __webpack_require__(188);
+ var step = __webpack_require__(196);
+ var Iterators = __webpack_require__(130);
+ var toIObject = __webpack_require__(33);
+
+ // 22.1.3.4 Array.prototype.entries()
+ // 22.1.3.13 Array.prototype.keys()
+ // 22.1.3.29 Array.prototype.values()
+ // 22.1.3.30 Array.prototype[@@iterator]()
+ module.exports = __webpack_require__(129)(Array, 'Array', function (iterated, kind) {
+ this._t = toIObject(iterated); // target
+ this._i = 0; // next index
+ this._k = kind; // kind
+ // 22.1.5.2.1 %ArrayIteratorPrototype%.next()
+ }, function () {
+ var O = this._t;
+ var kind = this._k;
+ var index = this._i++;
+ if (!O || index >= O.length) {
+ this._t = undefined;
+ return step(1);
+ }
+ if (kind == 'keys') return step(0, index);
+ if (kind == 'values') return step(0, O[index]);
+ return step(0, [index, O[index]]);
+ }, 'values');
+
+ // argumentsList[@@iterator] is %ArrayProto_values% (9.4.4.6, 9.4.4.7)
+ Iterators.Arguments = Iterators.Array;
+
+ addToUnscopables('keys');
+ addToUnscopables('values');
+ addToUnscopables('entries');
+
+
+/***/ }),
+/* 196 */
+/***/ (function(module, exports) {
+
+ module.exports = function (done, value) {
+ return { value: value, done: !!done };
+ };
+
+
+/***/ }),
+/* 197 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var global = __webpack_require__(4);
+ var inheritIfRequired = __webpack_require__(88);
+ var dP = __webpack_require__(11).f;
+ var gOPN = __webpack_require__(51).f;
+ var isRegExp = __webpack_require__(135);
+ var $flags = __webpack_require__(198);
+ var $RegExp = global.RegExp;
+ var Base = $RegExp;
+ var proto = $RegExp.prototype;
+ var re1 = /a/g;
+ var re2 = /a/g;
+ // "new" creates a new object, old webkit buggy here
+ var CORRECT_NEW = new $RegExp(re1) !== re1;
+
+ if (__webpack_require__(6) && (!CORRECT_NEW || __webpack_require__(7)(function () {
+ re2[__webpack_require__(27)('match')] = false;
+ // RegExp constructor can alter flags and IsRegExp works correct with @@match
+ return $RegExp(re1) != re1 || $RegExp(re2) == re2 || $RegExp(re1, 'i') != '/a/i';
+ }))) {
+ $RegExp = function RegExp(p, f) {
+ var tiRE = this instanceof $RegExp;
+ var piRE = isRegExp(p);
+ var fiU = f === undefined;
+ return !tiRE && piRE && p.constructor === $RegExp && fiU ? p
+ : inheritIfRequired(CORRECT_NEW
+ ? new Base(piRE && !fiU ? p.source : p, f)
+ : Base((piRE = p instanceof $RegExp) ? p.source : p, piRE && fiU ? $flags.call(p) : f)
+ , tiRE ? this : proto, $RegExp);
+ };
+ var proxy = function (key) {
+ key in $RegExp || dP($RegExp, key, {
+ configurable: true,
+ get: function () { return Base[key]; },
+ set: function (it) { Base[key] = it; }
+ });
+ };
+ for (var keys = gOPN(Base), i = 0; keys.length > i;) proxy(keys[i++]);
+ proto.constructor = $RegExp;
+ $RegExp.prototype = proto;
+ __webpack_require__(18)(global, 'RegExp', $RegExp);
+ }
+
+ __webpack_require__(194)('RegExp');
+
+
+/***/ }),
+/* 198 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 21.2.5.3 get RegExp.prototype.flags
+ var anObject = __webpack_require__(12);
+ module.exports = function () {
+ var that = anObject(this);
+ var result = '';
+ if (that.global) result += 'g';
+ if (that.ignoreCase) result += 'i';
+ if (that.multiline) result += 'm';
+ if (that.unicode) result += 'u';
+ if (that.sticky) result += 'y';
+ return result;
+ };
+
+
+/***/ }),
+/* 199 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var regexpExec = __webpack_require__(200);
+ __webpack_require__(8)({
+ target: 'RegExp',
+ proto: true,
+ forced: regexpExec !== /./.exec
+ }, {
+ exec: regexpExec
+ });
+
+
+/***/ }),
+/* 200 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var regexpFlags = __webpack_require__(198);
+
+ var nativeExec = RegExp.prototype.exec;
+ // This always refers to the native implementation, because the
+ // String#replace polyfill uses ./fix-regexp-well-known-symbol-logic.js,
+ // which loads this file before patching the method.
+ var nativeReplace = String.prototype.replace;
+
+ var patchedExec = nativeExec;
+
+ var LAST_INDEX = 'lastIndex';
+
+ var UPDATES_LAST_INDEX_WRONG = (function () {
+ var re1 = /a/,
+ re2 = /b*/g;
+ nativeExec.call(re1, 'a');
+ nativeExec.call(re2, 'a');
+ return re1[LAST_INDEX] !== 0 || re2[LAST_INDEX] !== 0;
+ })();
+
+ // nonparticipating capturing group, copied from es5-shim's String#split patch.
+ var NPCG_INCLUDED = /()??/.exec('')[1] !== undefined;
+
+ var PATCH = UPDATES_LAST_INDEX_WRONG || NPCG_INCLUDED;
+
+ if (PATCH) {
+ patchedExec = function exec(str) {
+ var re = this;
+ var lastIndex, reCopy, match, i;
+
+ if (NPCG_INCLUDED) {
+ reCopy = new RegExp('^' + re.source + '$(?!\\s)', regexpFlags.call(re));
+ }
+ if (UPDATES_LAST_INDEX_WRONG) lastIndex = re[LAST_INDEX];
+
+ match = nativeExec.call(re, str);
+
+ if (UPDATES_LAST_INDEX_WRONG && match) {
+ re[LAST_INDEX] = re.global ? match.index + match[0].length : lastIndex;
+ }
+ if (NPCG_INCLUDED && match && match.length > 1) {
+ // Fix browsers whose `exec` methods don't consistently return `undefined`
+ // for NPCG, like IE8. NOTE: This doesn' work for /(.?)?/
+ // eslint-disable-next-line no-loop-func
+ nativeReplace.call(match[0], reCopy, function () {
+ for (i = 1; i < arguments.length - 2; i++) {
+ if (arguments[i] === undefined) match[i] = undefined;
+ }
+ });
+ }
+
+ return match;
+ };
+ }
+
+ module.exports = patchedExec;
+
+
+/***/ }),
+/* 201 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ __webpack_require__(202);
+ var anObject = __webpack_require__(12);
+ var $flags = __webpack_require__(198);
+ var DESCRIPTORS = __webpack_require__(6);
+ var TO_STRING = 'toString';
+ var $toString = /./[TO_STRING];
+
+ var define = function (fn) {
+ __webpack_require__(18)(RegExp.prototype, TO_STRING, fn, true);
+ };
+
+ // 21.2.5.14 RegExp.prototype.toString()
+ if (__webpack_require__(7)(function () { return $toString.call({ source: 'a', flags: 'b' }) != '/a/b'; })) {
+ define(function toString() {
+ var R = anObject(this);
+ return '/'.concat(R.source, '/',
+ 'flags' in R ? R.flags : !DESCRIPTORS && R instanceof RegExp ? $flags.call(R) : undefined);
+ });
+ // FF44- RegExp#toString has a wrong name
+ } else if ($toString.name != TO_STRING) {
+ define(function toString() {
+ return $toString.call(this);
+ });
+ }
+
+
+/***/ }),
+/* 202 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 21.2.5.3 get RegExp.prototype.flags()
+ if (__webpack_require__(6) && /./g.flags != 'g') __webpack_require__(11).f(RegExp.prototype, 'flags', {
+ configurable: true,
+ get: __webpack_require__(198)
+ });
+
+
+/***/ }),
+/* 203 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var anObject = __webpack_require__(12);
+ var toLength = __webpack_require__(38);
+ var advanceStringIndex = __webpack_require__(204);
+ var regExpExec = __webpack_require__(205);
+
+ // @@match logic
+ __webpack_require__(206)('match', 1, function (defined, MATCH, $match, maybeCallNative) {
+ return [
+ // `String.prototype.match` method
+ // https://tc39.github.io/ecma262/#sec-string.prototype.match
+ function match(regexp) {
+ var O = defined(this);
+ var fn = regexp == undefined ? undefined : regexp[MATCH];
+ return fn !== undefined ? fn.call(regexp, O) : new RegExp(regexp)[MATCH](String(O));
+ },
+ // `RegExp.prototype[@@match]` method
+ // https://tc39.github.io/ecma262/#sec-regexp.prototype-@@match
+ function (regexp) {
+ var res = maybeCallNative($match, regexp, this);
+ if (res.done) return res.value;
+ var rx = anObject(regexp);
+ var S = String(this);
+ if (!rx.global) return regExpExec(rx, S);
+ var fullUnicode = rx.unicode;
+ rx.lastIndex = 0;
+ var A = [];
+ var n = 0;
+ var result;
+ while ((result = regExpExec(rx, S)) !== null) {
+ var matchStr = String(result[0]);
+ A[n] = matchStr;
+ if (matchStr === '') rx.lastIndex = advanceStringIndex(S, toLength(rx.lastIndex), fullUnicode);
+ n++;
+ }
+ return n === 0 ? null : A;
+ }
+ ];
+ });
+
+
+/***/ }),
+/* 204 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var at = __webpack_require__(128)(true);
+
+ // `AdvanceStringIndex` abstract operation
+ // https://tc39.github.io/ecma262/#sec-advancestringindex
+ module.exports = function (S, index, unicode) {
+ return index + (unicode ? at(S, index).length : 1);
+ };
+
+
+/***/ }),
+/* 205 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var classof = __webpack_require__(75);
+ var builtinExec = RegExp.prototype.exec;
+
+ // `RegExpExec` abstract operation
+ // https://tc39.github.io/ecma262/#sec-regexpexec
+ module.exports = function (R, S) {
+ var exec = R.exec;
+ if (typeof exec === 'function') {
+ var result = exec.call(R, S);
+ if (typeof result !== 'object') {
+ throw new TypeError('RegExp exec method returned something other than an Object or null');
+ }
+ return result;
+ }
+ if (classof(R) !== 'RegExp') {
+ throw new TypeError('RegExp#exec called on incompatible receiver');
+ }
+ return builtinExec.call(R, S);
+ };
+
+
+/***/ }),
+/* 206 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ __webpack_require__(199);
+ var redefine = __webpack_require__(18);
+ var hide = __webpack_require__(10);
+ var fails = __webpack_require__(7);
+ var defined = __webpack_require__(36);
+ var wks = __webpack_require__(27);
+ var regexpExec = __webpack_require__(200);
+
+ var SPECIES = wks('species');
+
+ var REPLACE_SUPPORTS_NAMED_GROUPS = !fails(function () {
+ // #replace needs built-in support for named groups.
+ // #match works fine because it just return the exec results, even if it has
+ // a "grops" property.
+ var re = /./;
+ re.exec = function () {
+ var result = [];
+ result.groups = { a: '7' };
+ return result;
+ };
+ return ''.replace(re, '$') !== '7';
+ });
+
+ var SPLIT_WORKS_WITH_OVERWRITTEN_EXEC = (function () {
+ // Chrome 51 has a buggy "split" implementation when RegExp#exec !== nativeExec
+ var re = /(?:)/;
+ var originalExec = re.exec;
+ re.exec = function () { return originalExec.apply(this, arguments); };
+ var result = 'ab'.split(re);
+ return result.length === 2 && result[0] === 'a' && result[1] === 'b';
+ })();
+
+ module.exports = function (KEY, length, exec) {
+ var SYMBOL = wks(KEY);
+
+ var DELEGATES_TO_SYMBOL = !fails(function () {
+ // String methods call symbol-named RegEp methods
+ var O = {};
+ O[SYMBOL] = function () { return 7; };
+ return ''[KEY](O) != 7;
+ });
+
+ var DELEGATES_TO_EXEC = DELEGATES_TO_SYMBOL ? !fails(function () {
+ // Symbol-named RegExp methods call .exec
+ var execCalled = false;
+ var re = /a/;
+ re.exec = function () { execCalled = true; return null; };
+ if (KEY === 'split') {
+ // RegExp[@@split] doesn't call the regex's exec method, but first creates
+ // a new one. We need to return the patched regex when creating the new one.
+ re.constructor = {};
+ re.constructor[SPECIES] = function () { return re; };
+ }
+ re[SYMBOL]('');
+ return !execCalled;
+ }) : undefined;
+
+ if (
+ !DELEGATES_TO_SYMBOL ||
+ !DELEGATES_TO_EXEC ||
+ (KEY === 'replace' && !REPLACE_SUPPORTS_NAMED_GROUPS) ||
+ (KEY === 'split' && !SPLIT_WORKS_WITH_OVERWRITTEN_EXEC)
+ ) {
+ var nativeRegExpMethod = /./[SYMBOL];
+ var fns = exec(
+ defined,
+ SYMBOL,
+ ''[KEY],
+ function maybeCallNative(nativeMethod, regexp, str, arg2, forceStringMethod) {
+ if (regexp.exec === regexpExec) {
+ if (DELEGATES_TO_SYMBOL && !forceStringMethod) {
+ // The native String method already delegates to @@method (this
+ // polyfilled function), leasing to infinite recursion.
+ // We avoid it by directly calling the native @@method method.
+ return { done: true, value: nativeRegExpMethod.call(regexp, str, arg2) };
+ }
+ return { done: true, value: nativeMethod.call(str, regexp, arg2) };
+ }
+ return { done: false };
+ }
+ );
+ var strfn = fns[0];
+ var rxfn = fns[1];
+
+ redefine(String.prototype, KEY, strfn);
+ hide(RegExp.prototype, SYMBOL, length == 2
+ // 21.2.5.8 RegExp.prototype[@@replace](string, replaceValue)
+ // 21.2.5.11 RegExp.prototype[@@split](string, limit)
+ ? function (string, arg) { return rxfn.call(string, this, arg); }
+ // 21.2.5.6 RegExp.prototype[@@match](string)
+ // 21.2.5.9 RegExp.prototype[@@search](string)
+ : function (string) { return rxfn.call(string, this); }
+ );
+ }
+ };
+
+
+/***/ }),
+/* 207 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var anObject = __webpack_require__(12);
+ var toObject = __webpack_require__(46);
+ var toLength = __webpack_require__(38);
+ var toInteger = __webpack_require__(39);
+ var advanceStringIndex = __webpack_require__(204);
+ var regExpExec = __webpack_require__(205);
+ var max = Math.max;
+ var min = Math.min;
+ var floor = Math.floor;
+ var SUBSTITUTION_SYMBOLS = /\$([$&`']|\d\d?|<[^>]*>)/g;
+ var SUBSTITUTION_SYMBOLS_NO_NAMED = /\$([$&`']|\d\d?)/g;
+
+ var maybeToString = function (it) {
+ return it === undefined ? it : String(it);
+ };
+
+ // @@replace logic
+ __webpack_require__(206)('replace', 2, function (defined, REPLACE, $replace, maybeCallNative) {
+ return [
+ // `String.prototype.replace` method
+ // https://tc39.github.io/ecma262/#sec-string.prototype.replace
+ function replace(searchValue, replaceValue) {
+ var O = defined(this);
+ var fn = searchValue == undefined ? undefined : searchValue[REPLACE];
+ return fn !== undefined
+ ? fn.call(searchValue, O, replaceValue)
+ : $replace.call(String(O), searchValue, replaceValue);
+ },
+ // `RegExp.prototype[@@replace]` method
+ // https://tc39.github.io/ecma262/#sec-regexp.prototype-@@replace
+ function (regexp, replaceValue) {
+ var res = maybeCallNative($replace, regexp, this, replaceValue);
+ if (res.done) return res.value;
+
+ var rx = anObject(regexp);
+ var S = String(this);
+ var functionalReplace = typeof replaceValue === 'function';
+ if (!functionalReplace) replaceValue = String(replaceValue);
+ var global = rx.global;
+ if (global) {
+ var fullUnicode = rx.unicode;
+ rx.lastIndex = 0;
+ }
+ var results = [];
+ while (true) {
+ var result = regExpExec(rx, S);
+ if (result === null) break;
+ results.push(result);
+ if (!global) break;
+ var matchStr = String(result[0]);
+ if (matchStr === '') rx.lastIndex = advanceStringIndex(S, toLength(rx.lastIndex), fullUnicode);
+ }
+ var accumulatedResult = '';
+ var nextSourcePosition = 0;
+ for (var i = 0; i < results.length; i++) {
+ result = results[i];
+ var matched = String(result[0]);
+ var position = max(min(toInteger(result.index), S.length), 0);
+ var captures = [];
+ // NOTE: This is equivalent to
+ // captures = result.slice(1).map(maybeToString)
+ // but for some reason `nativeSlice.call(result, 1, result.length)` (called in
+ // the slice polyfill when slicing native arrays) "doesn't work" in safari 9 and
+ // causes a crash (https://pastebin.com/N21QzeQA) when trying to debug it.
+ for (var j = 1; j < result.length; j++) captures.push(maybeToString(result[j]));
+ var namedCaptures = result.groups;
+ if (functionalReplace) {
+ var replacerArgs = [matched].concat(captures, position, S);
+ if (namedCaptures !== undefined) replacerArgs.push(namedCaptures);
+ var replacement = String(replaceValue.apply(undefined, replacerArgs));
+ } else {
+ replacement = getSubstitution(matched, S, position, captures, namedCaptures, replaceValue);
+ }
+ if (position >= nextSourcePosition) {
+ accumulatedResult += S.slice(nextSourcePosition, position) + replacement;
+ nextSourcePosition = position + matched.length;
+ }
+ }
+ return accumulatedResult + S.slice(nextSourcePosition);
+ }
+ ];
+
+ // https://tc39.github.io/ecma262/#sec-getsubstitution
+ function getSubstitution(matched, str, position, captures, namedCaptures, replacement) {
+ var tailPos = position + matched.length;
+ var m = captures.length;
+ var symbols = SUBSTITUTION_SYMBOLS_NO_NAMED;
+ if (namedCaptures !== undefined) {
+ namedCaptures = toObject(namedCaptures);
+ symbols = SUBSTITUTION_SYMBOLS;
+ }
+ return $replace.call(replacement, symbols, function (match, ch) {
+ var capture;
+ switch (ch.charAt(0)) {
+ case '$': return '$';
+ case '&': return matched;
+ case '`': return str.slice(0, position);
+ case "'": return str.slice(tailPos);
+ case '<':
+ capture = namedCaptures[ch.slice(1, -1)];
+ break;
+ default: // \d\d?
+ var n = +ch;
+ if (n === 0) return match;
+ if (n > m) {
+ var f = floor(n / 10);
+ if (f === 0) return match;
+ if (f <= m) return captures[f - 1] === undefined ? ch.charAt(1) : captures[f - 1] + ch.charAt(1);
+ return match;
+ }
+ capture = captures[n - 1];
+ }
+ return capture === undefined ? '' : capture;
+ });
+ }
+ });
+
+
+/***/ }),
+/* 208 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var anObject = __webpack_require__(12);
+ var sameValue = __webpack_require__(71);
+ var regExpExec = __webpack_require__(205);
+
+ // @@search logic
+ __webpack_require__(206)('search', 1, function (defined, SEARCH, $search, maybeCallNative) {
+ return [
+ // `String.prototype.search` method
+ // https://tc39.github.io/ecma262/#sec-string.prototype.search
+ function search(regexp) {
+ var O = defined(this);
+ var fn = regexp == undefined ? undefined : regexp[SEARCH];
+ return fn !== undefined ? fn.call(regexp, O) : new RegExp(regexp)[SEARCH](String(O));
+ },
+ // `RegExp.prototype[@@search]` method
+ // https://tc39.github.io/ecma262/#sec-regexp.prototype-@@search
+ function (regexp) {
+ var res = maybeCallNative($search, regexp, this);
+ if (res.done) return res.value;
+ var rx = anObject(regexp);
+ var S = String(this);
+ var previousLastIndex = rx.lastIndex;
+ if (!sameValue(previousLastIndex, 0)) rx.lastIndex = 0;
+ var result = regExpExec(rx, S);
+ if (!sameValue(rx.lastIndex, previousLastIndex)) rx.lastIndex = previousLastIndex;
+ return result === null ? -1 : result.index;
+ }
+ ];
+ });
+
+
+/***/ }),
+/* 209 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var isRegExp = __webpack_require__(135);
+ var anObject = __webpack_require__(12);
+ var speciesConstructor = __webpack_require__(210);
+ var advanceStringIndex = __webpack_require__(204);
+ var toLength = __webpack_require__(38);
+ var callRegExpExec = __webpack_require__(205);
+ var regexpExec = __webpack_require__(200);
+ var fails = __webpack_require__(7);
+ var $min = Math.min;
+ var $push = [].push;
+ var $SPLIT = 'split';
+ var LENGTH = 'length';
+ var LAST_INDEX = 'lastIndex';
+ var MAX_UINT32 = 0xffffffff;
+
+ // babel-minify transpiles RegExp('x', 'y') -> /x/y and it causes SyntaxError
+ var SUPPORTS_Y = !fails(function () { RegExp(MAX_UINT32, 'y'); });
+
+ // @@split logic
+ __webpack_require__(206)('split', 2, function (defined, SPLIT, $split, maybeCallNative) {
+ var internalSplit;
+ if (
+ 'abbc'[$SPLIT](/(b)*/)[1] == 'c' ||
+ 'test'[$SPLIT](/(?:)/, -1)[LENGTH] != 4 ||
+ 'ab'[$SPLIT](/(?:ab)*/)[LENGTH] != 2 ||
+ '.'[$SPLIT](/(.?)(.?)/)[LENGTH] != 4 ||
+ '.'[$SPLIT](/()()/)[LENGTH] > 1 ||
+ ''[$SPLIT](/.?/)[LENGTH]
+ ) {
+ // based on es5-shim implementation, need to rework it
+ internalSplit = function (separator, limit) {
+ var string = String(this);
+ if (separator === undefined && limit === 0) return [];
+ // If `separator` is not a regex, use native split
+ if (!isRegExp(separator)) return $split.call(string, separator, limit);
+ var output = [];
+ var flags = (separator.ignoreCase ? 'i' : '') +
+ (separator.multiline ? 'm' : '') +
+ (separator.unicode ? 'u' : '') +
+ (separator.sticky ? 'y' : '');
+ var lastLastIndex = 0;
+ var splitLimit = limit === undefined ? MAX_UINT32 : limit >>> 0;
+ // Make `global` and avoid `lastIndex` issues by working with a copy
+ var separatorCopy = new RegExp(separator.source, flags + 'g');
+ var match, lastIndex, lastLength;
+ while (match = regexpExec.call(separatorCopy, string)) {
+ lastIndex = separatorCopy[LAST_INDEX];
+ if (lastIndex > lastLastIndex) {
+ output.push(string.slice(lastLastIndex, match.index));
+ if (match[LENGTH] > 1 && match.index < string[LENGTH]) $push.apply(output, match.slice(1));
+ lastLength = match[0][LENGTH];
+ lastLastIndex = lastIndex;
+ if (output[LENGTH] >= splitLimit) break;
+ }
+ if (separatorCopy[LAST_INDEX] === match.index) separatorCopy[LAST_INDEX]++; // Avoid an infinite loop
+ }
+ if (lastLastIndex === string[LENGTH]) {
+ if (lastLength || !separatorCopy.test('')) output.push('');
+ } else output.push(string.slice(lastLastIndex));
+ return output[LENGTH] > splitLimit ? output.slice(0, splitLimit) : output;
+ };
+ // Chakra, V8
+ } else if ('0'[$SPLIT](undefined, 0)[LENGTH]) {
+ internalSplit = function (separator, limit) {
+ return separator === undefined && limit === 0 ? [] : $split.call(this, separator, limit);
+ };
+ } else {
+ internalSplit = $split;
+ }
+
+ return [
+ // `String.prototype.split` method
+ // https://tc39.github.io/ecma262/#sec-string.prototype.split
+ function split(separator, limit) {
+ var O = defined(this);
+ var splitter = separator == undefined ? undefined : separator[SPLIT];
+ return splitter !== undefined
+ ? splitter.call(separator, O, limit)
+ : internalSplit.call(String(O), separator, limit);
+ },
+ // `RegExp.prototype[@@split]` method
+ // https://tc39.github.io/ecma262/#sec-regexp.prototype-@@split
+ //
+ // NOTE: This cannot be properly polyfilled in engines that don't support
+ // the 'y' flag.
+ function (regexp, limit) {
+ var res = maybeCallNative(internalSplit, regexp, this, limit, internalSplit !== $split);
+ if (res.done) return res.value;
+
+ var rx = anObject(regexp);
+ var S = String(this);
+ var C = speciesConstructor(rx, RegExp);
+
+ var unicodeMatching = rx.unicode;
+ var flags = (rx.ignoreCase ? 'i' : '') +
+ (rx.multiline ? 'm' : '') +
+ (rx.unicode ? 'u' : '') +
+ (SUPPORTS_Y ? 'y' : 'g');
+
+ // ^(? + rx + ) is needed, in combination with some S slicing, to
+ // simulate the 'y' flag.
+ var splitter = new C(SUPPORTS_Y ? rx : '^(?:' + rx.source + ')', flags);
+ var lim = limit === undefined ? MAX_UINT32 : limit >>> 0;
+ if (lim === 0) return [];
+ if (S.length === 0) return callRegExpExec(splitter, S) === null ? [S] : [];
+ var p = 0;
+ var q = 0;
+ var A = [];
+ while (q < S.length) {
+ splitter.lastIndex = SUPPORTS_Y ? q : 0;
+ var z = callRegExpExec(splitter, SUPPORTS_Y ? S : S.slice(q));
+ var e;
+ if (
+ z === null ||
+ (e = $min(toLength(splitter.lastIndex + (SUPPORTS_Y ? 0 : q)), S.length)) === p
+ ) {
+ q = advanceStringIndex(S, q, unicodeMatching);
+ } else {
+ A.push(S.slice(p, q));
+ if (A.length === lim) return A;
+ for (var i = 1; i <= z.length - 1; i++) {
+ A.push(z[i]);
+ if (A.length === lim) return A;
+ }
+ q = p = e;
+ }
+ }
+ A.push(S.slice(p));
+ return A;
+ }
+ ];
+ });
+
+
+/***/ }),
+/* 210 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 7.3.20 SpeciesConstructor(O, defaultConstructor)
+ var anObject = __webpack_require__(12);
+ var aFunction = __webpack_require__(24);
+ var SPECIES = __webpack_require__(27)('species');
+ module.exports = function (O, D) {
+ var C = anObject(O).constructor;
+ var S;
+ return C === undefined || (S = anObject(C)[SPECIES]) == undefined ? D : aFunction(S);
+ };
+
+
+/***/ }),
+/* 211 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var LIBRARY = __webpack_require__(22);
+ var global = __webpack_require__(4);
+ var ctx = __webpack_require__(23);
+ var classof = __webpack_require__(75);
+ var $export = __webpack_require__(8);
+ var isObject = __webpack_require__(13);
+ var aFunction = __webpack_require__(24);
+ var anInstance = __webpack_require__(212);
+ var forOf = __webpack_require__(213);
+ var speciesConstructor = __webpack_require__(210);
+ var task = __webpack_require__(214).set;
+ var microtask = __webpack_require__(215)();
+ var newPromiseCapabilityModule = __webpack_require__(216);
+ var perform = __webpack_require__(217);
+ var userAgent = __webpack_require__(218);
+ var promiseResolve = __webpack_require__(219);
+ var PROMISE = 'Promise';
+ var TypeError = global.TypeError;
+ var process = global.process;
+ var versions = process && process.versions;
+ var v8 = versions && versions.v8 || '';
+ var $Promise = global[PROMISE];
+ var isNode = classof(process) == 'process';
+ var empty = function () { /* empty */ };
+ var Internal, newGenericPromiseCapability, OwnPromiseCapability, Wrapper;
+ var newPromiseCapability = newGenericPromiseCapability = newPromiseCapabilityModule.f;
+
+ var USE_NATIVE = !!function () {
+ try {
+ // correct subclassing with @@species support
+ var promise = $Promise.resolve(1);
+ var FakePromise = (promise.constructor = {})[__webpack_require__(27)('species')] = function (exec) {
+ exec(empty, empty);
+ };
+ // unhandled rejections tracking support, NodeJS Promise without it fails @@species test
+ return (isNode || typeof PromiseRejectionEvent == 'function')
+ && promise.then(empty) instanceof FakePromise
+ // v8 6.6 (Node 10 and Chrome 66) have a bug with resolving custom thenables
+ // https://bugs.chromium.org/p/chromium/issues/detail?id=830565
+ // we can't detect it synchronously, so just check versions
+ && v8.indexOf('6.6') !== 0
+ && userAgent.indexOf('Chrome/66') === -1;
+ } catch (e) { /* empty */ }
+ }();
+
+ // helpers
+ var isThenable = function (it) {
+ var then;
+ return isObject(it) && typeof (then = it.then) == 'function' ? then : false;
+ };
+ var notify = function (promise, isReject) {
+ if (promise._n) return;
+ promise._n = true;
+ var chain = promise._c;
+ microtask(function () {
+ var value = promise._v;
+ var ok = promise._s == 1;
+ var i = 0;
+ var run = function (reaction) {
+ var handler = ok ? reaction.ok : reaction.fail;
+ var resolve = reaction.resolve;
+ var reject = reaction.reject;
+ var domain = reaction.domain;
+ var result, then, exited;
+ try {
+ if (handler) {
+ if (!ok) {
+ if (promise._h == 2) onHandleUnhandled(promise);
+ promise._h = 1;
+ }
+ if (handler === true) result = value;
+ else {
+ if (domain) domain.enter();
+ result = handler(value); // may throw
+ if (domain) {
+ domain.exit();
+ exited = true;
+ }
+ }
+ if (result === reaction.promise) {
+ reject(TypeError('Promise-chain cycle'));
+ } else if (then = isThenable(result)) {
+ then.call(result, resolve, reject);
+ } else resolve(result);
+ } else reject(value);
+ } catch (e) {
+ if (domain && !exited) domain.exit();
+ reject(e);
+ }
+ };
+ while (chain.length > i) run(chain[i++]); // variable length - can't use forEach
+ promise._c = [];
+ promise._n = false;
+ if (isReject && !promise._h) onUnhandled(promise);
+ });
+ };
+ var onUnhandled = function (promise) {
+ task.call(global, function () {
+ var value = promise._v;
+ var unhandled = isUnhandled(promise);
+ var result, handler, console;
+ if (unhandled) {
+ result = perform(function () {
+ if (isNode) {
+ process.emit('unhandledRejection', value, promise);
+ } else if (handler = global.onunhandledrejection) {
+ handler({ promise: promise, reason: value });
+ } else if ((console = global.console) && console.error) {
+ console.error('Unhandled promise rejection', value);
+ }
+ });
+ // Browsers should not trigger `rejectionHandled` event if it was handled here, NodeJS - should
+ promise._h = isNode || isUnhandled(promise) ? 2 : 1;
+ } promise._a = undefined;
+ if (unhandled && result.e) throw result.v;
+ });
+ };
+ var isUnhandled = function (promise) {
+ return promise._h !== 1 && (promise._a || promise._c).length === 0;
+ };
+ var onHandleUnhandled = function (promise) {
+ task.call(global, function () {
+ var handler;
+ if (isNode) {
+ process.emit('rejectionHandled', promise);
+ } else if (handler = global.onrejectionhandled) {
+ handler({ promise: promise, reason: promise._v });
+ }
+ });
+ };
+ var $reject = function (value) {
+ var promise = this;
+ if (promise._d) return;
+ promise._d = true;
+ promise = promise._w || promise; // unwrap
+ promise._v = value;
+ promise._s = 2;
+ if (!promise._a) promise._a = promise._c.slice();
+ notify(promise, true);
+ };
+ var $resolve = function (value) {
+ var promise = this;
+ var then;
+ if (promise._d) return;
+ promise._d = true;
+ promise = promise._w || promise; // unwrap
+ try {
+ if (promise === value) throw TypeError("Promise can't be resolved itself");
+ if (then = isThenable(value)) {
+ microtask(function () {
+ var wrapper = { _w: promise, _d: false }; // wrap
+ try {
+ then.call(value, ctx($resolve, wrapper, 1), ctx($reject, wrapper, 1));
+ } catch (e) {
+ $reject.call(wrapper, e);
+ }
+ });
+ } else {
+ promise._v = value;
+ promise._s = 1;
+ notify(promise, false);
+ }
+ } catch (e) {
+ $reject.call({ _w: promise, _d: false }, e); // wrap
+ }
+ };
+
+ // constructor polyfill
+ if (!USE_NATIVE) {
+ // 25.4.3.1 Promise(executor)
+ $Promise = function Promise(executor) {
+ anInstance(this, $Promise, PROMISE, '_h');
+ aFunction(executor);
+ Internal.call(this);
+ try {
+ executor(ctx($resolve, this, 1), ctx($reject, this, 1));
+ } catch (err) {
+ $reject.call(this, err);
+ }
+ };
+ // eslint-disable-next-line no-unused-vars
+ Internal = function Promise(executor) {
+ this._c = []; // <- awaiting reactions
+ this._a = undefined; // <- checked in isUnhandled reactions
+ this._s = 0; // <- state
+ this._d = false; // <- done
+ this._v = undefined; // <- value
+ this._h = 0; // <- rejection state, 0 - default, 1 - handled, 2 - unhandled
+ this._n = false; // <- notify
+ };
+ Internal.prototype = __webpack_require__(220)($Promise.prototype, {
+ // 25.4.5.3 Promise.prototype.then(onFulfilled, onRejected)
+ then: function then(onFulfilled, onRejected) {
+ var reaction = newPromiseCapability(speciesConstructor(this, $Promise));
+ reaction.ok = typeof onFulfilled == 'function' ? onFulfilled : true;
+ reaction.fail = typeof onRejected == 'function' && onRejected;
+ reaction.domain = isNode ? process.domain : undefined;
+ this._c.push(reaction);
+ if (this._a) this._a.push(reaction);
+ if (this._s) notify(this, false);
+ return reaction.promise;
+ },
+ // 25.4.5.1 Promise.prototype.catch(onRejected)
+ 'catch': function (onRejected) {
+ return this.then(undefined, onRejected);
+ }
+ });
+ OwnPromiseCapability = function () {
+ var promise = new Internal();
+ this.promise = promise;
+ this.resolve = ctx($resolve, promise, 1);
+ this.reject = ctx($reject, promise, 1);
+ };
+ newPromiseCapabilityModule.f = newPromiseCapability = function (C) {
+ return C === $Promise || C === Wrapper
+ ? new OwnPromiseCapability(C)
+ : newGenericPromiseCapability(C);
+ };
+ }
+
+ $export($export.G + $export.W + $export.F * !USE_NATIVE, { Promise: $Promise });
+ __webpack_require__(26)($Promise, PROMISE);
+ __webpack_require__(194)(PROMISE);
+ Wrapper = __webpack_require__(9)[PROMISE];
+
+ // statics
+ $export($export.S + $export.F * !USE_NATIVE, PROMISE, {
+ // 25.4.4.5 Promise.reject(r)
+ reject: function reject(r) {
+ var capability = newPromiseCapability(this);
+ var $$reject = capability.reject;
+ $$reject(r);
+ return capability.promise;
+ }
+ });
+ $export($export.S + $export.F * (LIBRARY || !USE_NATIVE), PROMISE, {
+ // 25.4.4.6 Promise.resolve(x)
+ resolve: function resolve(x) {
+ return promiseResolve(LIBRARY && this === Wrapper ? $Promise : this, x);
+ }
+ });
+ $export($export.S + $export.F * !(USE_NATIVE && __webpack_require__(167)(function (iter) {
+ $Promise.all(iter)['catch'](empty);
+ })), PROMISE, {
+ // 25.4.4.1 Promise.all(iterable)
+ all: function all(iterable) {
+ var C = this;
+ var capability = newPromiseCapability(C);
+ var resolve = capability.resolve;
+ var reject = capability.reject;
+ var result = perform(function () {
+ var values = [];
+ var index = 0;
+ var remaining = 1;
+ forOf(iterable, false, function (promise) {
+ var $index = index++;
+ var alreadyCalled = false;
+ values.push(undefined);
+ remaining++;
+ C.resolve(promise).then(function (value) {
+ if (alreadyCalled) return;
+ alreadyCalled = true;
+ values[$index] = value;
+ --remaining || resolve(values);
+ }, reject);
+ });
+ --remaining || resolve(values);
+ });
+ if (result.e) reject(result.v);
+ return capability.promise;
+ },
+ // 25.4.4.4 Promise.race(iterable)
+ race: function race(iterable) {
+ var C = this;
+ var capability = newPromiseCapability(C);
+ var reject = capability.reject;
+ var result = perform(function () {
+ forOf(iterable, false, function (promise) {
+ C.resolve(promise).then(capability.resolve, reject);
+ });
+ });
+ if (result.e) reject(result.v);
+ return capability.promise;
+ }
+ });
+
+
+/***/ }),
+/* 212 */
+/***/ (function(module, exports) {
+
+ module.exports = function (it, Constructor, name, forbiddenField) {
+ if (!(it instanceof Constructor) || (forbiddenField !== undefined && forbiddenField in it)) {
+ throw TypeError(name + ': incorrect invocation!');
+ } return it;
+ };
+
+
+/***/ }),
+/* 213 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var ctx = __webpack_require__(23);
+ var call = __webpack_require__(163);
+ var isArrayIter = __webpack_require__(164);
+ var anObject = __webpack_require__(12);
+ var toLength = __webpack_require__(38);
+ var getIterFn = __webpack_require__(166);
+ var BREAK = {};
+ var RETURN = {};
+ var exports = module.exports = function (iterable, entries, fn, that, ITERATOR) {
+ var iterFn = ITERATOR ? function () { return iterable; } : getIterFn(iterable);
+ var f = ctx(fn, that, entries ? 2 : 1);
+ var index = 0;
+ var length, step, iterator, result;
+ if (typeof iterFn != 'function') throw TypeError(iterable + ' is not iterable!');
+ // fast case for arrays with default iterator
+ if (isArrayIter(iterFn)) for (length = toLength(iterable.length); length > index; index++) {
+ result = entries ? f(anObject(step = iterable[index])[0], step[1]) : f(iterable[index]);
+ if (result === BREAK || result === RETURN) return result;
+ } else for (iterator = iterFn.call(iterable); !(step = iterator.next()).done;) {
+ result = call(iterator, f, step.value, entries);
+ if (result === BREAK || result === RETURN) return result;
+ }
+ };
+ exports.BREAK = BREAK;
+ exports.RETURN = RETURN;
+
+
+/***/ }),
+/* 214 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var ctx = __webpack_require__(23);
+ var invoke = __webpack_require__(78);
+ var html = __webpack_require__(49);
+ var cel = __webpack_require__(15);
+ var global = __webpack_require__(4);
+ var process = global.process;
+ var setTask = global.setImmediate;
+ var clearTask = global.clearImmediate;
+ var MessageChannel = global.MessageChannel;
+ var Dispatch = global.Dispatch;
+ var counter = 0;
+ var queue = {};
+ var ONREADYSTATECHANGE = 'onreadystatechange';
+ var defer, channel, port;
+ var run = function () {
+ var id = +this;
+ // eslint-disable-next-line no-prototype-builtins
+ if (queue.hasOwnProperty(id)) {
+ var fn = queue[id];
+ delete queue[id];
+ fn();
+ }
+ };
+ var listener = function (event) {
+ run.call(event.data);
+ };
+ // Node.js 0.9+ & IE10+ has setImmediate, otherwise:
+ if (!setTask || !clearTask) {
+ setTask = function setImmediate(fn) {
+ var args = [];
+ var i = 1;
+ while (arguments.length > i) args.push(arguments[i++]);
+ queue[++counter] = function () {
+ // eslint-disable-next-line no-new-func
+ invoke(typeof fn == 'function' ? fn : Function(fn), args);
+ };
+ defer(counter);
+ return counter;
+ };
+ clearTask = function clearImmediate(id) {
+ delete queue[id];
+ };
+ // Node.js 0.8-
+ if (__webpack_require__(35)(process) == 'process') {
+ defer = function (id) {
+ process.nextTick(ctx(run, id, 1));
+ };
+ // Sphere (JS game engine) Dispatch API
+ } else if (Dispatch && Dispatch.now) {
+ defer = function (id) {
+ Dispatch.now(ctx(run, id, 1));
+ };
+ // Browsers with MessageChannel, includes WebWorkers
+ } else if (MessageChannel) {
+ channel = new MessageChannel();
+ port = channel.port2;
+ channel.port1.onmessage = listener;
+ defer = ctx(port.postMessage, port, 1);
+ // Browsers with postMessage, skip WebWorkers
+ // IE8 has postMessage, but it's sync & typeof its postMessage is 'object'
+ } else if (global.addEventListener && typeof postMessage == 'function' && !global.importScripts) {
+ defer = function (id) {
+ global.postMessage(id + '', '*');
+ };
+ global.addEventListener('message', listener, false);
+ // IE8-
+ } else if (ONREADYSTATECHANGE in cel('script')) {
+ defer = function (id) {
+ html.appendChild(cel('script'))[ONREADYSTATECHANGE] = function () {
+ html.removeChild(this);
+ run.call(id);
+ };
+ };
+ // Rest old browsers
+ } else {
+ defer = function (id) {
+ setTimeout(ctx(run, id, 1), 0);
+ };
+ }
+ }
+ module.exports = {
+ set: setTask,
+ clear: clearTask
+ };
+
+
+/***/ }),
+/* 215 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var global = __webpack_require__(4);
+ var macrotask = __webpack_require__(214).set;
+ var Observer = global.MutationObserver || global.WebKitMutationObserver;
+ var process = global.process;
+ var Promise = global.Promise;
+ var isNode = __webpack_require__(35)(process) == 'process';
+
+ module.exports = function () {
+ var head, last, notify;
+
+ var flush = function () {
+ var parent, fn;
+ if (isNode && (parent = process.domain)) parent.exit();
+ while (head) {
+ fn = head.fn;
+ head = head.next;
+ try {
+ fn();
+ } catch (e) {
+ if (head) notify();
+ else last = undefined;
+ throw e;
+ }
+ } last = undefined;
+ if (parent) parent.enter();
+ };
+
+ // Node.js
+ if (isNode) {
+ notify = function () {
+ process.nextTick(flush);
+ };
+ // browsers with MutationObserver, except iOS Safari - https://github.com/zloirock/core-js/issues/339
+ } else if (Observer && !(global.navigator && global.navigator.standalone)) {
+ var toggle = true;
+ var node = document.createTextNode('');
+ new Observer(flush).observe(node, { characterData: true }); // eslint-disable-line no-new
+ notify = function () {
+ node.data = toggle = !toggle;
+ };
+ // environments with maybe non-completely correct, but existent Promise
+ } else if (Promise && Promise.resolve) {
+ // Promise.resolve without an argument throws an error in LG WebOS 2
+ var promise = Promise.resolve(undefined);
+ notify = function () {
+ promise.then(flush);
+ };
+ // for other environments - macrotask based on:
+ // - setImmediate
+ // - MessageChannel
+ // - window.postMessag
+ // - onreadystatechange
+ // - setTimeout
+ } else {
+ notify = function () {
+ // strange IE + webpack dev server bug - use .call(global)
+ macrotask.call(global, flush);
+ };
+ }
+
+ return function (fn) {
+ var task = { fn: fn, next: undefined };
+ if (last) last.next = task;
+ if (!head) {
+ head = task;
+ notify();
+ } last = task;
+ };
+ };
+
+
+/***/ }),
+/* 216 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 25.4.1.5 NewPromiseCapability(C)
+ var aFunction = __webpack_require__(24);
+
+ function PromiseCapability(C) {
+ var resolve, reject;
+ this.promise = new C(function ($$resolve, $$reject) {
+ if (resolve !== undefined || reject !== undefined) throw TypeError('Bad Promise constructor');
+ resolve = $$resolve;
+ reject = $$reject;
+ });
+ this.resolve = aFunction(resolve);
+ this.reject = aFunction(reject);
+ }
+
+ module.exports.f = function (C) {
+ return new PromiseCapability(C);
+ };
+
+
+/***/ }),
+/* 217 */
+/***/ (function(module, exports) {
+
+ module.exports = function (exec) {
+ try {
+ return { e: false, v: exec() };
+ } catch (e) {
+ return { e: true, v: e };
+ }
+ };
+
+
+/***/ }),
+/* 218 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var global = __webpack_require__(4);
+ var navigator = global.navigator;
+
+ module.exports = navigator && navigator.userAgent || '';
+
+
+/***/ }),
+/* 219 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var anObject = __webpack_require__(12);
+ var isObject = __webpack_require__(13);
+ var newPromiseCapability = __webpack_require__(216);
+
+ module.exports = function (C, x) {
+ anObject(C);
+ if (isObject(x) && x.constructor === C) return x;
+ var promiseCapability = newPromiseCapability.f(C);
+ var resolve = promiseCapability.resolve;
+ resolve(x);
+ return promiseCapability.promise;
+ };
+
+
+/***/ }),
+/* 220 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var redefine = __webpack_require__(18);
+ module.exports = function (target, src, safe) {
+ for (var key in src) redefine(target, key, src[key], safe);
+ return target;
+ };
+
+
+/***/ }),
+/* 221 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var strong = __webpack_require__(222);
+ var validate = __webpack_require__(223);
+ var MAP = 'Map';
+
+ // 23.1 Map Objects
+ module.exports = __webpack_require__(224)(MAP, function (get) {
+ return function Map() { return get(this, arguments.length > 0 ? arguments[0] : undefined); };
+ }, {
+ // 23.1.3.6 Map.prototype.get(key)
+ get: function get(key) {
+ var entry = strong.getEntry(validate(this, MAP), key);
+ return entry && entry.v;
+ },
+ // 23.1.3.9 Map.prototype.set(key, value)
+ set: function set(key, value) {
+ return strong.def(validate(this, MAP), key === 0 ? 0 : key, value);
+ }
+ }, strong, true);
+
+
+/***/ }),
+/* 222 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var dP = __webpack_require__(11).f;
+ var create = __webpack_require__(47);
+ var redefineAll = __webpack_require__(220);
+ var ctx = __webpack_require__(23);
+ var anInstance = __webpack_require__(212);
+ var forOf = __webpack_require__(213);
+ var $iterDefine = __webpack_require__(129);
+ var step = __webpack_require__(196);
+ var setSpecies = __webpack_require__(194);
+ var DESCRIPTORS = __webpack_require__(6);
+ var fastKey = __webpack_require__(25).fastKey;
+ var validate = __webpack_require__(223);
+ var SIZE = DESCRIPTORS ? '_s' : 'size';
+
+ var getEntry = function (that, key) {
+ // fast case
+ var index = fastKey(key);
+ var entry;
+ if (index !== 'F') return that._i[index];
+ // frozen object case
+ for (entry = that._f; entry; entry = entry.n) {
+ if (entry.k == key) return entry;
+ }
+ };
+
+ module.exports = {
+ getConstructor: function (wrapper, NAME, IS_MAP, ADDER) {
+ var C = wrapper(function (that, iterable) {
+ anInstance(that, C, NAME, '_i');
+ that._t = NAME; // collection type
+ that._i = create(null); // index
+ that._f = undefined; // first entry
+ that._l = undefined; // last entry
+ that[SIZE] = 0; // size
+ if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that);
+ });
+ redefineAll(C.prototype, {
+ // 23.1.3.1 Map.prototype.clear()
+ // 23.2.3.2 Set.prototype.clear()
+ clear: function clear() {
+ for (var that = validate(this, NAME), data = that._i, entry = that._f; entry; entry = entry.n) {
+ entry.r = true;
+ if (entry.p) entry.p = entry.p.n = undefined;
+ delete data[entry.i];
+ }
+ that._f = that._l = undefined;
+ that[SIZE] = 0;
+ },
+ // 23.1.3.3 Map.prototype.delete(key)
+ // 23.2.3.4 Set.prototype.delete(value)
+ 'delete': function (key) {
+ var that = validate(this, NAME);
+ var entry = getEntry(that, key);
+ if (entry) {
+ var next = entry.n;
+ var prev = entry.p;
+ delete that._i[entry.i];
+ entry.r = true;
+ if (prev) prev.n = next;
+ if (next) next.p = prev;
+ if (that._f == entry) that._f = next;
+ if (that._l == entry) that._l = prev;
+ that[SIZE]--;
+ } return !!entry;
+ },
+ // 23.2.3.6 Set.prototype.forEach(callbackfn, thisArg = undefined)
+ // 23.1.3.5 Map.prototype.forEach(callbackfn, thisArg = undefined)
+ forEach: function forEach(callbackfn /* , that = undefined */) {
+ validate(this, NAME);
+ var f = ctx(callbackfn, arguments.length > 1 ? arguments[1] : undefined, 3);
+ var entry;
+ while (entry = entry ? entry.n : this._f) {
+ f(entry.v, entry.k, this);
+ // revert to the last existing entry
+ while (entry && entry.r) entry = entry.p;
+ }
+ },
+ // 23.1.3.7 Map.prototype.has(key)
+ // 23.2.3.7 Set.prototype.has(value)
+ has: function has(key) {
+ return !!getEntry(validate(this, NAME), key);
+ }
+ });
+ if (DESCRIPTORS) dP(C.prototype, 'size', {
+ get: function () {
+ return validate(this, NAME)[SIZE];
+ }
+ });
+ return C;
+ },
+ def: function (that, key, value) {
+ var entry = getEntry(that, key);
+ var prev, index;
+ // change existing entry
+ if (entry) {
+ entry.v = value;
+ // create new entry
+ } else {
+ that._l = entry = {
+ i: index = fastKey(key, true), // <- index
+ k: key, // <- key
+ v: value, // <- value
+ p: prev = that._l, // <- previous entry
+ n: undefined, // <- next entry
+ r: false // <- removed
+ };
+ if (!that._f) that._f = entry;
+ if (prev) prev.n = entry;
+ that[SIZE]++;
+ // add to index
+ if (index !== 'F') that._i[index] = entry;
+ } return that;
+ },
+ getEntry: getEntry,
+ setStrong: function (C, NAME, IS_MAP) {
+ // add .keys, .values, .entries, [@@iterator]
+ // 23.1.3.4, 23.1.3.8, 23.1.3.11, 23.1.3.12, 23.2.3.5, 23.2.3.8, 23.2.3.10, 23.2.3.11
+ $iterDefine(C, NAME, function (iterated, kind) {
+ this._t = validate(iterated, NAME); // target
+ this._k = kind; // kind
+ this._l = undefined; // previous
+ }, function () {
+ var that = this;
+ var kind = that._k;
+ var entry = that._l;
+ // revert to the last existing entry
+ while (entry && entry.r) entry = entry.p;
+ // get next entry
+ if (!that._t || !(that._l = entry = entry ? entry.n : that._t._f)) {
+ // or finish the iteration
+ that._t = undefined;
+ return step(1);
+ }
+ // return step by kind
+ if (kind == 'keys') return step(0, entry.k);
+ if (kind == 'values') return step(0, entry.v);
+ return step(0, [entry.k, entry.v]);
+ }, IS_MAP ? 'entries' : 'values', !IS_MAP, true);
+
+ // add [@@species], 23.1.2.2, 23.2.2.2
+ setSpecies(NAME);
+ }
+ };
+
+
+/***/ }),
+/* 223 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var isObject = __webpack_require__(13);
+ module.exports = function (it, TYPE) {
+ if (!isObject(it) || it._t !== TYPE) throw TypeError('Incompatible receiver, ' + TYPE + ' required!');
+ return it;
+ };
+
+
+/***/ }),
+/* 224 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var global = __webpack_require__(4);
+ var $export = __webpack_require__(8);
+ var redefine = __webpack_require__(18);
+ var redefineAll = __webpack_require__(220);
+ var meta = __webpack_require__(25);
+ var forOf = __webpack_require__(213);
+ var anInstance = __webpack_require__(212);
+ var isObject = __webpack_require__(13);
+ var fails = __webpack_require__(7);
+ var $iterDetect = __webpack_require__(167);
+ var setToStringTag = __webpack_require__(26);
+ var inheritIfRequired = __webpack_require__(88);
+
+ module.exports = function (NAME, wrapper, methods, common, IS_MAP, IS_WEAK) {
+ var Base = global[NAME];
+ var C = Base;
+ var ADDER = IS_MAP ? 'set' : 'add';
+ var proto = C && C.prototype;
+ var O = {};
+ var fixMethod = function (KEY) {
+ var fn = proto[KEY];
+ redefine(proto, KEY,
+ KEY == 'delete' ? function (a) {
+ return IS_WEAK && !isObject(a) ? false : fn.call(this, a === 0 ? 0 : a);
+ } : KEY == 'has' ? function has(a) {
+ return IS_WEAK && !isObject(a) ? false : fn.call(this, a === 0 ? 0 : a);
+ } : KEY == 'get' ? function get(a) {
+ return IS_WEAK && !isObject(a) ? undefined : fn.call(this, a === 0 ? 0 : a);
+ } : KEY == 'add' ? function add(a) { fn.call(this, a === 0 ? 0 : a); return this; }
+ : function set(a, b) { fn.call(this, a === 0 ? 0 : a, b); return this; }
+ );
+ };
+ if (typeof C != 'function' || !(IS_WEAK || proto.forEach && !fails(function () {
+ new C().entries().next();
+ }))) {
+ // create collection constructor
+ C = common.getConstructor(wrapper, NAME, IS_MAP, ADDER);
+ redefineAll(C.prototype, methods);
+ meta.NEED = true;
+ } else {
+ var instance = new C();
+ // early implementations not supports chaining
+ var HASNT_CHAINING = instance[ADDER](IS_WEAK ? {} : -0, 1) != instance;
+ // V8 ~ Chromium 40- weak-collections throws on primitives, but should return false
+ var THROWS_ON_PRIMITIVES = fails(function () { instance.has(1); });
+ // most early implementations doesn't supports iterables, most modern - not close it correctly
+ var ACCEPT_ITERABLES = $iterDetect(function (iter) { new C(iter); }); // eslint-disable-line no-new
+ // for early implementations -0 and +0 not the same
+ var BUGGY_ZERO = !IS_WEAK && fails(function () {
+ // V8 ~ Chromium 42- fails only with 5+ elements
+ var $instance = new C();
+ var index = 5;
+ while (index--) $instance[ADDER](index, index);
+ return !$instance.has(-0);
+ });
+ if (!ACCEPT_ITERABLES) {
+ C = wrapper(function (target, iterable) {
+ anInstance(target, C, NAME);
+ var that = inheritIfRequired(new Base(), target, C);
+ if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that);
+ return that;
+ });
+ C.prototype = proto;
+ proto.constructor = C;
+ }
+ if (THROWS_ON_PRIMITIVES || BUGGY_ZERO) {
+ fixMethod('delete');
+ fixMethod('has');
+ IS_MAP && fixMethod('get');
+ }
+ if (BUGGY_ZERO || HASNT_CHAINING) fixMethod(ADDER);
+ // weak collections should not contains .clear method
+ if (IS_WEAK && proto.clear) delete proto.clear;
+ }
+
+ setToStringTag(C, NAME);
+
+ O[NAME] = C;
+ $export($export.G + $export.W + $export.F * (C != Base), O);
+
+ if (!IS_WEAK) common.setStrong(C, NAME, IS_MAP);
+
+ return C;
+ };
+
+
+/***/ }),
+/* 225 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var strong = __webpack_require__(222);
+ var validate = __webpack_require__(223);
+ var SET = 'Set';
+
+ // 23.2 Set Objects
+ module.exports = __webpack_require__(224)(SET, function (get) {
+ return function Set() { return get(this, arguments.length > 0 ? arguments[0] : undefined); };
+ }, {
+ // 23.2.3.1 Set.prototype.add(value)
+ add: function add(value) {
+ return strong.def(validate(this, SET), value = value === 0 ? 0 : value, value);
+ }
+ }, strong);
+
+
+/***/ }),
+/* 226 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var global = __webpack_require__(4);
+ var each = __webpack_require__(174)(0);
+ var redefine = __webpack_require__(18);
+ var meta = __webpack_require__(25);
+ var assign = __webpack_require__(69);
+ var weak = __webpack_require__(227);
+ var isObject = __webpack_require__(13);
+ var validate = __webpack_require__(223);
+ var NATIVE_WEAK_MAP = __webpack_require__(223);
+ var IS_IE11 = !global.ActiveXObject && 'ActiveXObject' in global;
+ var WEAK_MAP = 'WeakMap';
+ var getWeak = meta.getWeak;
+ var isExtensible = Object.isExtensible;
+ var uncaughtFrozenStore = weak.ufstore;
+ var InternalMap;
+
+ var wrapper = function (get) {
+ return function WeakMap() {
+ return get(this, arguments.length > 0 ? arguments[0] : undefined);
+ };
+ };
+
+ var methods = {
+ // 23.3.3.3 WeakMap.prototype.get(key)
+ get: function get(key) {
+ if (isObject(key)) {
+ var data = getWeak(key);
+ if (data === true) return uncaughtFrozenStore(validate(this, WEAK_MAP)).get(key);
+ return data ? data[this._i] : undefined;
+ }
+ },
+ // 23.3.3.5 WeakMap.prototype.set(key, value)
+ set: function set(key, value) {
+ return weak.def(validate(this, WEAK_MAP), key, value);
+ }
+ };
+
+ // 23.3 WeakMap Objects
+ var $WeakMap = module.exports = __webpack_require__(224)(WEAK_MAP, wrapper, methods, weak, true, true);
+
+ // IE11 WeakMap frozen keys fix
+ if (NATIVE_WEAK_MAP && IS_IE11) {
+ InternalMap = weak.getConstructor(wrapper, WEAK_MAP);
+ assign(InternalMap.prototype, methods);
+ meta.NEED = true;
+ each(['delete', 'has', 'get', 'set'], function (key) {
+ var proto = $WeakMap.prototype;
+ var method = proto[key];
+ redefine(proto, key, function (a, b) {
+ // store frozen objects on internal weakmap shim
+ if (isObject(a) && !isExtensible(a)) {
+ if (!this._f) this._f = new InternalMap();
+ var result = this._f[key](a, b);
+ return key == 'set' ? this : result;
+ // store all the rest on native weakmap
+ } return method.call(this, a, b);
+ });
+ });
+ }
+
+
+/***/ }),
+/* 227 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var redefineAll = __webpack_require__(220);
+ var getWeak = __webpack_require__(25).getWeak;
+ var anObject = __webpack_require__(12);
+ var isObject = __webpack_require__(13);
+ var anInstance = __webpack_require__(212);
+ var forOf = __webpack_require__(213);
+ var createArrayMethod = __webpack_require__(174);
+ var $has = __webpack_require__(5);
+ var validate = __webpack_require__(223);
+ var arrayFind = createArrayMethod(5);
+ var arrayFindIndex = createArrayMethod(6);
+ var id = 0;
+
+ // fallback for uncaught frozen keys
+ var uncaughtFrozenStore = function (that) {
+ return that._l || (that._l = new UncaughtFrozenStore());
+ };
+ var UncaughtFrozenStore = function () {
+ this.a = [];
+ };
+ var findUncaughtFrozen = function (store, key) {
+ return arrayFind(store.a, function (it) {
+ return it[0] === key;
+ });
+ };
+ UncaughtFrozenStore.prototype = {
+ get: function (key) {
+ var entry = findUncaughtFrozen(this, key);
+ if (entry) return entry[1];
+ },
+ has: function (key) {
+ return !!findUncaughtFrozen(this, key);
+ },
+ set: function (key, value) {
+ var entry = findUncaughtFrozen(this, key);
+ if (entry) entry[1] = value;
+ else this.a.push([key, value]);
+ },
+ 'delete': function (key) {
+ var index = arrayFindIndex(this.a, function (it) {
+ return it[0] === key;
+ });
+ if (~index) this.a.splice(index, 1);
+ return !!~index;
+ }
+ };
+
+ module.exports = {
+ getConstructor: function (wrapper, NAME, IS_MAP, ADDER) {
+ var C = wrapper(function (that, iterable) {
+ anInstance(that, C, NAME, '_i');
+ that._t = NAME; // collection type
+ that._i = id++; // collection id
+ that._l = undefined; // leak store for uncaught frozen objects
+ if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that);
+ });
+ redefineAll(C.prototype, {
+ // 23.3.3.2 WeakMap.prototype.delete(key)
+ // 23.4.3.3 WeakSet.prototype.delete(value)
+ 'delete': function (key) {
+ if (!isObject(key)) return false;
+ var data = getWeak(key);
+ if (data === true) return uncaughtFrozenStore(validate(this, NAME))['delete'](key);
+ return data && $has(data, this._i) && delete data[this._i];
+ },
+ // 23.3.3.4 WeakMap.prototype.has(key)
+ // 23.4.3.4 WeakSet.prototype.has(value)
+ has: function has(key) {
+ if (!isObject(key)) return false;
+ var data = getWeak(key);
+ if (data === true) return uncaughtFrozenStore(validate(this, NAME)).has(key);
+ return data && $has(data, this._i);
+ }
+ });
+ return C;
+ },
+ def: function (that, key, value) {
+ var data = getWeak(anObject(key), true);
+ if (data === true) uncaughtFrozenStore(that).set(key, value);
+ else data[that._i] = value;
+ return that;
+ },
+ ufstore: uncaughtFrozenStore
+ };
+
+
+/***/ }),
+/* 228 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var weak = __webpack_require__(227);
+ var validate = __webpack_require__(223);
+ var WEAK_SET = 'WeakSet';
+
+ // 23.4 WeakSet Objects
+ __webpack_require__(224)(WEAK_SET, function (get) {
+ return function WeakSet() { return get(this, arguments.length > 0 ? arguments[0] : undefined); };
+ }, {
+ // 23.4.3.1 WeakSet.prototype.add(value)
+ add: function add(value) {
+ return weak.def(validate(this, WEAK_SET), value, true);
+ }
+ }, weak, false, true);
+
+
+/***/ }),
+/* 229 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var $typed = __webpack_require__(230);
+ var buffer = __webpack_require__(231);
+ var anObject = __webpack_require__(12);
+ var toAbsoluteIndex = __webpack_require__(40);
+ var toLength = __webpack_require__(38);
+ var isObject = __webpack_require__(13);
+ var ArrayBuffer = __webpack_require__(4).ArrayBuffer;
+ var speciesConstructor = __webpack_require__(210);
+ var $ArrayBuffer = buffer.ArrayBuffer;
+ var $DataView = buffer.DataView;
+ var $isView = $typed.ABV && ArrayBuffer.isView;
+ var $slice = $ArrayBuffer.prototype.slice;
+ var VIEW = $typed.VIEW;
+ var ARRAY_BUFFER = 'ArrayBuffer';
+
+ $export($export.G + $export.W + $export.F * (ArrayBuffer !== $ArrayBuffer), { ArrayBuffer: $ArrayBuffer });
+
+ $export($export.S + $export.F * !$typed.CONSTR, ARRAY_BUFFER, {
+ // 24.1.3.1 ArrayBuffer.isView(arg)
+ isView: function isView(it) {
+ return $isView && $isView(it) || isObject(it) && VIEW in it;
+ }
+ });
+
+ $export($export.P + $export.U + $export.F * __webpack_require__(7)(function () {
+ return !new $ArrayBuffer(2).slice(1, undefined).byteLength;
+ }), ARRAY_BUFFER, {
+ // 24.1.4.3 ArrayBuffer.prototype.slice(start, end)
+ slice: function slice(start, end) {
+ if ($slice !== undefined && end === undefined) return $slice.call(anObject(this), start); // FF fix
+ var len = anObject(this).byteLength;
+ var first = toAbsoluteIndex(start, len);
+ var fin = toAbsoluteIndex(end === undefined ? len : end, len);
+ var result = new (speciesConstructor(this, $ArrayBuffer))(toLength(fin - first));
+ var viewS = new $DataView(this);
+ var viewT = new $DataView(result);
+ var index = 0;
+ while (first < fin) {
+ viewT.setUint8(index++, viewS.getUint8(first++));
+ } return result;
+ }
+ });
+
+ __webpack_require__(194)(ARRAY_BUFFER);
+
+
+/***/ }),
+/* 230 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var global = __webpack_require__(4);
+ var hide = __webpack_require__(10);
+ var uid = __webpack_require__(19);
+ var TYPED = uid('typed_array');
+ var VIEW = uid('view');
+ var ABV = !!(global.ArrayBuffer && global.DataView);
+ var CONSTR = ABV;
+ var i = 0;
+ var l = 9;
+ var Typed;
+
+ var TypedArrayConstructors = (
+ 'Int8Array,Uint8Array,Uint8ClampedArray,Int16Array,Uint16Array,Int32Array,Uint32Array,Float32Array,Float64Array'
+ ).split(',');
+
+ while (i < l) {
+ if (Typed = global[TypedArrayConstructors[i++]]) {
+ hide(Typed.prototype, TYPED, true);
+ hide(Typed.prototype, VIEW, true);
+ } else CONSTR = false;
+ }
+
+ module.exports = {
+ ABV: ABV,
+ CONSTR: CONSTR,
+ TYPED: TYPED,
+ VIEW: VIEW
+ };
+
+
+/***/ }),
+/* 231 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var global = __webpack_require__(4);
+ var DESCRIPTORS = __webpack_require__(6);
+ var LIBRARY = __webpack_require__(22);
+ var $typed = __webpack_require__(230);
+ var hide = __webpack_require__(10);
+ var redefineAll = __webpack_require__(220);
+ var fails = __webpack_require__(7);
+ var anInstance = __webpack_require__(212);
+ var toInteger = __webpack_require__(39);
+ var toLength = __webpack_require__(38);
+ var toIndex = __webpack_require__(232);
+ var gOPN = __webpack_require__(51).f;
+ var dP = __webpack_require__(11).f;
+ var arrayFill = __webpack_require__(190);
+ var setToStringTag = __webpack_require__(26);
+ var ARRAY_BUFFER = 'ArrayBuffer';
+ var DATA_VIEW = 'DataView';
+ var PROTOTYPE = 'prototype';
+ var WRONG_LENGTH = 'Wrong length!';
+ var WRONG_INDEX = 'Wrong index!';
+ var $ArrayBuffer = global[ARRAY_BUFFER];
+ var $DataView = global[DATA_VIEW];
+ var Math = global.Math;
+ var RangeError = global.RangeError;
+ // eslint-disable-next-line no-shadow-restricted-names
+ var Infinity = global.Infinity;
+ var BaseBuffer = $ArrayBuffer;
+ var abs = Math.abs;
+ var pow = Math.pow;
+ var floor = Math.floor;
+ var log = Math.log;
+ var LN2 = Math.LN2;
+ var BUFFER = 'buffer';
+ var BYTE_LENGTH = 'byteLength';
+ var BYTE_OFFSET = 'byteOffset';
+ var $BUFFER = DESCRIPTORS ? '_b' : BUFFER;
+ var $LENGTH = DESCRIPTORS ? '_l' : BYTE_LENGTH;
+ var $OFFSET = DESCRIPTORS ? '_o' : BYTE_OFFSET;
+
+ // IEEE754 conversions based on https://github.com/feross/ieee754
+ function packIEEE754(value, mLen, nBytes) {
+ var buffer = new Array(nBytes);
+ var eLen = nBytes * 8 - mLen - 1;
+ var eMax = (1 << eLen) - 1;
+ var eBias = eMax >> 1;
+ var rt = mLen === 23 ? pow(2, -24) - pow(2, -77) : 0;
+ var i = 0;
+ var s = value < 0 || value === 0 && 1 / value < 0 ? 1 : 0;
+ var e, m, c;
+ value = abs(value);
+ // eslint-disable-next-line no-self-compare
+ if (value != value || value === Infinity) {
+ // eslint-disable-next-line no-self-compare
+ m = value != value ? 1 : 0;
+ e = eMax;
+ } else {
+ e = floor(log(value) / LN2);
+ if (value * (c = pow(2, -e)) < 1) {
+ e--;
+ c *= 2;
+ }
+ if (e + eBias >= 1) {
+ value += rt / c;
+ } else {
+ value += rt * pow(2, 1 - eBias);
+ }
+ if (value * c >= 2) {
+ e++;
+ c /= 2;
+ }
+ if (e + eBias >= eMax) {
+ m = 0;
+ e = eMax;
+ } else if (e + eBias >= 1) {
+ m = (value * c - 1) * pow(2, mLen);
+ e = e + eBias;
+ } else {
+ m = value * pow(2, eBias - 1) * pow(2, mLen);
+ e = 0;
+ }
+ }
+ for (; mLen >= 8; buffer[i++] = m & 255, m /= 256, mLen -= 8);
+ e = e << mLen | m;
+ eLen += mLen;
+ for (; eLen > 0; buffer[i++] = e & 255, e /= 256, eLen -= 8);
+ buffer[--i] |= s * 128;
+ return buffer;
+ }
+ function unpackIEEE754(buffer, mLen, nBytes) {
+ var eLen = nBytes * 8 - mLen - 1;
+ var eMax = (1 << eLen) - 1;
+ var eBias = eMax >> 1;
+ var nBits = eLen - 7;
+ var i = nBytes - 1;
+ var s = buffer[i--];
+ var e = s & 127;
+ var m;
+ s >>= 7;
+ for (; nBits > 0; e = e * 256 + buffer[i], i--, nBits -= 8);
+ m = e & (1 << -nBits) - 1;
+ e >>= -nBits;
+ nBits += mLen;
+ for (; nBits > 0; m = m * 256 + buffer[i], i--, nBits -= 8);
+ if (e === 0) {
+ e = 1 - eBias;
+ } else if (e === eMax) {
+ return m ? NaN : s ? -Infinity : Infinity;
+ } else {
+ m = m + pow(2, mLen);
+ e = e - eBias;
+ } return (s ? -1 : 1) * m * pow(2, e - mLen);
+ }
+
+ function unpackI32(bytes) {
+ return bytes[3] << 24 | bytes[2] << 16 | bytes[1] << 8 | bytes[0];
+ }
+ function packI8(it) {
+ return [it & 0xff];
+ }
+ function packI16(it) {
+ return [it & 0xff, it >> 8 & 0xff];
+ }
+ function packI32(it) {
+ return [it & 0xff, it >> 8 & 0xff, it >> 16 & 0xff, it >> 24 & 0xff];
+ }
+ function packF64(it) {
+ return packIEEE754(it, 52, 8);
+ }
+ function packF32(it) {
+ return packIEEE754(it, 23, 4);
+ }
+
+ function addGetter(C, key, internal) {
+ dP(C[PROTOTYPE], key, { get: function () { return this[internal]; } });
+ }
+
+ function get(view, bytes, index, isLittleEndian) {
+ var numIndex = +index;
+ var intIndex = toIndex(numIndex);
+ if (intIndex + bytes > view[$LENGTH]) throw RangeError(WRONG_INDEX);
+ var store = view[$BUFFER]._b;
+ var start = intIndex + view[$OFFSET];
+ var pack = store.slice(start, start + bytes);
+ return isLittleEndian ? pack : pack.reverse();
+ }
+ function set(view, bytes, index, conversion, value, isLittleEndian) {
+ var numIndex = +index;
+ var intIndex = toIndex(numIndex);
+ if (intIndex + bytes > view[$LENGTH]) throw RangeError(WRONG_INDEX);
+ var store = view[$BUFFER]._b;
+ var start = intIndex + view[$OFFSET];
+ var pack = conversion(+value);
+ for (var i = 0; i < bytes; i++) store[start + i] = pack[isLittleEndian ? i : bytes - i - 1];
+ }
+
+ if (!$typed.ABV) {
+ $ArrayBuffer = function ArrayBuffer(length) {
+ anInstance(this, $ArrayBuffer, ARRAY_BUFFER);
+ var byteLength = toIndex(length);
+ this._b = arrayFill.call(new Array(byteLength), 0);
+ this[$LENGTH] = byteLength;
+ };
+
+ $DataView = function DataView(buffer, byteOffset, byteLength) {
+ anInstance(this, $DataView, DATA_VIEW);
+ anInstance(buffer, $ArrayBuffer, DATA_VIEW);
+ var bufferLength = buffer[$LENGTH];
+ var offset = toInteger(byteOffset);
+ if (offset < 0 || offset > bufferLength) throw RangeError('Wrong offset!');
+ byteLength = byteLength === undefined ? bufferLength - offset : toLength(byteLength);
+ if (offset + byteLength > bufferLength) throw RangeError(WRONG_LENGTH);
+ this[$BUFFER] = buffer;
+ this[$OFFSET] = offset;
+ this[$LENGTH] = byteLength;
+ };
+
+ if (DESCRIPTORS) {
+ addGetter($ArrayBuffer, BYTE_LENGTH, '_l');
+ addGetter($DataView, BUFFER, '_b');
+ addGetter($DataView, BYTE_LENGTH, '_l');
+ addGetter($DataView, BYTE_OFFSET, '_o');
+ }
+
+ redefineAll($DataView[PROTOTYPE], {
+ getInt8: function getInt8(byteOffset) {
+ return get(this, 1, byteOffset)[0] << 24 >> 24;
+ },
+ getUint8: function getUint8(byteOffset) {
+ return get(this, 1, byteOffset)[0];
+ },
+ getInt16: function getInt16(byteOffset /* , littleEndian */) {
+ var bytes = get(this, 2, byteOffset, arguments[1]);
+ return (bytes[1] << 8 | bytes[0]) << 16 >> 16;
+ },
+ getUint16: function getUint16(byteOffset /* , littleEndian */) {
+ var bytes = get(this, 2, byteOffset, arguments[1]);
+ return bytes[1] << 8 | bytes[0];
+ },
+ getInt32: function getInt32(byteOffset /* , littleEndian */) {
+ return unpackI32(get(this, 4, byteOffset, arguments[1]));
+ },
+ getUint32: function getUint32(byteOffset /* , littleEndian */) {
+ return unpackI32(get(this, 4, byteOffset, arguments[1])) >>> 0;
+ },
+ getFloat32: function getFloat32(byteOffset /* , littleEndian */) {
+ return unpackIEEE754(get(this, 4, byteOffset, arguments[1]), 23, 4);
+ },
+ getFloat64: function getFloat64(byteOffset /* , littleEndian */) {
+ return unpackIEEE754(get(this, 8, byteOffset, arguments[1]), 52, 8);
+ },
+ setInt8: function setInt8(byteOffset, value) {
+ set(this, 1, byteOffset, packI8, value);
+ },
+ setUint8: function setUint8(byteOffset, value) {
+ set(this, 1, byteOffset, packI8, value);
+ },
+ setInt16: function setInt16(byteOffset, value /* , littleEndian */) {
+ set(this, 2, byteOffset, packI16, value, arguments[2]);
+ },
+ setUint16: function setUint16(byteOffset, value /* , littleEndian */) {
+ set(this, 2, byteOffset, packI16, value, arguments[2]);
+ },
+ setInt32: function setInt32(byteOffset, value /* , littleEndian */) {
+ set(this, 4, byteOffset, packI32, value, arguments[2]);
+ },
+ setUint32: function setUint32(byteOffset, value /* , littleEndian */) {
+ set(this, 4, byteOffset, packI32, value, arguments[2]);
+ },
+ setFloat32: function setFloat32(byteOffset, value /* , littleEndian */) {
+ set(this, 4, byteOffset, packF32, value, arguments[2]);
+ },
+ setFloat64: function setFloat64(byteOffset, value /* , littleEndian */) {
+ set(this, 8, byteOffset, packF64, value, arguments[2]);
+ }
+ });
+ } else {
+ if (!fails(function () {
+ $ArrayBuffer(1);
+ }) || !fails(function () {
+ new $ArrayBuffer(-1); // eslint-disable-line no-new
+ }) || fails(function () {
+ new $ArrayBuffer(); // eslint-disable-line no-new
+ new $ArrayBuffer(1.5); // eslint-disable-line no-new
+ new $ArrayBuffer(NaN); // eslint-disable-line no-new
+ return $ArrayBuffer.name != ARRAY_BUFFER;
+ })) {
+ $ArrayBuffer = function ArrayBuffer(length) {
+ anInstance(this, $ArrayBuffer);
+ return new BaseBuffer(toIndex(length));
+ };
+ var ArrayBufferProto = $ArrayBuffer[PROTOTYPE] = BaseBuffer[PROTOTYPE];
+ for (var keys = gOPN(BaseBuffer), j = 0, key; keys.length > j;) {
+ if (!((key = keys[j++]) in $ArrayBuffer)) hide($ArrayBuffer, key, BaseBuffer[key]);
+ }
+ if (!LIBRARY) ArrayBufferProto.constructor = $ArrayBuffer;
+ }
+ // iOS Safari 7.x bug
+ var view = new $DataView(new $ArrayBuffer(2));
+ var $setInt8 = $DataView[PROTOTYPE].setInt8;
+ view.setInt8(0, 2147483648);
+ view.setInt8(1, 2147483649);
+ if (view.getInt8(0) || !view.getInt8(1)) redefineAll($DataView[PROTOTYPE], {
+ setInt8: function setInt8(byteOffset, value) {
+ $setInt8.call(this, byteOffset, value << 24 >> 24);
+ },
+ setUint8: function setUint8(byteOffset, value) {
+ $setInt8.call(this, byteOffset, value << 24 >> 24);
+ }
+ }, true);
+ }
+ setToStringTag($ArrayBuffer, ARRAY_BUFFER);
+ setToStringTag($DataView, DATA_VIEW);
+ hide($DataView[PROTOTYPE], $typed.VIEW, true);
+ exports[ARRAY_BUFFER] = $ArrayBuffer;
+ exports[DATA_VIEW] = $DataView;
+
+
+/***/ }),
+/* 232 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/ecma262/#sec-toindex
+ var toInteger = __webpack_require__(39);
+ var toLength = __webpack_require__(38);
+ module.exports = function (it) {
+ if (it === undefined) return 0;
+ var number = toInteger(it);
+ var length = toLength(number);
+ if (number !== length) throw RangeError('Wrong length!');
+ return length;
+ };
+
+
+/***/ }),
+/* 233 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ $export($export.G + $export.W + $export.F * !__webpack_require__(230).ABV, {
+ DataView: __webpack_require__(231).DataView
+ });
+
+
+/***/ }),
+/* 234 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Int8', 1, function (init) {
+ return function Int8Array(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ });
+
+
+/***/ }),
+/* 235 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ if (__webpack_require__(6)) {
+ var LIBRARY = __webpack_require__(22);
+ var global = __webpack_require__(4);
+ var fails = __webpack_require__(7);
+ var $export = __webpack_require__(8);
+ var $typed = __webpack_require__(230);
+ var $buffer = __webpack_require__(231);
+ var ctx = __webpack_require__(23);
+ var anInstance = __webpack_require__(212);
+ var propertyDesc = __webpack_require__(17);
+ var hide = __webpack_require__(10);
+ var redefineAll = __webpack_require__(220);
+ var toInteger = __webpack_require__(39);
+ var toLength = __webpack_require__(38);
+ var toIndex = __webpack_require__(232);
+ var toAbsoluteIndex = __webpack_require__(40);
+ var toPrimitive = __webpack_require__(16);
+ var has = __webpack_require__(5);
+ var classof = __webpack_require__(75);
+ var isObject = __webpack_require__(13);
+ var toObject = __webpack_require__(46);
+ var isArrayIter = __webpack_require__(164);
+ var create = __webpack_require__(47);
+ var getPrototypeOf = __webpack_require__(59);
+ var gOPN = __webpack_require__(51).f;
+ var getIterFn = __webpack_require__(166);
+ var uid = __webpack_require__(19);
+ var wks = __webpack_require__(27);
+ var createArrayMethod = __webpack_require__(174);
+ var createArrayIncludes = __webpack_require__(37);
+ var speciesConstructor = __webpack_require__(210);
+ var ArrayIterators = __webpack_require__(195);
+ var Iterators = __webpack_require__(130);
+ var $iterDetect = __webpack_require__(167);
+ var setSpecies = __webpack_require__(194);
+ var arrayFill = __webpack_require__(190);
+ var arrayCopyWithin = __webpack_require__(187);
+ var $DP = __webpack_require__(11);
+ var $GOPD = __webpack_require__(52);
+ var dP = $DP.f;
+ var gOPD = $GOPD.f;
+ var RangeError = global.RangeError;
+ var TypeError = global.TypeError;
+ var Uint8Array = global.Uint8Array;
+ var ARRAY_BUFFER = 'ArrayBuffer';
+ var SHARED_BUFFER = 'Shared' + ARRAY_BUFFER;
+ var BYTES_PER_ELEMENT = 'BYTES_PER_ELEMENT';
+ var PROTOTYPE = 'prototype';
+ var ArrayProto = Array[PROTOTYPE];
+ var $ArrayBuffer = $buffer.ArrayBuffer;
+ var $DataView = $buffer.DataView;
+ var arrayForEach = createArrayMethod(0);
+ var arrayFilter = createArrayMethod(2);
+ var arraySome = createArrayMethod(3);
+ var arrayEvery = createArrayMethod(4);
+ var arrayFind = createArrayMethod(5);
+ var arrayFindIndex = createArrayMethod(6);
+ var arrayIncludes = createArrayIncludes(true);
+ var arrayIndexOf = createArrayIncludes(false);
+ var arrayValues = ArrayIterators.values;
+ var arrayKeys = ArrayIterators.keys;
+ var arrayEntries = ArrayIterators.entries;
+ var arrayLastIndexOf = ArrayProto.lastIndexOf;
+ var arrayReduce = ArrayProto.reduce;
+ var arrayReduceRight = ArrayProto.reduceRight;
+ var arrayJoin = ArrayProto.join;
+ var arraySort = ArrayProto.sort;
+ var arraySlice = ArrayProto.slice;
+ var arrayToString = ArrayProto.toString;
+ var arrayToLocaleString = ArrayProto.toLocaleString;
+ var ITERATOR = wks('iterator');
+ var TAG = wks('toStringTag');
+ var TYPED_CONSTRUCTOR = uid('typed_constructor');
+ var DEF_CONSTRUCTOR = uid('def_constructor');
+ var ALL_CONSTRUCTORS = $typed.CONSTR;
+ var TYPED_ARRAY = $typed.TYPED;
+ var VIEW = $typed.VIEW;
+ var WRONG_LENGTH = 'Wrong length!';
+
+ var $map = createArrayMethod(1, function (O, length) {
+ return allocate(speciesConstructor(O, O[DEF_CONSTRUCTOR]), length);
+ });
+
+ var LITTLE_ENDIAN = fails(function () {
+ // eslint-disable-next-line no-undef
+ return new Uint8Array(new Uint16Array([1]).buffer)[0] === 1;
+ });
+
+ var FORCED_SET = !!Uint8Array && !!Uint8Array[PROTOTYPE].set && fails(function () {
+ new Uint8Array(1).set({});
+ });
+
+ var toOffset = function (it, BYTES) {
+ var offset = toInteger(it);
+ if (offset < 0 || offset % BYTES) throw RangeError('Wrong offset!');
+ return offset;
+ };
+
+ var validate = function (it) {
+ if (isObject(it) && TYPED_ARRAY in it) return it;
+ throw TypeError(it + ' is not a typed array!');
+ };
+
+ var allocate = function (C, length) {
+ if (!(isObject(C) && TYPED_CONSTRUCTOR in C)) {
+ throw TypeError('It is not a typed array constructor!');
+ } return new C(length);
+ };
+
+ var speciesFromList = function (O, list) {
+ return fromList(speciesConstructor(O, O[DEF_CONSTRUCTOR]), list);
+ };
+
+ var fromList = function (C, list) {
+ var index = 0;
+ var length = list.length;
+ var result = allocate(C, length);
+ while (length > index) result[index] = list[index++];
+ return result;
+ };
+
+ var addGetter = function (it, key, internal) {
+ dP(it, key, { get: function () { return this._d[internal]; } });
+ };
+
+ var $from = function from(source /* , mapfn, thisArg */) {
+ var O = toObject(source);
+ var aLen = arguments.length;
+ var mapfn = aLen > 1 ? arguments[1] : undefined;
+ var mapping = mapfn !== undefined;
+ var iterFn = getIterFn(O);
+ var i, length, values, result, step, iterator;
+ if (iterFn != undefined && !isArrayIter(iterFn)) {
+ for (iterator = iterFn.call(O), values = [], i = 0; !(step = iterator.next()).done; i++) {
+ values.push(step.value);
+ } O = values;
+ }
+ if (mapping && aLen > 2) mapfn = ctx(mapfn, arguments[2], 2);
+ for (i = 0, length = toLength(O.length), result = allocate(this, length); length > i; i++) {
+ result[i] = mapping ? mapfn(O[i], i) : O[i];
+ }
+ return result;
+ };
+
+ var $of = function of(/* ...items */) {
+ var index = 0;
+ var length = arguments.length;
+ var result = allocate(this, length);
+ while (length > index) result[index] = arguments[index++];
+ return result;
+ };
+
+ // iOS Safari 6.x fails here
+ var TO_LOCALE_BUG = !!Uint8Array && fails(function () { arrayToLocaleString.call(new Uint8Array(1)); });
+
+ var $toLocaleString = function toLocaleString() {
+ return arrayToLocaleString.apply(TO_LOCALE_BUG ? arraySlice.call(validate(this)) : validate(this), arguments);
+ };
+
+ var proto = {
+ copyWithin: function copyWithin(target, start /* , end */) {
+ return arrayCopyWithin.call(validate(this), target, start, arguments.length > 2 ? arguments[2] : undefined);
+ },
+ every: function every(callbackfn /* , thisArg */) {
+ return arrayEvery(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined);
+ },
+ fill: function fill(value /* , start, end */) { // eslint-disable-line no-unused-vars
+ return arrayFill.apply(validate(this), arguments);
+ },
+ filter: function filter(callbackfn /* , thisArg */) {
+ return speciesFromList(this, arrayFilter(validate(this), callbackfn,
+ arguments.length > 1 ? arguments[1] : undefined));
+ },
+ find: function find(predicate /* , thisArg */) {
+ return arrayFind(validate(this), predicate, arguments.length > 1 ? arguments[1] : undefined);
+ },
+ findIndex: function findIndex(predicate /* , thisArg */) {
+ return arrayFindIndex(validate(this), predicate, arguments.length > 1 ? arguments[1] : undefined);
+ },
+ forEach: function forEach(callbackfn /* , thisArg */) {
+ arrayForEach(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined);
+ },
+ indexOf: function indexOf(searchElement /* , fromIndex */) {
+ return arrayIndexOf(validate(this), searchElement, arguments.length > 1 ? arguments[1] : undefined);
+ },
+ includes: function includes(searchElement /* , fromIndex */) {
+ return arrayIncludes(validate(this), searchElement, arguments.length > 1 ? arguments[1] : undefined);
+ },
+ join: function join(separator) { // eslint-disable-line no-unused-vars
+ return arrayJoin.apply(validate(this), arguments);
+ },
+ lastIndexOf: function lastIndexOf(searchElement /* , fromIndex */) { // eslint-disable-line no-unused-vars
+ return arrayLastIndexOf.apply(validate(this), arguments);
+ },
+ map: function map(mapfn /* , thisArg */) {
+ return $map(validate(this), mapfn, arguments.length > 1 ? arguments[1] : undefined);
+ },
+ reduce: function reduce(callbackfn /* , initialValue */) { // eslint-disable-line no-unused-vars
+ return arrayReduce.apply(validate(this), arguments);
+ },
+ reduceRight: function reduceRight(callbackfn /* , initialValue */) { // eslint-disable-line no-unused-vars
+ return arrayReduceRight.apply(validate(this), arguments);
+ },
+ reverse: function reverse() {
+ var that = this;
+ var length = validate(that).length;
+ var middle = Math.floor(length / 2);
+ var index = 0;
+ var value;
+ while (index < middle) {
+ value = that[index];
+ that[index++] = that[--length];
+ that[length] = value;
+ } return that;
+ },
+ some: function some(callbackfn /* , thisArg */) {
+ return arraySome(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined);
+ },
+ sort: function sort(comparefn) {
+ return arraySort.call(validate(this), comparefn);
+ },
+ subarray: function subarray(begin, end) {
+ var O = validate(this);
+ var length = O.length;
+ var $begin = toAbsoluteIndex(begin, length);
+ return new (speciesConstructor(O, O[DEF_CONSTRUCTOR]))(
+ O.buffer,
+ O.byteOffset + $begin * O.BYTES_PER_ELEMENT,
+ toLength((end === undefined ? length : toAbsoluteIndex(end, length)) - $begin)
+ );
+ }
+ };
+
+ var $slice = function slice(start, end) {
+ return speciesFromList(this, arraySlice.call(validate(this), start, end));
+ };
+
+ var $set = function set(arrayLike /* , offset */) {
+ validate(this);
+ var offset = toOffset(arguments[1], 1);
+ var length = this.length;
+ var src = toObject(arrayLike);
+ var len = toLength(src.length);
+ var index = 0;
+ if (len + offset > length) throw RangeError(WRONG_LENGTH);
+ while (index < len) this[offset + index] = src[index++];
+ };
+
+ var $iterators = {
+ entries: function entries() {
+ return arrayEntries.call(validate(this));
+ },
+ keys: function keys() {
+ return arrayKeys.call(validate(this));
+ },
+ values: function values() {
+ return arrayValues.call(validate(this));
+ }
+ };
+
+ var isTAIndex = function (target, key) {
+ return isObject(target)
+ && target[TYPED_ARRAY]
+ && typeof key != 'symbol'
+ && key in target
+ && String(+key) == String(key);
+ };
+ var $getDesc = function getOwnPropertyDescriptor(target, key) {
+ return isTAIndex(target, key = toPrimitive(key, true))
+ ? propertyDesc(2, target[key])
+ : gOPD(target, key);
+ };
+ var $setDesc = function defineProperty(target, key, desc) {
+ if (isTAIndex(target, key = toPrimitive(key, true))
+ && isObject(desc)
+ && has(desc, 'value')
+ && !has(desc, 'get')
+ && !has(desc, 'set')
+ // TODO: add validation descriptor w/o calling accessors
+ && !desc.configurable
+ && (!has(desc, 'writable') || desc.writable)
+ && (!has(desc, 'enumerable') || desc.enumerable)
+ ) {
+ target[key] = desc.value;
+ return target;
+ } return dP(target, key, desc);
+ };
+
+ if (!ALL_CONSTRUCTORS) {
+ $GOPD.f = $getDesc;
+ $DP.f = $setDesc;
+ }
+
+ $export($export.S + $export.F * !ALL_CONSTRUCTORS, 'Object', {
+ getOwnPropertyDescriptor: $getDesc,
+ defineProperty: $setDesc
+ });
+
+ if (fails(function () { arrayToString.call({}); })) {
+ arrayToString = arrayToLocaleString = function toString() {
+ return arrayJoin.call(this);
+ };
+ }
+
+ var $TypedArrayPrototype$ = redefineAll({}, proto);
+ redefineAll($TypedArrayPrototype$, $iterators);
+ hide($TypedArrayPrototype$, ITERATOR, $iterators.values);
+ redefineAll($TypedArrayPrototype$, {
+ slice: $slice,
+ set: $set,
+ constructor: function () { /* noop */ },
+ toString: arrayToString,
+ toLocaleString: $toLocaleString
+ });
+ addGetter($TypedArrayPrototype$, 'buffer', 'b');
+ addGetter($TypedArrayPrototype$, 'byteOffset', 'o');
+ addGetter($TypedArrayPrototype$, 'byteLength', 'l');
+ addGetter($TypedArrayPrototype$, 'length', 'e');
+ dP($TypedArrayPrototype$, TAG, {
+ get: function () { return this[TYPED_ARRAY]; }
+ });
+
+ // eslint-disable-next-line max-statements
+ module.exports = function (KEY, BYTES, wrapper, CLAMPED) {
+ CLAMPED = !!CLAMPED;
+ var NAME = KEY + (CLAMPED ? 'Clamped' : '') + 'Array';
+ var GETTER = 'get' + KEY;
+ var SETTER = 'set' + KEY;
+ var TypedArray = global[NAME];
+ var Base = TypedArray || {};
+ var TAC = TypedArray && getPrototypeOf(TypedArray);
+ var FORCED = !TypedArray || !$typed.ABV;
+ var O = {};
+ var TypedArrayPrototype = TypedArray && TypedArray[PROTOTYPE];
+ var getter = function (that, index) {
+ var data = that._d;
+ return data.v[GETTER](index * BYTES + data.o, LITTLE_ENDIAN);
+ };
+ var setter = function (that, index, value) {
+ var data = that._d;
+ if (CLAMPED) value = (value = Math.round(value)) < 0 ? 0 : value > 0xff ? 0xff : value & 0xff;
+ data.v[SETTER](index * BYTES + data.o, value, LITTLE_ENDIAN);
+ };
+ var addElement = function (that, index) {
+ dP(that, index, {
+ get: function () {
+ return getter(this, index);
+ },
+ set: function (value) {
+ return setter(this, index, value);
+ },
+ enumerable: true
+ });
+ };
+ if (FORCED) {
+ TypedArray = wrapper(function (that, data, $offset, $length) {
+ anInstance(that, TypedArray, NAME, '_d');
+ var index = 0;
+ var offset = 0;
+ var buffer, byteLength, length, klass;
+ if (!isObject(data)) {
+ length = toIndex(data);
+ byteLength = length * BYTES;
+ buffer = new $ArrayBuffer(byteLength);
+ } else if (data instanceof $ArrayBuffer || (klass = classof(data)) == ARRAY_BUFFER || klass == SHARED_BUFFER) {
+ buffer = data;
+ offset = toOffset($offset, BYTES);
+ var $len = data.byteLength;
+ if ($length === undefined) {
+ if ($len % BYTES) throw RangeError(WRONG_LENGTH);
+ byteLength = $len - offset;
+ if (byteLength < 0) throw RangeError(WRONG_LENGTH);
+ } else {
+ byteLength = toLength($length) * BYTES;
+ if (byteLength + offset > $len) throw RangeError(WRONG_LENGTH);
+ }
+ length = byteLength / BYTES;
+ } else if (TYPED_ARRAY in data) {
+ return fromList(TypedArray, data);
+ } else {
+ return $from.call(TypedArray, data);
+ }
+ hide(that, '_d', {
+ b: buffer,
+ o: offset,
+ l: byteLength,
+ e: length,
+ v: new $DataView(buffer)
+ });
+ while (index < length) addElement(that, index++);
+ });
+ TypedArrayPrototype = TypedArray[PROTOTYPE] = create($TypedArrayPrototype$);
+ hide(TypedArrayPrototype, 'constructor', TypedArray);
+ } else if (!fails(function () {
+ TypedArray(1);
+ }) || !fails(function () {
+ new TypedArray(-1); // eslint-disable-line no-new
+ }) || !$iterDetect(function (iter) {
+ new TypedArray(); // eslint-disable-line no-new
+ new TypedArray(null); // eslint-disable-line no-new
+ new TypedArray(1.5); // eslint-disable-line no-new
+ new TypedArray(iter); // eslint-disable-line no-new
+ }, true)) {
+ TypedArray = wrapper(function (that, data, $offset, $length) {
+ anInstance(that, TypedArray, NAME);
+ var klass;
+ // `ws` module bug, temporarily remove validation length for Uint8Array
+ // https://github.com/websockets/ws/pull/645
+ if (!isObject(data)) return new Base(toIndex(data));
+ if (data instanceof $ArrayBuffer || (klass = classof(data)) == ARRAY_BUFFER || klass == SHARED_BUFFER) {
+ return $length !== undefined
+ ? new Base(data, toOffset($offset, BYTES), $length)
+ : $offset !== undefined
+ ? new Base(data, toOffset($offset, BYTES))
+ : new Base(data);
+ }
+ if (TYPED_ARRAY in data) return fromList(TypedArray, data);
+ return $from.call(TypedArray, data);
+ });
+ arrayForEach(TAC !== Function.prototype ? gOPN(Base).concat(gOPN(TAC)) : gOPN(Base), function (key) {
+ if (!(key in TypedArray)) hide(TypedArray, key, Base[key]);
+ });
+ TypedArray[PROTOTYPE] = TypedArrayPrototype;
+ if (!LIBRARY) TypedArrayPrototype.constructor = TypedArray;
+ }
+ var $nativeIterator = TypedArrayPrototype[ITERATOR];
+ var CORRECT_ITER_NAME = !!$nativeIterator
+ && ($nativeIterator.name == 'values' || $nativeIterator.name == undefined);
+ var $iterator = $iterators.values;
+ hide(TypedArray, TYPED_CONSTRUCTOR, true);
+ hide(TypedArrayPrototype, TYPED_ARRAY, NAME);
+ hide(TypedArrayPrototype, VIEW, true);
+ hide(TypedArrayPrototype, DEF_CONSTRUCTOR, TypedArray);
+
+ if (CLAMPED ? new TypedArray(1)[TAG] != NAME : !(TAG in TypedArrayPrototype)) {
+ dP(TypedArrayPrototype, TAG, {
+ get: function () { return NAME; }
+ });
+ }
+
+ O[NAME] = TypedArray;
+
+ $export($export.G + $export.W + $export.F * (TypedArray != Base), O);
+
+ $export($export.S, NAME, {
+ BYTES_PER_ELEMENT: BYTES
+ });
+
+ $export($export.S + $export.F * fails(function () { Base.of.call(TypedArray, 1); }), NAME, {
+ from: $from,
+ of: $of
+ });
+
+ if (!(BYTES_PER_ELEMENT in TypedArrayPrototype)) hide(TypedArrayPrototype, BYTES_PER_ELEMENT, BYTES);
+
+ $export($export.P, NAME, proto);
+
+ setSpecies(NAME);
+
+ $export($export.P + $export.F * FORCED_SET, NAME, { set: $set });
+
+ $export($export.P + $export.F * !CORRECT_ITER_NAME, NAME, $iterators);
+
+ if (!LIBRARY && TypedArrayPrototype.toString != arrayToString) TypedArrayPrototype.toString = arrayToString;
+
+ $export($export.P + $export.F * fails(function () {
+ new TypedArray(1).slice();
+ }), NAME, { slice: $slice });
+
+ $export($export.P + $export.F * (fails(function () {
+ return [1, 2].toLocaleString() != new TypedArray([1, 2]).toLocaleString();
+ }) || !fails(function () {
+ TypedArrayPrototype.toLocaleString.call([1, 2]);
+ })), NAME, { toLocaleString: $toLocaleString });
+
+ Iterators[NAME] = CORRECT_ITER_NAME ? $nativeIterator : $iterator;
+ if (!LIBRARY && !CORRECT_ITER_NAME) hide(TypedArrayPrototype, ITERATOR, $iterator);
+ };
+ } else module.exports = function () { /* empty */ };
+
+
+/***/ }),
+/* 236 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Uint8', 1, function (init) {
+ return function Uint8Array(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ });
+
+
+/***/ }),
+/* 237 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Uint8', 1, function (init) {
+ return function Uint8ClampedArray(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ }, true);
+
+
+/***/ }),
+/* 238 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Int16', 2, function (init) {
+ return function Int16Array(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ });
+
+
+/***/ }),
+/* 239 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Uint16', 2, function (init) {
+ return function Uint16Array(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ });
+
+
+/***/ }),
+/* 240 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Int32', 4, function (init) {
+ return function Int32Array(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ });
+
+
+/***/ }),
+/* 241 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Uint32', 4, function (init) {
+ return function Uint32Array(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ });
+
+
+/***/ }),
+/* 242 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Float32', 4, function (init) {
+ return function Float32Array(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ });
+
+
+/***/ }),
+/* 243 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(235)('Float64', 8, function (init) {
+ return function Float64Array(data, byteOffset, length) {
+ return init(this, data, byteOffset, length);
+ };
+ });
+
+
+/***/ }),
+/* 244 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.1 Reflect.apply(target, thisArgument, argumentsList)
+ var $export = __webpack_require__(8);
+ var aFunction = __webpack_require__(24);
+ var anObject = __webpack_require__(12);
+ var rApply = (__webpack_require__(4).Reflect || {}).apply;
+ var fApply = Function.apply;
+ // MS Edge argumentsList argument is optional
+ $export($export.S + $export.F * !__webpack_require__(7)(function () {
+ rApply(function () { /* empty */ });
+ }), 'Reflect', {
+ apply: function apply(target, thisArgument, argumentsList) {
+ var T = aFunction(target);
+ var L = anObject(argumentsList);
+ return rApply ? rApply(T, thisArgument, L) : fApply.call(T, thisArgument, L);
+ }
+ });
+
+
+/***/ }),
+/* 245 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.2 Reflect.construct(target, argumentsList [, newTarget])
+ var $export = __webpack_require__(8);
+ var create = __webpack_require__(47);
+ var aFunction = __webpack_require__(24);
+ var anObject = __webpack_require__(12);
+ var isObject = __webpack_require__(13);
+ var fails = __webpack_require__(7);
+ var bind = __webpack_require__(77);
+ var rConstruct = (__webpack_require__(4).Reflect || {}).construct;
+
+ // MS Edge supports only 2 arguments and argumentsList argument is optional
+ // FF Nightly sets third argument as `new.target`, but does not create `this` from it
+ var NEW_TARGET_BUG = fails(function () {
+ function F() { /* empty */ }
+ return !(rConstruct(function () { /* empty */ }, [], F) instanceof F);
+ });
+ var ARGS_BUG = !fails(function () {
+ rConstruct(function () { /* empty */ });
+ });
+
+ $export($export.S + $export.F * (NEW_TARGET_BUG || ARGS_BUG), 'Reflect', {
+ construct: function construct(Target, args /* , newTarget */) {
+ aFunction(Target);
+ anObject(args);
+ var newTarget = arguments.length < 3 ? Target : aFunction(arguments[2]);
+ if (ARGS_BUG && !NEW_TARGET_BUG) return rConstruct(Target, args, newTarget);
+ if (Target == newTarget) {
+ // w/o altered newTarget, optimization for 0-4 arguments
+ switch (args.length) {
+ case 0: return new Target();
+ case 1: return new Target(args[0]);
+ case 2: return new Target(args[0], args[1]);
+ case 3: return new Target(args[0], args[1], args[2]);
+ case 4: return new Target(args[0], args[1], args[2], args[3]);
+ }
+ // w/o altered newTarget, lot of arguments case
+ var $args = [null];
+ $args.push.apply($args, args);
+ return new (bind.apply(Target, $args))();
+ }
+ // with altered newTarget, not support built-in constructors
+ var proto = newTarget.prototype;
+ var instance = create(isObject(proto) ? proto : Object.prototype);
+ var result = Function.apply.call(Target, instance, args);
+ return isObject(result) ? result : instance;
+ }
+ });
+
+
+/***/ }),
+/* 246 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.3 Reflect.defineProperty(target, propertyKey, attributes)
+ var dP = __webpack_require__(11);
+ var $export = __webpack_require__(8);
+ var anObject = __webpack_require__(12);
+ var toPrimitive = __webpack_require__(16);
+
+ // MS Edge has broken Reflect.defineProperty - throwing instead of returning false
+ $export($export.S + $export.F * __webpack_require__(7)(function () {
+ // eslint-disable-next-line no-undef
+ Reflect.defineProperty(dP.f({}, 1, { value: 1 }), 1, { value: 2 });
+ }), 'Reflect', {
+ defineProperty: function defineProperty(target, propertyKey, attributes) {
+ anObject(target);
+ propertyKey = toPrimitive(propertyKey, true);
+ anObject(attributes);
+ try {
+ dP.f(target, propertyKey, attributes);
+ return true;
+ } catch (e) {
+ return false;
+ }
+ }
+ });
+
+
+/***/ }),
+/* 247 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.4 Reflect.deleteProperty(target, propertyKey)
+ var $export = __webpack_require__(8);
+ var gOPD = __webpack_require__(52).f;
+ var anObject = __webpack_require__(12);
+
+ $export($export.S, 'Reflect', {
+ deleteProperty: function deleteProperty(target, propertyKey) {
+ var desc = gOPD(anObject(target), propertyKey);
+ return desc && !desc.configurable ? false : delete target[propertyKey];
+ }
+ });
+
+
+/***/ }),
+/* 248 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // 26.1.5 Reflect.enumerate(target)
+ var $export = __webpack_require__(8);
+ var anObject = __webpack_require__(12);
+ var Enumerate = function (iterated) {
+ this._t = anObject(iterated); // target
+ this._i = 0; // next index
+ var keys = this._k = []; // keys
+ var key;
+ for (key in iterated) keys.push(key);
+ };
+ __webpack_require__(131)(Enumerate, 'Object', function () {
+ var that = this;
+ var keys = that._k;
+ var key;
+ do {
+ if (that._i >= keys.length) return { value: undefined, done: true };
+ } while (!((key = keys[that._i++]) in that._t));
+ return { value: key, done: false };
+ });
+
+ $export($export.S, 'Reflect', {
+ enumerate: function enumerate(target) {
+ return new Enumerate(target);
+ }
+ });
+
+
+/***/ }),
+/* 249 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.6 Reflect.get(target, propertyKey [, receiver])
+ var gOPD = __webpack_require__(52);
+ var getPrototypeOf = __webpack_require__(59);
+ var has = __webpack_require__(5);
+ var $export = __webpack_require__(8);
+ var isObject = __webpack_require__(13);
+ var anObject = __webpack_require__(12);
+
+ function get(target, propertyKey /* , receiver */) {
+ var receiver = arguments.length < 3 ? target : arguments[2];
+ var desc, proto;
+ if (anObject(target) === receiver) return target[propertyKey];
+ if (desc = gOPD.f(target, propertyKey)) return has(desc, 'value')
+ ? desc.value
+ : desc.get !== undefined
+ ? desc.get.call(receiver)
+ : undefined;
+ if (isObject(proto = getPrototypeOf(target))) return get(proto, propertyKey, receiver);
+ }
+
+ $export($export.S, 'Reflect', { get: get });
+
+
+/***/ }),
+/* 250 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.7 Reflect.getOwnPropertyDescriptor(target, propertyKey)
+ var gOPD = __webpack_require__(52);
+ var $export = __webpack_require__(8);
+ var anObject = __webpack_require__(12);
+
+ $export($export.S, 'Reflect', {
+ getOwnPropertyDescriptor: function getOwnPropertyDescriptor(target, propertyKey) {
+ return gOPD.f(anObject(target), propertyKey);
+ }
+ });
+
+
+/***/ }),
+/* 251 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.8 Reflect.getPrototypeOf(target)
+ var $export = __webpack_require__(8);
+ var getProto = __webpack_require__(59);
+ var anObject = __webpack_require__(12);
+
+ $export($export.S, 'Reflect', {
+ getPrototypeOf: function getPrototypeOf(target) {
+ return getProto(anObject(target));
+ }
+ });
+
+
+/***/ }),
+/* 252 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.9 Reflect.has(target, propertyKey)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Reflect', {
+ has: function has(target, propertyKey) {
+ return propertyKey in target;
+ }
+ });
+
+
+/***/ }),
+/* 253 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.10 Reflect.isExtensible(target)
+ var $export = __webpack_require__(8);
+ var anObject = __webpack_require__(12);
+ var $isExtensible = Object.isExtensible;
+
+ $export($export.S, 'Reflect', {
+ isExtensible: function isExtensible(target) {
+ anObject(target);
+ return $isExtensible ? $isExtensible(target) : true;
+ }
+ });
+
+
+/***/ }),
+/* 254 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.11 Reflect.ownKeys(target)
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Reflect', { ownKeys: __webpack_require__(255) });
+
+
+/***/ }),
+/* 255 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // all object keys, includes non-enumerable and symbols
+ var gOPN = __webpack_require__(51);
+ var gOPS = __webpack_require__(43);
+ var anObject = __webpack_require__(12);
+ var Reflect = __webpack_require__(4).Reflect;
+ module.exports = Reflect && Reflect.ownKeys || function ownKeys(it) {
+ var keys = gOPN.f(anObject(it));
+ var getSymbols = gOPS.f;
+ return getSymbols ? keys.concat(getSymbols(it)) : keys;
+ };
+
+
+/***/ }),
+/* 256 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.12 Reflect.preventExtensions(target)
+ var $export = __webpack_require__(8);
+ var anObject = __webpack_require__(12);
+ var $preventExtensions = Object.preventExtensions;
+
+ $export($export.S, 'Reflect', {
+ preventExtensions: function preventExtensions(target) {
+ anObject(target);
+ try {
+ if ($preventExtensions) $preventExtensions(target);
+ return true;
+ } catch (e) {
+ return false;
+ }
+ }
+ });
+
+
+/***/ }),
+/* 257 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.13 Reflect.set(target, propertyKey, V [, receiver])
+ var dP = __webpack_require__(11);
+ var gOPD = __webpack_require__(52);
+ var getPrototypeOf = __webpack_require__(59);
+ var has = __webpack_require__(5);
+ var $export = __webpack_require__(8);
+ var createDesc = __webpack_require__(17);
+ var anObject = __webpack_require__(12);
+ var isObject = __webpack_require__(13);
+
+ function set(target, propertyKey, V /* , receiver */) {
+ var receiver = arguments.length < 4 ? target : arguments[3];
+ var ownDesc = gOPD.f(anObject(target), propertyKey);
+ var existingDescriptor, proto;
+ if (!ownDesc) {
+ if (isObject(proto = getPrototypeOf(target))) {
+ return set(proto, propertyKey, V, receiver);
+ }
+ ownDesc = createDesc(0);
+ }
+ if (has(ownDesc, 'value')) {
+ if (ownDesc.writable === false || !isObject(receiver)) return false;
+ if (existingDescriptor = gOPD.f(receiver, propertyKey)) {
+ if (existingDescriptor.get || existingDescriptor.set || existingDescriptor.writable === false) return false;
+ existingDescriptor.value = V;
+ dP.f(receiver, propertyKey, existingDescriptor);
+ } else dP.f(receiver, propertyKey, createDesc(0, V));
+ return true;
+ }
+ return ownDesc.set === undefined ? false : (ownDesc.set.call(receiver, V), true);
+ }
+
+ $export($export.S, 'Reflect', { set: set });
+
+
+/***/ }),
+/* 258 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // 26.1.14 Reflect.setPrototypeOf(target, proto)
+ var $export = __webpack_require__(8);
+ var setProto = __webpack_require__(73);
+
+ if (setProto) $export($export.S, 'Reflect', {
+ setPrototypeOf: function setPrototypeOf(target, proto) {
+ setProto.check(target, proto);
+ try {
+ setProto.set(target, proto);
+ return true;
+ } catch (e) {
+ return false;
+ }
+ }
+ });
+
+
+/***/ }),
+/* 259 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://github.com/tc39/Array.prototype.includes
+ var $export = __webpack_require__(8);
+ var $includes = __webpack_require__(37)(true);
+
+ $export($export.P, 'Array', {
+ includes: function includes(el /* , fromIndex = 0 */) {
+ return $includes(this, el, arguments.length > 1 ? arguments[1] : undefined);
+ }
+ });
+
+ __webpack_require__(188)('includes');
+
+
+/***/ }),
+/* 260 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://tc39.github.io/proposal-flatMap/#sec-Array.prototype.flatMap
+ var $export = __webpack_require__(8);
+ var flattenIntoArray = __webpack_require__(261);
+ var toObject = __webpack_require__(46);
+ var toLength = __webpack_require__(38);
+ var aFunction = __webpack_require__(24);
+ var arraySpeciesCreate = __webpack_require__(175);
+
+ $export($export.P, 'Array', {
+ flatMap: function flatMap(callbackfn /* , thisArg */) {
+ var O = toObject(this);
+ var sourceLen, A;
+ aFunction(callbackfn);
+ sourceLen = toLength(O.length);
+ A = arraySpeciesCreate(O, 0);
+ flattenIntoArray(A, O, O, sourceLen, 0, 1, callbackfn, arguments[1]);
+ return A;
+ }
+ });
+
+ __webpack_require__(188)('flatMap');
+
+
+/***/ }),
+/* 261 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://tc39.github.io/proposal-flatMap/#sec-FlattenIntoArray
+ var isArray = __webpack_require__(45);
+ var isObject = __webpack_require__(13);
+ var toLength = __webpack_require__(38);
+ var ctx = __webpack_require__(23);
+ var IS_CONCAT_SPREADABLE = __webpack_require__(27)('isConcatSpreadable');
+
+ function flattenIntoArray(target, original, source, sourceLen, start, depth, mapper, thisArg) {
+ var targetIndex = start;
+ var sourceIndex = 0;
+ var mapFn = mapper ? ctx(mapper, thisArg, 3) : false;
+ var element, spreadable;
+
+ while (sourceIndex < sourceLen) {
+ if (sourceIndex in source) {
+ element = mapFn ? mapFn(source[sourceIndex], sourceIndex, original) : source[sourceIndex];
+
+ spreadable = false;
+ if (isObject(element)) {
+ spreadable = element[IS_CONCAT_SPREADABLE];
+ spreadable = spreadable !== undefined ? !!spreadable : isArray(element);
+ }
+
+ if (spreadable && depth > 0) {
+ targetIndex = flattenIntoArray(target, original, element, toLength(element.length), targetIndex, depth - 1) - 1;
+ } else {
+ if (targetIndex >= 0x1fffffffffffff) throw TypeError();
+ target[targetIndex] = element;
+ }
+
+ targetIndex++;
+ }
+ sourceIndex++;
+ }
+ return targetIndex;
+ }
+
+ module.exports = flattenIntoArray;
+
+
+/***/ }),
+/* 262 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://tc39.github.io/proposal-flatMap/#sec-Array.prototype.flatten
+ var $export = __webpack_require__(8);
+ var flattenIntoArray = __webpack_require__(261);
+ var toObject = __webpack_require__(46);
+ var toLength = __webpack_require__(38);
+ var toInteger = __webpack_require__(39);
+ var arraySpeciesCreate = __webpack_require__(175);
+
+ $export($export.P, 'Array', {
+ flatten: function flatten(/* depthArg = 1 */) {
+ var depthArg = arguments[0];
+ var O = toObject(this);
+ var sourceLen = toLength(O.length);
+ var A = arraySpeciesCreate(O, 0);
+ flattenIntoArray(A, O, O, sourceLen, 0, depthArg === undefined ? 1 : toInteger(depthArg));
+ return A;
+ }
+ });
+
+ __webpack_require__(188)('flatten');
+
+
+/***/ }),
+/* 263 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://github.com/mathiasbynens/String.prototype.at
+ var $export = __webpack_require__(8);
+ var $at = __webpack_require__(128)(true);
+
+ $export($export.P, 'String', {
+ at: function at(pos) {
+ return $at(this, pos);
+ }
+ });
+
+
+/***/ }),
+/* 264 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://github.com/tc39/proposal-string-pad-start-end
+ var $export = __webpack_require__(8);
+ var $pad = __webpack_require__(265);
+ var userAgent = __webpack_require__(218);
+
+ // https://github.com/zloirock/core-js/issues/280
+ var WEBKIT_BUG = /Version\/10\.\d+(\.\d+)?( Mobile\/\w+)? Safari\//.test(userAgent);
+
+ $export($export.P + $export.F * WEBKIT_BUG, 'String', {
+ padStart: function padStart(maxLength /* , fillString = ' ' */) {
+ return $pad(this, maxLength, arguments.length > 1 ? arguments[1] : undefined, true);
+ }
+ });
+
+
+/***/ }),
+/* 265 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/tc39/proposal-string-pad-start-end
+ var toLength = __webpack_require__(38);
+ var repeat = __webpack_require__(91);
+ var defined = __webpack_require__(36);
+
+ module.exports = function (that, maxLength, fillString, left) {
+ var S = String(defined(that));
+ var stringLength = S.length;
+ var fillStr = fillString === undefined ? ' ' : String(fillString);
+ var intMaxLength = toLength(maxLength);
+ if (intMaxLength <= stringLength || fillStr == '') return S;
+ var fillLen = intMaxLength - stringLength;
+ var stringFiller = repeat.call(fillStr, Math.ceil(fillLen / fillStr.length));
+ if (stringFiller.length > fillLen) stringFiller = stringFiller.slice(0, fillLen);
+ return left ? stringFiller + S : S + stringFiller;
+ };
+
+
+/***/ }),
+/* 266 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://github.com/tc39/proposal-string-pad-start-end
+ var $export = __webpack_require__(8);
+ var $pad = __webpack_require__(265);
+ var userAgent = __webpack_require__(218);
+
+ // https://github.com/zloirock/core-js/issues/280
+ var WEBKIT_BUG = /Version\/10\.\d+(\.\d+)?( Mobile\/\w+)? Safari\//.test(userAgent);
+
+ $export($export.P + $export.F * WEBKIT_BUG, 'String', {
+ padEnd: function padEnd(maxLength /* , fillString = ' ' */) {
+ return $pad(this, maxLength, arguments.length > 1 ? arguments[1] : undefined, false);
+ }
+ });
+
+
+/***/ }),
+/* 267 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://github.com/sebmarkbage/ecmascript-string-left-right-trim
+ __webpack_require__(83)('trimLeft', function ($trim) {
+ return function trimLeft() {
+ return $trim(this, 1);
+ };
+ }, 'trimStart');
+
+
+/***/ }),
+/* 268 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://github.com/sebmarkbage/ecmascript-string-left-right-trim
+ __webpack_require__(83)('trimRight', function ($trim) {
+ return function trimRight() {
+ return $trim(this, 2);
+ };
+ }, 'trimEnd');
+
+
+/***/ }),
+/* 269 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://tc39.github.io/String.prototype.matchAll/
+ var $export = __webpack_require__(8);
+ var defined = __webpack_require__(36);
+ var toLength = __webpack_require__(38);
+ var isRegExp = __webpack_require__(135);
+ var getFlags = __webpack_require__(198);
+ var RegExpProto = RegExp.prototype;
+
+ var $RegExpStringIterator = function (regexp, string) {
+ this._r = regexp;
+ this._s = string;
+ };
+
+ __webpack_require__(131)($RegExpStringIterator, 'RegExp String', function next() {
+ var match = this._r.exec(this._s);
+ return { value: match, done: match === null };
+ });
+
+ $export($export.P, 'String', {
+ matchAll: function matchAll(regexp) {
+ defined(this);
+ if (!isRegExp(regexp)) throw TypeError(regexp + ' is not a regexp!');
+ var S = String(this);
+ var flags = 'flags' in RegExpProto ? String(regexp.flags) : getFlags.call(regexp);
+ var rx = new RegExp(regexp.source, ~flags.indexOf('g') ? flags : 'g' + flags);
+ rx.lastIndex = toLength(regexp.lastIndex);
+ return new $RegExpStringIterator(rx, S);
+ }
+ });
+
+
+/***/ }),
+/* 270 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(29)('asyncIterator');
+
+
+/***/ }),
+/* 271 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(29)('observable');
+
+
+/***/ }),
+/* 272 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/tc39/proposal-object-getownpropertydescriptors
+ var $export = __webpack_require__(8);
+ var ownKeys = __webpack_require__(255);
+ var toIObject = __webpack_require__(33);
+ var gOPD = __webpack_require__(52);
+ var createProperty = __webpack_require__(165);
+
+ $export($export.S, 'Object', {
+ getOwnPropertyDescriptors: function getOwnPropertyDescriptors(object) {
+ var O = toIObject(object);
+ var getDesc = gOPD.f;
+ var keys = ownKeys(O);
+ var result = {};
+ var i = 0;
+ var key, desc;
+ while (keys.length > i) {
+ desc = getDesc(O, key = keys[i++]);
+ if (desc !== undefined) createProperty(result, key, desc);
+ }
+ return result;
+ }
+ });
+
+
+/***/ }),
+/* 273 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/tc39/proposal-object-values-entries
+ var $export = __webpack_require__(8);
+ var $values = __webpack_require__(274)(false);
+
+ $export($export.S, 'Object', {
+ values: function values(it) {
+ return $values(it);
+ }
+ });
+
+
+/***/ }),
+/* 274 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var DESCRIPTORS = __webpack_require__(6);
+ var getKeys = __webpack_require__(31);
+ var toIObject = __webpack_require__(33);
+ var isEnum = __webpack_require__(44).f;
+ module.exports = function (isEntries) {
+ return function (it) {
+ var O = toIObject(it);
+ var keys = getKeys(O);
+ var length = keys.length;
+ var i = 0;
+ var result = [];
+ var key;
+ while (length > i) {
+ key = keys[i++];
+ if (!DESCRIPTORS || isEnum.call(O, key)) {
+ result.push(isEntries ? [key, O[key]] : O[key]);
+ }
+ }
+ return result;
+ };
+ };
+
+
+/***/ }),
+/* 275 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/tc39/proposal-object-values-entries
+ var $export = __webpack_require__(8);
+ var $entries = __webpack_require__(274)(true);
+
+ $export($export.S, 'Object', {
+ entries: function entries(it) {
+ return $entries(it);
+ }
+ });
+
+
+/***/ }),
+/* 276 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toObject = __webpack_require__(46);
+ var aFunction = __webpack_require__(24);
+ var $defineProperty = __webpack_require__(11);
+
+ // B.2.2.2 Object.prototype.__defineGetter__(P, getter)
+ __webpack_require__(6) && $export($export.P + __webpack_require__(277), 'Object', {
+ __defineGetter__: function __defineGetter__(P, getter) {
+ $defineProperty.f(toObject(this), P, { get: aFunction(getter), enumerable: true, configurable: true });
+ }
+ });
+
+
+/***/ }),
+/* 277 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // Forced replacement prototype accessors methods
+ module.exports = __webpack_require__(22) || !__webpack_require__(7)(function () {
+ var K = Math.random();
+ // In FF throws only define methods
+ // eslint-disable-next-line no-undef, no-useless-call
+ __defineSetter__.call(null, K, function () { /* empty */ });
+ delete __webpack_require__(4)[K];
+ });
+
+
+/***/ }),
+/* 278 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toObject = __webpack_require__(46);
+ var aFunction = __webpack_require__(24);
+ var $defineProperty = __webpack_require__(11);
+
+ // B.2.2.3 Object.prototype.__defineSetter__(P, setter)
+ __webpack_require__(6) && $export($export.P + __webpack_require__(277), 'Object', {
+ __defineSetter__: function __defineSetter__(P, setter) {
+ $defineProperty.f(toObject(this), P, { set: aFunction(setter), enumerable: true, configurable: true });
+ }
+ });
+
+
+/***/ }),
+/* 279 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toObject = __webpack_require__(46);
+ var toPrimitive = __webpack_require__(16);
+ var getPrototypeOf = __webpack_require__(59);
+ var getOwnPropertyDescriptor = __webpack_require__(52).f;
+
+ // B.2.2.4 Object.prototype.__lookupGetter__(P)
+ __webpack_require__(6) && $export($export.P + __webpack_require__(277), 'Object', {
+ __lookupGetter__: function __lookupGetter__(P) {
+ var O = toObject(this);
+ var K = toPrimitive(P, true);
+ var D;
+ do {
+ if (D = getOwnPropertyDescriptor(O, K)) return D.get;
+ } while (O = getPrototypeOf(O));
+ }
+ });
+
+
+/***/ }),
+/* 280 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var toObject = __webpack_require__(46);
+ var toPrimitive = __webpack_require__(16);
+ var getPrototypeOf = __webpack_require__(59);
+ var getOwnPropertyDescriptor = __webpack_require__(52).f;
+
+ // B.2.2.5 Object.prototype.__lookupSetter__(P)
+ __webpack_require__(6) && $export($export.P + __webpack_require__(277), 'Object', {
+ __lookupSetter__: function __lookupSetter__(P) {
+ var O = toObject(this);
+ var K = toPrimitive(P, true);
+ var D;
+ do {
+ if (D = getOwnPropertyDescriptor(O, K)) return D.set;
+ } while (O = getPrototypeOf(O));
+ }
+ });
+
+
+/***/ }),
+/* 281 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/DavidBruant/Map-Set.prototype.toJSON
+ var $export = __webpack_require__(8);
+
+ $export($export.P + $export.R, 'Map', { toJSON: __webpack_require__(282)('Map') });
+
+
+/***/ }),
+/* 282 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/DavidBruant/Map-Set.prototype.toJSON
+ var classof = __webpack_require__(75);
+ var from = __webpack_require__(283);
+ module.exports = function (NAME) {
+ return function toJSON() {
+ if (classof(this) != NAME) throw TypeError(NAME + "#toJSON isn't generic");
+ return from(this);
+ };
+ };
+
+
+/***/ }),
+/* 283 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var forOf = __webpack_require__(213);
+
+ module.exports = function (iter, ITERATOR) {
+ var result = [];
+ forOf(iter, false, result.push, result, ITERATOR);
+ return result;
+ };
+
+
+/***/ }),
+/* 284 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/DavidBruant/Map-Set.prototype.toJSON
+ var $export = __webpack_require__(8);
+
+ $export($export.P + $export.R, 'Set', { toJSON: __webpack_require__(282)('Set') });
+
+
+/***/ }),
+/* 285 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/proposal-setmap-offrom/#sec-map.of
+ __webpack_require__(286)('Map');
+
+
+/***/ }),
+/* 286 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://tc39.github.io/proposal-setmap-offrom/
+ var $export = __webpack_require__(8);
+
+ module.exports = function (COLLECTION) {
+ $export($export.S, COLLECTION, { of: function of() {
+ var length = arguments.length;
+ var A = new Array(length);
+ while (length--) A[length] = arguments[length];
+ return new this(A);
+ } });
+ };
+
+
+/***/ }),
+/* 287 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/proposal-setmap-offrom/#sec-set.of
+ __webpack_require__(286)('Set');
+
+
+/***/ }),
+/* 288 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/proposal-setmap-offrom/#sec-weakmap.of
+ __webpack_require__(286)('WeakMap');
+
+
+/***/ }),
+/* 289 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/proposal-setmap-offrom/#sec-weakset.of
+ __webpack_require__(286)('WeakSet');
+
+
+/***/ }),
+/* 290 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/proposal-setmap-offrom/#sec-map.from
+ __webpack_require__(291)('Map');
+
+
+/***/ }),
+/* 291 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://tc39.github.io/proposal-setmap-offrom/
+ var $export = __webpack_require__(8);
+ var aFunction = __webpack_require__(24);
+ var ctx = __webpack_require__(23);
+ var forOf = __webpack_require__(213);
+
+ module.exports = function (COLLECTION) {
+ $export($export.S, COLLECTION, { from: function from(source /* , mapFn, thisArg */) {
+ var mapFn = arguments[1];
+ var mapping, A, n, cb;
+ aFunction(this);
+ mapping = mapFn !== undefined;
+ if (mapping) aFunction(mapFn);
+ if (source == undefined) return new this();
+ A = [];
+ if (mapping) {
+ n = 0;
+ cb = ctx(mapFn, arguments[2], 2);
+ forOf(source, false, function (nextItem) {
+ A.push(cb(nextItem, n++));
+ });
+ } else {
+ forOf(source, false, A.push, A);
+ }
+ return new this(A);
+ } });
+ };
+
+
+/***/ }),
+/* 292 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/proposal-setmap-offrom/#sec-set.from
+ __webpack_require__(291)('Set');
+
+
+/***/ }),
+/* 293 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/proposal-setmap-offrom/#sec-weakmap.from
+ __webpack_require__(291)('WeakMap');
+
+
+/***/ }),
+/* 294 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://tc39.github.io/proposal-setmap-offrom/#sec-weakset.from
+ __webpack_require__(291)('WeakSet');
+
+
+/***/ }),
+/* 295 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/tc39/proposal-global
+ var $export = __webpack_require__(8);
+
+ $export($export.G, { global: __webpack_require__(4) });
+
+
+/***/ }),
+/* 296 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/tc39/proposal-global
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'System', { global: __webpack_require__(4) });
+
+
+/***/ }),
+/* 297 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/ljharb/proposal-is-error
+ var $export = __webpack_require__(8);
+ var cof = __webpack_require__(35);
+
+ $export($export.S, 'Error', {
+ isError: function isError(it) {
+ return cof(it) === 'Error';
+ }
+ });
+
+
+/***/ }),
+/* 298 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://rwaldron.github.io/proposal-math-extensions/
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ clamp: function clamp(x, lower, upper) {
+ return Math.min(upper, Math.max(lower, x));
+ }
+ });
+
+
+/***/ }),
+/* 299 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://rwaldron.github.io/proposal-math-extensions/
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', { DEG_PER_RAD: Math.PI / 180 });
+
+
+/***/ }),
+/* 300 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://rwaldron.github.io/proposal-math-extensions/
+ var $export = __webpack_require__(8);
+ var RAD_PER_DEG = 180 / Math.PI;
+
+ $export($export.S, 'Math', {
+ degrees: function degrees(radians) {
+ return radians * RAD_PER_DEG;
+ }
+ });
+
+
+/***/ }),
+/* 301 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://rwaldron.github.io/proposal-math-extensions/
+ var $export = __webpack_require__(8);
+ var scale = __webpack_require__(302);
+ var fround = __webpack_require__(114);
+
+ $export($export.S, 'Math', {
+ fscale: function fscale(x, inLow, inHigh, outLow, outHigh) {
+ return fround(scale(x, inLow, inHigh, outLow, outHigh));
+ }
+ });
+
+
+/***/ }),
+/* 302 */
+/***/ (function(module, exports) {
+
+ // https://rwaldron.github.io/proposal-math-extensions/
+ module.exports = Math.scale || function scale(x, inLow, inHigh, outLow, outHigh) {
+ if (
+ arguments.length === 0
+ // eslint-disable-next-line no-self-compare
+ || x != x
+ // eslint-disable-next-line no-self-compare
+ || inLow != inLow
+ // eslint-disable-next-line no-self-compare
+ || inHigh != inHigh
+ // eslint-disable-next-line no-self-compare
+ || outLow != outLow
+ // eslint-disable-next-line no-self-compare
+ || outHigh != outHigh
+ ) return NaN;
+ if (x === Infinity || x === -Infinity) return x;
+ return (x - inLow) * (outHigh - outLow) / (inHigh - inLow) + outLow;
+ };
+
+
+/***/ }),
+/* 303 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://gist.github.com/BrendanEich/4294d5c212a6d2254703
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ iaddh: function iaddh(x0, x1, y0, y1) {
+ var $x0 = x0 >>> 0;
+ var $x1 = x1 >>> 0;
+ var $y0 = y0 >>> 0;
+ return $x1 + (y1 >>> 0) + (($x0 & $y0 | ($x0 | $y0) & ~($x0 + $y0 >>> 0)) >>> 31) | 0;
+ }
+ });
+
+
+/***/ }),
+/* 304 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://gist.github.com/BrendanEich/4294d5c212a6d2254703
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ isubh: function isubh(x0, x1, y0, y1) {
+ var $x0 = x0 >>> 0;
+ var $x1 = x1 >>> 0;
+ var $y0 = y0 >>> 0;
+ return $x1 - (y1 >>> 0) - ((~$x0 & $y0 | ~($x0 ^ $y0) & $x0 - $y0 >>> 0) >>> 31) | 0;
+ }
+ });
+
+
+/***/ }),
+/* 305 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://gist.github.com/BrendanEich/4294d5c212a6d2254703
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ imulh: function imulh(u, v) {
+ var UINT16 = 0xffff;
+ var $u = +u;
+ var $v = +v;
+ var u0 = $u & UINT16;
+ var v0 = $v & UINT16;
+ var u1 = $u >> 16;
+ var v1 = $v >> 16;
+ var t = (u1 * v0 >>> 0) + (u0 * v0 >>> 16);
+ return u1 * v1 + (t >> 16) + ((u0 * v1 >>> 0) + (t & UINT16) >> 16);
+ }
+ });
+
+
+/***/ }),
+/* 306 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://rwaldron.github.io/proposal-math-extensions/
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', { RAD_PER_DEG: 180 / Math.PI });
+
+
+/***/ }),
+/* 307 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://rwaldron.github.io/proposal-math-extensions/
+ var $export = __webpack_require__(8);
+ var DEG_PER_RAD = Math.PI / 180;
+
+ $export($export.S, 'Math', {
+ radians: function radians(degrees) {
+ return degrees * DEG_PER_RAD;
+ }
+ });
+
+
+/***/ }),
+/* 308 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://rwaldron.github.io/proposal-math-extensions/
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', { scale: __webpack_require__(302) });
+
+
+/***/ }),
+/* 309 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://gist.github.com/BrendanEich/4294d5c212a6d2254703
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', {
+ umulh: function umulh(u, v) {
+ var UINT16 = 0xffff;
+ var $u = +u;
+ var $v = +v;
+ var u0 = $u & UINT16;
+ var v0 = $v & UINT16;
+ var u1 = $u >>> 16;
+ var v1 = $v >>> 16;
+ var t = (u1 * v0 >>> 0) + (u0 * v0 >>> 16);
+ return u1 * v1 + (t >>> 16) + ((u0 * v1 >>> 0) + (t & UINT16) >>> 16);
+ }
+ });
+
+
+/***/ }),
+/* 310 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // http://jfbastien.github.io/papers/Math.signbit.html
+ var $export = __webpack_require__(8);
+
+ $export($export.S, 'Math', { signbit: function signbit(x) {
+ // eslint-disable-next-line no-self-compare
+ return (x = +x) != x ? x : x == 0 ? 1 / x == Infinity : x > 0;
+ } });
+
+
+/***/ }),
+/* 311 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/tc39/proposal-promise-finally
+ 'use strict';
+ var $export = __webpack_require__(8);
+ var core = __webpack_require__(9);
+ var global = __webpack_require__(4);
+ var speciesConstructor = __webpack_require__(210);
+ var promiseResolve = __webpack_require__(219);
+
+ $export($export.P + $export.R, 'Promise', { 'finally': function (onFinally) {
+ var C = speciesConstructor(this, core.Promise || global.Promise);
+ var isFunction = typeof onFinally == 'function';
+ return this.then(
+ isFunction ? function (x) {
+ return promiseResolve(C, onFinally()).then(function () { return x; });
+ } : onFinally,
+ isFunction ? function (e) {
+ return promiseResolve(C, onFinally()).then(function () { throw e; });
+ } : onFinally
+ );
+ } });
+
+
+/***/ }),
+/* 312 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://github.com/tc39/proposal-promise-try
+ var $export = __webpack_require__(8);
+ var newPromiseCapability = __webpack_require__(216);
+ var perform = __webpack_require__(217);
+
+ $export($export.S, 'Promise', { 'try': function (callbackfn) {
+ var promiseCapability = newPromiseCapability.f(this);
+ var result = perform(callbackfn);
+ (result.e ? promiseCapability.reject : promiseCapability.resolve)(result.v);
+ return promiseCapability.promise;
+ } });
+
+
+/***/ }),
+/* 313 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var toMetaKey = metadata.key;
+ var ordinaryDefineOwnMetadata = metadata.set;
+
+ metadata.exp({ defineMetadata: function defineMetadata(metadataKey, metadataValue, target, targetKey) {
+ ordinaryDefineOwnMetadata(metadataKey, metadataValue, anObject(target), toMetaKey(targetKey));
+ } });
+
+
+/***/ }),
+/* 314 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var Map = __webpack_require__(221);
+ var $export = __webpack_require__(8);
+ var shared = __webpack_require__(21)('metadata');
+ var store = shared.store || (shared.store = new (__webpack_require__(226))());
+
+ var getOrCreateMetadataMap = function (target, targetKey, create) {
+ var targetMetadata = store.get(target);
+ if (!targetMetadata) {
+ if (!create) return undefined;
+ store.set(target, targetMetadata = new Map());
+ }
+ var keyMetadata = targetMetadata.get(targetKey);
+ if (!keyMetadata) {
+ if (!create) return undefined;
+ targetMetadata.set(targetKey, keyMetadata = new Map());
+ } return keyMetadata;
+ };
+ var ordinaryHasOwnMetadata = function (MetadataKey, O, P) {
+ var metadataMap = getOrCreateMetadataMap(O, P, false);
+ return metadataMap === undefined ? false : metadataMap.has(MetadataKey);
+ };
+ var ordinaryGetOwnMetadata = function (MetadataKey, O, P) {
+ var metadataMap = getOrCreateMetadataMap(O, P, false);
+ return metadataMap === undefined ? undefined : metadataMap.get(MetadataKey);
+ };
+ var ordinaryDefineOwnMetadata = function (MetadataKey, MetadataValue, O, P) {
+ getOrCreateMetadataMap(O, P, true).set(MetadataKey, MetadataValue);
+ };
+ var ordinaryOwnMetadataKeys = function (target, targetKey) {
+ var metadataMap = getOrCreateMetadataMap(target, targetKey, false);
+ var keys = [];
+ if (metadataMap) metadataMap.forEach(function (_, key) { keys.push(key); });
+ return keys;
+ };
+ var toMetaKey = function (it) {
+ return it === undefined || typeof it == 'symbol' ? it : String(it);
+ };
+ var exp = function (O) {
+ $export($export.S, 'Reflect', O);
+ };
+
+ module.exports = {
+ store: store,
+ map: getOrCreateMetadataMap,
+ has: ordinaryHasOwnMetadata,
+ get: ordinaryGetOwnMetadata,
+ set: ordinaryDefineOwnMetadata,
+ keys: ordinaryOwnMetadataKeys,
+ key: toMetaKey,
+ exp: exp
+ };
+
+
+/***/ }),
+/* 315 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var toMetaKey = metadata.key;
+ var getOrCreateMetadataMap = metadata.map;
+ var store = metadata.store;
+
+ metadata.exp({ deleteMetadata: function deleteMetadata(metadataKey, target /* , targetKey */) {
+ var targetKey = arguments.length < 3 ? undefined : toMetaKey(arguments[2]);
+ var metadataMap = getOrCreateMetadataMap(anObject(target), targetKey, false);
+ if (metadataMap === undefined || !metadataMap['delete'](metadataKey)) return false;
+ if (metadataMap.size) return true;
+ var targetMetadata = store.get(target);
+ targetMetadata['delete'](targetKey);
+ return !!targetMetadata.size || store['delete'](target);
+ } });
+
+
+/***/ }),
+/* 316 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var getPrototypeOf = __webpack_require__(59);
+ var ordinaryHasOwnMetadata = metadata.has;
+ var ordinaryGetOwnMetadata = metadata.get;
+ var toMetaKey = metadata.key;
+
+ var ordinaryGetMetadata = function (MetadataKey, O, P) {
+ var hasOwn = ordinaryHasOwnMetadata(MetadataKey, O, P);
+ if (hasOwn) return ordinaryGetOwnMetadata(MetadataKey, O, P);
+ var parent = getPrototypeOf(O);
+ return parent !== null ? ordinaryGetMetadata(MetadataKey, parent, P) : undefined;
+ };
+
+ metadata.exp({ getMetadata: function getMetadata(metadataKey, target /* , targetKey */) {
+ return ordinaryGetMetadata(metadataKey, anObject(target), arguments.length < 3 ? undefined : toMetaKey(arguments[2]));
+ } });
+
+
+/***/ }),
+/* 317 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var Set = __webpack_require__(225);
+ var from = __webpack_require__(283);
+ var metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var getPrototypeOf = __webpack_require__(59);
+ var ordinaryOwnMetadataKeys = metadata.keys;
+ var toMetaKey = metadata.key;
+
+ var ordinaryMetadataKeys = function (O, P) {
+ var oKeys = ordinaryOwnMetadataKeys(O, P);
+ var parent = getPrototypeOf(O);
+ if (parent === null) return oKeys;
+ var pKeys = ordinaryMetadataKeys(parent, P);
+ return pKeys.length ? oKeys.length ? from(new Set(oKeys.concat(pKeys))) : pKeys : oKeys;
+ };
+
+ metadata.exp({ getMetadataKeys: function getMetadataKeys(target /* , targetKey */) {
+ return ordinaryMetadataKeys(anObject(target), arguments.length < 2 ? undefined : toMetaKey(arguments[1]));
+ } });
+
+
+/***/ }),
+/* 318 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var ordinaryGetOwnMetadata = metadata.get;
+ var toMetaKey = metadata.key;
+
+ metadata.exp({ getOwnMetadata: function getOwnMetadata(metadataKey, target /* , targetKey */) {
+ return ordinaryGetOwnMetadata(metadataKey, anObject(target)
+ , arguments.length < 3 ? undefined : toMetaKey(arguments[2]));
+ } });
+
+
+/***/ }),
+/* 319 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var ordinaryOwnMetadataKeys = metadata.keys;
+ var toMetaKey = metadata.key;
+
+ metadata.exp({ getOwnMetadataKeys: function getOwnMetadataKeys(target /* , targetKey */) {
+ return ordinaryOwnMetadataKeys(anObject(target), arguments.length < 2 ? undefined : toMetaKey(arguments[1]));
+ } });
+
+
+/***/ }),
+/* 320 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var getPrototypeOf = __webpack_require__(59);
+ var ordinaryHasOwnMetadata = metadata.has;
+ var toMetaKey = metadata.key;
+
+ var ordinaryHasMetadata = function (MetadataKey, O, P) {
+ var hasOwn = ordinaryHasOwnMetadata(MetadataKey, O, P);
+ if (hasOwn) return true;
+ var parent = getPrototypeOf(O);
+ return parent !== null ? ordinaryHasMetadata(MetadataKey, parent, P) : false;
+ };
+
+ metadata.exp({ hasMetadata: function hasMetadata(metadataKey, target /* , targetKey */) {
+ return ordinaryHasMetadata(metadataKey, anObject(target), arguments.length < 3 ? undefined : toMetaKey(arguments[2]));
+ } });
+
+
+/***/ }),
+/* 321 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var ordinaryHasOwnMetadata = metadata.has;
+ var toMetaKey = metadata.key;
+
+ metadata.exp({ hasOwnMetadata: function hasOwnMetadata(metadataKey, target /* , targetKey */) {
+ return ordinaryHasOwnMetadata(metadataKey, anObject(target)
+ , arguments.length < 3 ? undefined : toMetaKey(arguments[2]));
+ } });
+
+
+/***/ }),
+/* 322 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $metadata = __webpack_require__(314);
+ var anObject = __webpack_require__(12);
+ var aFunction = __webpack_require__(24);
+ var toMetaKey = $metadata.key;
+ var ordinaryDefineOwnMetadata = $metadata.set;
+
+ $metadata.exp({ metadata: function metadata(metadataKey, metadataValue) {
+ return function decorator(target, targetKey) {
+ ordinaryDefineOwnMetadata(
+ metadataKey, metadataValue,
+ (targetKey !== undefined ? anObject : aFunction)(target),
+ toMetaKey(targetKey)
+ );
+ };
+ } });
+
+
+/***/ }),
+/* 323 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/rwaldron/tc39-notes/blob/master/es6/2014-09/sept-25.md#510-globalasap-for-enqueuing-a-microtask
+ var $export = __webpack_require__(8);
+ var microtask = __webpack_require__(215)();
+ var process = __webpack_require__(4).process;
+ var isNode = __webpack_require__(35)(process) == 'process';
+
+ $export($export.G, {
+ asap: function asap(fn) {
+ var domain = isNode && process.domain;
+ microtask(domain ? domain.bind(fn) : fn);
+ }
+ });
+
+
+/***/ }),
+/* 324 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+ // https://github.com/zenparsing/es-observable
+ var $export = __webpack_require__(8);
+ var global = __webpack_require__(4);
+ var core = __webpack_require__(9);
+ var microtask = __webpack_require__(215)();
+ var OBSERVABLE = __webpack_require__(27)('observable');
+ var aFunction = __webpack_require__(24);
+ var anObject = __webpack_require__(12);
+ var anInstance = __webpack_require__(212);
+ var redefineAll = __webpack_require__(220);
+ var hide = __webpack_require__(10);
+ var forOf = __webpack_require__(213);
+ var RETURN = forOf.RETURN;
+
+ var getMethod = function (fn) {
+ return fn == null ? undefined : aFunction(fn);
+ };
+
+ var cleanupSubscription = function (subscription) {
+ var cleanup = subscription._c;
+ if (cleanup) {
+ subscription._c = undefined;
+ cleanup();
+ }
+ };
+
+ var subscriptionClosed = function (subscription) {
+ return subscription._o === undefined;
+ };
+
+ var closeSubscription = function (subscription) {
+ if (!subscriptionClosed(subscription)) {
+ subscription._o = undefined;
+ cleanupSubscription(subscription);
+ }
+ };
+
+ var Subscription = function (observer, subscriber) {
+ anObject(observer);
+ this._c = undefined;
+ this._o = observer;
+ observer = new SubscriptionObserver(this);
+ try {
+ var cleanup = subscriber(observer);
+ var subscription = cleanup;
+ if (cleanup != null) {
+ if (typeof cleanup.unsubscribe === 'function') cleanup = function () { subscription.unsubscribe(); };
+ else aFunction(cleanup);
+ this._c = cleanup;
+ }
+ } catch (e) {
+ observer.error(e);
+ return;
+ } if (subscriptionClosed(this)) cleanupSubscription(this);
+ };
+
+ Subscription.prototype = redefineAll({}, {
+ unsubscribe: function unsubscribe() { closeSubscription(this); }
+ });
+
+ var SubscriptionObserver = function (subscription) {
+ this._s = subscription;
+ };
+
+ SubscriptionObserver.prototype = redefineAll({}, {
+ next: function next(value) {
+ var subscription = this._s;
+ if (!subscriptionClosed(subscription)) {
+ var observer = subscription._o;
+ try {
+ var m = getMethod(observer.next);
+ if (m) return m.call(observer, value);
+ } catch (e) {
+ try {
+ closeSubscription(subscription);
+ } finally {
+ throw e;
+ }
+ }
+ }
+ },
+ error: function error(value) {
+ var subscription = this._s;
+ if (subscriptionClosed(subscription)) throw value;
+ var observer = subscription._o;
+ subscription._o = undefined;
+ try {
+ var m = getMethod(observer.error);
+ if (!m) throw value;
+ value = m.call(observer, value);
+ } catch (e) {
+ try {
+ cleanupSubscription(subscription);
+ } finally {
+ throw e;
+ }
+ } cleanupSubscription(subscription);
+ return value;
+ },
+ complete: function complete(value) {
+ var subscription = this._s;
+ if (!subscriptionClosed(subscription)) {
+ var observer = subscription._o;
+ subscription._o = undefined;
+ try {
+ var m = getMethod(observer.complete);
+ value = m ? m.call(observer, value) : undefined;
+ } catch (e) {
+ try {
+ cleanupSubscription(subscription);
+ } finally {
+ throw e;
+ }
+ } cleanupSubscription(subscription);
+ return value;
+ }
+ }
+ });
+
+ var $Observable = function Observable(subscriber) {
+ anInstance(this, $Observable, 'Observable', '_f')._f = aFunction(subscriber);
+ };
+
+ redefineAll($Observable.prototype, {
+ subscribe: function subscribe(observer) {
+ return new Subscription(observer, this._f);
+ },
+ forEach: function forEach(fn) {
+ var that = this;
+ return new (core.Promise || global.Promise)(function (resolve, reject) {
+ aFunction(fn);
+ var subscription = that.subscribe({
+ next: function (value) {
+ try {
+ return fn(value);
+ } catch (e) {
+ reject(e);
+ subscription.unsubscribe();
+ }
+ },
+ error: reject,
+ complete: resolve
+ });
+ });
+ }
+ });
+
+ redefineAll($Observable, {
+ from: function from(x) {
+ var C = typeof this === 'function' ? this : $Observable;
+ var method = getMethod(anObject(x)[OBSERVABLE]);
+ if (method) {
+ var observable = anObject(method.call(x));
+ return observable.constructor === C ? observable : new C(function (observer) {
+ return observable.subscribe(observer);
+ });
+ }
+ return new C(function (observer) {
+ var done = false;
+ microtask(function () {
+ if (!done) {
+ try {
+ if (forOf(x, false, function (it) {
+ observer.next(it);
+ if (done) return RETURN;
+ }) === RETURN) return;
+ } catch (e) {
+ if (done) throw e;
+ observer.error(e);
+ return;
+ } observer.complete();
+ }
+ });
+ return function () { done = true; };
+ });
+ },
+ of: function of() {
+ for (var i = 0, l = arguments.length, items = new Array(l); i < l;) items[i] = arguments[i++];
+ return new (typeof this === 'function' ? this : $Observable)(function (observer) {
+ var done = false;
+ microtask(function () {
+ if (!done) {
+ for (var j = 0; j < items.length; ++j) {
+ observer.next(items[j]);
+ if (done) return;
+ } observer.complete();
+ }
+ });
+ return function () { done = true; };
+ });
+ }
+ });
+
+ hide($Observable.prototype, OBSERVABLE, function () { return this; });
+
+ $export($export.G, { Observable: $Observable });
+
+ __webpack_require__(194)('Observable');
+
+
+/***/ }),
+/* 325 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // ie9- setTimeout & setInterval additional parameters fix
+ var global = __webpack_require__(4);
+ var $export = __webpack_require__(8);
+ var userAgent = __webpack_require__(218);
+ var slice = [].slice;
+ var MSIE = /MSIE .\./.test(userAgent); // <- dirty ie9- check
+ var wrap = function (set) {
+ return function (fn, time /* , ...args */) {
+ var boundArgs = arguments.length > 2;
+ var args = boundArgs ? slice.call(arguments, 2) : false;
+ return set(boundArgs ? function () {
+ // eslint-disable-next-line no-new-func
+ (typeof fn == 'function' ? fn : Function(fn)).apply(this, args);
+ } : fn, time);
+ };
+ };
+ $export($export.G + $export.B + $export.F * MSIE, {
+ setTimeout: wrap(global.setTimeout),
+ setInterval: wrap(global.setInterval)
+ });
+
+
+/***/ }),
+/* 326 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $export = __webpack_require__(8);
+ var $task = __webpack_require__(214);
+ $export($export.G + $export.B, {
+ setImmediate: $task.set,
+ clearImmediate: $task.clear
+ });
+
+
+/***/ }),
+/* 327 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var $iterators = __webpack_require__(195);
+ var getKeys = __webpack_require__(31);
+ var redefine = __webpack_require__(18);
+ var global = __webpack_require__(4);
+ var hide = __webpack_require__(10);
+ var Iterators = __webpack_require__(130);
+ var wks = __webpack_require__(27);
+ var ITERATOR = wks('iterator');
+ var TO_STRING_TAG = wks('toStringTag');
+ var ArrayValues = Iterators.Array;
+
+ var DOMIterables = {
+ CSSRuleList: true, // TODO: Not spec compliant, should be false.
+ CSSStyleDeclaration: false,
+ CSSValueList: false,
+ ClientRectList: false,
+ DOMRectList: false,
+ DOMStringList: false,
+ DOMTokenList: true,
+ DataTransferItemList: false,
+ FileList: false,
+ HTMLAllCollection: false,
+ HTMLCollection: false,
+ HTMLFormElement: false,
+ HTMLSelectElement: false,
+ MediaList: true, // TODO: Not spec compliant, should be false.
+ MimeTypeArray: false,
+ NamedNodeMap: false,
+ NodeList: true,
+ PaintRequestList: false,
+ Plugin: false,
+ PluginArray: false,
+ SVGLengthList: false,
+ SVGNumberList: false,
+ SVGPathSegList: false,
+ SVGPointList: false,
+ SVGStringList: false,
+ SVGTransformList: false,
+ SourceBufferList: false,
+ StyleSheetList: true, // TODO: Not spec compliant, should be false.
+ TextTrackCueList: false,
+ TextTrackList: false,
+ TouchList: false
+ };
+
+ for (var collections = getKeys(DOMIterables), i = 0; i < collections.length; i++) {
+ var NAME = collections[i];
+ var explicit = DOMIterables[NAME];
+ var Collection = global[NAME];
+ var proto = Collection && Collection.prototype;
+ var key;
+ if (proto) {
+ if (!proto[ITERATOR]) hide(proto, ITERATOR, ArrayValues);
+ if (!proto[TO_STRING_TAG]) hide(proto, TO_STRING_TAG, NAME);
+ Iterators[NAME] = ArrayValues;
+ if (explicit) for (key in $iterators) if (!proto[key]) redefine(proto, key, $iterators[key], true);
+ }
+ }
+
+
+/***/ }),
+/* 328 */
+/***/ (function(module, exports) {
+
+ /* WEBPACK VAR INJECTION */(function(global) {/**
+ * Copyright (c) 2014, Facebook, Inc.
+ * All rights reserved.
+ *
+ * This source code is licensed under the BSD-style license found in the
+ * https://raw.github.com/facebook/regenerator/master/LICENSE file. An
+ * additional grant of patent rights can be found in the PATENTS file in
+ * the same directory.
+ */
+
+ !(function(global) {
+ "use strict";
+
+ var Op = Object.prototype;
+ var hasOwn = Op.hasOwnProperty;
+ var undefined; // More compressible than void 0.
+ var $Symbol = typeof Symbol === "function" ? Symbol : {};
+ var iteratorSymbol = $Symbol.iterator || "@@iterator";
+ var asyncIteratorSymbol = $Symbol.asyncIterator || "@@asyncIterator";
+ var toStringTagSymbol = $Symbol.toStringTag || "@@toStringTag";
+
+ var inModule = typeof module === "object";
+ var runtime = global.regeneratorRuntime;
+ if (runtime) {
+ if (inModule) {
+ // If regeneratorRuntime is defined globally and we're in a module,
+ // make the exports object identical to regeneratorRuntime.
+ module.exports = runtime;
+ }
+ // Don't bother evaluating the rest of this file if the runtime was
+ // already defined globally.
+ return;
+ }
+
+ // Define the runtime globally (as expected by generated code) as either
+ // module.exports (if we're in a module) or a new, empty object.
+ runtime = global.regeneratorRuntime = inModule ? module.exports : {};
+
+ function wrap(innerFn, outerFn, self, tryLocsList) {
+ // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator.
+ var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator;
+ var generator = Object.create(protoGenerator.prototype);
+ var context = new Context(tryLocsList || []);
+
+ // The ._invoke method unifies the implementations of the .next,
+ // .throw, and .return methods.
+ generator._invoke = makeInvokeMethod(innerFn, self, context);
+
+ return generator;
+ }
+ runtime.wrap = wrap;
+
+ // Try/catch helper to minimize deoptimizations. Returns a completion
+ // record like context.tryEntries[i].completion. This interface could
+ // have been (and was previously) designed to take a closure to be
+ // invoked without arguments, but in all the cases we care about we
+ // already have an existing method we want to call, so there's no need
+ // to create a new function object. We can even get away with assuming
+ // the method takes exactly one argument, since that happens to be true
+ // in every case, so we don't have to touch the arguments object. The
+ // only additional allocation required is the completion record, which
+ // has a stable shape and so hopefully should be cheap to allocate.
+ function tryCatch(fn, obj, arg) {
+ try {
+ return { type: "normal", arg: fn.call(obj, arg) };
+ } catch (err) {
+ return { type: "throw", arg: err };
+ }
+ }
+
+ var GenStateSuspendedStart = "suspendedStart";
+ var GenStateSuspendedYield = "suspendedYield";
+ var GenStateExecuting = "executing";
+ var GenStateCompleted = "completed";
+
+ // Returning this object from the innerFn has the same effect as
+ // breaking out of the dispatch switch statement.
+ var ContinueSentinel = {};
+
+ // Dummy constructor functions that we use as the .constructor and
+ // .constructor.prototype properties for functions that return Generator
+ // objects. For full spec compliance, you may wish to configure your
+ // minifier not to mangle the names of these two functions.
+ function Generator() {}
+ function GeneratorFunction() {}
+ function GeneratorFunctionPrototype() {}
+
+ // This is a polyfill for %IteratorPrototype% for environments that
+ // don't natively support it.
+ var IteratorPrototype = {};
+ IteratorPrototype[iteratorSymbol] = function () {
+ return this;
+ };
+
+ var getProto = Object.getPrototypeOf;
+ var NativeIteratorPrototype = getProto && getProto(getProto(values([])));
+ if (NativeIteratorPrototype &&
+ NativeIteratorPrototype !== Op &&
+ hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) {
+ // This environment has a native %IteratorPrototype%; use it instead
+ // of the polyfill.
+ IteratorPrototype = NativeIteratorPrototype;
+ }
+
+ var Gp = GeneratorFunctionPrototype.prototype =
+ Generator.prototype = Object.create(IteratorPrototype);
+ GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype;
+ GeneratorFunctionPrototype.constructor = GeneratorFunction;
+ GeneratorFunctionPrototype[toStringTagSymbol] =
+ GeneratorFunction.displayName = "GeneratorFunction";
+
+ // Helper for defining the .next, .throw, and .return methods of the
+ // Iterator interface in terms of a single ._invoke method.
+ function defineIteratorMethods(prototype) {
+ ["next", "throw", "return"].forEach(function(method) {
+ prototype[method] = function(arg) {
+ return this._invoke(method, arg);
+ };
+ });
+ }
+
+ runtime.isGeneratorFunction = function(genFun) {
+ var ctor = typeof genFun === "function" && genFun.constructor;
+ return ctor
+ ? ctor === GeneratorFunction ||
+ // For the native GeneratorFunction constructor, the best we can
+ // do is to check its .name property.
+ (ctor.displayName || ctor.name) === "GeneratorFunction"
+ : false;
+ };
+
+ runtime.mark = function(genFun) {
+ if (Object.setPrototypeOf) {
+ Object.setPrototypeOf(genFun, GeneratorFunctionPrototype);
+ } else {
+ genFun.__proto__ = GeneratorFunctionPrototype;
+ if (!(toStringTagSymbol in genFun)) {
+ genFun[toStringTagSymbol] = "GeneratorFunction";
+ }
+ }
+ genFun.prototype = Object.create(Gp);
+ return genFun;
+ };
+
+ // Within the body of any async function, `await x` is transformed to
+ // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test
+ // `hasOwn.call(value, "__await")` to determine if the yielded value is
+ // meant to be awaited.
+ runtime.awrap = function(arg) {
+ return { __await: arg };
+ };
+
+ function AsyncIterator(generator) {
+ function invoke(method, arg, resolve, reject) {
+ var record = tryCatch(generator[method], generator, arg);
+ if (record.type === "throw") {
+ reject(record.arg);
+ } else {
+ var result = record.arg;
+ var value = result.value;
+ if (value &&
+ typeof value === "object" &&
+ hasOwn.call(value, "__await")) {
+ return Promise.resolve(value.__await).then(function(value) {
+ invoke("next", value, resolve, reject);
+ }, function(err) {
+ invoke("throw", err, resolve, reject);
+ });
+ }
+
+ return Promise.resolve(value).then(function(unwrapped) {
+ // When a yielded Promise is resolved, its final value becomes
+ // the .value of the Promise<{value,done}> result for the
+ // current iteration. If the Promise is rejected, however, the
+ // result for this iteration will be rejected with the same
+ // reason. Note that rejections of yielded Promises are not
+ // thrown back into the generator function, as is the case
+ // when an awaited Promise is rejected. This difference in
+ // behavior between yield and await is important, because it
+ // allows the consumer to decide what to do with the yielded
+ // rejection (swallow it and continue, manually .throw it back
+ // into the generator, abandon iteration, whatever). With
+ // await, by contrast, there is no opportunity to examine the
+ // rejection reason outside the generator function, so the
+ // only option is to throw it from the await expression, and
+ // let the generator function handle the exception.
+ result.value = unwrapped;
+ resolve(result);
+ }, reject);
+ }
+ }
+
+ if (typeof global.process === "object" && global.process.domain) {
+ invoke = global.process.domain.bind(invoke);
+ }
+
+ var previousPromise;
+
+ function enqueue(method, arg) {
+ function callInvokeWithMethodAndArg() {
+ return new Promise(function(resolve, reject) {
+ invoke(method, arg, resolve, reject);
+ });
+ }
+
+ return previousPromise =
+ // If enqueue has been called before, then we want to wait until
+ // all previous Promises have been resolved before calling invoke,
+ // so that results are always delivered in the correct order. If
+ // enqueue has not been called before, then it is important to
+ // call invoke immediately, without waiting on a callback to fire,
+ // so that the async generator function has the opportunity to do
+ // any necessary setup in a predictable way. This predictability
+ // is why the Promise constructor synchronously invokes its
+ // executor callback, and why async functions synchronously
+ // execute code before the first await. Since we implement simple
+ // async functions in terms of async generators, it is especially
+ // important to get this right, even though it requires care.
+ previousPromise ? previousPromise.then(
+ callInvokeWithMethodAndArg,
+ // Avoid propagating failures to Promises returned by later
+ // invocations of the iterator.
+ callInvokeWithMethodAndArg
+ ) : callInvokeWithMethodAndArg();
+ }
+
+ // Define the unified helper method that is used to implement .next,
+ // .throw, and .return (see defineIteratorMethods).
+ this._invoke = enqueue;
+ }
+
+ defineIteratorMethods(AsyncIterator.prototype);
+ AsyncIterator.prototype[asyncIteratorSymbol] = function () {
+ return this;
+ };
+ runtime.AsyncIterator = AsyncIterator;
+
+ // Note that simple async functions are implemented on top of
+ // AsyncIterator objects; they just return a Promise for the value of
+ // the final result produced by the iterator.
+ runtime.async = function(innerFn, outerFn, self, tryLocsList) {
+ var iter = new AsyncIterator(
+ wrap(innerFn, outerFn, self, tryLocsList)
+ );
+
+ return runtime.isGeneratorFunction(outerFn)
+ ? iter // If outerFn is a generator, return the full iterator.
+ : iter.next().then(function(result) {
+ return result.done ? result.value : iter.next();
+ });
+ };
+
+ function makeInvokeMethod(innerFn, self, context) {
+ var state = GenStateSuspendedStart;
+
+ return function invoke(method, arg) {
+ if (state === GenStateExecuting) {
+ throw new Error("Generator is already running");
+ }
+
+ if (state === GenStateCompleted) {
+ if (method === "throw") {
+ throw arg;
+ }
+
+ // Be forgiving, per 25.3.3.3.3 of the spec:
+ // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume
+ return doneResult();
+ }
+
+ context.method = method;
+ context.arg = arg;
+
+ while (true) {
+ var delegate = context.delegate;
+ if (delegate) {
+ var delegateResult = maybeInvokeDelegate(delegate, context);
+ if (delegateResult) {
+ if (delegateResult === ContinueSentinel) continue;
+ return delegateResult;
+ }
+ }
+
+ if (context.method === "next") {
+ // Setting context._sent for legacy support of Babel's
+ // function.sent implementation.
+ context.sent = context._sent = context.arg;
+
+ } else if (context.method === "throw") {
+ if (state === GenStateSuspendedStart) {
+ state = GenStateCompleted;
+ throw context.arg;
+ }
+
+ context.dispatchException(context.arg);
+
+ } else if (context.method === "return") {
+ context.abrupt("return", context.arg);
+ }
+
+ state = GenStateExecuting;
+
+ var record = tryCatch(innerFn, self, context);
+ if (record.type === "normal") {
+ // If an exception is thrown from innerFn, we leave state ===
+ // GenStateExecuting and loop back for another invocation.
+ state = context.done
+ ? GenStateCompleted
+ : GenStateSuspendedYield;
+
+ if (record.arg === ContinueSentinel) {
+ continue;
+ }
+
+ return {
+ value: record.arg,
+ done: context.done
+ };
+
+ } else if (record.type === "throw") {
+ state = GenStateCompleted;
+ // Dispatch the exception by looping back around to the
+ // context.dispatchException(context.arg) call above.
+ context.method = "throw";
+ context.arg = record.arg;
+ }
+ }
+ };
+ }
+
+ // Call delegate.iterator[context.method](context.arg) and handle the
+ // result, either by returning a { value, done } result from the
+ // delegate iterator, or by modifying context.method and context.arg,
+ // setting context.delegate to null, and returning the ContinueSentinel.
+ function maybeInvokeDelegate(delegate, context) {
+ var method = delegate.iterator[context.method];
+ if (method === undefined) {
+ // A .throw or .return when the delegate iterator has no .throw
+ // method always terminates the yield* loop.
+ context.delegate = null;
+
+ if (context.method === "throw") {
+ if (delegate.iterator.return) {
+ // If the delegate iterator has a return method, give it a
+ // chance to clean up.
+ context.method = "return";
+ context.arg = undefined;
+ maybeInvokeDelegate(delegate, context);
+
+ if (context.method === "throw") {
+ // If maybeInvokeDelegate(context) changed context.method from
+ // "return" to "throw", let that override the TypeError below.
+ return ContinueSentinel;
+ }
+ }
+
+ context.method = "throw";
+ context.arg = new TypeError(
+ "The iterator does not provide a 'throw' method");
+ }
+
+ return ContinueSentinel;
+ }
+
+ var record = tryCatch(method, delegate.iterator, context.arg);
+
+ if (record.type === "throw") {
+ context.method = "throw";
+ context.arg = record.arg;
+ context.delegate = null;
+ return ContinueSentinel;
+ }
+
+ var info = record.arg;
+
+ if (! info) {
+ context.method = "throw";
+ context.arg = new TypeError("iterator result is not an object");
+ context.delegate = null;
+ return ContinueSentinel;
+ }
+
+ if (info.done) {
+ // Assign the result of the finished delegate to the temporary
+ // variable specified by delegate.resultName (see delegateYield).
+ context[delegate.resultName] = info.value;
+
+ // Resume execution at the desired location (see delegateYield).
+ context.next = delegate.nextLoc;
+
+ // If context.method was "throw" but the delegate handled the
+ // exception, let the outer generator proceed normally. If
+ // context.method was "next", forget context.arg since it has been
+ // "consumed" by the delegate iterator. If context.method was
+ // "return", allow the original .return call to continue in the
+ // outer generator.
+ if (context.method !== "return") {
+ context.method = "next";
+ context.arg = undefined;
+ }
+
+ } else {
+ // Re-yield the result returned by the delegate method.
+ return info;
+ }
+
+ // The delegate iterator is finished, so forget it and continue with
+ // the outer generator.
+ context.delegate = null;
+ return ContinueSentinel;
+ }
+
+ // Define Generator.prototype.{next,throw,return} in terms of the
+ // unified ._invoke helper method.
+ defineIteratorMethods(Gp);
+
+ Gp[toStringTagSymbol] = "Generator";
+
+ // A Generator should always return itself as the iterator object when the
+ // @@iterator function is called on it. Some browsers' implementations of the
+ // iterator prototype chain incorrectly implement this, causing the Generator
+ // object to not be returned from this call. This ensures that doesn't happen.
+ // See https://github.com/facebook/regenerator/issues/274 for more details.
+ Gp[iteratorSymbol] = function() {
+ return this;
+ };
+
+ Gp.toString = function() {
+ return "[object Generator]";
+ };
+
+ function pushTryEntry(locs) {
+ var entry = { tryLoc: locs[0] };
+
+ if (1 in locs) {
+ entry.catchLoc = locs[1];
+ }
+
+ if (2 in locs) {
+ entry.finallyLoc = locs[2];
+ entry.afterLoc = locs[3];
+ }
+
+ this.tryEntries.push(entry);
+ }
+
+ function resetTryEntry(entry) {
+ var record = entry.completion || {};
+ record.type = "normal";
+ delete record.arg;
+ entry.completion = record;
+ }
+
+ function Context(tryLocsList) {
+ // The root entry object (effectively a try statement without a catch
+ // or a finally block) gives us a place to store values thrown from
+ // locations where there is no enclosing try statement.
+ this.tryEntries = [{ tryLoc: "root" }];
+ tryLocsList.forEach(pushTryEntry, this);
+ this.reset(true);
+ }
+
+ runtime.keys = function(object) {
+ var keys = [];
+ for (var key in object) {
+ keys.push(key);
+ }
+ keys.reverse();
+
+ // Rather than returning an object with a next method, we keep
+ // things simple and return the next function itself.
+ return function next() {
+ while (keys.length) {
+ var key = keys.pop();
+ if (key in object) {
+ next.value = key;
+ next.done = false;
+ return next;
+ }
+ }
+
+ // To avoid creating an additional object, we just hang the .value
+ // and .done properties off the next function object itself. This
+ // also ensures that the minifier will not anonymize the function.
+ next.done = true;
+ return next;
+ };
+ };
+
+ function values(iterable) {
+ if (iterable) {
+ var iteratorMethod = iterable[iteratorSymbol];
+ if (iteratorMethod) {
+ return iteratorMethod.call(iterable);
+ }
+
+ if (typeof iterable.next === "function") {
+ return iterable;
+ }
+
+ if (!isNaN(iterable.length)) {
+ var i = -1, next = function next() {
+ while (++i < iterable.length) {
+ if (hasOwn.call(iterable, i)) {
+ next.value = iterable[i];
+ next.done = false;
+ return next;
+ }
+ }
+
+ next.value = undefined;
+ next.done = true;
+
+ return next;
+ };
+
+ return next.next = next;
+ }
+ }
+
+ // Return an iterator with no values.
+ return { next: doneResult };
+ }
+ runtime.values = values;
+
+ function doneResult() {
+ return { value: undefined, done: true };
+ }
+
+ Context.prototype = {
+ constructor: Context,
+
+ reset: function(skipTempReset) {
+ this.prev = 0;
+ this.next = 0;
+ // Resetting context._sent for legacy support of Babel's
+ // function.sent implementation.
+ this.sent = this._sent = undefined;
+ this.done = false;
+ this.delegate = null;
+
+ this.method = "next";
+ this.arg = undefined;
+
+ this.tryEntries.forEach(resetTryEntry);
+
+ if (!skipTempReset) {
+ for (var name in this) {
+ // Not sure about the optimal order of these conditions:
+ if (name.charAt(0) === "t" &&
+ hasOwn.call(this, name) &&
+ !isNaN(+name.slice(1))) {
+ this[name] = undefined;
+ }
+ }
+ }
+ },
+
+ stop: function() {
+ this.done = true;
+
+ var rootEntry = this.tryEntries[0];
+ var rootRecord = rootEntry.completion;
+ if (rootRecord.type === "throw") {
+ throw rootRecord.arg;
+ }
+
+ return this.rval;
+ },
+
+ dispatchException: function(exception) {
+ if (this.done) {
+ throw exception;
+ }
+
+ var context = this;
+ function handle(loc, caught) {
+ record.type = "throw";
+ record.arg = exception;
+ context.next = loc;
+
+ if (caught) {
+ // If the dispatched exception was caught by a catch block,
+ // then let that catch block handle the exception normally.
+ context.method = "next";
+ context.arg = undefined;
+ }
+
+ return !! caught;
+ }
+
+ for (var i = this.tryEntries.length - 1; i >= 0; --i) {
+ var entry = this.tryEntries[i];
+ var record = entry.completion;
+
+ if (entry.tryLoc === "root") {
+ // Exception thrown outside of any try block that could handle
+ // it, so set the completion value of the entire function to
+ // throw the exception.
+ return handle("end");
+ }
+
+ if (entry.tryLoc <= this.prev) {
+ var hasCatch = hasOwn.call(entry, "catchLoc");
+ var hasFinally = hasOwn.call(entry, "finallyLoc");
+
+ if (hasCatch && hasFinally) {
+ if (this.prev < entry.catchLoc) {
+ return handle(entry.catchLoc, true);
+ } else if (this.prev < entry.finallyLoc) {
+ return handle(entry.finallyLoc);
+ }
+
+ } else if (hasCatch) {
+ if (this.prev < entry.catchLoc) {
+ return handle(entry.catchLoc, true);
+ }
+
+ } else if (hasFinally) {
+ if (this.prev < entry.finallyLoc) {
+ return handle(entry.finallyLoc);
+ }
+
+ } else {
+ throw new Error("try statement without catch or finally");
+ }
+ }
+ }
+ },
+
+ abrupt: function(type, arg) {
+ for (var i = this.tryEntries.length - 1; i >= 0; --i) {
+ var entry = this.tryEntries[i];
+ if (entry.tryLoc <= this.prev &&
+ hasOwn.call(entry, "finallyLoc") &&
+ this.prev < entry.finallyLoc) {
+ var finallyEntry = entry;
+ break;
+ }
+ }
+
+ if (finallyEntry &&
+ (type === "break" ||
+ type === "continue") &&
+ finallyEntry.tryLoc <= arg &&
+ arg <= finallyEntry.finallyLoc) {
+ // Ignore the finally entry if control is not jumping to a
+ // location outside the try/catch block.
+ finallyEntry = null;
+ }
+
+ var record = finallyEntry ? finallyEntry.completion : {};
+ record.type = type;
+ record.arg = arg;
+
+ if (finallyEntry) {
+ this.method = "next";
+ this.next = finallyEntry.finallyLoc;
+ return ContinueSentinel;
+ }
+
+ return this.complete(record);
+ },
+
+ complete: function(record, afterLoc) {
+ if (record.type === "throw") {
+ throw record.arg;
+ }
+
+ if (record.type === "break" ||
+ record.type === "continue") {
+ this.next = record.arg;
+ } else if (record.type === "return") {
+ this.rval = this.arg = record.arg;
+ this.method = "return";
+ this.next = "end";
+ } else if (record.type === "normal" && afterLoc) {
+ this.next = afterLoc;
+ }
+
+ return ContinueSentinel;
+ },
+
+ finish: function(finallyLoc) {
+ for (var i = this.tryEntries.length - 1; i >= 0; --i) {
+ var entry = this.tryEntries[i];
+ if (entry.finallyLoc === finallyLoc) {
+ this.complete(entry.completion, entry.afterLoc);
+ resetTryEntry(entry);
+ return ContinueSentinel;
+ }
+ }
+ },
+
+ "catch": function(tryLoc) {
+ for (var i = this.tryEntries.length - 1; i >= 0; --i) {
+ var entry = this.tryEntries[i];
+ if (entry.tryLoc === tryLoc) {
+ var record = entry.completion;
+ if (record.type === "throw") {
+ var thrown = record.arg;
+ resetTryEntry(entry);
+ }
+ return thrown;
+ }
+ }
+
+ // The context.catch method must only be called with a location
+ // argument that corresponds to a known catch block.
+ throw new Error("illegal catch attempt");
+ },
+
+ delegateYield: function(iterable, resultName, nextLoc) {
+ this.delegate = {
+ iterator: values(iterable),
+ resultName: resultName,
+ nextLoc: nextLoc
+ };
+
+ if (this.method === "next") {
+ // Deliberately forget the last sent value so that we don't
+ // accidentally pass it on to the delegate.
+ this.arg = undefined;
+ }
+
+ return ContinueSentinel;
+ }
+ };
+ })(
+ // Among the various tricks for obtaining a reference to the global
+ // object, this seems to be the most reliable technique that does not
+ // use indirect eval (which violates Content Security Policy).
+ typeof global === "object" ? global :
+ typeof window === "object" ? window :
+ typeof self === "object" ? self : this
+ );
+
+ /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }())))
+
+/***/ }),
+/* 329 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ __webpack_require__(330);
+ module.exports = __webpack_require__(9).RegExp.escape;
+
+
+/***/ }),
+/* 330 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ // https://github.com/benjamingr/RexExp.escape
+ var $export = __webpack_require__(8);
+ var $re = __webpack_require__(331)(/[\\^$*+?.()|[\]{}]/g, '\\$&');
+
+ $export($export.S, 'RegExp', { escape: function escape(it) { return $re(it); } });
+
+
+/***/ }),
+/* 331 */
+/***/ (function(module, exports) {
+
+ module.exports = function (regExp, replace) {
+ var replacer = replace === Object(replace) ? function (part) {
+ return replace[part];
+ } : replace;
+ return function (it) {
+ return String(it).replace(regExp, replacer);
+ };
+ };
+
+
+/***/ }),
+/* 332 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ var BSON = __webpack_require__(333),
+ Binary = __webpack_require__(356),
+ Code = __webpack_require__(351),
+ DBRef = __webpack_require__(355),
+ Decimal128 = __webpack_require__(352),
+ Double = __webpack_require__(336),
+ Int32 = __webpack_require__(350),
+ Long = __webpack_require__(335),
+ Map = __webpack_require__(334),
+ MaxKey = __webpack_require__(354),
+ MinKey = __webpack_require__(353),
+ ObjectId = __webpack_require__(338),
+ BSONRegExp = __webpack_require__(348),
+ Symbol = __webpack_require__(349),
+ Timestamp = __webpack_require__(337);
+
+ // BSON MAX VALUES
+ BSON.BSON_INT32_MAX = 0x7fffffff;
+ BSON.BSON_INT32_MIN = -0x80000000;
+
+ BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1;
+ BSON.BSON_INT64_MIN = -Math.pow(2, 63);
+
+ // JS MAX PRECISE VALUES
+ BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+ BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+ // Add BSON types to function creation
+ BSON.Binary = Binary;
+ BSON.Code = Code;
+ BSON.DBRef = DBRef;
+ BSON.Decimal128 = Decimal128;
+ BSON.Double = Double;
+ BSON.Int32 = Int32;
+ BSON.Long = Long;
+ BSON.Map = Map;
+ BSON.MaxKey = MaxKey;
+ BSON.MinKey = MinKey;
+ BSON.ObjectId = ObjectId;
+ BSON.ObjectID = ObjectId;
+ BSON.BSONRegExp = BSONRegExp;
+ BSON.Symbol = Symbol;
+ BSON.Timestamp = Timestamp;
+
+ // Return the BSON
+ module.exports = BSON;
+
+/***/ }),
+/* 333 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var Map = __webpack_require__(334),
+ Long = __webpack_require__(335),
+ Double = __webpack_require__(336),
+ Timestamp = __webpack_require__(337),
+ ObjectID = __webpack_require__(338),
+ BSONRegExp = __webpack_require__(348),
+ Symbol = __webpack_require__(349),
+ Int32 = __webpack_require__(350),
+ Code = __webpack_require__(351),
+ Decimal128 = __webpack_require__(352),
+ MinKey = __webpack_require__(353),
+ MaxKey = __webpack_require__(354),
+ DBRef = __webpack_require__(355),
+ Binary = __webpack_require__(356);
+
+ // Parts of the parser
+ var deserialize = __webpack_require__(357),
+ serializer = __webpack_require__(358),
+ calculateObjectSize = __webpack_require__(360),
+ utils = __webpack_require__(344);
+
+ /**
+ * @ignore
+ * @api private
+ */
+ // Default Max Size
+ var MAXSIZE = 1024 * 1024 * 17;
+
+ // Current Internal Temporary Serialization Buffer
+ var buffer = utils.allocBuffer(MAXSIZE);
+
+ var BSON = function () {};
+
+ /**
+ * Serialize a Javascript object.
+ *
+ * @param {Object} object the Javascript object to serialize.
+ * @param {Boolean} [options.checkKeys] the serializer will check if keys are valid.
+ * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**.
+ * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**.
+ * @param {Number} [options.minInternalBufferSize=1024*1024*17] minimum size of the internal temporary serialization buffer **(default:1024*1024*17)**.
+ * @return {Buffer} returns the Buffer object containing the serialized object.
+ * @api public
+ */
+ BSON.prototype.serialize = function serialize(object, options) {
+ options = options || {};
+ // Unpack the options
+ var checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false;
+ var serializeFunctions = typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
+ var ignoreUndefined = typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true;
+ var minInternalBufferSize = typeof options.minInternalBufferSize === 'number' ? options.minInternalBufferSize : MAXSIZE;
+
+ // Resize the internal serialization buffer if needed
+ if (buffer.length < minInternalBufferSize) {
+ buffer = utils.allocBuffer(minInternalBufferSize);
+ }
+
+ // Attempt to serialize
+ var serializationIndex = serializer(buffer, object, checkKeys, 0, 0, serializeFunctions, ignoreUndefined, []);
+ // Create the final buffer
+ var finishedBuffer = utils.allocBuffer(serializationIndex);
+ // Copy into the finished buffer
+ buffer.copy(finishedBuffer, 0, 0, finishedBuffer.length);
+ // Return the buffer
+ return finishedBuffer;
+ };
+
+ /**
+ * Serialize a Javascript object using a predefined Buffer and index into the buffer, useful when pre-allocating the space for serialization.
+ *
+ * @param {Object} object the Javascript object to serialize.
+ * @param {Buffer} buffer the Buffer you pre-allocated to store the serialized BSON object.
+ * @param {Boolean} [options.checkKeys] the serializer will check if keys are valid.
+ * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**.
+ * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**.
+ * @param {Number} [options.index] the index in the buffer where we wish to start serializing into.
+ * @return {Number} returns the index pointing to the last written byte in the buffer.
+ * @api public
+ */
+ BSON.prototype.serializeWithBufferAndIndex = function (object, finalBuffer, options) {
+ options = options || {};
+ // Unpack the options
+ var checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false;
+ var serializeFunctions = typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
+ var ignoreUndefined = typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true;
+ var startIndex = typeof options.index === 'number' ? options.index : 0;
+
+ // Attempt to serialize
+ var serializationIndex = serializer(finalBuffer, object, checkKeys, startIndex || 0, 0, serializeFunctions, ignoreUndefined);
+
+ // Return the index
+ return serializationIndex - 1;
+ };
+
+ /**
+ * Deserialize data as BSON.
+ *
+ * @param {Buffer} buffer the buffer containing the serialized set of BSON documents.
+ * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized.
+ * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse.
+ * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function.
+ * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits
+ * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a node.js Buffer instance.
+ * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types.
+ * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer.
+ * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances.
+ * @return {Object} returns the deserialized Javascript Object.
+ * @api public
+ */
+ BSON.prototype.deserialize = function (buffer, options) {
+ return deserialize(buffer, options);
+ };
+
+ /**
+ * Calculate the bson size for a passed in Javascript object.
+ *
+ * @param {Object} object the Javascript object to calculate the BSON byte size for.
+ * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**.
+ * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**.
+ * @return {Number} returns the number of bytes the BSON object will take up.
+ * @api public
+ */
+ BSON.prototype.calculateObjectSize = function (object, options) {
+ options = options || {};
+
+ var serializeFunctions = typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
+ var ignoreUndefined = typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true;
+
+ return calculateObjectSize(object, serializeFunctions, ignoreUndefined);
+ };
+
+ /**
+ * Deserialize stream data as BSON documents.
+ *
+ * @param {Buffer} data the buffer containing the serialized set of BSON documents.
+ * @param {Number} startIndex the start index in the data Buffer where the deserialization is to start.
+ * @param {Number} numberOfDocuments number of documents to deserialize.
+ * @param {Array} documents an array where to store the deserialized documents.
+ * @param {Number} docStartIndex the index in the documents array from where to start inserting documents.
+ * @param {Object} [options] additional options used for the deserialization.
+ * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized.
+ * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse.
+ * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function.
+ * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits
+ * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a node.js Buffer instance.
+ * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types.
+ * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer.
+ * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances.
+ * @return {Number} returns the next index in the buffer after deserialization **x** numbers of documents.
+ * @api public
+ */
+ BSON.prototype.deserializeStream = function (data, startIndex, numberOfDocuments, documents, docStartIndex, options) {
+ options = options != null ? options : {};
+ var index = startIndex;
+ // Loop over all documents
+ for (var i = 0; i < numberOfDocuments; i++) {
+ // Find size of the document
+ var size = data[index] | data[index + 1] << 8 | data[index + 2] << 16 | data[index + 3] << 24;
+ // Update options with index
+ options['index'] = index;
+ // Parse the document at this point
+ documents[docStartIndex + i] = this.deserialize(data, options);
+ // Adjust index by the document size
+ index = index + size;
+ }
+
+ // Return object containing end index of parsing and list of documents
+ return index;
+ };
+
+ /**
+ * @ignore
+ * @api private
+ */
+ // BSON MAX VALUES
+ BSON.BSON_INT32_MAX = 0x7fffffff;
+ BSON.BSON_INT32_MIN = -0x80000000;
+
+ BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1;
+ BSON.BSON_INT64_MIN = -Math.pow(2, 63);
+
+ // JS MAX PRECISE VALUES
+ BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+ BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+ // Internal long versions
+ // var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double.
+ // var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double.
+
+ /**
+ * Number BSON Type
+ *
+ * @classconstant BSON_DATA_NUMBER
+ **/
+ BSON.BSON_DATA_NUMBER = 1;
+ /**
+ * String BSON Type
+ *
+ * @classconstant BSON_DATA_STRING
+ **/
+ BSON.BSON_DATA_STRING = 2;
+ /**
+ * Object BSON Type
+ *
+ * @classconstant BSON_DATA_OBJECT
+ **/
+ BSON.BSON_DATA_OBJECT = 3;
+ /**
+ * Array BSON Type
+ *
+ * @classconstant BSON_DATA_ARRAY
+ **/
+ BSON.BSON_DATA_ARRAY = 4;
+ /**
+ * Binary BSON Type
+ *
+ * @classconstant BSON_DATA_BINARY
+ **/
+ BSON.BSON_DATA_BINARY = 5;
+ /**
+ * ObjectID BSON Type
+ *
+ * @classconstant BSON_DATA_OID
+ **/
+ BSON.BSON_DATA_OID = 7;
+ /**
+ * Boolean BSON Type
+ *
+ * @classconstant BSON_DATA_BOOLEAN
+ **/
+ BSON.BSON_DATA_BOOLEAN = 8;
+ /**
+ * Date BSON Type
+ *
+ * @classconstant BSON_DATA_DATE
+ **/
+ BSON.BSON_DATA_DATE = 9;
+ /**
+ * null BSON Type
+ *
+ * @classconstant BSON_DATA_NULL
+ **/
+ BSON.BSON_DATA_NULL = 10;
+ /**
+ * RegExp BSON Type
+ *
+ * @classconstant BSON_DATA_REGEXP
+ **/
+ BSON.BSON_DATA_REGEXP = 11;
+ /**
+ * Code BSON Type
+ *
+ * @classconstant BSON_DATA_CODE
+ **/
+ BSON.BSON_DATA_CODE = 13;
+ /**
+ * Symbol BSON Type
+ *
+ * @classconstant BSON_DATA_SYMBOL
+ **/
+ BSON.BSON_DATA_SYMBOL = 14;
+ /**
+ * Code with Scope BSON Type
+ *
+ * @classconstant BSON_DATA_CODE_W_SCOPE
+ **/
+ BSON.BSON_DATA_CODE_W_SCOPE = 15;
+ /**
+ * 32 bit Integer BSON Type
+ *
+ * @classconstant BSON_DATA_INT
+ **/
+ BSON.BSON_DATA_INT = 16;
+ /**
+ * Timestamp BSON Type
+ *
+ * @classconstant BSON_DATA_TIMESTAMP
+ **/
+ BSON.BSON_DATA_TIMESTAMP = 17;
+ /**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_LONG
+ **/
+ BSON.BSON_DATA_LONG = 18;
+ /**
+ * MinKey BSON Type
+ *
+ * @classconstant BSON_DATA_MIN_KEY
+ **/
+ BSON.BSON_DATA_MIN_KEY = 0xff;
+ /**
+ * MaxKey BSON Type
+ *
+ * @classconstant BSON_DATA_MAX_KEY
+ **/
+ BSON.BSON_DATA_MAX_KEY = 0x7f;
+
+ /**
+ * Binary Default Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_DEFAULT
+ **/
+ BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0;
+ /**
+ * Binary Function Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_FUNCTION
+ **/
+ BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1;
+ /**
+ * Binary Byte Array Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY
+ **/
+ BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2;
+ /**
+ * Binary UUID Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_UUID
+ **/
+ BSON.BSON_BINARY_SUBTYPE_UUID = 3;
+ /**
+ * Binary MD5 Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_MD5
+ **/
+ BSON.BSON_BINARY_SUBTYPE_MD5 = 4;
+ /**
+ * Binary User Defined Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED
+ **/
+ BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128;
+
+ // Return BSON
+ module.exports = BSON;
+ module.exports.Code = Code;
+ module.exports.Map = Map;
+ module.exports.Symbol = Symbol;
+ module.exports.BSON = BSON;
+ module.exports.DBRef = DBRef;
+ module.exports.Binary = Binary;
+ module.exports.ObjectID = ObjectID;
+ module.exports.Long = Long;
+ module.exports.Timestamp = Timestamp;
+ module.exports.Double = Double;
+ module.exports.Int32 = Int32;
+ module.exports.MinKey = MinKey;
+ module.exports.MaxKey = MaxKey;
+ module.exports.BSONRegExp = BSONRegExp;
+ module.exports.Decimal128 = Decimal128;
+
+/***/ }),
+/* 334 */
+/***/ (function(module, exports) {
+
+ /* WEBPACK VAR INJECTION */(function(global) {'use strict';
+
+ // We have an ES6 Map available, return the native instance
+
+ if (typeof global.Map !== 'undefined') {
+ module.exports = global.Map;
+ module.exports.Map = global.Map;
+ } else {
+ // We will return a polyfill
+ var Map = function (array) {
+ this._keys = [];
+ this._values = {};
+
+ for (var i = 0; i < array.length; i++) {
+ if (array[i] == null) continue; // skip null and undefined
+ var entry = array[i];
+ var key = entry[0];
+ var value = entry[1];
+ // Add the key to the list of keys in order
+ this._keys.push(key);
+ // Add the key and value to the values dictionary with a point
+ // to the location in the ordered keys list
+ this._values[key] = { v: value, i: this._keys.length - 1 };
+ }
+ };
+
+ Map.prototype.clear = function () {
+ this._keys = [];
+ this._values = {};
+ };
+
+ Map.prototype.delete = function (key) {
+ var value = this._values[key];
+ if (value == null) return false;
+ // Delete entry
+ delete this._values[key];
+ // Remove the key from the ordered keys list
+ this._keys.splice(value.i, 1);
+ return true;
+ };
+
+ Map.prototype.entries = function () {
+ var self = this;
+ var index = 0;
+
+ return {
+ next: function () {
+ var key = self._keys[index++];
+ return {
+ value: key !== undefined ? [key, self._values[key].v] : undefined,
+ done: key !== undefined ? false : true
+ };
+ }
+ };
+ };
+
+ Map.prototype.forEach = function (callback, self) {
+ self = self || this;
+
+ for (var i = 0; i < this._keys.length; i++) {
+ var key = this._keys[i];
+ // Call the forEach callback
+ callback.call(self, this._values[key].v, key, self);
+ }
+ };
+
+ Map.prototype.get = function (key) {
+ return this._values[key] ? this._values[key].v : undefined;
+ };
+
+ Map.prototype.has = function (key) {
+ return this._values[key] != null;
+ };
+
+ Map.prototype.keys = function () {
+ var self = this;
+ var index = 0;
+
+ return {
+ next: function () {
+ var key = self._keys[index++];
+ return {
+ value: key !== undefined ? key : undefined,
+ done: key !== undefined ? false : true
+ };
+ }
+ };
+ };
+
+ Map.prototype.set = function (key, value) {
+ if (this._values[key]) {
+ this._values[key].v = value;
+ return this;
+ }
+
+ // Add the key to the list of keys in order
+ this._keys.push(key);
+ // Add the key and value to the values dictionary with a point
+ // to the location in the ordered keys list
+ this._values[key] = { v: value, i: this._keys.length - 1 };
+ return this;
+ };
+
+ Map.prototype.values = function () {
+ var self = this;
+ var index = 0;
+
+ return {
+ next: function () {
+ var key = self._keys[index++];
+ return {
+ value: key !== undefined ? self._values[key].v : undefined,
+ done: key !== undefined ? false : true
+ };
+ }
+ };
+ };
+
+ // Last ismaster
+ Object.defineProperty(Map.prototype, 'size', {
+ enumerable: true,
+ get: function () {
+ return this._keys.length;
+ }
+ });
+
+ module.exports = Map;
+ module.exports.Map = Map;
+ }
+ /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }())))
+
+/***/ }),
+/* 335 */
+/***/ (function(module, exports) {
+
+ // Licensed under the Apache License, Version 2.0 (the "License");
+ // you may not use this file except in compliance with the License.
+ // You may obtain a copy of the License at
+ //
+ // http://www.apache.org/licenses/LICENSE-2.0
+ //
+ // Unless required by applicable law or agreed to in writing, software
+ // distributed under the License is distributed on an "AS IS" BASIS,
+ // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ // See the License for the specific language governing permissions and
+ // limitations under the License.
+ //
+ // Copyright 2009 Google Inc. All Rights Reserved
+
+ /**
+ * Defines a Long class for representing a 64-bit two's-complement
+ * integer value, which faithfully simulates the behavior of a Java "Long". This
+ * implementation is derived from LongLib in GWT.
+ *
+ * Constructs a 64-bit two's-complement integer, given its low and high 32-bit
+ * values as *signed* integers. See the from* functions below for more
+ * convenient ways of constructing Longs.
+ *
+ * The internal representation of a Long is the two given signed, 32-bit values.
+ * We use 32-bit pieces because these are the size of integers on which
+ * Javascript performs bit-operations. For operations like addition and
+ * multiplication, we split each number into 16-bit pieces, which can easily be
+ * multiplied within Javascript's floating-point representation without overflow
+ * or change in sign.
+ *
+ * In the algorithms below, we frequently reduce the negative case to the
+ * positive case by negating the input(s) and then post-processing the result.
+ * Note that we must ALWAYS check specially whether those values are MIN_VALUE
+ * (-2^63) because -MIN_VALUE == MIN_VALUE (since 2^63 cannot be represented as
+ * a positive number, it overflows back into a negative). Not handling this
+ * case would often result in infinite recursion.
+ *
+ * @class
+ * @param {number} low the low (signed) 32 bits of the Long.
+ * @param {number} high the high (signed) 32 bits of the Long.
+ * @return {Long}
+ */
+ function Long(low, high) {
+ if (!(this instanceof Long)) return new Long(low, high);
+
+ this._bsontype = 'Long';
+ /**
+ * @type {number}
+ * @ignore
+ */
+ this.low_ = low | 0; // force into 32 signed bits.
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ this.high_ = high | 0; // force into 32 signed bits.
+ }
+
+ /**
+ * Return the int value.
+ *
+ * @method
+ * @return {number} the value, assuming it is a 32-bit integer.
+ */
+ Long.prototype.toInt = function () {
+ return this.low_;
+ };
+
+ /**
+ * Return the Number value.
+ *
+ * @method
+ * @return {number} the closest floating-point representation to this value.
+ */
+ Long.prototype.toNumber = function () {
+ return this.high_ * Long.TWO_PWR_32_DBL_ + this.getLowBitsUnsigned();
+ };
+
+ /**
+ * Return the JSON value.
+ *
+ * @method
+ * @return {string} the JSON representation.
+ */
+ Long.prototype.toJSON = function () {
+ return this.toString();
+ };
+
+ /**
+ * Return the String value.
+ *
+ * @method
+ * @param {number} [opt_radix] the radix in which the text should be written.
+ * @return {string} the textual representation of this value.
+ */
+ Long.prototype.toString = function (opt_radix) {
+ var radix = opt_radix || 10;
+ if (radix < 2 || 36 < radix) {
+ throw Error('radix out of range: ' + radix);
+ }
+
+ if (this.isZero()) {
+ return '0';
+ }
+
+ if (this.isNegative()) {
+ if (this.equals(Long.MIN_VALUE)) {
+ // We need to change the Long value before it can be negated, so we remove
+ // the bottom-most digit in this base and then recurse to do the rest.
+ var radixLong = Long.fromNumber(radix);
+ var div = this.div(radixLong);
+ var rem = div.multiply(radixLong).subtract(this);
+ return div.toString(radix) + rem.toInt().toString(radix);
+ } else {
+ return '-' + this.negate().toString(radix);
+ }
+ }
+
+ // Do several (6) digits each time through the loop, so as to
+ // minimize the calls to the very expensive emulated div.
+ var radixToPower = Long.fromNumber(Math.pow(radix, 6));
+
+ rem = this;
+ var result = '';
+
+ while (!rem.isZero()) {
+ var remDiv = rem.div(radixToPower);
+ var intval = rem.subtract(remDiv.multiply(radixToPower)).toInt();
+ var digits = intval.toString(radix);
+
+ rem = remDiv;
+ if (rem.isZero()) {
+ return digits + result;
+ } else {
+ while (digits.length < 6) {
+ digits = '0' + digits;
+ }
+ result = '' + digits + result;
+ }
+ }
+ };
+
+ /**
+ * Return the high 32-bits value.
+ *
+ * @method
+ * @return {number} the high 32-bits as a signed value.
+ */
+ Long.prototype.getHighBits = function () {
+ return this.high_;
+ };
+
+ /**
+ * Return the low 32-bits value.
+ *
+ * @method
+ * @return {number} the low 32-bits as a signed value.
+ */
+ Long.prototype.getLowBits = function () {
+ return this.low_;
+ };
+
+ /**
+ * Return the low unsigned 32-bits value.
+ *
+ * @method
+ * @return {number} the low 32-bits as an unsigned value.
+ */
+ Long.prototype.getLowBitsUnsigned = function () {
+ return this.low_ >= 0 ? this.low_ : Long.TWO_PWR_32_DBL_ + this.low_;
+ };
+
+ /**
+ * Returns the number of bits needed to represent the absolute value of this Long.
+ *
+ * @method
+ * @return {number} Returns the number of bits needed to represent the absolute value of this Long.
+ */
+ Long.prototype.getNumBitsAbs = function () {
+ if (this.isNegative()) {
+ if (this.equals(Long.MIN_VALUE)) {
+ return 64;
+ } else {
+ return this.negate().getNumBitsAbs();
+ }
+ } else {
+ var val = this.high_ !== 0 ? this.high_ : this.low_;
+ for (var bit = 31; bit > 0; bit--) {
+ if ((val & 1 << bit) !== 0) {
+ break;
+ }
+ }
+ return this.high_ !== 0 ? bit + 33 : bit + 1;
+ }
+ };
+
+ /**
+ * Return whether this value is zero.
+ *
+ * @method
+ * @return {boolean} whether this value is zero.
+ */
+ Long.prototype.isZero = function () {
+ return this.high_ === 0 && this.low_ === 0;
+ };
+
+ /**
+ * Return whether this value is negative.
+ *
+ * @method
+ * @return {boolean} whether this value is negative.
+ */
+ Long.prototype.isNegative = function () {
+ return this.high_ < 0;
+ };
+
+ /**
+ * Return whether this value is odd.
+ *
+ * @method
+ * @return {boolean} whether this value is odd.
+ */
+ Long.prototype.isOdd = function () {
+ return (this.low_ & 1) === 1;
+ };
+
+ /**
+ * Return whether this Long equals the other
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long equals the other
+ */
+ Long.prototype.equals = function (other) {
+ return this.high_ === other.high_ && this.low_ === other.low_;
+ };
+
+ /**
+ * Return whether this Long does not equal the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long does not equal the other.
+ */
+ Long.prototype.notEquals = function (other) {
+ return this.high_ !== other.high_ || this.low_ !== other.low_;
+ };
+
+ /**
+ * Return whether this Long is less than the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long is less than the other.
+ */
+ Long.prototype.lessThan = function (other) {
+ return this.compare(other) < 0;
+ };
+
+ /**
+ * Return whether this Long is less than or equal to the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long is less than or equal to the other.
+ */
+ Long.prototype.lessThanOrEqual = function (other) {
+ return this.compare(other) <= 0;
+ };
+
+ /**
+ * Return whether this Long is greater than the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long is greater than the other.
+ */
+ Long.prototype.greaterThan = function (other) {
+ return this.compare(other) > 0;
+ };
+
+ /**
+ * Return whether this Long is greater than or equal to the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long is greater than or equal to the other.
+ */
+ Long.prototype.greaterThanOrEqual = function (other) {
+ return this.compare(other) >= 0;
+ };
+
+ /**
+ * Compares this Long with the given one.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} 0 if they are the same, 1 if the this is greater, and -1 if the given one is greater.
+ */
+ Long.prototype.compare = function (other) {
+ if (this.equals(other)) {
+ return 0;
+ }
+
+ var thisNeg = this.isNegative();
+ var otherNeg = other.isNegative();
+ if (thisNeg && !otherNeg) {
+ return -1;
+ }
+ if (!thisNeg && otherNeg) {
+ return 1;
+ }
+
+ // at this point, the signs are the same, so subtraction will not overflow
+ if (this.subtract(other).isNegative()) {
+ return -1;
+ } else {
+ return 1;
+ }
+ };
+
+ /**
+ * The negation of this value.
+ *
+ * @method
+ * @return {Long} the negation of this value.
+ */
+ Long.prototype.negate = function () {
+ if (this.equals(Long.MIN_VALUE)) {
+ return Long.MIN_VALUE;
+ } else {
+ return this.not().add(Long.ONE);
+ }
+ };
+
+ /**
+ * Returns the sum of this and the given Long.
+ *
+ * @method
+ * @param {Long} other Long to add to this one.
+ * @return {Long} the sum of this and the given Long.
+ */
+ Long.prototype.add = function (other) {
+ // Divide each number into 4 chunks of 16 bits, and then sum the chunks.
+
+ var a48 = this.high_ >>> 16;
+ var a32 = this.high_ & 0xffff;
+ var a16 = this.low_ >>> 16;
+ var a00 = this.low_ & 0xffff;
+
+ var b48 = other.high_ >>> 16;
+ var b32 = other.high_ & 0xffff;
+ var b16 = other.low_ >>> 16;
+ var b00 = other.low_ & 0xffff;
+
+ var c48 = 0,
+ c32 = 0,
+ c16 = 0,
+ c00 = 0;
+ c00 += a00 + b00;
+ c16 += c00 >>> 16;
+ c00 &= 0xffff;
+ c16 += a16 + b16;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c32 += a32 + b32;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c48 += a48 + b48;
+ c48 &= 0xffff;
+ return Long.fromBits(c16 << 16 | c00, c48 << 16 | c32);
+ };
+
+ /**
+ * Returns the difference of this and the given Long.
+ *
+ * @method
+ * @param {Long} other Long to subtract from this.
+ * @return {Long} the difference of this and the given Long.
+ */
+ Long.prototype.subtract = function (other) {
+ return this.add(other.negate());
+ };
+
+ /**
+ * Returns the product of this and the given Long.
+ *
+ * @method
+ * @param {Long} other Long to multiply with this.
+ * @return {Long} the product of this and the other.
+ */
+ Long.prototype.multiply = function (other) {
+ if (this.isZero()) {
+ return Long.ZERO;
+ } else if (other.isZero()) {
+ return Long.ZERO;
+ }
+
+ if (this.equals(Long.MIN_VALUE)) {
+ return other.isOdd() ? Long.MIN_VALUE : Long.ZERO;
+ } else if (other.equals(Long.MIN_VALUE)) {
+ return this.isOdd() ? Long.MIN_VALUE : Long.ZERO;
+ }
+
+ if (this.isNegative()) {
+ if (other.isNegative()) {
+ return this.negate().multiply(other.negate());
+ } else {
+ return this.negate().multiply(other).negate();
+ }
+ } else if (other.isNegative()) {
+ return this.multiply(other.negate()).negate();
+ }
+
+ // If both Longs are small, use float multiplication
+ if (this.lessThan(Long.TWO_PWR_24_) && other.lessThan(Long.TWO_PWR_24_)) {
+ return Long.fromNumber(this.toNumber() * other.toNumber());
+ }
+
+ // Divide each Long into 4 chunks of 16 bits, and then add up 4x4 products.
+ // We can skip products that would overflow.
+
+ var a48 = this.high_ >>> 16;
+ var a32 = this.high_ & 0xffff;
+ var a16 = this.low_ >>> 16;
+ var a00 = this.low_ & 0xffff;
+
+ var b48 = other.high_ >>> 16;
+ var b32 = other.high_ & 0xffff;
+ var b16 = other.low_ >>> 16;
+ var b00 = other.low_ & 0xffff;
+
+ var c48 = 0,
+ c32 = 0,
+ c16 = 0,
+ c00 = 0;
+ c00 += a00 * b00;
+ c16 += c00 >>> 16;
+ c00 &= 0xffff;
+ c16 += a16 * b00;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c16 += a00 * b16;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c32 += a32 * b00;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c32 += a16 * b16;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c32 += a00 * b32;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c48 += a48 * b00 + a32 * b16 + a16 * b32 + a00 * b48;
+ c48 &= 0xffff;
+ return Long.fromBits(c16 << 16 | c00, c48 << 16 | c32);
+ };
+
+ /**
+ * Returns this Long divided by the given one.
+ *
+ * @method
+ * @param {Long} other Long by which to divide.
+ * @return {Long} this Long divided by the given one.
+ */
+ Long.prototype.div = function (other) {
+ if (other.isZero()) {
+ throw Error('division by zero');
+ } else if (this.isZero()) {
+ return Long.ZERO;
+ }
+
+ if (this.equals(Long.MIN_VALUE)) {
+ if (other.equals(Long.ONE) || other.equals(Long.NEG_ONE)) {
+ return Long.MIN_VALUE; // recall that -MIN_VALUE == MIN_VALUE
+ } else if (other.equals(Long.MIN_VALUE)) {
+ return Long.ONE;
+ } else {
+ // At this point, we have |other| >= 2, so |this/other| < |MIN_VALUE|.
+ var halfThis = this.shiftRight(1);
+ var approx = halfThis.div(other).shiftLeft(1);
+ if (approx.equals(Long.ZERO)) {
+ return other.isNegative() ? Long.ONE : Long.NEG_ONE;
+ } else {
+ var rem = this.subtract(other.multiply(approx));
+ var result = approx.add(rem.div(other));
+ return result;
+ }
+ }
+ } else if (other.equals(Long.MIN_VALUE)) {
+ return Long.ZERO;
+ }
+
+ if (this.isNegative()) {
+ if (other.isNegative()) {
+ return this.negate().div(other.negate());
+ } else {
+ return this.negate().div(other).negate();
+ }
+ } else if (other.isNegative()) {
+ return this.div(other.negate()).negate();
+ }
+
+ // Repeat the following until the remainder is less than other: find a
+ // floating-point that approximates remainder / other *from below*, add this
+ // into the result, and subtract it from the remainder. It is critical that
+ // the approximate value is less than or equal to the real value so that the
+ // remainder never becomes negative.
+ var res = Long.ZERO;
+ rem = this;
+ while (rem.greaterThanOrEqual(other)) {
+ // Approximate the result of division. This may be a little greater or
+ // smaller than the actual value.
+ approx = Math.max(1, Math.floor(rem.toNumber() / other.toNumber()));
+
+ // We will tweak the approximate result by changing it in the 48-th digit or
+ // the smallest non-fractional digit, whichever is larger.
+ var log2 = Math.ceil(Math.log(approx) / Math.LN2);
+ var delta = log2 <= 48 ? 1 : Math.pow(2, log2 - 48);
+
+ // Decrease the approximation until it is smaller than the remainder. Note
+ // that if it is too large, the product overflows and is negative.
+ var approxRes = Long.fromNumber(approx);
+ var approxRem = approxRes.multiply(other);
+ while (approxRem.isNegative() || approxRem.greaterThan(rem)) {
+ approx -= delta;
+ approxRes = Long.fromNumber(approx);
+ approxRem = approxRes.multiply(other);
+ }
+
+ // We know the answer can't be zero... and actually, zero would cause
+ // infinite recursion since we would make no progress.
+ if (approxRes.isZero()) {
+ approxRes = Long.ONE;
+ }
+
+ res = res.add(approxRes);
+ rem = rem.subtract(approxRem);
+ }
+ return res;
+ };
+
+ /**
+ * Returns this Long modulo the given one.
+ *
+ * @method
+ * @param {Long} other Long by which to mod.
+ * @return {Long} this Long modulo the given one.
+ */
+ Long.prototype.modulo = function (other) {
+ return this.subtract(this.div(other).multiply(other));
+ };
+
+ /**
+ * The bitwise-NOT of this value.
+ *
+ * @method
+ * @return {Long} the bitwise-NOT of this value.
+ */
+ Long.prototype.not = function () {
+ return Long.fromBits(~this.low_, ~this.high_);
+ };
+
+ /**
+ * Returns the bitwise-AND of this Long and the given one.
+ *
+ * @method
+ * @param {Long} other the Long with which to AND.
+ * @return {Long} the bitwise-AND of this and the other.
+ */
+ Long.prototype.and = function (other) {
+ return Long.fromBits(this.low_ & other.low_, this.high_ & other.high_);
+ };
+
+ /**
+ * Returns the bitwise-OR of this Long and the given one.
+ *
+ * @method
+ * @param {Long} other the Long with which to OR.
+ * @return {Long} the bitwise-OR of this and the other.
+ */
+ Long.prototype.or = function (other) {
+ return Long.fromBits(this.low_ | other.low_, this.high_ | other.high_);
+ };
+
+ /**
+ * Returns the bitwise-XOR of this Long and the given one.
+ *
+ * @method
+ * @param {Long} other the Long with which to XOR.
+ * @return {Long} the bitwise-XOR of this and the other.
+ */
+ Long.prototype.xor = function (other) {
+ return Long.fromBits(this.low_ ^ other.low_, this.high_ ^ other.high_);
+ };
+
+ /**
+ * Returns this Long with bits shifted to the left by the given amount.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Long} this shifted to the left by the given amount.
+ */
+ Long.prototype.shiftLeft = function (numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var low = this.low_;
+ if (numBits < 32) {
+ var high = this.high_;
+ return Long.fromBits(low << numBits, high << numBits | low >>> 32 - numBits);
+ } else {
+ return Long.fromBits(0, low << numBits - 32);
+ }
+ }
+ };
+
+ /**
+ * Returns this Long with bits shifted to the right by the given amount.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Long} this shifted to the right by the given amount.
+ */
+ Long.prototype.shiftRight = function (numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var high = this.high_;
+ if (numBits < 32) {
+ var low = this.low_;
+ return Long.fromBits(low >>> numBits | high << 32 - numBits, high >> numBits);
+ } else {
+ return Long.fromBits(high >> numBits - 32, high >= 0 ? 0 : -1);
+ }
+ }
+ };
+
+ /**
+ * Returns this Long with bits shifted to the right by the given amount, with the new top bits matching the current sign bit.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Long} this shifted to the right by the given amount, with zeros placed into the new leading bits.
+ */
+ Long.prototype.shiftRightUnsigned = function (numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var high = this.high_;
+ if (numBits < 32) {
+ var low = this.low_;
+ return Long.fromBits(low >>> numBits | high << 32 - numBits, high >>> numBits);
+ } else if (numBits === 32) {
+ return Long.fromBits(high, 0);
+ } else {
+ return Long.fromBits(high >>> numBits - 32, 0);
+ }
+ }
+ };
+
+ /**
+ * Returns a Long representing the given (32-bit) integer value.
+ *
+ * @method
+ * @param {number} value the 32-bit integer in question.
+ * @return {Long} the corresponding Long value.
+ */
+ Long.fromInt = function (value) {
+ if (-128 <= value && value < 128) {
+ var cachedObj = Long.INT_CACHE_[value];
+ if (cachedObj) {
+ return cachedObj;
+ }
+ }
+
+ var obj = new Long(value | 0, value < 0 ? -1 : 0);
+ if (-128 <= value && value < 128) {
+ Long.INT_CACHE_[value] = obj;
+ }
+ return obj;
+ };
+
+ /**
+ * Returns a Long representing the given value, provided that it is a finite number. Otherwise, zero is returned.
+ *
+ * @method
+ * @param {number} value the number in question.
+ * @return {Long} the corresponding Long value.
+ */
+ Long.fromNumber = function (value) {
+ if (isNaN(value) || !isFinite(value)) {
+ return Long.ZERO;
+ } else if (value <= -Long.TWO_PWR_63_DBL_) {
+ return Long.MIN_VALUE;
+ } else if (value + 1 >= Long.TWO_PWR_63_DBL_) {
+ return Long.MAX_VALUE;
+ } else if (value < 0) {
+ return Long.fromNumber(-value).negate();
+ } else {
+ return new Long(value % Long.TWO_PWR_32_DBL_ | 0, value / Long.TWO_PWR_32_DBL_ | 0);
+ }
+ };
+
+ /**
+ * Returns a Long representing the 64-bit integer that comes by concatenating the given high and low bits. Each is assumed to use 32 bits.
+ *
+ * @method
+ * @param {number} lowBits the low 32-bits.
+ * @param {number} highBits the high 32-bits.
+ * @return {Long} the corresponding Long value.
+ */
+ Long.fromBits = function (lowBits, highBits) {
+ return new Long(lowBits, highBits);
+ };
+
+ /**
+ * Returns a Long representation of the given string, written using the given radix.
+ *
+ * @method
+ * @param {string} str the textual representation of the Long.
+ * @param {number} opt_radix the radix in which the text is written.
+ * @return {Long} the corresponding Long value.
+ */
+ Long.fromString = function (str, opt_radix) {
+ if (str.length === 0) {
+ throw Error('number format error: empty string');
+ }
+
+ var radix = opt_radix || 10;
+ if (radix < 2 || 36 < radix) {
+ throw Error('radix out of range: ' + radix);
+ }
+
+ if (str.charAt(0) === '-') {
+ return Long.fromString(str.substring(1), radix).negate();
+ } else if (str.indexOf('-') >= 0) {
+ throw Error('number format error: interior "-" character: ' + str);
+ }
+
+ // Do several (8) digits each time through the loop, so as to
+ // minimize the calls to the very expensive emulated div.
+ var radixToPower = Long.fromNumber(Math.pow(radix, 8));
+
+ var result = Long.ZERO;
+ for (var i = 0; i < str.length; i += 8) {
+ var size = Math.min(8, str.length - i);
+ var value = parseInt(str.substring(i, i + size), radix);
+ if (size < 8) {
+ var power = Long.fromNumber(Math.pow(radix, size));
+ result = result.multiply(power).add(Long.fromNumber(value));
+ } else {
+ result = result.multiply(radixToPower);
+ result = result.add(Long.fromNumber(value));
+ }
+ }
+ return result;
+ };
+
+ // NOTE: Common constant values ZERO, ONE, NEG_ONE, etc. are defined below the
+ // from* methods on which they depend.
+
+ /**
+ * A cache of the Long representations of small integer values.
+ * @type {Object}
+ * @ignore
+ */
+ Long.INT_CACHE_ = {};
+
+ // NOTE: the compiler should inline these constant values below and then remove
+ // these variables, so there should be no runtime penalty for these.
+
+ /**
+ * Number used repeated below in calculations. This must appear before the
+ * first call to any from* function below.
+ * @type {number}
+ * @ignore
+ */
+ Long.TWO_PWR_16_DBL_ = 1 << 16;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Long.TWO_PWR_24_DBL_ = 1 << 24;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Long.TWO_PWR_32_DBL_ = Long.TWO_PWR_16_DBL_ * Long.TWO_PWR_16_DBL_;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Long.TWO_PWR_31_DBL_ = Long.TWO_PWR_32_DBL_ / 2;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Long.TWO_PWR_48_DBL_ = Long.TWO_PWR_32_DBL_ * Long.TWO_PWR_16_DBL_;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Long.TWO_PWR_64_DBL_ = Long.TWO_PWR_32_DBL_ * Long.TWO_PWR_32_DBL_;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Long.TWO_PWR_63_DBL_ = Long.TWO_PWR_64_DBL_ / 2;
+
+ /** @type {Long} */
+ Long.ZERO = Long.fromInt(0);
+
+ /** @type {Long} */
+ Long.ONE = Long.fromInt(1);
+
+ /** @type {Long} */
+ Long.NEG_ONE = Long.fromInt(-1);
+
+ /** @type {Long} */
+ Long.MAX_VALUE = Long.fromBits(0xffffffff | 0, 0x7fffffff | 0);
+
+ /** @type {Long} */
+ Long.MIN_VALUE = Long.fromBits(0, 0x80000000 | 0);
+
+ /**
+ * @type {Long}
+ * @ignore
+ */
+ Long.TWO_PWR_24_ = Long.fromInt(1 << 24);
+
+ /**
+ * Expose.
+ */
+ module.exports = Long;
+ module.exports.Long = Long;
+
+/***/ }),
+/* 336 */
+/***/ (function(module, exports) {
+
+ /**
+ * A class representation of the BSON Double type.
+ *
+ * @class
+ * @param {number} value the number we want to represent as a double.
+ * @return {Double}
+ */
+ function Double(value) {
+ if (!(this instanceof Double)) return new Double(value);
+
+ this._bsontype = 'Double';
+ this.value = value;
+ }
+
+ /**
+ * Access the number value.
+ *
+ * @method
+ * @return {number} returns the wrapped double number.
+ */
+ Double.prototype.valueOf = function () {
+ return this.value;
+ };
+
+ /**
+ * @ignore
+ */
+ Double.prototype.toJSON = function () {
+ return this.value;
+ };
+
+ module.exports = Double;
+ module.exports.Double = Double;
+
+/***/ }),
+/* 337 */
+/***/ (function(module, exports) {
+
+ // Licensed under the Apache License, Version 2.0 (the "License");
+ // you may not use this file except in compliance with the License.
+ // You may obtain a copy of the License at
+ //
+ // http://www.apache.org/licenses/LICENSE-2.0
+ //
+ // Unless required by applicable law or agreed to in writing, software
+ // distributed under the License is distributed on an "AS IS" BASIS,
+ // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ // See the License for the specific language governing permissions and
+ // limitations under the License.
+ //
+ // Copyright 2009 Google Inc. All Rights Reserved
+
+ /**
+ * This type is for INTERNAL use in MongoDB only and should not be used in applications.
+ * The appropriate corresponding type is the JavaScript Date type.
+ *
+ * Defines a Timestamp class for representing a 64-bit two's-complement
+ * integer value, which faithfully simulates the behavior of a Java "Timestamp". This
+ * implementation is derived from TimestampLib in GWT.
+ *
+ * Constructs a 64-bit two's-complement integer, given its low and high 32-bit
+ * values as *signed* integers. See the from* functions below for more
+ * convenient ways of constructing Timestamps.
+ *
+ * The internal representation of a Timestamp is the two given signed, 32-bit values.
+ * We use 32-bit pieces because these are the size of integers on which
+ * Javascript performs bit-operations. For operations like addition and
+ * multiplication, we split each number into 16-bit pieces, which can easily be
+ * multiplied within Javascript's floating-point representation without overflow
+ * or change in sign.
+ *
+ * In the algorithms below, we frequently reduce the negative case to the
+ * positive case by negating the input(s) and then post-processing the result.
+ * Note that we must ALWAYS check specially whether those values are MIN_VALUE
+ * (-2^63) because -MIN_VALUE == MIN_VALUE (since 2^63 cannot be represented as
+ * a positive number, it overflows back into a negative). Not handling this
+ * case would often result in infinite recursion.
+ *
+ * @class
+ * @param {number} low the low (signed) 32 bits of the Timestamp.
+ * @param {number} high the high (signed) 32 bits of the Timestamp.
+ */
+ function Timestamp(low, high) {
+ if (!(this instanceof Timestamp)) return new Timestamp(low, high);
+ this._bsontype = 'Timestamp';
+ /**
+ * @type {number}
+ * @ignore
+ */
+ this.low_ = low | 0; // force into 32 signed bits.
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ this.high_ = high | 0; // force into 32 signed bits.
+ }
+
+ /**
+ * Return the int value.
+ *
+ * @return {number} the value, assuming it is a 32-bit integer.
+ */
+ Timestamp.prototype.toInt = function () {
+ return this.low_;
+ };
+
+ /**
+ * Return the Number value.
+ *
+ * @method
+ * @return {number} the closest floating-point representation to this value.
+ */
+ Timestamp.prototype.toNumber = function () {
+ return this.high_ * Timestamp.TWO_PWR_32_DBL_ + this.getLowBitsUnsigned();
+ };
+
+ /**
+ * Return the JSON value.
+ *
+ * @method
+ * @return {string} the JSON representation.
+ */
+ Timestamp.prototype.toJSON = function () {
+ return this.toString();
+ };
+
+ /**
+ * Return the String value.
+ *
+ * @method
+ * @param {number} [opt_radix] the radix in which the text should be written.
+ * @return {string} the textual representation of this value.
+ */
+ Timestamp.prototype.toString = function (opt_radix) {
+ var radix = opt_radix || 10;
+ if (radix < 2 || 36 < radix) {
+ throw Error('radix out of range: ' + radix);
+ }
+
+ if (this.isZero()) {
+ return '0';
+ }
+
+ if (this.isNegative()) {
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ // We need to change the Timestamp value before it can be negated, so we remove
+ // the bottom-most digit in this base and then recurse to do the rest.
+ var radixTimestamp = Timestamp.fromNumber(radix);
+ var div = this.div(radixTimestamp);
+ var rem = div.multiply(radixTimestamp).subtract(this);
+ return div.toString(radix) + rem.toInt().toString(radix);
+ } else {
+ return '-' + this.negate().toString(radix);
+ }
+ }
+
+ // Do several (6) digits each time through the loop, so as to
+ // minimize the calls to the very expensive emulated div.
+ var radixToPower = Timestamp.fromNumber(Math.pow(radix, 6));
+
+ rem = this;
+ var result = '';
+
+ while (!rem.isZero()) {
+ var remDiv = rem.div(radixToPower);
+ var intval = rem.subtract(remDiv.multiply(radixToPower)).toInt();
+ var digits = intval.toString(radix);
+
+ rem = remDiv;
+ if (rem.isZero()) {
+ return digits + result;
+ } else {
+ while (digits.length < 6) {
+ digits = '0' + digits;
+ }
+ result = '' + digits + result;
+ }
+ }
+ };
+
+ /**
+ * Return the high 32-bits value.
+ *
+ * @method
+ * @return {number} the high 32-bits as a signed value.
+ */
+ Timestamp.prototype.getHighBits = function () {
+ return this.high_;
+ };
+
+ /**
+ * Return the low 32-bits value.
+ *
+ * @method
+ * @return {number} the low 32-bits as a signed value.
+ */
+ Timestamp.prototype.getLowBits = function () {
+ return this.low_;
+ };
+
+ /**
+ * Return the low unsigned 32-bits value.
+ *
+ * @method
+ * @return {number} the low 32-bits as an unsigned value.
+ */
+ Timestamp.prototype.getLowBitsUnsigned = function () {
+ return this.low_ >= 0 ? this.low_ : Timestamp.TWO_PWR_32_DBL_ + this.low_;
+ };
+
+ /**
+ * Returns the number of bits needed to represent the absolute value of this Timestamp.
+ *
+ * @method
+ * @return {number} Returns the number of bits needed to represent the absolute value of this Timestamp.
+ */
+ Timestamp.prototype.getNumBitsAbs = function () {
+ if (this.isNegative()) {
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ return 64;
+ } else {
+ return this.negate().getNumBitsAbs();
+ }
+ } else {
+ var val = this.high_ !== 0 ? this.high_ : this.low_;
+ for (var bit = 31; bit > 0; bit--) {
+ if ((val & 1 << bit) !== 0) {
+ break;
+ }
+ }
+ return this.high_ !== 0 ? bit + 33 : bit + 1;
+ }
+ };
+
+ /**
+ * Return whether this value is zero.
+ *
+ * @method
+ * @return {boolean} whether this value is zero.
+ */
+ Timestamp.prototype.isZero = function () {
+ return this.high_ === 0 && this.low_ === 0;
+ };
+
+ /**
+ * Return whether this value is negative.
+ *
+ * @method
+ * @return {boolean} whether this value is negative.
+ */
+ Timestamp.prototype.isNegative = function () {
+ return this.high_ < 0;
+ };
+
+ /**
+ * Return whether this value is odd.
+ *
+ * @method
+ * @return {boolean} whether this value is odd.
+ */
+ Timestamp.prototype.isOdd = function () {
+ return (this.low_ & 1) === 1;
+ };
+
+ /**
+ * Return whether this Timestamp equals the other
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp equals the other
+ */
+ Timestamp.prototype.equals = function (other) {
+ return this.high_ === other.high_ && this.low_ === other.low_;
+ };
+
+ /**
+ * Return whether this Timestamp does not equal the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp does not equal the other.
+ */
+ Timestamp.prototype.notEquals = function (other) {
+ return this.high_ !== other.high_ || this.low_ !== other.low_;
+ };
+
+ /**
+ * Return whether this Timestamp is less than the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp is less than the other.
+ */
+ Timestamp.prototype.lessThan = function (other) {
+ return this.compare(other) < 0;
+ };
+
+ /**
+ * Return whether this Timestamp is less than or equal to the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp is less than or equal to the other.
+ */
+ Timestamp.prototype.lessThanOrEqual = function (other) {
+ return this.compare(other) <= 0;
+ };
+
+ /**
+ * Return whether this Timestamp is greater than the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp is greater than the other.
+ */
+ Timestamp.prototype.greaterThan = function (other) {
+ return this.compare(other) > 0;
+ };
+
+ /**
+ * Return whether this Timestamp is greater than or equal to the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp is greater than or equal to the other.
+ */
+ Timestamp.prototype.greaterThanOrEqual = function (other) {
+ return this.compare(other) >= 0;
+ };
+
+ /**
+ * Compares this Timestamp with the given one.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} 0 if they are the same, 1 if the this is greater, and -1 if the given one is greater.
+ */
+ Timestamp.prototype.compare = function (other) {
+ if (this.equals(other)) {
+ return 0;
+ }
+
+ var thisNeg = this.isNegative();
+ var otherNeg = other.isNegative();
+ if (thisNeg && !otherNeg) {
+ return -1;
+ }
+ if (!thisNeg && otherNeg) {
+ return 1;
+ }
+
+ // at this point, the signs are the same, so subtraction will not overflow
+ if (this.subtract(other).isNegative()) {
+ return -1;
+ } else {
+ return 1;
+ }
+ };
+
+ /**
+ * The negation of this value.
+ *
+ * @method
+ * @return {Timestamp} the negation of this value.
+ */
+ Timestamp.prototype.negate = function () {
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ return Timestamp.MIN_VALUE;
+ } else {
+ return this.not().add(Timestamp.ONE);
+ }
+ };
+
+ /**
+ * Returns the sum of this and the given Timestamp.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to add to this one.
+ * @return {Timestamp} the sum of this and the given Timestamp.
+ */
+ Timestamp.prototype.add = function (other) {
+ // Divide each number into 4 chunks of 16 bits, and then sum the chunks.
+
+ var a48 = this.high_ >>> 16;
+ var a32 = this.high_ & 0xffff;
+ var a16 = this.low_ >>> 16;
+ var a00 = this.low_ & 0xffff;
+
+ var b48 = other.high_ >>> 16;
+ var b32 = other.high_ & 0xffff;
+ var b16 = other.low_ >>> 16;
+ var b00 = other.low_ & 0xffff;
+
+ var c48 = 0,
+ c32 = 0,
+ c16 = 0,
+ c00 = 0;
+ c00 += a00 + b00;
+ c16 += c00 >>> 16;
+ c00 &= 0xffff;
+ c16 += a16 + b16;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c32 += a32 + b32;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c48 += a48 + b48;
+ c48 &= 0xffff;
+ return Timestamp.fromBits(c16 << 16 | c00, c48 << 16 | c32);
+ };
+
+ /**
+ * Returns the difference of this and the given Timestamp.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to subtract from this.
+ * @return {Timestamp} the difference of this and the given Timestamp.
+ */
+ Timestamp.prototype.subtract = function (other) {
+ return this.add(other.negate());
+ };
+
+ /**
+ * Returns the product of this and the given Timestamp.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to multiply with this.
+ * @return {Timestamp} the product of this and the other.
+ */
+ Timestamp.prototype.multiply = function (other) {
+ if (this.isZero()) {
+ return Timestamp.ZERO;
+ } else if (other.isZero()) {
+ return Timestamp.ZERO;
+ }
+
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ return other.isOdd() ? Timestamp.MIN_VALUE : Timestamp.ZERO;
+ } else if (other.equals(Timestamp.MIN_VALUE)) {
+ return this.isOdd() ? Timestamp.MIN_VALUE : Timestamp.ZERO;
+ }
+
+ if (this.isNegative()) {
+ if (other.isNegative()) {
+ return this.negate().multiply(other.negate());
+ } else {
+ return this.negate().multiply(other).negate();
+ }
+ } else if (other.isNegative()) {
+ return this.multiply(other.negate()).negate();
+ }
+
+ // If both Timestamps are small, use float multiplication
+ if (this.lessThan(Timestamp.TWO_PWR_24_) && other.lessThan(Timestamp.TWO_PWR_24_)) {
+ return Timestamp.fromNumber(this.toNumber() * other.toNumber());
+ }
+
+ // Divide each Timestamp into 4 chunks of 16 bits, and then add up 4x4 products.
+ // We can skip products that would overflow.
+
+ var a48 = this.high_ >>> 16;
+ var a32 = this.high_ & 0xffff;
+ var a16 = this.low_ >>> 16;
+ var a00 = this.low_ & 0xffff;
+
+ var b48 = other.high_ >>> 16;
+ var b32 = other.high_ & 0xffff;
+ var b16 = other.low_ >>> 16;
+ var b00 = other.low_ & 0xffff;
+
+ var c48 = 0,
+ c32 = 0,
+ c16 = 0,
+ c00 = 0;
+ c00 += a00 * b00;
+ c16 += c00 >>> 16;
+ c00 &= 0xffff;
+ c16 += a16 * b00;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c16 += a00 * b16;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c32 += a32 * b00;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c32 += a16 * b16;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c32 += a00 * b32;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c48 += a48 * b00 + a32 * b16 + a16 * b32 + a00 * b48;
+ c48 &= 0xffff;
+ return Timestamp.fromBits(c16 << 16 | c00, c48 << 16 | c32);
+ };
+
+ /**
+ * Returns this Timestamp divided by the given one.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp by which to divide.
+ * @return {Timestamp} this Timestamp divided by the given one.
+ */
+ Timestamp.prototype.div = function (other) {
+ if (other.isZero()) {
+ throw Error('division by zero');
+ } else if (this.isZero()) {
+ return Timestamp.ZERO;
+ }
+
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ if (other.equals(Timestamp.ONE) || other.equals(Timestamp.NEG_ONE)) {
+ return Timestamp.MIN_VALUE; // recall that -MIN_VALUE == MIN_VALUE
+ } else if (other.equals(Timestamp.MIN_VALUE)) {
+ return Timestamp.ONE;
+ } else {
+ // At this point, we have |other| >= 2, so |this/other| < |MIN_VALUE|.
+ var halfThis = this.shiftRight(1);
+ var approx = halfThis.div(other).shiftLeft(1);
+ if (approx.equals(Timestamp.ZERO)) {
+ return other.isNegative() ? Timestamp.ONE : Timestamp.NEG_ONE;
+ } else {
+ var rem = this.subtract(other.multiply(approx));
+ var result = approx.add(rem.div(other));
+ return result;
+ }
+ }
+ } else if (other.equals(Timestamp.MIN_VALUE)) {
+ return Timestamp.ZERO;
+ }
+
+ if (this.isNegative()) {
+ if (other.isNegative()) {
+ return this.negate().div(other.negate());
+ } else {
+ return this.negate().div(other).negate();
+ }
+ } else if (other.isNegative()) {
+ return this.div(other.negate()).negate();
+ }
+
+ // Repeat the following until the remainder is less than other: find a
+ // floating-point that approximates remainder / other *from below*, add this
+ // into the result, and subtract it from the remainder. It is critical that
+ // the approximate value is less than or equal to the real value so that the
+ // remainder never becomes negative.
+ var res = Timestamp.ZERO;
+ rem = this;
+ while (rem.greaterThanOrEqual(other)) {
+ // Approximate the result of division. This may be a little greater or
+ // smaller than the actual value.
+ approx = Math.max(1, Math.floor(rem.toNumber() / other.toNumber()));
+
+ // We will tweak the approximate result by changing it in the 48-th digit or
+ // the smallest non-fractional digit, whichever is larger.
+ var log2 = Math.ceil(Math.log(approx) / Math.LN2);
+ var delta = log2 <= 48 ? 1 : Math.pow(2, log2 - 48);
+
+ // Decrease the approximation until it is smaller than the remainder. Note
+ // that if it is too large, the product overflows and is negative.
+ var approxRes = Timestamp.fromNumber(approx);
+ var approxRem = approxRes.multiply(other);
+ while (approxRem.isNegative() || approxRem.greaterThan(rem)) {
+ approx -= delta;
+ approxRes = Timestamp.fromNumber(approx);
+ approxRem = approxRes.multiply(other);
+ }
+
+ // We know the answer can't be zero... and actually, zero would cause
+ // infinite recursion since we would make no progress.
+ if (approxRes.isZero()) {
+ approxRes = Timestamp.ONE;
+ }
+
+ res = res.add(approxRes);
+ rem = rem.subtract(approxRem);
+ }
+ return res;
+ };
+
+ /**
+ * Returns this Timestamp modulo the given one.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp by which to mod.
+ * @return {Timestamp} this Timestamp modulo the given one.
+ */
+ Timestamp.prototype.modulo = function (other) {
+ return this.subtract(this.div(other).multiply(other));
+ };
+
+ /**
+ * The bitwise-NOT of this value.
+ *
+ * @method
+ * @return {Timestamp} the bitwise-NOT of this value.
+ */
+ Timestamp.prototype.not = function () {
+ return Timestamp.fromBits(~this.low_, ~this.high_);
+ };
+
+ /**
+ * Returns the bitwise-AND of this Timestamp and the given one.
+ *
+ * @method
+ * @param {Timestamp} other the Timestamp with which to AND.
+ * @return {Timestamp} the bitwise-AND of this and the other.
+ */
+ Timestamp.prototype.and = function (other) {
+ return Timestamp.fromBits(this.low_ & other.low_, this.high_ & other.high_);
+ };
+
+ /**
+ * Returns the bitwise-OR of this Timestamp and the given one.
+ *
+ * @method
+ * @param {Timestamp} other the Timestamp with which to OR.
+ * @return {Timestamp} the bitwise-OR of this and the other.
+ */
+ Timestamp.prototype.or = function (other) {
+ return Timestamp.fromBits(this.low_ | other.low_, this.high_ | other.high_);
+ };
+
+ /**
+ * Returns the bitwise-XOR of this Timestamp and the given one.
+ *
+ * @method
+ * @param {Timestamp} other the Timestamp with which to XOR.
+ * @return {Timestamp} the bitwise-XOR of this and the other.
+ */
+ Timestamp.prototype.xor = function (other) {
+ return Timestamp.fromBits(this.low_ ^ other.low_, this.high_ ^ other.high_);
+ };
+
+ /**
+ * Returns this Timestamp with bits shifted to the left by the given amount.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Timestamp} this shifted to the left by the given amount.
+ */
+ Timestamp.prototype.shiftLeft = function (numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var low = this.low_;
+ if (numBits < 32) {
+ var high = this.high_;
+ return Timestamp.fromBits(low << numBits, high << numBits | low >>> 32 - numBits);
+ } else {
+ return Timestamp.fromBits(0, low << numBits - 32);
+ }
+ }
+ };
+
+ /**
+ * Returns this Timestamp with bits shifted to the right by the given amount.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Timestamp} this shifted to the right by the given amount.
+ */
+ Timestamp.prototype.shiftRight = function (numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var high = this.high_;
+ if (numBits < 32) {
+ var low = this.low_;
+ return Timestamp.fromBits(low >>> numBits | high << 32 - numBits, high >> numBits);
+ } else {
+ return Timestamp.fromBits(high >> numBits - 32, high >= 0 ? 0 : -1);
+ }
+ }
+ };
+
+ /**
+ * Returns this Timestamp with bits shifted to the right by the given amount, with the new top bits matching the current sign bit.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Timestamp} this shifted to the right by the given amount, with zeros placed into the new leading bits.
+ */
+ Timestamp.prototype.shiftRightUnsigned = function (numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var high = this.high_;
+ if (numBits < 32) {
+ var low = this.low_;
+ return Timestamp.fromBits(low >>> numBits | high << 32 - numBits, high >>> numBits);
+ } else if (numBits === 32) {
+ return Timestamp.fromBits(high, 0);
+ } else {
+ return Timestamp.fromBits(high >>> numBits - 32, 0);
+ }
+ }
+ };
+
+ /**
+ * Returns a Timestamp representing the given (32-bit) integer value.
+ *
+ * @method
+ * @param {number} value the 32-bit integer in question.
+ * @return {Timestamp} the corresponding Timestamp value.
+ */
+ Timestamp.fromInt = function (value) {
+ if (-128 <= value && value < 128) {
+ var cachedObj = Timestamp.INT_CACHE_[value];
+ if (cachedObj) {
+ return cachedObj;
+ }
+ }
+
+ var obj = new Timestamp(value | 0, value < 0 ? -1 : 0);
+ if (-128 <= value && value < 128) {
+ Timestamp.INT_CACHE_[value] = obj;
+ }
+ return obj;
+ };
+
+ /**
+ * Returns a Timestamp representing the given value, provided that it is a finite number. Otherwise, zero is returned.
+ *
+ * @method
+ * @param {number} value the number in question.
+ * @return {Timestamp} the corresponding Timestamp value.
+ */
+ Timestamp.fromNumber = function (value) {
+ if (isNaN(value) || !isFinite(value)) {
+ return Timestamp.ZERO;
+ } else if (value <= -Timestamp.TWO_PWR_63_DBL_) {
+ return Timestamp.MIN_VALUE;
+ } else if (value + 1 >= Timestamp.TWO_PWR_63_DBL_) {
+ return Timestamp.MAX_VALUE;
+ } else if (value < 0) {
+ return Timestamp.fromNumber(-value).negate();
+ } else {
+ return new Timestamp(value % Timestamp.TWO_PWR_32_DBL_ | 0, value / Timestamp.TWO_PWR_32_DBL_ | 0);
+ }
+ };
+
+ /**
+ * Returns a Timestamp representing the 64-bit integer that comes by concatenating the given high and low bits. Each is assumed to use 32 bits.
+ *
+ * @method
+ * @param {number} lowBits the low 32-bits.
+ * @param {number} highBits the high 32-bits.
+ * @return {Timestamp} the corresponding Timestamp value.
+ */
+ Timestamp.fromBits = function (lowBits, highBits) {
+ return new Timestamp(lowBits, highBits);
+ };
+
+ /**
+ * Returns a Timestamp representation of the given string, written using the given radix.
+ *
+ * @method
+ * @param {string} str the textual representation of the Timestamp.
+ * @param {number} opt_radix the radix in which the text is written.
+ * @return {Timestamp} the corresponding Timestamp value.
+ */
+ Timestamp.fromString = function (str, opt_radix) {
+ if (str.length === 0) {
+ throw Error('number format error: empty string');
+ }
+
+ var radix = opt_radix || 10;
+ if (radix < 2 || 36 < radix) {
+ throw Error('radix out of range: ' + radix);
+ }
+
+ if (str.charAt(0) === '-') {
+ return Timestamp.fromString(str.substring(1), radix).negate();
+ } else if (str.indexOf('-') >= 0) {
+ throw Error('number format error: interior "-" character: ' + str);
+ }
+
+ // Do several (8) digits each time through the loop, so as to
+ // minimize the calls to the very expensive emulated div.
+ var radixToPower = Timestamp.fromNumber(Math.pow(radix, 8));
+
+ var result = Timestamp.ZERO;
+ for (var i = 0; i < str.length; i += 8) {
+ var size = Math.min(8, str.length - i);
+ var value = parseInt(str.substring(i, i + size), radix);
+ if (size < 8) {
+ var power = Timestamp.fromNumber(Math.pow(radix, size));
+ result = result.multiply(power).add(Timestamp.fromNumber(value));
+ } else {
+ result = result.multiply(radixToPower);
+ result = result.add(Timestamp.fromNumber(value));
+ }
+ }
+ return result;
+ };
+
+ // NOTE: Common constant values ZERO, ONE, NEG_ONE, etc. are defined below the
+ // from* methods on which they depend.
+
+ /**
+ * A cache of the Timestamp representations of small integer values.
+ * @type {Object}
+ * @ignore
+ */
+ Timestamp.INT_CACHE_ = {};
+
+ // NOTE: the compiler should inline these constant values below and then remove
+ // these variables, so there should be no runtime penalty for these.
+
+ /**
+ * Number used repeated below in calculations. This must appear before the
+ * first call to any from* function below.
+ * @type {number}
+ * @ignore
+ */
+ Timestamp.TWO_PWR_16_DBL_ = 1 << 16;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Timestamp.TWO_PWR_24_DBL_ = 1 << 24;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Timestamp.TWO_PWR_32_DBL_ = Timestamp.TWO_PWR_16_DBL_ * Timestamp.TWO_PWR_16_DBL_;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Timestamp.TWO_PWR_31_DBL_ = Timestamp.TWO_PWR_32_DBL_ / 2;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Timestamp.TWO_PWR_48_DBL_ = Timestamp.TWO_PWR_32_DBL_ * Timestamp.TWO_PWR_16_DBL_;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Timestamp.TWO_PWR_64_DBL_ = Timestamp.TWO_PWR_32_DBL_ * Timestamp.TWO_PWR_32_DBL_;
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ Timestamp.TWO_PWR_63_DBL_ = Timestamp.TWO_PWR_64_DBL_ / 2;
+
+ /** @type {Timestamp} */
+ Timestamp.ZERO = Timestamp.fromInt(0);
+
+ /** @type {Timestamp} */
+ Timestamp.ONE = Timestamp.fromInt(1);
+
+ /** @type {Timestamp} */
+ Timestamp.NEG_ONE = Timestamp.fromInt(-1);
+
+ /** @type {Timestamp} */
+ Timestamp.MAX_VALUE = Timestamp.fromBits(0xffffffff | 0, 0x7fffffff | 0);
+
+ /** @type {Timestamp} */
+ Timestamp.MIN_VALUE = Timestamp.fromBits(0, 0x80000000 | 0);
+
+ /**
+ * @type {Timestamp}
+ * @ignore
+ */
+ Timestamp.TWO_PWR_24_ = Timestamp.fromInt(1 << 24);
+
+ /**
+ * Expose.
+ */
+ module.exports = Timestamp;
+ module.exports.Timestamp = Timestamp;
+
+/***/ }),
+/* 338 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(Buffer, process) {// Custom inspect property name / symbol.
+ var inspect = 'inspect';
+
+ var utils = __webpack_require__(344);
+
+ /**
+ * Machine id.
+ *
+ * Create a random 3-byte value (i.e. unique for this
+ * process). Other drivers use a md5 of the machine id here, but
+ * that would mean an asyc call to gethostname, so we don't bother.
+ * @ignore
+ */
+ var MACHINE_ID = parseInt(Math.random() * 0xffffff, 10);
+
+ // Regular expression that checks for hex value
+ var checkForHexRegExp = new RegExp('^[0-9a-fA-F]{24}$');
+
+ // Check if buffer exists
+ try {
+ if (Buffer && Buffer.from) {
+ var hasBufferType = true;
+ inspect = __webpack_require__(345).inspect.custom || 'inspect';
+ }
+ } catch (err) {
+ hasBufferType = false;
+ }
+
+ /**
+ * Create a new ObjectID instance
+ *
+ * @class
+ * @param {(string|number)} id Can be a 24 byte hex string, 12 byte binary string or a Number.
+ * @property {number} generationTime The generation time of this ObjectId instance
+ * @return {ObjectID} instance of ObjectID.
+ */
+ var ObjectID = function ObjectID(id) {
+ // Duck-typing to support ObjectId from different npm packages
+ if (id instanceof ObjectID) return id;
+ if (!(this instanceof ObjectID)) return new ObjectID(id);
+
+ this._bsontype = 'ObjectID';
+
+ // The most common usecase (blank id, new objectId instance)
+ if (id == null || typeof id === 'number') {
+ // Generate a new id
+ this.id = this.generate(id);
+ // If we are caching the hex string
+ if (ObjectID.cacheHexString) this.__id = this.toString('hex');
+ // Return the object
+ return;
+ }
+
+ // Check if the passed in id is valid
+ var valid = ObjectID.isValid(id);
+
+ // Throw an error if it's not a valid setup
+ if (!valid && id != null) {
+ throw new Error('Argument passed in must be a single String of 12 bytes or a string of 24 hex characters');
+ } else if (valid && typeof id === 'string' && id.length === 24 && hasBufferType) {
+ return new ObjectID(utils.toBuffer(id, 'hex'));
+ } else if (valid && typeof id === 'string' && id.length === 24) {
+ return ObjectID.createFromHexString(id);
+ } else if (id != null && id.length === 12) {
+ // assume 12 byte string
+ this.id = id;
+ } else if (id != null && id.toHexString) {
+ // Duck-typing to support ObjectId from different npm packages
+ return id;
+ } else {
+ throw new Error('Argument passed in must be a single String of 12 bytes or a string of 24 hex characters');
+ }
+
+ if (ObjectID.cacheHexString) this.__id = this.toString('hex');
+ };
+
+ // Allow usage of ObjectId as well as ObjectID
+ // var ObjectId = ObjectID;
+
+ // Precomputed hex table enables speedy hex string conversion
+ var hexTable = [];
+ for (var i = 0; i < 256; i++) {
+ hexTable[i] = (i <= 15 ? '0' : '') + i.toString(16);
+ }
+
+ /**
+ * Return the ObjectID id as a 24 byte hex string representation
+ *
+ * @method
+ * @return {string} return the 24 byte hex string representation.
+ */
+ ObjectID.prototype.toHexString = function () {
+ if (ObjectID.cacheHexString && this.__id) return this.__id;
+
+ var hexString = '';
+ if (!this.id || !this.id.length) {
+ throw new Error('invalid ObjectId, ObjectId.id must be either a string or a Buffer, but is [' + JSON.stringify(this.id) + ']');
+ }
+
+ if (this.id instanceof _Buffer) {
+ hexString = convertToHex(this.id);
+ if (ObjectID.cacheHexString) this.__id = hexString;
+ return hexString;
+ }
+
+ for (var i = 0; i < this.id.length; i++) {
+ hexString += hexTable[this.id.charCodeAt(i)];
+ }
+
+ if (ObjectID.cacheHexString) this.__id = hexString;
+ return hexString;
+ };
+
+ /**
+ * Update the ObjectID index used in generating new ObjectID's on the driver
+ *
+ * @method
+ * @return {number} returns next index value.
+ * @ignore
+ */
+ ObjectID.prototype.get_inc = function () {
+ return ObjectID.index = (ObjectID.index + 1) % 0xffffff;
+ };
+
+ /**
+ * Update the ObjectID index used in generating new ObjectID's on the driver
+ *
+ * @method
+ * @return {number} returns next index value.
+ * @ignore
+ */
+ ObjectID.prototype.getInc = function () {
+ return this.get_inc();
+ };
+
+ /**
+ * Generate a 12 byte id buffer used in ObjectID's
+ *
+ * @method
+ * @param {number} [time] optional parameter allowing to pass in a second based timestamp.
+ * @return {Buffer} return the 12 byte id buffer string.
+ */
+ ObjectID.prototype.generate = function (time) {
+ if ('number' !== typeof time) {
+ time = ~~(Date.now() / 1000);
+ }
+
+ // Use pid
+ var pid = (typeof process === 'undefined' || process.pid === 1 ? Math.floor(Math.random() * 100000) : process.pid) % 0xffff;
+ var inc = this.get_inc();
+ // Buffer used
+ var buffer = utils.allocBuffer(12);
+ // Encode time
+ buffer[3] = time & 0xff;
+ buffer[2] = time >> 8 & 0xff;
+ buffer[1] = time >> 16 & 0xff;
+ buffer[0] = time >> 24 & 0xff;
+ // Encode machine
+ buffer[6] = MACHINE_ID & 0xff;
+ buffer[5] = MACHINE_ID >> 8 & 0xff;
+ buffer[4] = MACHINE_ID >> 16 & 0xff;
+ // Encode pid
+ buffer[8] = pid & 0xff;
+ buffer[7] = pid >> 8 & 0xff;
+ // Encode index
+ buffer[11] = inc & 0xff;
+ buffer[10] = inc >> 8 & 0xff;
+ buffer[9] = inc >> 16 & 0xff;
+ // Return the buffer
+ return buffer;
+ };
+
+ /**
+ * Converts the id into a 24 byte hex string for printing
+ *
+ * @param {String} format The Buffer toString format parameter.
+ * @return {String} return the 24 byte hex string representation.
+ * @ignore
+ */
+ ObjectID.prototype.toString = function (format) {
+ // Is the id a buffer then use the buffer toString method to return the format
+ if (this.id && this.id.copy) {
+ return this.id.toString(typeof format === 'string' ? format : 'hex');
+ }
+
+ // if(this.buffer )
+ return this.toHexString();
+ };
+
+ /**
+ * Converts to a string representation of this Id.
+ *
+ * @return {String} return the 24 byte hex string representation.
+ * @ignore
+ */
+ ObjectID.prototype[inspect] = ObjectID.prototype.toString;
+
+ /**
+ * Converts to its JSON representation.
+ *
+ * @return {String} return the 24 byte hex string representation.
+ * @ignore
+ */
+ ObjectID.prototype.toJSON = function () {
+ return this.toHexString();
+ };
+
+ /**
+ * Compares the equality of this ObjectID with `otherID`.
+ *
+ * @method
+ * @param {object} otherID ObjectID instance to compare against.
+ * @return {boolean} the result of comparing two ObjectID's
+ */
+ ObjectID.prototype.equals = function equals(otherId) {
+ // var id;
+
+ if (otherId instanceof ObjectID) {
+ return this.toString() === otherId.toString();
+ } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 12 && this.id instanceof _Buffer) {
+ return otherId === this.id.toString('binary');
+ } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 24) {
+ return otherId.toLowerCase() === this.toHexString();
+ } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 12) {
+ return otherId === this.id;
+ } else if (otherId != null && (otherId instanceof ObjectID || otherId.toHexString)) {
+ return otherId.toHexString() === this.toHexString();
+ } else {
+ return false;
+ }
+ };
+
+ /**
+ * Returns the generation date (accurate up to the second) that this ID was generated.
+ *
+ * @method
+ * @return {date} the generation date
+ */
+ ObjectID.prototype.getTimestamp = function () {
+ var timestamp = new Date();
+ var time = this.id[3] | this.id[2] << 8 | this.id[1] << 16 | this.id[0] << 24;
+ timestamp.setTime(Math.floor(time) * 1000);
+ return timestamp;
+ };
+
+ /**
+ * @ignore
+ */
+ ObjectID.index = ~~(Math.random() * 0xffffff);
+
+ /**
+ * @ignore
+ */
+ ObjectID.createPk = function createPk() {
+ return new ObjectID();
+ };
+
+ /**
+ * Creates an ObjectID from a second based number, with the rest of the ObjectID zeroed out. Used for comparisons or sorting the ObjectID.
+ *
+ * @method
+ * @param {number} time an integer number representing a number of seconds.
+ * @return {ObjectID} return the created ObjectID
+ */
+ ObjectID.createFromTime = function createFromTime(time) {
+ var buffer = utils.toBuffer([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]);
+ // Encode time into first 4 bytes
+ buffer[3] = time & 0xff;
+ buffer[2] = time >> 8 & 0xff;
+ buffer[1] = time >> 16 & 0xff;
+ buffer[0] = time >> 24 & 0xff;
+ // Return the new objectId
+ return new ObjectID(buffer);
+ };
+
+ // Lookup tables
+ //var encodeLookup = '0123456789abcdef'.split('');
+ var decodeLookup = [];
+ i = 0;
+ while (i < 10) decodeLookup[0x30 + i] = i++;
+ while (i < 16) decodeLookup[0x41 - 10 + i] = decodeLookup[0x61 - 10 + i] = i++;
+
+ var _Buffer = Buffer;
+ var convertToHex = function (bytes) {
+ return bytes.toString('hex');
+ };
+
+ /**
+ * Creates an ObjectID from a hex string representation of an ObjectID.
+ *
+ * @method
+ * @param {string} hexString create a ObjectID from a passed in 24 byte hexstring.
+ * @return {ObjectID} return the created ObjectID
+ */
+ ObjectID.createFromHexString = function createFromHexString(string) {
+ // Throw an error if it's not a valid setup
+ if (typeof string === 'undefined' || string != null && string.length !== 24) {
+ throw new Error('Argument passed in must be a single String of 12 bytes or a string of 24 hex characters');
+ }
+
+ // Use Buffer.from method if available
+ if (hasBufferType) return new ObjectID(utils.toBuffer(string, 'hex'));
+
+ // Calculate lengths
+ var array = new _Buffer(12);
+ var n = 0;
+ var i = 0;
+
+ while (i < 24) {
+ array[n++] = decodeLookup[string.charCodeAt(i++)] << 4 | decodeLookup[string.charCodeAt(i++)];
+ }
+
+ return new ObjectID(array);
+ };
+
+ /**
+ * Checks if a value is a valid bson ObjectId
+ *
+ * @method
+ * @return {boolean} return true if the value is a valid bson ObjectId, return false otherwise.
+ */
+ ObjectID.isValid = function isValid(id) {
+ if (id == null) return false;
+
+ if (typeof id === 'number') {
+ return true;
+ }
+
+ if (typeof id === 'string') {
+ return id.length === 12 || id.length === 24 && checkForHexRegExp.test(id);
+ }
+
+ if (id instanceof ObjectID) {
+ return true;
+ }
+
+ if (id instanceof _Buffer) {
+ return true;
+ }
+
+ // Duck-Typing detection of ObjectId like objects
+ if (id.toHexString) {
+ return id.id.length === 12 || id.id.length === 24 && checkForHexRegExp.test(id.id);
+ }
+
+ return false;
+ };
+
+ /**
+ * @ignore
+ */
+ Object.defineProperty(ObjectID.prototype, 'generationTime', {
+ enumerable: true,
+ get: function () {
+ return this.id[3] | this.id[2] << 8 | this.id[1] << 16 | this.id[0] << 24;
+ },
+ set: function (value) {
+ // Encode time into first 4 bytes
+ this.id[3] = value & 0xff;
+ this.id[2] = value >> 8 & 0xff;
+ this.id[1] = value >> 16 & 0xff;
+ this.id[0] = value >> 24 & 0xff;
+ }
+ });
+
+ /**
+ * Expose.
+ */
+ module.exports = ObjectID;
+ module.exports.ObjectID = ObjectID;
+ module.exports.ObjectId = ObjectID;
+ /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer, __webpack_require__(343)))
+
+/***/ }),
+/* 339 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(global) {/*!
+ * The buffer module from node.js, for the browser.
+ *
+ * @author Feross Aboukhadijeh
+ * @license MIT
+ */
+ /* eslint-disable no-proto */
+
+ 'use strict'
+
+ var base64 = __webpack_require__(340)
+ var ieee754 = __webpack_require__(341)
+ var isArray = __webpack_require__(342)
+
+ exports.Buffer = Buffer
+ exports.SlowBuffer = SlowBuffer
+ exports.INSPECT_MAX_BYTES = 50
+
+ /**
+ * If `Buffer.TYPED_ARRAY_SUPPORT`:
+ * === true Use Uint8Array implementation (fastest)
+ * === false Use Object implementation (most compatible, even IE6)
+ *
+ * Browsers that support typed arrays are IE 10+, Firefox 4+, Chrome 7+, Safari 5.1+,
+ * Opera 11.6+, iOS 4.2+.
+ *
+ * Due to various browser bugs, sometimes the Object implementation will be used even
+ * when the browser supports typed arrays.
+ *
+ * Note:
+ *
+ * - Firefox 4-29 lacks support for adding new properties to `Uint8Array` instances,
+ * See: https://bugzilla.mozilla.org/show_bug.cgi?id=695438.
+ *
+ * - Chrome 9-10 is missing the `TypedArray.prototype.subarray` function.
+ *
+ * - IE10 has a broken `TypedArray.prototype.subarray` function which returns arrays of
+ * incorrect length in some situations.
+
+ * We detect these buggy browsers and set `Buffer.TYPED_ARRAY_SUPPORT` to `false` so they
+ * get the Object implementation, which is slower but behaves correctly.
+ */
+ Buffer.TYPED_ARRAY_SUPPORT = global.TYPED_ARRAY_SUPPORT !== undefined
+ ? global.TYPED_ARRAY_SUPPORT
+ : typedArraySupport()
+
+ /*
+ * Export kMaxLength after typed array support is determined.
+ */
+ exports.kMaxLength = kMaxLength()
+
+ function typedArraySupport () {
+ try {
+ var arr = new Uint8Array(1)
+ arr.__proto__ = {__proto__: Uint8Array.prototype, foo: function () { return 42 }}
+ return arr.foo() === 42 && // typed array instances can be augmented
+ typeof arr.subarray === 'function' && // chrome 9-10 lack `subarray`
+ arr.subarray(1, 1).byteLength === 0 // ie10 has broken `subarray`
+ } catch (e) {
+ return false
+ }
+ }
+
+ function kMaxLength () {
+ return Buffer.TYPED_ARRAY_SUPPORT
+ ? 0x7fffffff
+ : 0x3fffffff
+ }
+
+ function createBuffer (that, length) {
+ if (kMaxLength() < length) {
+ throw new RangeError('Invalid typed array length')
+ }
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ // Return an augmented `Uint8Array` instance, for best performance
+ that = new Uint8Array(length)
+ that.__proto__ = Buffer.prototype
+ } else {
+ // Fallback: Return an object instance of the Buffer class
+ if (that === null) {
+ that = new Buffer(length)
+ }
+ that.length = length
+ }
+
+ return that
+ }
+
+ /**
+ * The Buffer constructor returns instances of `Uint8Array` that have their
+ * prototype changed to `Buffer.prototype`. Furthermore, `Buffer` is a subclass of
+ * `Uint8Array`, so the returned instances will have all the node `Buffer` methods
+ * and the `Uint8Array` methods. Square bracket notation works as expected -- it
+ * returns a single octet.
+ *
+ * The `Uint8Array` prototype remains unmodified.
+ */
+
+ function Buffer (arg, encodingOrOffset, length) {
+ if (!Buffer.TYPED_ARRAY_SUPPORT && !(this instanceof Buffer)) {
+ return new Buffer(arg, encodingOrOffset, length)
+ }
+
+ // Common case.
+ if (typeof arg === 'number') {
+ if (typeof encodingOrOffset === 'string') {
+ throw new Error(
+ 'If encoding is specified then the first argument must be a string'
+ )
+ }
+ return allocUnsafe(this, arg)
+ }
+ return from(this, arg, encodingOrOffset, length)
+ }
+
+ Buffer.poolSize = 8192 // not used by this implementation
+
+ // TODO: Legacy, not needed anymore. Remove in next major version.
+ Buffer._augment = function (arr) {
+ arr.__proto__ = Buffer.prototype
+ return arr
+ }
+
+ function from (that, value, encodingOrOffset, length) {
+ if (typeof value === 'number') {
+ throw new TypeError('"value" argument must not be a number')
+ }
+
+ if (typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer) {
+ return fromArrayBuffer(that, value, encodingOrOffset, length)
+ }
+
+ if (typeof value === 'string') {
+ return fromString(that, value, encodingOrOffset)
+ }
+
+ return fromObject(that, value)
+ }
+
+ /**
+ * Functionally equivalent to Buffer(arg, encoding) but throws a TypeError
+ * if value is a number.
+ * Buffer.from(str[, encoding])
+ * Buffer.from(array)
+ * Buffer.from(buffer)
+ * Buffer.from(arrayBuffer[, byteOffset[, length]])
+ **/
+ Buffer.from = function (value, encodingOrOffset, length) {
+ return from(null, value, encodingOrOffset, length)
+ }
+
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ Buffer.prototype.__proto__ = Uint8Array.prototype
+ Buffer.__proto__ = Uint8Array
+ if (typeof Symbol !== 'undefined' && Symbol.species &&
+ Buffer[Symbol.species] === Buffer) {
+ // Fix subarray() in ES2016. See: https://github.com/feross/buffer/pull/97
+ Object.defineProperty(Buffer, Symbol.species, {
+ value: null,
+ configurable: true
+ })
+ }
+ }
+
+ function assertSize (size) {
+ if (typeof size !== 'number') {
+ throw new TypeError('"size" argument must be a number')
+ } else if (size < 0) {
+ throw new RangeError('"size" argument must not be negative')
+ }
+ }
+
+ function alloc (that, size, fill, encoding) {
+ assertSize(size)
+ if (size <= 0) {
+ return createBuffer(that, size)
+ }
+ if (fill !== undefined) {
+ // Only pay attention to encoding if it's a string. This
+ // prevents accidentally sending in a number that would
+ // be interpretted as a start offset.
+ return typeof encoding === 'string'
+ ? createBuffer(that, size).fill(fill, encoding)
+ : createBuffer(that, size).fill(fill)
+ }
+ return createBuffer(that, size)
+ }
+
+ /**
+ * Creates a new filled Buffer instance.
+ * alloc(size[, fill[, encoding]])
+ **/
+ Buffer.alloc = function (size, fill, encoding) {
+ return alloc(null, size, fill, encoding)
+ }
+
+ function allocUnsafe (that, size) {
+ assertSize(size)
+ that = createBuffer(that, size < 0 ? 0 : checked(size) | 0)
+ if (!Buffer.TYPED_ARRAY_SUPPORT) {
+ for (var i = 0; i < size; ++i) {
+ that[i] = 0
+ }
+ }
+ return that
+ }
+
+ /**
+ * Equivalent to Buffer(num), by default creates a non-zero-filled Buffer instance.
+ * */
+ Buffer.allocUnsafe = function (size) {
+ return allocUnsafe(null, size)
+ }
+ /**
+ * Equivalent to SlowBuffer(num), by default creates a non-zero-filled Buffer instance.
+ */
+ Buffer.allocUnsafeSlow = function (size) {
+ return allocUnsafe(null, size)
+ }
+
+ function fromString (that, string, encoding) {
+ if (typeof encoding !== 'string' || encoding === '') {
+ encoding = 'utf8'
+ }
+
+ if (!Buffer.isEncoding(encoding)) {
+ throw new TypeError('"encoding" must be a valid string encoding')
+ }
+
+ var length = byteLength(string, encoding) | 0
+ that = createBuffer(that, length)
+
+ var actual = that.write(string, encoding)
+
+ if (actual !== length) {
+ // Writing a hex string, for example, that contains invalid characters will
+ // cause everything after the first invalid character to be ignored. (e.g.
+ // 'abxxcd' will be treated as 'ab')
+ that = that.slice(0, actual)
+ }
+
+ return that
+ }
+
+ function fromArrayLike (that, array) {
+ var length = array.length < 0 ? 0 : checked(array.length) | 0
+ that = createBuffer(that, length)
+ for (var i = 0; i < length; i += 1) {
+ that[i] = array[i] & 255
+ }
+ return that
+ }
+
+ function fromArrayBuffer (that, array, byteOffset, length) {
+ array.byteLength // this throws if `array` is not a valid ArrayBuffer
+
+ if (byteOffset < 0 || array.byteLength < byteOffset) {
+ throw new RangeError('\'offset\' is out of bounds')
+ }
+
+ if (array.byteLength < byteOffset + (length || 0)) {
+ throw new RangeError('\'length\' is out of bounds')
+ }
+
+ if (byteOffset === undefined && length === undefined) {
+ array = new Uint8Array(array)
+ } else if (length === undefined) {
+ array = new Uint8Array(array, byteOffset)
+ } else {
+ array = new Uint8Array(array, byteOffset, length)
+ }
+
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ // Return an augmented `Uint8Array` instance, for best performance
+ that = array
+ that.__proto__ = Buffer.prototype
+ } else {
+ // Fallback: Return an object instance of the Buffer class
+ that = fromArrayLike(that, array)
+ }
+ return that
+ }
+
+ function fromObject (that, obj) {
+ if (Buffer.isBuffer(obj)) {
+ var len = checked(obj.length) | 0
+ that = createBuffer(that, len)
+
+ if (that.length === 0) {
+ return that
+ }
+
+ obj.copy(that, 0, 0, len)
+ return that
+ }
+
+ if (obj) {
+ if ((typeof ArrayBuffer !== 'undefined' &&
+ obj.buffer instanceof ArrayBuffer) || 'length' in obj) {
+ if (typeof obj.length !== 'number' || isnan(obj.length)) {
+ return createBuffer(that, 0)
+ }
+ return fromArrayLike(that, obj)
+ }
+
+ if (obj.type === 'Buffer' && isArray(obj.data)) {
+ return fromArrayLike(that, obj.data)
+ }
+ }
+
+ throw new TypeError('First argument must be a string, Buffer, ArrayBuffer, Array, or array-like object.')
+ }
+
+ function checked (length) {
+ // Note: cannot use `length < kMaxLength()` here because that fails when
+ // length is NaN (which is otherwise coerced to zero.)
+ if (length >= kMaxLength()) {
+ throw new RangeError('Attempt to allocate Buffer larger than maximum ' +
+ 'size: 0x' + kMaxLength().toString(16) + ' bytes')
+ }
+ return length | 0
+ }
+
+ function SlowBuffer (length) {
+ if (+length != length) { // eslint-disable-line eqeqeq
+ length = 0
+ }
+ return Buffer.alloc(+length)
+ }
+
+ Buffer.isBuffer = function isBuffer (b) {
+ return !!(b != null && b._isBuffer)
+ }
+
+ Buffer.compare = function compare (a, b) {
+ if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) {
+ throw new TypeError('Arguments must be Buffers')
+ }
+
+ if (a === b) return 0
+
+ var x = a.length
+ var y = b.length
+
+ for (var i = 0, len = Math.min(x, y); i < len; ++i) {
+ if (a[i] !== b[i]) {
+ x = a[i]
+ y = b[i]
+ break
+ }
+ }
+
+ if (x < y) return -1
+ if (y < x) return 1
+ return 0
+ }
+
+ Buffer.isEncoding = function isEncoding (encoding) {
+ switch (String(encoding).toLowerCase()) {
+ case 'hex':
+ case 'utf8':
+ case 'utf-8':
+ case 'ascii':
+ case 'latin1':
+ case 'binary':
+ case 'base64':
+ case 'ucs2':
+ case 'ucs-2':
+ case 'utf16le':
+ case 'utf-16le':
+ return true
+ default:
+ return false
+ }
+ }
+
+ Buffer.concat = function concat (list, length) {
+ if (!isArray(list)) {
+ throw new TypeError('"list" argument must be an Array of Buffers')
+ }
+
+ if (list.length === 0) {
+ return Buffer.alloc(0)
+ }
+
+ var i
+ if (length === undefined) {
+ length = 0
+ for (i = 0; i < list.length; ++i) {
+ length += list[i].length
+ }
+ }
+
+ var buffer = Buffer.allocUnsafe(length)
+ var pos = 0
+ for (i = 0; i < list.length; ++i) {
+ var buf = list[i]
+ if (!Buffer.isBuffer(buf)) {
+ throw new TypeError('"list" argument must be an Array of Buffers')
+ }
+ buf.copy(buffer, pos)
+ pos += buf.length
+ }
+ return buffer
+ }
+
+ function byteLength (string, encoding) {
+ if (Buffer.isBuffer(string)) {
+ return string.length
+ }
+ if (typeof ArrayBuffer !== 'undefined' && typeof ArrayBuffer.isView === 'function' &&
+ (ArrayBuffer.isView(string) || string instanceof ArrayBuffer)) {
+ return string.byteLength
+ }
+ if (typeof string !== 'string') {
+ string = '' + string
+ }
+
+ var len = string.length
+ if (len === 0) return 0
+
+ // Use a for loop to avoid recursion
+ var loweredCase = false
+ for (;;) {
+ switch (encoding) {
+ case 'ascii':
+ case 'latin1':
+ case 'binary':
+ return len
+ case 'utf8':
+ case 'utf-8':
+ case undefined:
+ return utf8ToBytes(string).length
+ case 'ucs2':
+ case 'ucs-2':
+ case 'utf16le':
+ case 'utf-16le':
+ return len * 2
+ case 'hex':
+ return len >>> 1
+ case 'base64':
+ return base64ToBytes(string).length
+ default:
+ if (loweredCase) return utf8ToBytes(string).length // assume utf8
+ encoding = ('' + encoding).toLowerCase()
+ loweredCase = true
+ }
+ }
+ }
+ Buffer.byteLength = byteLength
+
+ function slowToString (encoding, start, end) {
+ var loweredCase = false
+
+ // No need to verify that "this.length <= MAX_UINT32" since it's a read-only
+ // property of a typed array.
+
+ // This behaves neither like String nor Uint8Array in that we set start/end
+ // to their upper/lower bounds if the value passed is out of range.
+ // undefined is handled specially as per ECMA-262 6th Edition,
+ // Section 13.3.3.7 Runtime Semantics: KeyedBindingInitialization.
+ if (start === undefined || start < 0) {
+ start = 0
+ }
+ // Return early if start > this.length. Done here to prevent potential uint32
+ // coercion fail below.
+ if (start > this.length) {
+ return ''
+ }
+
+ if (end === undefined || end > this.length) {
+ end = this.length
+ }
+
+ if (end <= 0) {
+ return ''
+ }
+
+ // Force coersion to uint32. This will also coerce falsey/NaN values to 0.
+ end >>>= 0
+ start >>>= 0
+
+ if (end <= start) {
+ return ''
+ }
+
+ if (!encoding) encoding = 'utf8'
+
+ while (true) {
+ switch (encoding) {
+ case 'hex':
+ return hexSlice(this, start, end)
+
+ case 'utf8':
+ case 'utf-8':
+ return utf8Slice(this, start, end)
+
+ case 'ascii':
+ return asciiSlice(this, start, end)
+
+ case 'latin1':
+ case 'binary':
+ return latin1Slice(this, start, end)
+
+ case 'base64':
+ return base64Slice(this, start, end)
+
+ case 'ucs2':
+ case 'ucs-2':
+ case 'utf16le':
+ case 'utf-16le':
+ return utf16leSlice(this, start, end)
+
+ default:
+ if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
+ encoding = (encoding + '').toLowerCase()
+ loweredCase = true
+ }
+ }
+ }
+
+ // The property is used by `Buffer.isBuffer` and `is-buffer` (in Safari 5-7) to detect
+ // Buffer instances.
+ Buffer.prototype._isBuffer = true
+
+ function swap (b, n, m) {
+ var i = b[n]
+ b[n] = b[m]
+ b[m] = i
+ }
+
+ Buffer.prototype.swap16 = function swap16 () {
+ var len = this.length
+ if (len % 2 !== 0) {
+ throw new RangeError('Buffer size must be a multiple of 16-bits')
+ }
+ for (var i = 0; i < len; i += 2) {
+ swap(this, i, i + 1)
+ }
+ return this
+ }
+
+ Buffer.prototype.swap32 = function swap32 () {
+ var len = this.length
+ if (len % 4 !== 0) {
+ throw new RangeError('Buffer size must be a multiple of 32-bits')
+ }
+ for (var i = 0; i < len; i += 4) {
+ swap(this, i, i + 3)
+ swap(this, i + 1, i + 2)
+ }
+ return this
+ }
+
+ Buffer.prototype.swap64 = function swap64 () {
+ var len = this.length
+ if (len % 8 !== 0) {
+ throw new RangeError('Buffer size must be a multiple of 64-bits')
+ }
+ for (var i = 0; i < len; i += 8) {
+ swap(this, i, i + 7)
+ swap(this, i + 1, i + 6)
+ swap(this, i + 2, i + 5)
+ swap(this, i + 3, i + 4)
+ }
+ return this
+ }
+
+ Buffer.prototype.toString = function toString () {
+ var length = this.length | 0
+ if (length === 0) return ''
+ if (arguments.length === 0) return utf8Slice(this, 0, length)
+ return slowToString.apply(this, arguments)
+ }
+
+ Buffer.prototype.equals = function equals (b) {
+ if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer')
+ if (this === b) return true
+ return Buffer.compare(this, b) === 0
+ }
+
+ Buffer.prototype.inspect = function inspect () {
+ var str = ''
+ var max = exports.INSPECT_MAX_BYTES
+ if (this.length > 0) {
+ str = this.toString('hex', 0, max).match(/.{2}/g).join(' ')
+ if (this.length > max) str += ' ... '
+ }
+ return ''
+ }
+
+ Buffer.prototype.compare = function compare (target, start, end, thisStart, thisEnd) {
+ if (!Buffer.isBuffer(target)) {
+ throw new TypeError('Argument must be a Buffer')
+ }
+
+ if (start === undefined) {
+ start = 0
+ }
+ if (end === undefined) {
+ end = target ? target.length : 0
+ }
+ if (thisStart === undefined) {
+ thisStart = 0
+ }
+ if (thisEnd === undefined) {
+ thisEnd = this.length
+ }
+
+ if (start < 0 || end > target.length || thisStart < 0 || thisEnd > this.length) {
+ throw new RangeError('out of range index')
+ }
+
+ if (thisStart >= thisEnd && start >= end) {
+ return 0
+ }
+ if (thisStart >= thisEnd) {
+ return -1
+ }
+ if (start >= end) {
+ return 1
+ }
+
+ start >>>= 0
+ end >>>= 0
+ thisStart >>>= 0
+ thisEnd >>>= 0
+
+ if (this === target) return 0
+
+ var x = thisEnd - thisStart
+ var y = end - start
+ var len = Math.min(x, y)
+
+ var thisCopy = this.slice(thisStart, thisEnd)
+ var targetCopy = target.slice(start, end)
+
+ for (var i = 0; i < len; ++i) {
+ if (thisCopy[i] !== targetCopy[i]) {
+ x = thisCopy[i]
+ y = targetCopy[i]
+ break
+ }
+ }
+
+ if (x < y) return -1
+ if (y < x) return 1
+ return 0
+ }
+
+ // Finds either the first index of `val` in `buffer` at offset >= `byteOffset`,
+ // OR the last index of `val` in `buffer` at offset <= `byteOffset`.
+ //
+ // Arguments:
+ // - buffer - a Buffer to search
+ // - val - a string, Buffer, or number
+ // - byteOffset - an index into `buffer`; will be clamped to an int32
+ // - encoding - an optional encoding, relevant is val is a string
+ // - dir - true for indexOf, false for lastIndexOf
+ function bidirectionalIndexOf (buffer, val, byteOffset, encoding, dir) {
+ // Empty buffer means no match
+ if (buffer.length === 0) return -1
+
+ // Normalize byteOffset
+ if (typeof byteOffset === 'string') {
+ encoding = byteOffset
+ byteOffset = 0
+ } else if (byteOffset > 0x7fffffff) {
+ byteOffset = 0x7fffffff
+ } else if (byteOffset < -0x80000000) {
+ byteOffset = -0x80000000
+ }
+ byteOffset = +byteOffset // Coerce to Number.
+ if (isNaN(byteOffset)) {
+ // byteOffset: it it's undefined, null, NaN, "foo", etc, search whole buffer
+ byteOffset = dir ? 0 : (buffer.length - 1)
+ }
+
+ // Normalize byteOffset: negative offsets start from the end of the buffer
+ if (byteOffset < 0) byteOffset = buffer.length + byteOffset
+ if (byteOffset >= buffer.length) {
+ if (dir) return -1
+ else byteOffset = buffer.length - 1
+ } else if (byteOffset < 0) {
+ if (dir) byteOffset = 0
+ else return -1
+ }
+
+ // Normalize val
+ if (typeof val === 'string') {
+ val = Buffer.from(val, encoding)
+ }
+
+ // Finally, search either indexOf (if dir is true) or lastIndexOf
+ if (Buffer.isBuffer(val)) {
+ // Special case: looking for empty string/buffer always fails
+ if (val.length === 0) {
+ return -1
+ }
+ return arrayIndexOf(buffer, val, byteOffset, encoding, dir)
+ } else if (typeof val === 'number') {
+ val = val & 0xFF // Search for a byte value [0-255]
+ if (Buffer.TYPED_ARRAY_SUPPORT &&
+ typeof Uint8Array.prototype.indexOf === 'function') {
+ if (dir) {
+ return Uint8Array.prototype.indexOf.call(buffer, val, byteOffset)
+ } else {
+ return Uint8Array.prototype.lastIndexOf.call(buffer, val, byteOffset)
+ }
+ }
+ return arrayIndexOf(buffer, [ val ], byteOffset, encoding, dir)
+ }
+
+ throw new TypeError('val must be string, number or Buffer')
+ }
+
+ function arrayIndexOf (arr, val, byteOffset, encoding, dir) {
+ var indexSize = 1
+ var arrLength = arr.length
+ var valLength = val.length
+
+ if (encoding !== undefined) {
+ encoding = String(encoding).toLowerCase()
+ if (encoding === 'ucs2' || encoding === 'ucs-2' ||
+ encoding === 'utf16le' || encoding === 'utf-16le') {
+ if (arr.length < 2 || val.length < 2) {
+ return -1
+ }
+ indexSize = 2
+ arrLength /= 2
+ valLength /= 2
+ byteOffset /= 2
+ }
+ }
+
+ function read (buf, i) {
+ if (indexSize === 1) {
+ return buf[i]
+ } else {
+ return buf.readUInt16BE(i * indexSize)
+ }
+ }
+
+ var i
+ if (dir) {
+ var foundIndex = -1
+ for (i = byteOffset; i < arrLength; i++) {
+ if (read(arr, i) === read(val, foundIndex === -1 ? 0 : i - foundIndex)) {
+ if (foundIndex === -1) foundIndex = i
+ if (i - foundIndex + 1 === valLength) return foundIndex * indexSize
+ } else {
+ if (foundIndex !== -1) i -= i - foundIndex
+ foundIndex = -1
+ }
+ }
+ } else {
+ if (byteOffset + valLength > arrLength) byteOffset = arrLength - valLength
+ for (i = byteOffset; i >= 0; i--) {
+ var found = true
+ for (var j = 0; j < valLength; j++) {
+ if (read(arr, i + j) !== read(val, j)) {
+ found = false
+ break
+ }
+ }
+ if (found) return i
+ }
+ }
+
+ return -1
+ }
+
+ Buffer.prototype.includes = function includes (val, byteOffset, encoding) {
+ return this.indexOf(val, byteOffset, encoding) !== -1
+ }
+
+ Buffer.prototype.indexOf = function indexOf (val, byteOffset, encoding) {
+ return bidirectionalIndexOf(this, val, byteOffset, encoding, true)
+ }
+
+ Buffer.prototype.lastIndexOf = function lastIndexOf (val, byteOffset, encoding) {
+ return bidirectionalIndexOf(this, val, byteOffset, encoding, false)
+ }
+
+ function hexWrite (buf, string, offset, length) {
+ offset = Number(offset) || 0
+ var remaining = buf.length - offset
+ if (!length) {
+ length = remaining
+ } else {
+ length = Number(length)
+ if (length > remaining) {
+ length = remaining
+ }
+ }
+
+ // must be an even number of digits
+ var strLen = string.length
+ if (strLen % 2 !== 0) throw new TypeError('Invalid hex string')
+
+ if (length > strLen / 2) {
+ length = strLen / 2
+ }
+ for (var i = 0; i < length; ++i) {
+ var parsed = parseInt(string.substr(i * 2, 2), 16)
+ if (isNaN(parsed)) return i
+ buf[offset + i] = parsed
+ }
+ return i
+ }
+
+ function utf8Write (buf, string, offset, length) {
+ return blitBuffer(utf8ToBytes(string, buf.length - offset), buf, offset, length)
+ }
+
+ function asciiWrite (buf, string, offset, length) {
+ return blitBuffer(asciiToBytes(string), buf, offset, length)
+ }
+
+ function latin1Write (buf, string, offset, length) {
+ return asciiWrite(buf, string, offset, length)
+ }
+
+ function base64Write (buf, string, offset, length) {
+ return blitBuffer(base64ToBytes(string), buf, offset, length)
+ }
+
+ function ucs2Write (buf, string, offset, length) {
+ return blitBuffer(utf16leToBytes(string, buf.length - offset), buf, offset, length)
+ }
+
+ Buffer.prototype.write = function write (string, offset, length, encoding) {
+ // Buffer#write(string)
+ if (offset === undefined) {
+ encoding = 'utf8'
+ length = this.length
+ offset = 0
+ // Buffer#write(string, encoding)
+ } else if (length === undefined && typeof offset === 'string') {
+ encoding = offset
+ length = this.length
+ offset = 0
+ // Buffer#write(string, offset[, length][, encoding])
+ } else if (isFinite(offset)) {
+ offset = offset | 0
+ if (isFinite(length)) {
+ length = length | 0
+ if (encoding === undefined) encoding = 'utf8'
+ } else {
+ encoding = length
+ length = undefined
+ }
+ // legacy write(string, encoding, offset, length) - remove in v0.13
+ } else {
+ throw new Error(
+ 'Buffer.write(string, encoding, offset[, length]) is no longer supported'
+ )
+ }
+
+ var remaining = this.length - offset
+ if (length === undefined || length > remaining) length = remaining
+
+ if ((string.length > 0 && (length < 0 || offset < 0)) || offset > this.length) {
+ throw new RangeError('Attempt to write outside buffer bounds')
+ }
+
+ if (!encoding) encoding = 'utf8'
+
+ var loweredCase = false
+ for (;;) {
+ switch (encoding) {
+ case 'hex':
+ return hexWrite(this, string, offset, length)
+
+ case 'utf8':
+ case 'utf-8':
+ return utf8Write(this, string, offset, length)
+
+ case 'ascii':
+ return asciiWrite(this, string, offset, length)
+
+ case 'latin1':
+ case 'binary':
+ return latin1Write(this, string, offset, length)
+
+ case 'base64':
+ // Warning: maxLength not taken into account in base64Write
+ return base64Write(this, string, offset, length)
+
+ case 'ucs2':
+ case 'ucs-2':
+ case 'utf16le':
+ case 'utf-16le':
+ return ucs2Write(this, string, offset, length)
+
+ default:
+ if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
+ encoding = ('' + encoding).toLowerCase()
+ loweredCase = true
+ }
+ }
+ }
+
+ Buffer.prototype.toJSON = function toJSON () {
+ return {
+ type: 'Buffer',
+ data: Array.prototype.slice.call(this._arr || this, 0)
+ }
+ }
+
+ function base64Slice (buf, start, end) {
+ if (start === 0 && end === buf.length) {
+ return base64.fromByteArray(buf)
+ } else {
+ return base64.fromByteArray(buf.slice(start, end))
+ }
+ }
+
+ function utf8Slice (buf, start, end) {
+ end = Math.min(buf.length, end)
+ var res = []
+
+ var i = start
+ while (i < end) {
+ var firstByte = buf[i]
+ var codePoint = null
+ var bytesPerSequence = (firstByte > 0xEF) ? 4
+ : (firstByte > 0xDF) ? 3
+ : (firstByte > 0xBF) ? 2
+ : 1
+
+ if (i + bytesPerSequence <= end) {
+ var secondByte, thirdByte, fourthByte, tempCodePoint
+
+ switch (bytesPerSequence) {
+ case 1:
+ if (firstByte < 0x80) {
+ codePoint = firstByte
+ }
+ break
+ case 2:
+ secondByte = buf[i + 1]
+ if ((secondByte & 0xC0) === 0x80) {
+ tempCodePoint = (firstByte & 0x1F) << 0x6 | (secondByte & 0x3F)
+ if (tempCodePoint > 0x7F) {
+ codePoint = tempCodePoint
+ }
+ }
+ break
+ case 3:
+ secondByte = buf[i + 1]
+ thirdByte = buf[i + 2]
+ if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80) {
+ tempCodePoint = (firstByte & 0xF) << 0xC | (secondByte & 0x3F) << 0x6 | (thirdByte & 0x3F)
+ if (tempCodePoint > 0x7FF && (tempCodePoint < 0xD800 || tempCodePoint > 0xDFFF)) {
+ codePoint = tempCodePoint
+ }
+ }
+ break
+ case 4:
+ secondByte = buf[i + 1]
+ thirdByte = buf[i + 2]
+ fourthByte = buf[i + 3]
+ if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80 && (fourthByte & 0xC0) === 0x80) {
+ tempCodePoint = (firstByte & 0xF) << 0x12 | (secondByte & 0x3F) << 0xC | (thirdByte & 0x3F) << 0x6 | (fourthByte & 0x3F)
+ if (tempCodePoint > 0xFFFF && tempCodePoint < 0x110000) {
+ codePoint = tempCodePoint
+ }
+ }
+ }
+ }
+
+ if (codePoint === null) {
+ // we did not generate a valid codePoint so insert a
+ // replacement char (U+FFFD) and advance only 1 byte
+ codePoint = 0xFFFD
+ bytesPerSequence = 1
+ } else if (codePoint > 0xFFFF) {
+ // encode to utf16 (surrogate pair dance)
+ codePoint -= 0x10000
+ res.push(codePoint >>> 10 & 0x3FF | 0xD800)
+ codePoint = 0xDC00 | codePoint & 0x3FF
+ }
+
+ res.push(codePoint)
+ i += bytesPerSequence
+ }
+
+ return decodeCodePointsArray(res)
+ }
+
+ // Based on http://stackoverflow.com/a/22747272/680742, the browser with
+ // the lowest limit is Chrome, with 0x10000 args.
+ // We go 1 magnitude less, for safety
+ var MAX_ARGUMENTS_LENGTH = 0x1000
+
+ function decodeCodePointsArray (codePoints) {
+ var len = codePoints.length
+ if (len <= MAX_ARGUMENTS_LENGTH) {
+ return String.fromCharCode.apply(String, codePoints) // avoid extra slice()
+ }
+
+ // Decode in chunks to avoid "call stack size exceeded".
+ var res = ''
+ var i = 0
+ while (i < len) {
+ res += String.fromCharCode.apply(
+ String,
+ codePoints.slice(i, i += MAX_ARGUMENTS_LENGTH)
+ )
+ }
+ return res
+ }
+
+ function asciiSlice (buf, start, end) {
+ var ret = ''
+ end = Math.min(buf.length, end)
+
+ for (var i = start; i < end; ++i) {
+ ret += String.fromCharCode(buf[i] & 0x7F)
+ }
+ return ret
+ }
+
+ function latin1Slice (buf, start, end) {
+ var ret = ''
+ end = Math.min(buf.length, end)
+
+ for (var i = start; i < end; ++i) {
+ ret += String.fromCharCode(buf[i])
+ }
+ return ret
+ }
+
+ function hexSlice (buf, start, end) {
+ var len = buf.length
+
+ if (!start || start < 0) start = 0
+ if (!end || end < 0 || end > len) end = len
+
+ var out = ''
+ for (var i = start; i < end; ++i) {
+ out += toHex(buf[i])
+ }
+ return out
+ }
+
+ function utf16leSlice (buf, start, end) {
+ var bytes = buf.slice(start, end)
+ var res = ''
+ for (var i = 0; i < bytes.length; i += 2) {
+ res += String.fromCharCode(bytes[i] + bytes[i + 1] * 256)
+ }
+ return res
+ }
+
+ Buffer.prototype.slice = function slice (start, end) {
+ var len = this.length
+ start = ~~start
+ end = end === undefined ? len : ~~end
+
+ if (start < 0) {
+ start += len
+ if (start < 0) start = 0
+ } else if (start > len) {
+ start = len
+ }
+
+ if (end < 0) {
+ end += len
+ if (end < 0) end = 0
+ } else if (end > len) {
+ end = len
+ }
+
+ if (end < start) end = start
+
+ var newBuf
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ newBuf = this.subarray(start, end)
+ newBuf.__proto__ = Buffer.prototype
+ } else {
+ var sliceLen = end - start
+ newBuf = new Buffer(sliceLen, undefined)
+ for (var i = 0; i < sliceLen; ++i) {
+ newBuf[i] = this[i + start]
+ }
+ }
+
+ return newBuf
+ }
+
+ /*
+ * Need to make sure that buffer isn't trying to write out of bounds.
+ */
+ function checkOffset (offset, ext, length) {
+ if ((offset % 1) !== 0 || offset < 0) throw new RangeError('offset is not uint')
+ if (offset + ext > length) throw new RangeError('Trying to access beyond buffer length')
+ }
+
+ Buffer.prototype.readUIntLE = function readUIntLE (offset, byteLength, noAssert) {
+ offset = offset | 0
+ byteLength = byteLength | 0
+ if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+ var val = this[offset]
+ var mul = 1
+ var i = 0
+ while (++i < byteLength && (mul *= 0x100)) {
+ val += this[offset + i] * mul
+ }
+
+ return val
+ }
+
+ Buffer.prototype.readUIntBE = function readUIntBE (offset, byteLength, noAssert) {
+ offset = offset | 0
+ byteLength = byteLength | 0
+ if (!noAssert) {
+ checkOffset(offset, byteLength, this.length)
+ }
+
+ var val = this[offset + --byteLength]
+ var mul = 1
+ while (byteLength > 0 && (mul *= 0x100)) {
+ val += this[offset + --byteLength] * mul
+ }
+
+ return val
+ }
+
+ Buffer.prototype.readUInt8 = function readUInt8 (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 1, this.length)
+ return this[offset]
+ }
+
+ Buffer.prototype.readUInt16LE = function readUInt16LE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 2, this.length)
+ return this[offset] | (this[offset + 1] << 8)
+ }
+
+ Buffer.prototype.readUInt16BE = function readUInt16BE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 2, this.length)
+ return (this[offset] << 8) | this[offset + 1]
+ }
+
+ Buffer.prototype.readUInt32LE = function readUInt32LE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 4, this.length)
+
+ return ((this[offset]) |
+ (this[offset + 1] << 8) |
+ (this[offset + 2] << 16)) +
+ (this[offset + 3] * 0x1000000)
+ }
+
+ Buffer.prototype.readUInt32BE = function readUInt32BE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 4, this.length)
+
+ return (this[offset] * 0x1000000) +
+ ((this[offset + 1] << 16) |
+ (this[offset + 2] << 8) |
+ this[offset + 3])
+ }
+
+ Buffer.prototype.readIntLE = function readIntLE (offset, byteLength, noAssert) {
+ offset = offset | 0
+ byteLength = byteLength | 0
+ if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+ var val = this[offset]
+ var mul = 1
+ var i = 0
+ while (++i < byteLength && (mul *= 0x100)) {
+ val += this[offset + i] * mul
+ }
+ mul *= 0x80
+
+ if (val >= mul) val -= Math.pow(2, 8 * byteLength)
+
+ return val
+ }
+
+ Buffer.prototype.readIntBE = function readIntBE (offset, byteLength, noAssert) {
+ offset = offset | 0
+ byteLength = byteLength | 0
+ if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+ var i = byteLength
+ var mul = 1
+ var val = this[offset + --i]
+ while (i > 0 && (mul *= 0x100)) {
+ val += this[offset + --i] * mul
+ }
+ mul *= 0x80
+
+ if (val >= mul) val -= Math.pow(2, 8 * byteLength)
+
+ return val
+ }
+
+ Buffer.prototype.readInt8 = function readInt8 (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 1, this.length)
+ if (!(this[offset] & 0x80)) return (this[offset])
+ return ((0xff - this[offset] + 1) * -1)
+ }
+
+ Buffer.prototype.readInt16LE = function readInt16LE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 2, this.length)
+ var val = this[offset] | (this[offset + 1] << 8)
+ return (val & 0x8000) ? val | 0xFFFF0000 : val
+ }
+
+ Buffer.prototype.readInt16BE = function readInt16BE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 2, this.length)
+ var val = this[offset + 1] | (this[offset] << 8)
+ return (val & 0x8000) ? val | 0xFFFF0000 : val
+ }
+
+ Buffer.prototype.readInt32LE = function readInt32LE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 4, this.length)
+
+ return (this[offset]) |
+ (this[offset + 1] << 8) |
+ (this[offset + 2] << 16) |
+ (this[offset + 3] << 24)
+ }
+
+ Buffer.prototype.readInt32BE = function readInt32BE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 4, this.length)
+
+ return (this[offset] << 24) |
+ (this[offset + 1] << 16) |
+ (this[offset + 2] << 8) |
+ (this[offset + 3])
+ }
+
+ Buffer.prototype.readFloatLE = function readFloatLE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 4, this.length)
+ return ieee754.read(this, offset, true, 23, 4)
+ }
+
+ Buffer.prototype.readFloatBE = function readFloatBE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 4, this.length)
+ return ieee754.read(this, offset, false, 23, 4)
+ }
+
+ Buffer.prototype.readDoubleLE = function readDoubleLE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 8, this.length)
+ return ieee754.read(this, offset, true, 52, 8)
+ }
+
+ Buffer.prototype.readDoubleBE = function readDoubleBE (offset, noAssert) {
+ if (!noAssert) checkOffset(offset, 8, this.length)
+ return ieee754.read(this, offset, false, 52, 8)
+ }
+
+ function checkInt (buf, value, offset, ext, max, min) {
+ if (!Buffer.isBuffer(buf)) throw new TypeError('"buffer" argument must be a Buffer instance')
+ if (value > max || value < min) throw new RangeError('"value" argument is out of bounds')
+ if (offset + ext > buf.length) throw new RangeError('Index out of range')
+ }
+
+ Buffer.prototype.writeUIntLE = function writeUIntLE (value, offset, byteLength, noAssert) {
+ value = +value
+ offset = offset | 0
+ byteLength = byteLength | 0
+ if (!noAssert) {
+ var maxBytes = Math.pow(2, 8 * byteLength) - 1
+ checkInt(this, value, offset, byteLength, maxBytes, 0)
+ }
+
+ var mul = 1
+ var i = 0
+ this[offset] = value & 0xFF
+ while (++i < byteLength && (mul *= 0x100)) {
+ this[offset + i] = (value / mul) & 0xFF
+ }
+
+ return offset + byteLength
+ }
+
+ Buffer.prototype.writeUIntBE = function writeUIntBE (value, offset, byteLength, noAssert) {
+ value = +value
+ offset = offset | 0
+ byteLength = byteLength | 0
+ if (!noAssert) {
+ var maxBytes = Math.pow(2, 8 * byteLength) - 1
+ checkInt(this, value, offset, byteLength, maxBytes, 0)
+ }
+
+ var i = byteLength - 1
+ var mul = 1
+ this[offset + i] = value & 0xFF
+ while (--i >= 0 && (mul *= 0x100)) {
+ this[offset + i] = (value / mul) & 0xFF
+ }
+
+ return offset + byteLength
+ }
+
+ Buffer.prototype.writeUInt8 = function writeUInt8 (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 1, 0xff, 0)
+ if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value)
+ this[offset] = (value & 0xff)
+ return offset + 1
+ }
+
+ function objectWriteUInt16 (buf, value, offset, littleEndian) {
+ if (value < 0) value = 0xffff + value + 1
+ for (var i = 0, j = Math.min(buf.length - offset, 2); i < j; ++i) {
+ buf[offset + i] = (value & (0xff << (8 * (littleEndian ? i : 1 - i)))) >>>
+ (littleEndian ? i : 1 - i) * 8
+ }
+ }
+
+ Buffer.prototype.writeUInt16LE = function writeUInt16LE (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ this[offset] = (value & 0xff)
+ this[offset + 1] = (value >>> 8)
+ } else {
+ objectWriteUInt16(this, value, offset, true)
+ }
+ return offset + 2
+ }
+
+ Buffer.prototype.writeUInt16BE = function writeUInt16BE (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ this[offset] = (value >>> 8)
+ this[offset + 1] = (value & 0xff)
+ } else {
+ objectWriteUInt16(this, value, offset, false)
+ }
+ return offset + 2
+ }
+
+ function objectWriteUInt32 (buf, value, offset, littleEndian) {
+ if (value < 0) value = 0xffffffff + value + 1
+ for (var i = 0, j = Math.min(buf.length - offset, 4); i < j; ++i) {
+ buf[offset + i] = (value >>> (littleEndian ? i : 3 - i) * 8) & 0xff
+ }
+ }
+
+ Buffer.prototype.writeUInt32LE = function writeUInt32LE (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ this[offset + 3] = (value >>> 24)
+ this[offset + 2] = (value >>> 16)
+ this[offset + 1] = (value >>> 8)
+ this[offset] = (value & 0xff)
+ } else {
+ objectWriteUInt32(this, value, offset, true)
+ }
+ return offset + 4
+ }
+
+ Buffer.prototype.writeUInt32BE = function writeUInt32BE (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ this[offset] = (value >>> 24)
+ this[offset + 1] = (value >>> 16)
+ this[offset + 2] = (value >>> 8)
+ this[offset + 3] = (value & 0xff)
+ } else {
+ objectWriteUInt32(this, value, offset, false)
+ }
+ return offset + 4
+ }
+
+ Buffer.prototype.writeIntLE = function writeIntLE (value, offset, byteLength, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) {
+ var limit = Math.pow(2, 8 * byteLength - 1)
+
+ checkInt(this, value, offset, byteLength, limit - 1, -limit)
+ }
+
+ var i = 0
+ var mul = 1
+ var sub = 0
+ this[offset] = value & 0xFF
+ while (++i < byteLength && (mul *= 0x100)) {
+ if (value < 0 && sub === 0 && this[offset + i - 1] !== 0) {
+ sub = 1
+ }
+ this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
+ }
+
+ return offset + byteLength
+ }
+
+ Buffer.prototype.writeIntBE = function writeIntBE (value, offset, byteLength, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) {
+ var limit = Math.pow(2, 8 * byteLength - 1)
+
+ checkInt(this, value, offset, byteLength, limit - 1, -limit)
+ }
+
+ var i = byteLength - 1
+ var mul = 1
+ var sub = 0
+ this[offset + i] = value & 0xFF
+ while (--i >= 0 && (mul *= 0x100)) {
+ if (value < 0 && sub === 0 && this[offset + i + 1] !== 0) {
+ sub = 1
+ }
+ this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
+ }
+
+ return offset + byteLength
+ }
+
+ Buffer.prototype.writeInt8 = function writeInt8 (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 1, 0x7f, -0x80)
+ if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value)
+ if (value < 0) value = 0xff + value + 1
+ this[offset] = (value & 0xff)
+ return offset + 1
+ }
+
+ Buffer.prototype.writeInt16LE = function writeInt16LE (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ this[offset] = (value & 0xff)
+ this[offset + 1] = (value >>> 8)
+ } else {
+ objectWriteUInt16(this, value, offset, true)
+ }
+ return offset + 2
+ }
+
+ Buffer.prototype.writeInt16BE = function writeInt16BE (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ this[offset] = (value >>> 8)
+ this[offset + 1] = (value & 0xff)
+ } else {
+ objectWriteUInt16(this, value, offset, false)
+ }
+ return offset + 2
+ }
+
+ Buffer.prototype.writeInt32LE = function writeInt32LE (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ this[offset] = (value & 0xff)
+ this[offset + 1] = (value >>> 8)
+ this[offset + 2] = (value >>> 16)
+ this[offset + 3] = (value >>> 24)
+ } else {
+ objectWriteUInt32(this, value, offset, true)
+ }
+ return offset + 4
+ }
+
+ Buffer.prototype.writeInt32BE = function writeInt32BE (value, offset, noAssert) {
+ value = +value
+ offset = offset | 0
+ if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
+ if (value < 0) value = 0xffffffff + value + 1
+ if (Buffer.TYPED_ARRAY_SUPPORT) {
+ this[offset] = (value >>> 24)
+ this[offset + 1] = (value >>> 16)
+ this[offset + 2] = (value >>> 8)
+ this[offset + 3] = (value & 0xff)
+ } else {
+ objectWriteUInt32(this, value, offset, false)
+ }
+ return offset + 4
+ }
+
+ function checkIEEE754 (buf, value, offset, ext, max, min) {
+ if (offset + ext > buf.length) throw new RangeError('Index out of range')
+ if (offset < 0) throw new RangeError('Index out of range')
+ }
+
+ function writeFloat (buf, value, offset, littleEndian, noAssert) {
+ if (!noAssert) {
+ checkIEEE754(buf, value, offset, 4, 3.4028234663852886e+38, -3.4028234663852886e+38)
+ }
+ ieee754.write(buf, value, offset, littleEndian, 23, 4)
+ return offset + 4
+ }
+
+ Buffer.prototype.writeFloatLE = function writeFloatLE (value, offset, noAssert) {
+ return writeFloat(this, value, offset, true, noAssert)
+ }
+
+ Buffer.prototype.writeFloatBE = function writeFloatBE (value, offset, noAssert) {
+ return writeFloat(this, value, offset, false, noAssert)
+ }
+
+ function writeDouble (buf, value, offset, littleEndian, noAssert) {
+ if (!noAssert) {
+ checkIEEE754(buf, value, offset, 8, 1.7976931348623157E+308, -1.7976931348623157E+308)
+ }
+ ieee754.write(buf, value, offset, littleEndian, 52, 8)
+ return offset + 8
+ }
+
+ Buffer.prototype.writeDoubleLE = function writeDoubleLE (value, offset, noAssert) {
+ return writeDouble(this, value, offset, true, noAssert)
+ }
+
+ Buffer.prototype.writeDoubleBE = function writeDoubleBE (value, offset, noAssert) {
+ return writeDouble(this, value, offset, false, noAssert)
+ }
+
+ // copy(targetBuffer, targetStart=0, sourceStart=0, sourceEnd=buffer.length)
+ Buffer.prototype.copy = function copy (target, targetStart, start, end) {
+ if (!start) start = 0
+ if (!end && end !== 0) end = this.length
+ if (targetStart >= target.length) targetStart = target.length
+ if (!targetStart) targetStart = 0
+ if (end > 0 && end < start) end = start
+
+ // Copy 0 bytes; we're done
+ if (end === start) return 0
+ if (target.length === 0 || this.length === 0) return 0
+
+ // Fatal error conditions
+ if (targetStart < 0) {
+ throw new RangeError('targetStart out of bounds')
+ }
+ if (start < 0 || start >= this.length) throw new RangeError('sourceStart out of bounds')
+ if (end < 0) throw new RangeError('sourceEnd out of bounds')
+
+ // Are we oob?
+ if (end > this.length) end = this.length
+ if (target.length - targetStart < end - start) {
+ end = target.length - targetStart + start
+ }
+
+ var len = end - start
+ var i
+
+ if (this === target && start < targetStart && targetStart < end) {
+ // descending copy from end
+ for (i = len - 1; i >= 0; --i) {
+ target[i + targetStart] = this[i + start]
+ }
+ } else if (len < 1000 || !Buffer.TYPED_ARRAY_SUPPORT) {
+ // ascending copy from start
+ for (i = 0; i < len; ++i) {
+ target[i + targetStart] = this[i + start]
+ }
+ } else {
+ Uint8Array.prototype.set.call(
+ target,
+ this.subarray(start, start + len),
+ targetStart
+ )
+ }
+
+ return len
+ }
+
+ // Usage:
+ // buffer.fill(number[, offset[, end]])
+ // buffer.fill(buffer[, offset[, end]])
+ // buffer.fill(string[, offset[, end]][, encoding])
+ Buffer.prototype.fill = function fill (val, start, end, encoding) {
+ // Handle string cases:
+ if (typeof val === 'string') {
+ if (typeof start === 'string') {
+ encoding = start
+ start = 0
+ end = this.length
+ } else if (typeof end === 'string') {
+ encoding = end
+ end = this.length
+ }
+ if (val.length === 1) {
+ var code = val.charCodeAt(0)
+ if (code < 256) {
+ val = code
+ }
+ }
+ if (encoding !== undefined && typeof encoding !== 'string') {
+ throw new TypeError('encoding must be a string')
+ }
+ if (typeof encoding === 'string' && !Buffer.isEncoding(encoding)) {
+ throw new TypeError('Unknown encoding: ' + encoding)
+ }
+ } else if (typeof val === 'number') {
+ val = val & 255
+ }
+
+ // Invalid ranges are not set to a default, so can range check early.
+ if (start < 0 || this.length < start || this.length < end) {
+ throw new RangeError('Out of range index')
+ }
+
+ if (end <= start) {
+ return this
+ }
+
+ start = start >>> 0
+ end = end === undefined ? this.length : end >>> 0
+
+ if (!val) val = 0
+
+ var i
+ if (typeof val === 'number') {
+ for (i = start; i < end; ++i) {
+ this[i] = val
+ }
+ } else {
+ var bytes = Buffer.isBuffer(val)
+ ? val
+ : utf8ToBytes(new Buffer(val, encoding).toString())
+ var len = bytes.length
+ for (i = 0; i < end - start; ++i) {
+ this[i + start] = bytes[i % len]
+ }
+ }
+
+ return this
+ }
+
+ // HELPER FUNCTIONS
+ // ================
+
+ var INVALID_BASE64_RE = /[^+\/0-9A-Za-z-_]/g
+
+ function base64clean (str) {
+ // Node strips out invalid characters like \n and \t from the string, base64-js does not
+ str = stringtrim(str).replace(INVALID_BASE64_RE, '')
+ // Node converts strings with length < 2 to ''
+ if (str.length < 2) return ''
+ // Node allows for non-padded base64 strings (missing trailing ===), base64-js does not
+ while (str.length % 4 !== 0) {
+ str = str + '='
+ }
+ return str
+ }
+
+ function stringtrim (str) {
+ if (str.trim) return str.trim()
+ return str.replace(/^\s+|\s+$/g, '')
+ }
+
+ function toHex (n) {
+ if (n < 16) return '0' + n.toString(16)
+ return n.toString(16)
+ }
+
+ function utf8ToBytes (string, units) {
+ units = units || Infinity
+ var codePoint
+ var length = string.length
+ var leadSurrogate = null
+ var bytes = []
+
+ for (var i = 0; i < length; ++i) {
+ codePoint = string.charCodeAt(i)
+
+ // is surrogate component
+ if (codePoint > 0xD7FF && codePoint < 0xE000) {
+ // last char was a lead
+ if (!leadSurrogate) {
+ // no lead yet
+ if (codePoint > 0xDBFF) {
+ // unexpected trail
+ if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+ continue
+ } else if (i + 1 === length) {
+ // unpaired lead
+ if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+ continue
+ }
+
+ // valid lead
+ leadSurrogate = codePoint
+
+ continue
+ }
+
+ // 2 leads in a row
+ if (codePoint < 0xDC00) {
+ if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+ leadSurrogate = codePoint
+ continue
+ }
+
+ // valid surrogate pair
+ codePoint = (leadSurrogate - 0xD800 << 10 | codePoint - 0xDC00) + 0x10000
+ } else if (leadSurrogate) {
+ // valid bmp char, but last char was a lead
+ if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+ }
+
+ leadSurrogate = null
+
+ // encode utf8
+ if (codePoint < 0x80) {
+ if ((units -= 1) < 0) break
+ bytes.push(codePoint)
+ } else if (codePoint < 0x800) {
+ if ((units -= 2) < 0) break
+ bytes.push(
+ codePoint >> 0x6 | 0xC0,
+ codePoint & 0x3F | 0x80
+ )
+ } else if (codePoint < 0x10000) {
+ if ((units -= 3) < 0) break
+ bytes.push(
+ codePoint >> 0xC | 0xE0,
+ codePoint >> 0x6 & 0x3F | 0x80,
+ codePoint & 0x3F | 0x80
+ )
+ } else if (codePoint < 0x110000) {
+ if ((units -= 4) < 0) break
+ bytes.push(
+ codePoint >> 0x12 | 0xF0,
+ codePoint >> 0xC & 0x3F | 0x80,
+ codePoint >> 0x6 & 0x3F | 0x80,
+ codePoint & 0x3F | 0x80
+ )
+ } else {
+ throw new Error('Invalid code point')
+ }
+ }
+
+ return bytes
+ }
+
+ function asciiToBytes (str) {
+ var byteArray = []
+ for (var i = 0; i < str.length; ++i) {
+ // Node's code seems to be doing this and not & 0x7F..
+ byteArray.push(str.charCodeAt(i) & 0xFF)
+ }
+ return byteArray
+ }
+
+ function utf16leToBytes (str, units) {
+ var c, hi, lo
+ var byteArray = []
+ for (var i = 0; i < str.length; ++i) {
+ if ((units -= 2) < 0) break
+
+ c = str.charCodeAt(i)
+ hi = c >> 8
+ lo = c % 256
+ byteArray.push(lo)
+ byteArray.push(hi)
+ }
+
+ return byteArray
+ }
+
+ function base64ToBytes (str) {
+ return base64.toByteArray(base64clean(str))
+ }
+
+ function blitBuffer (src, dst, offset, length) {
+ for (var i = 0; i < length; ++i) {
+ if ((i + offset >= dst.length) || (i >= src.length)) break
+ dst[i + offset] = src[i]
+ }
+ return i
+ }
+
+ function isnan (val) {
+ return val !== val // eslint-disable-line no-self-compare
+ }
+
+ /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }())))
+
+/***/ }),
+/* 340 */
+/***/ (function(module, exports) {
+
+ 'use strict'
+
+ exports.byteLength = byteLength
+ exports.toByteArray = toByteArray
+ exports.fromByteArray = fromByteArray
+
+ var lookup = []
+ var revLookup = []
+ var Arr = typeof Uint8Array !== 'undefined' ? Uint8Array : Array
+
+ var code = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'
+ for (var i = 0, len = code.length; i < len; ++i) {
+ lookup[i] = code[i]
+ revLookup[code.charCodeAt(i)] = i
+ }
+
+ // Support decoding URL-safe base64 strings, as Node.js does.
+ // See: https://en.wikipedia.org/wiki/Base64#URL_applications
+ revLookup['-'.charCodeAt(0)] = 62
+ revLookup['_'.charCodeAt(0)] = 63
+
+ function getLens (b64) {
+ var len = b64.length
+
+ if (len % 4 > 0) {
+ throw new Error('Invalid string. Length must be a multiple of 4')
+ }
+
+ // Trim off extra bytes after placeholder bytes are found
+ // See: https://github.com/beatgammit/base64-js/issues/42
+ var validLen = b64.indexOf('=')
+ if (validLen === -1) validLen = len
+
+ var placeHoldersLen = validLen === len
+ ? 0
+ : 4 - (validLen % 4)
+
+ return [validLen, placeHoldersLen]
+ }
+
+ // base64 is 4/3 + up to two characters of the original data
+ function byteLength (b64) {
+ var lens = getLens(b64)
+ var validLen = lens[0]
+ var placeHoldersLen = lens[1]
+ return ((validLen + placeHoldersLen) * 3 / 4) - placeHoldersLen
+ }
+
+ function _byteLength (b64, validLen, placeHoldersLen) {
+ return ((validLen + placeHoldersLen) * 3 / 4) - placeHoldersLen
+ }
+
+ function toByteArray (b64) {
+ var tmp
+ var lens = getLens(b64)
+ var validLen = lens[0]
+ var placeHoldersLen = lens[1]
+
+ var arr = new Arr(_byteLength(b64, validLen, placeHoldersLen))
+
+ var curByte = 0
+
+ // if there are placeholders, only get up to the last complete 4 chars
+ var len = placeHoldersLen > 0
+ ? validLen - 4
+ : validLen
+
+ var i
+ for (i = 0; i < len; i += 4) {
+ tmp =
+ (revLookup[b64.charCodeAt(i)] << 18) |
+ (revLookup[b64.charCodeAt(i + 1)] << 12) |
+ (revLookup[b64.charCodeAt(i + 2)] << 6) |
+ revLookup[b64.charCodeAt(i + 3)]
+ arr[curByte++] = (tmp >> 16) & 0xFF
+ arr[curByte++] = (tmp >> 8) & 0xFF
+ arr[curByte++] = tmp & 0xFF
+ }
+
+ if (placeHoldersLen === 2) {
+ tmp =
+ (revLookup[b64.charCodeAt(i)] << 2) |
+ (revLookup[b64.charCodeAt(i + 1)] >> 4)
+ arr[curByte++] = tmp & 0xFF
+ }
+
+ if (placeHoldersLen === 1) {
+ tmp =
+ (revLookup[b64.charCodeAt(i)] << 10) |
+ (revLookup[b64.charCodeAt(i + 1)] << 4) |
+ (revLookup[b64.charCodeAt(i + 2)] >> 2)
+ arr[curByte++] = (tmp >> 8) & 0xFF
+ arr[curByte++] = tmp & 0xFF
+ }
+
+ return arr
+ }
+
+ function tripletToBase64 (num) {
+ return lookup[num >> 18 & 0x3F] +
+ lookup[num >> 12 & 0x3F] +
+ lookup[num >> 6 & 0x3F] +
+ lookup[num & 0x3F]
+ }
+
+ function encodeChunk (uint8, start, end) {
+ var tmp
+ var output = []
+ for (var i = start; i < end; i += 3) {
+ tmp =
+ ((uint8[i] << 16) & 0xFF0000) +
+ ((uint8[i + 1] << 8) & 0xFF00) +
+ (uint8[i + 2] & 0xFF)
+ output.push(tripletToBase64(tmp))
+ }
+ return output.join('')
+ }
+
+ function fromByteArray (uint8) {
+ var tmp
+ var len = uint8.length
+ var extraBytes = len % 3 // if we have 1 byte left, pad 2 bytes
+ var parts = []
+ var maxChunkLength = 16383 // must be multiple of 3
+
+ // go through the array every three bytes, we'll deal with trailing stuff later
+ for (var i = 0, len2 = len - extraBytes; i < len2; i += maxChunkLength) {
+ parts.push(encodeChunk(
+ uint8, i, (i + maxChunkLength) > len2 ? len2 : (i + maxChunkLength)
+ ))
+ }
+
+ // pad the end with zeros, but make sure to not forget the extra bytes
+ if (extraBytes === 1) {
+ tmp = uint8[len - 1]
+ parts.push(
+ lookup[tmp >> 2] +
+ lookup[(tmp << 4) & 0x3F] +
+ '=='
+ )
+ } else if (extraBytes === 2) {
+ tmp = (uint8[len - 2] << 8) + uint8[len - 1]
+ parts.push(
+ lookup[tmp >> 10] +
+ lookup[(tmp >> 4) & 0x3F] +
+ lookup[(tmp << 2) & 0x3F] +
+ '='
+ )
+ }
+
+ return parts.join('')
+ }
+
+
+/***/ }),
+/* 341 */
+/***/ (function(module, exports) {
+
+ exports.read = function (buffer, offset, isLE, mLen, nBytes) {
+ var e, m
+ var eLen = (nBytes * 8) - mLen - 1
+ var eMax = (1 << eLen) - 1
+ var eBias = eMax >> 1
+ var nBits = -7
+ var i = isLE ? (nBytes - 1) : 0
+ var d = isLE ? -1 : 1
+ var s = buffer[offset + i]
+
+ i += d
+
+ e = s & ((1 << (-nBits)) - 1)
+ s >>= (-nBits)
+ nBits += eLen
+ for (; nBits > 0; e = (e * 256) + buffer[offset + i], i += d, nBits -= 8) {}
+
+ m = e & ((1 << (-nBits)) - 1)
+ e >>= (-nBits)
+ nBits += mLen
+ for (; nBits > 0; m = (m * 256) + buffer[offset + i], i += d, nBits -= 8) {}
+
+ if (e === 0) {
+ e = 1 - eBias
+ } else if (e === eMax) {
+ return m ? NaN : ((s ? -1 : 1) * Infinity)
+ } else {
+ m = m + Math.pow(2, mLen)
+ e = e - eBias
+ }
+ return (s ? -1 : 1) * m * Math.pow(2, e - mLen)
+ }
+
+ exports.write = function (buffer, value, offset, isLE, mLen, nBytes) {
+ var e, m, c
+ var eLen = (nBytes * 8) - mLen - 1
+ var eMax = (1 << eLen) - 1
+ var eBias = eMax >> 1
+ var rt = (mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0)
+ var i = isLE ? 0 : (nBytes - 1)
+ var d = isLE ? 1 : -1
+ var s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0
+
+ value = Math.abs(value)
+
+ if (isNaN(value) || value === Infinity) {
+ m = isNaN(value) ? 1 : 0
+ e = eMax
+ } else {
+ e = Math.floor(Math.log(value) / Math.LN2)
+ if (value * (c = Math.pow(2, -e)) < 1) {
+ e--
+ c *= 2
+ }
+ if (e + eBias >= 1) {
+ value += rt / c
+ } else {
+ value += rt * Math.pow(2, 1 - eBias)
+ }
+ if (value * c >= 2) {
+ e++
+ c /= 2
+ }
+
+ if (e + eBias >= eMax) {
+ m = 0
+ e = eMax
+ } else if (e + eBias >= 1) {
+ m = ((value * c) - 1) * Math.pow(2, mLen)
+ e = e + eBias
+ } else {
+ m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen)
+ e = 0
+ }
+ }
+
+ for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8) {}
+
+ e = (e << mLen) | m
+ eLen += mLen
+ for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8) {}
+
+ buffer[offset + i - d] |= s * 128
+ }
+
+
+/***/ }),
+/* 342 */
+/***/ (function(module, exports) {
+
+ var toString = {}.toString;
+
+ module.exports = Array.isArray || function (arr) {
+ return toString.call(arr) == '[object Array]';
+ };
+
+
+/***/ }),
+/* 343 */
+/***/ (function(module, exports) {
+
+ // shim for using process in browser
+ var process = module.exports = {};
+
+ // cached from whatever global is present so that test runners that stub it
+ // don't break things. But we need to wrap it in a try catch in case it is
+ // wrapped in strict mode code which doesn't define any globals. It's inside a
+ // function because try/catches deoptimize in certain engines.
+
+ var cachedSetTimeout;
+ var cachedClearTimeout;
+
+ function defaultSetTimout() {
+ throw new Error('setTimeout has not been defined');
+ }
+ function defaultClearTimeout () {
+ throw new Error('clearTimeout has not been defined');
+ }
+ (function () {
+ try {
+ if (typeof setTimeout === 'function') {
+ cachedSetTimeout = setTimeout;
+ } else {
+ cachedSetTimeout = defaultSetTimout;
+ }
+ } catch (e) {
+ cachedSetTimeout = defaultSetTimout;
+ }
+ try {
+ if (typeof clearTimeout === 'function') {
+ cachedClearTimeout = clearTimeout;
+ } else {
+ cachedClearTimeout = defaultClearTimeout;
+ }
+ } catch (e) {
+ cachedClearTimeout = defaultClearTimeout;
+ }
+ } ())
+ function runTimeout(fun) {
+ if (cachedSetTimeout === setTimeout) {
+ //normal enviroments in sane situations
+ return setTimeout(fun, 0);
+ }
+ // if setTimeout wasn't available but was latter defined
+ if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
+ cachedSetTimeout = setTimeout;
+ return setTimeout(fun, 0);
+ }
+ try {
+ // when when somebody has screwed with setTimeout but no I.E. maddness
+ return cachedSetTimeout(fun, 0);
+ } catch(e){
+ try {
+ // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
+ return cachedSetTimeout.call(null, fun, 0);
+ } catch(e){
+ // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
+ return cachedSetTimeout.call(this, fun, 0);
+ }
+ }
+
+
+ }
+ function runClearTimeout(marker) {
+ if (cachedClearTimeout === clearTimeout) {
+ //normal enviroments in sane situations
+ return clearTimeout(marker);
+ }
+ // if clearTimeout wasn't available but was latter defined
+ if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
+ cachedClearTimeout = clearTimeout;
+ return clearTimeout(marker);
+ }
+ try {
+ // when when somebody has screwed with setTimeout but no I.E. maddness
+ return cachedClearTimeout(marker);
+ } catch (e){
+ try {
+ // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
+ return cachedClearTimeout.call(null, marker);
+ } catch (e){
+ // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
+ // Some versions of I.E. have different rules for clearTimeout vs setTimeout
+ return cachedClearTimeout.call(this, marker);
+ }
+ }
+
+
+
+ }
+ var queue = [];
+ var draining = false;
+ var currentQueue;
+ var queueIndex = -1;
+
+ function cleanUpNextTick() {
+ if (!draining || !currentQueue) {
+ return;
+ }
+ draining = false;
+ if (currentQueue.length) {
+ queue = currentQueue.concat(queue);
+ } else {
+ queueIndex = -1;
+ }
+ if (queue.length) {
+ drainQueue();
+ }
+ }
+
+ function drainQueue() {
+ if (draining) {
+ return;
+ }
+ var timeout = runTimeout(cleanUpNextTick);
+ draining = true;
+
+ var len = queue.length;
+ while(len) {
+ currentQueue = queue;
+ queue = [];
+ while (++queueIndex < len) {
+ if (currentQueue) {
+ currentQueue[queueIndex].run();
+ }
+ }
+ queueIndex = -1;
+ len = queue.length;
+ }
+ currentQueue = null;
+ draining = false;
+ runClearTimeout(timeout);
+ }
+
+ process.nextTick = function (fun) {
+ var args = new Array(arguments.length - 1);
+ if (arguments.length > 1) {
+ for (var i = 1; i < arguments.length; i++) {
+ args[i - 1] = arguments[i];
+ }
+ }
+ queue.push(new Item(fun, args));
+ if (queue.length === 1 && !draining) {
+ runTimeout(drainQueue);
+ }
+ };
+
+ // v8 likes predictible objects
+ function Item(fun, array) {
+ this.fun = fun;
+ this.array = array;
+ }
+ Item.prototype.run = function () {
+ this.fun.apply(null, this.array);
+ };
+ process.title = 'browser';
+ process.browser = true;
+ process.env = {};
+ process.argv = [];
+ process.version = ''; // empty string to avoid regexp issues
+ process.versions = {};
+
+ function noop() {}
+
+ process.on = noop;
+ process.addListener = noop;
+ process.once = noop;
+ process.off = noop;
+ process.removeListener = noop;
+ process.removeAllListeners = noop;
+ process.emit = noop;
+ process.prependListener = noop;
+ process.prependOnceListener = noop;
+
+ process.listeners = function (name) { return [] }
+
+ process.binding = function (name) {
+ throw new Error('process.binding is not supported');
+ };
+
+ process.cwd = function () { return '/' };
+ process.chdir = function (dir) {
+ throw new Error('process.chdir is not supported');
+ };
+ process.umask = function() { return 0; };
+
+
+/***/ }),
+/* 344 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(Buffer) {'use strict';
+
+ /**
+ * Normalizes our expected stringified form of a function across versions of node
+ * @param {Function} fn The function to stringify
+ */
+
+ function normalizedFunctionString(fn) {
+ return fn.toString().replace(/function *\(/, 'function (');
+ }
+
+ function newBuffer(item, encoding) {
+ return new Buffer(item, encoding);
+ }
+
+ function allocBuffer() {
+ return Buffer.alloc.apply(Buffer, arguments);
+ }
+
+ function toBuffer() {
+ return Buffer.from.apply(Buffer, arguments);
+ }
+
+ module.exports = {
+ normalizedFunctionString: normalizedFunctionString,
+ allocBuffer: typeof Buffer.alloc === 'function' ? allocBuffer : newBuffer,
+ toBuffer: typeof Buffer.from === 'function' ? toBuffer : newBuffer
+ };
+ /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer))
+
+/***/ }),
+/* 345 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(global, process) {// Copyright Joyent, Inc. and other Node contributors.
+ //
+ // Permission is hereby granted, free of charge, to any person obtaining a
+ // copy of this software and associated documentation files (the
+ // "Software"), to deal in the Software without restriction, including
+ // without limitation the rights to use, copy, modify, merge, publish,
+ // distribute, sublicense, and/or sell copies of the Software, and to permit
+ // persons to whom the Software is furnished to do so, subject to the
+ // following conditions:
+ //
+ // The above copyright notice and this permission notice shall be included
+ // in all copies or substantial portions of the Software.
+ //
+ // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+ // OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+ // MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+ // NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+ // DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+ // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+ // USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+ var formatRegExp = /%[sdj%]/g;
+ exports.format = function(f) {
+ if (!isString(f)) {
+ var objects = [];
+ for (var i = 0; i < arguments.length; i++) {
+ objects.push(inspect(arguments[i]));
+ }
+ return objects.join(' ');
+ }
+
+ var i = 1;
+ var args = arguments;
+ var len = args.length;
+ var str = String(f).replace(formatRegExp, function(x) {
+ if (x === '%%') return '%';
+ if (i >= len) return x;
+ switch (x) {
+ case '%s': return String(args[i++]);
+ case '%d': return Number(args[i++]);
+ case '%j':
+ try {
+ return JSON.stringify(args[i++]);
+ } catch (_) {
+ return '[Circular]';
+ }
+ default:
+ return x;
+ }
+ });
+ for (var x = args[i]; i < len; x = args[++i]) {
+ if (isNull(x) || !isObject(x)) {
+ str += ' ' + x;
+ } else {
+ str += ' ' + inspect(x);
+ }
+ }
+ return str;
+ };
+
+
+ // Mark that a method should not be used.
+ // Returns a modified function which warns once by default.
+ // If --no-deprecation is set, then it is a no-op.
+ exports.deprecate = function(fn, msg) {
+ // Allow for deprecating things in the process of starting up.
+ if (isUndefined(global.process)) {
+ return function() {
+ return exports.deprecate(fn, msg).apply(this, arguments);
+ };
+ }
+
+ if (process.noDeprecation === true) {
+ return fn;
+ }
+
+ var warned = false;
+ function deprecated() {
+ if (!warned) {
+ if (process.throwDeprecation) {
+ throw new Error(msg);
+ } else if (process.traceDeprecation) {
+ console.trace(msg);
+ } else {
+ console.error(msg);
+ }
+ warned = true;
+ }
+ return fn.apply(this, arguments);
+ }
+
+ return deprecated;
+ };
+
+
+ var debugs = {};
+ var debugEnviron;
+ exports.debuglog = function(set) {
+ if (isUndefined(debugEnviron))
+ debugEnviron = process.env.NODE_DEBUG || '';
+ set = set.toUpperCase();
+ if (!debugs[set]) {
+ if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) {
+ var pid = process.pid;
+ debugs[set] = function() {
+ var msg = exports.format.apply(exports, arguments);
+ console.error('%s %d: %s', set, pid, msg);
+ };
+ } else {
+ debugs[set] = function() {};
+ }
+ }
+ return debugs[set];
+ };
+
+
+ /**
+ * Echos the value of a value. Trys to print the value out
+ * in the best way possible given the different types.
+ *
+ * @param {Object} obj The object to print out.
+ * @param {Object} opts Optional options object that alters the output.
+ */
+ /* legacy: obj, showHidden, depth, colors*/
+ function inspect(obj, opts) {
+ // default options
+ var ctx = {
+ seen: [],
+ stylize: stylizeNoColor
+ };
+ // legacy...
+ if (arguments.length >= 3) ctx.depth = arguments[2];
+ if (arguments.length >= 4) ctx.colors = arguments[3];
+ if (isBoolean(opts)) {
+ // legacy...
+ ctx.showHidden = opts;
+ } else if (opts) {
+ // got an "options" object
+ exports._extend(ctx, opts);
+ }
+ // set default options
+ if (isUndefined(ctx.showHidden)) ctx.showHidden = false;
+ if (isUndefined(ctx.depth)) ctx.depth = 2;
+ if (isUndefined(ctx.colors)) ctx.colors = false;
+ if (isUndefined(ctx.customInspect)) ctx.customInspect = true;
+ if (ctx.colors) ctx.stylize = stylizeWithColor;
+ return formatValue(ctx, obj, ctx.depth);
+ }
+ exports.inspect = inspect;
+
+
+ // http://en.wikipedia.org/wiki/ANSI_escape_code#graphics
+ inspect.colors = {
+ 'bold' : [1, 22],
+ 'italic' : [3, 23],
+ 'underline' : [4, 24],
+ 'inverse' : [7, 27],
+ 'white' : [37, 39],
+ 'grey' : [90, 39],
+ 'black' : [30, 39],
+ 'blue' : [34, 39],
+ 'cyan' : [36, 39],
+ 'green' : [32, 39],
+ 'magenta' : [35, 39],
+ 'red' : [31, 39],
+ 'yellow' : [33, 39]
+ };
+
+ // Don't use 'blue' not visible on cmd.exe
+ inspect.styles = {
+ 'special': 'cyan',
+ 'number': 'yellow',
+ 'boolean': 'yellow',
+ 'undefined': 'grey',
+ 'null': 'bold',
+ 'string': 'green',
+ 'date': 'magenta',
+ // "name": intentionally not styling
+ 'regexp': 'red'
+ };
+
+
+ function stylizeWithColor(str, styleType) {
+ var style = inspect.styles[styleType];
+
+ if (style) {
+ return '\u001b[' + inspect.colors[style][0] + 'm' + str +
+ '\u001b[' + inspect.colors[style][1] + 'm';
+ } else {
+ return str;
+ }
+ }
+
+
+ function stylizeNoColor(str, styleType) {
+ return str;
+ }
+
+
+ function arrayToHash(array) {
+ var hash = {};
+
+ array.forEach(function(val, idx) {
+ hash[val] = true;
+ });
+
+ return hash;
+ }
+
+
+ function formatValue(ctx, value, recurseTimes) {
+ // Provide a hook for user-specified inspect functions.
+ // Check that value is an object with an inspect function on it
+ if (ctx.customInspect &&
+ value &&
+ isFunction(value.inspect) &&
+ // Filter out the util module, it's inspect function is special
+ value.inspect !== exports.inspect &&
+ // Also filter out any prototype objects using the circular check.
+ !(value.constructor && value.constructor.prototype === value)) {
+ var ret = value.inspect(recurseTimes, ctx);
+ if (!isString(ret)) {
+ ret = formatValue(ctx, ret, recurseTimes);
+ }
+ return ret;
+ }
+
+ // Primitive types cannot have properties
+ var primitive = formatPrimitive(ctx, value);
+ if (primitive) {
+ return primitive;
+ }
+
+ // Look up the keys of the object.
+ var keys = Object.keys(value);
+ var visibleKeys = arrayToHash(keys);
+
+ if (ctx.showHidden) {
+ keys = Object.getOwnPropertyNames(value);
+ }
+
+ // IE doesn't make error fields non-enumerable
+ // http://msdn.microsoft.com/en-us/library/ie/dww52sbt(v=vs.94).aspx
+ if (isError(value)
+ && (keys.indexOf('message') >= 0 || keys.indexOf('description') >= 0)) {
+ return formatError(value);
+ }
+
+ // Some type of object without properties can be shortcutted.
+ if (keys.length === 0) {
+ if (isFunction(value)) {
+ var name = value.name ? ': ' + value.name : '';
+ return ctx.stylize('[Function' + name + ']', 'special');
+ }
+ if (isRegExp(value)) {
+ return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp');
+ }
+ if (isDate(value)) {
+ return ctx.stylize(Date.prototype.toString.call(value), 'date');
+ }
+ if (isError(value)) {
+ return formatError(value);
+ }
+ }
+
+ var base = '', array = false, braces = ['{', '}'];
+
+ // Make Array say that they are Array
+ if (isArray(value)) {
+ array = true;
+ braces = ['[', ']'];
+ }
+
+ // Make functions say that they are functions
+ if (isFunction(value)) {
+ var n = value.name ? ': ' + value.name : '';
+ base = ' [Function' + n + ']';
+ }
+
+ // Make RegExps say that they are RegExps
+ if (isRegExp(value)) {
+ base = ' ' + RegExp.prototype.toString.call(value);
+ }
+
+ // Make dates with properties first say the date
+ if (isDate(value)) {
+ base = ' ' + Date.prototype.toUTCString.call(value);
+ }
+
+ // Make error with message first say the error
+ if (isError(value)) {
+ base = ' ' + formatError(value);
+ }
+
+ if (keys.length === 0 && (!array || value.length == 0)) {
+ return braces[0] + base + braces[1];
+ }
+
+ if (recurseTimes < 0) {
+ if (isRegExp(value)) {
+ return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp');
+ } else {
+ return ctx.stylize('[Object]', 'special');
+ }
+ }
+
+ ctx.seen.push(value);
+
+ var output;
+ if (array) {
+ output = formatArray(ctx, value, recurseTimes, visibleKeys, keys);
+ } else {
+ output = keys.map(function(key) {
+ return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array);
+ });
+ }
+
+ ctx.seen.pop();
+
+ return reduceToSingleString(output, base, braces);
+ }
+
+
+ function formatPrimitive(ctx, value) {
+ if (isUndefined(value))
+ return ctx.stylize('undefined', 'undefined');
+ if (isString(value)) {
+ var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '')
+ .replace(/'/g, "\\'")
+ .replace(/\\"/g, '"') + '\'';
+ return ctx.stylize(simple, 'string');
+ }
+ if (isNumber(value))
+ return ctx.stylize('' + value, 'number');
+ if (isBoolean(value))
+ return ctx.stylize('' + value, 'boolean');
+ // For some reason typeof null is "object", so special case here.
+ if (isNull(value))
+ return ctx.stylize('null', 'null');
+ }
+
+
+ function formatError(value) {
+ return '[' + Error.prototype.toString.call(value) + ']';
+ }
+
+
+ function formatArray(ctx, value, recurseTimes, visibleKeys, keys) {
+ var output = [];
+ for (var i = 0, l = value.length; i < l; ++i) {
+ if (hasOwnProperty(value, String(i))) {
+ output.push(formatProperty(ctx, value, recurseTimes, visibleKeys,
+ String(i), true));
+ } else {
+ output.push('');
+ }
+ }
+ keys.forEach(function(key) {
+ if (!key.match(/^\d+$/)) {
+ output.push(formatProperty(ctx, value, recurseTimes, visibleKeys,
+ key, true));
+ }
+ });
+ return output;
+ }
+
+
+ function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) {
+ var name, str, desc;
+ desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] };
+ if (desc.get) {
+ if (desc.set) {
+ str = ctx.stylize('[Getter/Setter]', 'special');
+ } else {
+ str = ctx.stylize('[Getter]', 'special');
+ }
+ } else {
+ if (desc.set) {
+ str = ctx.stylize('[Setter]', 'special');
+ }
+ }
+ if (!hasOwnProperty(visibleKeys, key)) {
+ name = '[' + key + ']';
+ }
+ if (!str) {
+ if (ctx.seen.indexOf(desc.value) < 0) {
+ if (isNull(recurseTimes)) {
+ str = formatValue(ctx, desc.value, null);
+ } else {
+ str = formatValue(ctx, desc.value, recurseTimes - 1);
+ }
+ if (str.indexOf('\n') > -1) {
+ if (array) {
+ str = str.split('\n').map(function(line) {
+ return ' ' + line;
+ }).join('\n').substr(2);
+ } else {
+ str = '\n' + str.split('\n').map(function(line) {
+ return ' ' + line;
+ }).join('\n');
+ }
+ }
+ } else {
+ str = ctx.stylize('[Circular]', 'special');
+ }
+ }
+ if (isUndefined(name)) {
+ if (array && key.match(/^\d+$/)) {
+ return str;
+ }
+ name = JSON.stringify('' + key);
+ if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) {
+ name = name.substr(1, name.length - 2);
+ name = ctx.stylize(name, 'name');
+ } else {
+ name = name.replace(/'/g, "\\'")
+ .replace(/\\"/g, '"')
+ .replace(/(^"|"$)/g, "'");
+ name = ctx.stylize(name, 'string');
+ }
+ }
+
+ return name + ': ' + str;
+ }
+
+
+ function reduceToSingleString(output, base, braces) {
+ var numLinesEst = 0;
+ var length = output.reduce(function(prev, cur) {
+ numLinesEst++;
+ if (cur.indexOf('\n') >= 0) numLinesEst++;
+ return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1;
+ }, 0);
+
+ if (length > 60) {
+ return braces[0] +
+ (base === '' ? '' : base + '\n ') +
+ ' ' +
+ output.join(',\n ') +
+ ' ' +
+ braces[1];
+ }
+
+ return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1];
+ }
+
+
+ // NOTE: These type checking functions intentionally don't use `instanceof`
+ // because it is fragile and can be easily faked with `Object.create()`.
+ function isArray(ar) {
+ return Array.isArray(ar);
+ }
+ exports.isArray = isArray;
+
+ function isBoolean(arg) {
+ return typeof arg === 'boolean';
+ }
+ exports.isBoolean = isBoolean;
+
+ function isNull(arg) {
+ return arg === null;
+ }
+ exports.isNull = isNull;
+
+ function isNullOrUndefined(arg) {
+ return arg == null;
+ }
+ exports.isNullOrUndefined = isNullOrUndefined;
+
+ function isNumber(arg) {
+ return typeof arg === 'number';
+ }
+ exports.isNumber = isNumber;
+
+ function isString(arg) {
+ return typeof arg === 'string';
+ }
+ exports.isString = isString;
+
+ function isSymbol(arg) {
+ return typeof arg === 'symbol';
+ }
+ exports.isSymbol = isSymbol;
+
+ function isUndefined(arg) {
+ return arg === void 0;
+ }
+ exports.isUndefined = isUndefined;
+
+ function isRegExp(re) {
+ return isObject(re) && objectToString(re) === '[object RegExp]';
+ }
+ exports.isRegExp = isRegExp;
+
+ function isObject(arg) {
+ return typeof arg === 'object' && arg !== null;
+ }
+ exports.isObject = isObject;
+
+ function isDate(d) {
+ return isObject(d) && objectToString(d) === '[object Date]';
+ }
+ exports.isDate = isDate;
+
+ function isError(e) {
+ return isObject(e) &&
+ (objectToString(e) === '[object Error]' || e instanceof Error);
+ }
+ exports.isError = isError;
+
+ function isFunction(arg) {
+ return typeof arg === 'function';
+ }
+ exports.isFunction = isFunction;
+
+ function isPrimitive(arg) {
+ return arg === null ||
+ typeof arg === 'boolean' ||
+ typeof arg === 'number' ||
+ typeof arg === 'string' ||
+ typeof arg === 'symbol' || // ES6 symbol
+ typeof arg === 'undefined';
+ }
+ exports.isPrimitive = isPrimitive;
+
+ exports.isBuffer = __webpack_require__(346);
+
+ function objectToString(o) {
+ return Object.prototype.toString.call(o);
+ }
+
+
+ function pad(n) {
+ return n < 10 ? '0' + n.toString(10) : n.toString(10);
+ }
+
+
+ var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep',
+ 'Oct', 'Nov', 'Dec'];
+
+ // 26 Feb 16:19:34
+ function timestamp() {
+ var d = new Date();
+ var time = [pad(d.getHours()),
+ pad(d.getMinutes()),
+ pad(d.getSeconds())].join(':');
+ return [d.getDate(), months[d.getMonth()], time].join(' ');
+ }
+
+
+ // log is just a thin wrapper to console.log that prepends a timestamp
+ exports.log = function() {
+ console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments));
+ };
+
+
+ /**
+ * Inherit the prototype methods from one constructor into another.
+ *
+ * The Function.prototype.inherits from lang.js rewritten as a standalone
+ * function (not on Function.prototype). NOTE: If this file is to be loaded
+ * during bootstrapping this function needs to be rewritten using some native
+ * functions as prototype setup using normal JavaScript does not work as
+ * expected during bootstrapping (see mirror.js in r114903).
+ *
+ * @param {function} ctor Constructor function which needs to inherit the
+ * prototype.
+ * @param {function} superCtor Constructor function to inherit prototype from.
+ */
+ exports.inherits = __webpack_require__(347);
+
+ exports._extend = function(origin, add) {
+ // Don't do anything if add isn't an object
+ if (!add || !isObject(add)) return origin;
+
+ var keys = Object.keys(add);
+ var i = keys.length;
+ while (i--) {
+ origin[keys[i]] = add[keys[i]];
+ }
+ return origin;
+ };
+
+ function hasOwnProperty(obj, prop) {
+ return Object.prototype.hasOwnProperty.call(obj, prop);
+ }
+
+ /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }()), __webpack_require__(343)))
+
+/***/ }),
+/* 346 */
+/***/ (function(module, exports) {
+
+ module.exports = function isBuffer(arg) {
+ return arg && typeof arg === 'object'
+ && typeof arg.copy === 'function'
+ && typeof arg.fill === 'function'
+ && typeof arg.readUInt8 === 'function';
+ }
+
+/***/ }),
+/* 347 */
+/***/ (function(module, exports) {
+
+ if (typeof Object.create === 'function') {
+ // implementation from standard node.js 'util' module
+ module.exports = function inherits(ctor, superCtor) {
+ ctor.super_ = superCtor
+ ctor.prototype = Object.create(superCtor.prototype, {
+ constructor: {
+ value: ctor,
+ enumerable: false,
+ writable: true,
+ configurable: true
+ }
+ });
+ };
+ } else {
+ // old school shim for old browsers
+ module.exports = function inherits(ctor, superCtor) {
+ ctor.super_ = superCtor
+ var TempCtor = function () {}
+ TempCtor.prototype = superCtor.prototype
+ ctor.prototype = new TempCtor()
+ ctor.prototype.constructor = ctor
+ }
+ }
+
+
+/***/ }),
+/* 348 */
+/***/ (function(module, exports) {
+
+ /**
+ * A class representation of the BSON RegExp type.
+ *
+ * @class
+ * @return {BSONRegExp} A MinKey instance
+ */
+ function BSONRegExp(pattern, options) {
+ if (!(this instanceof BSONRegExp)) return new BSONRegExp();
+
+ // Execute
+ this._bsontype = 'BSONRegExp';
+ this.pattern = pattern || '';
+ this.options = options || '';
+
+ // Validate options
+ for (var i = 0; i < this.options.length; i++) {
+ if (!(this.options[i] === 'i' || this.options[i] === 'm' || this.options[i] === 'x' || this.options[i] === 'l' || this.options[i] === 's' || this.options[i] === 'u')) {
+ throw new Error('the regular expression options [' + this.options[i] + '] is not supported');
+ }
+ }
+ }
+
+ module.exports = BSONRegExp;
+ module.exports.BSONRegExp = BSONRegExp;
+
+/***/ }),
+/* 349 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(Buffer) {// Custom inspect property name / symbol.
+ var inspect = Buffer ? __webpack_require__(345).inspect.custom || 'inspect' : 'inspect';
+
+ /**
+ * A class representation of the BSON Symbol type.
+ *
+ * @class
+ * @deprecated
+ * @param {string} value the string representing the symbol.
+ * @return {Symbol}
+ */
+ function Symbol(value) {
+ if (!(this instanceof Symbol)) return new Symbol(value);
+ this._bsontype = 'Symbol';
+ this.value = value;
+ }
+
+ /**
+ * Access the wrapped string value.
+ *
+ * @method
+ * @return {String} returns the wrapped string.
+ */
+ Symbol.prototype.valueOf = function () {
+ return this.value;
+ };
+
+ /**
+ * @ignore
+ */
+ Symbol.prototype.toString = function () {
+ return this.value;
+ };
+
+ /**
+ * @ignore
+ */
+ Symbol.prototype[inspect] = function () {
+ return this.value;
+ };
+
+ /**
+ * @ignore
+ */
+ Symbol.prototype.toJSON = function () {
+ return this.value;
+ };
+
+ module.exports = Symbol;
+ module.exports.Symbol = Symbol;
+ /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer))
+
+/***/ }),
+/* 350 */
+/***/ (function(module, exports) {
+
+ /**
+ * A class representation of a BSON Int32 type.
+ *
+ * @class
+ * @param {number} value the number we want to represent as an int32.
+ * @return {Int32}
+ */
+ var Int32 = function (value) {
+ if (!(this instanceof Int32)) return new Int32(value);
+
+ this._bsontype = 'Int32';
+ this.value = value;
+ };
+
+ /**
+ * Access the number value.
+ *
+ * @method
+ * @return {number} returns the wrapped int32 number.
+ */
+ Int32.prototype.valueOf = function () {
+ return this.value;
+ };
+
+ /**
+ * @ignore
+ */
+ Int32.prototype.toJSON = function () {
+ return this.value;
+ };
+
+ module.exports = Int32;
+ module.exports.Int32 = Int32;
+
+/***/ }),
+/* 351 */
+/***/ (function(module, exports) {
+
+ /**
+ * A class representation of the BSON Code type.
+ *
+ * @class
+ * @param {(string|function)} code a string or function.
+ * @param {Object} [scope] an optional scope for the function.
+ * @return {Code}
+ */
+ var Code = function Code(code, scope) {
+ if (!(this instanceof Code)) return new Code(code, scope);
+ this._bsontype = 'Code';
+ this.code = code;
+ this.scope = scope;
+ };
+
+ /**
+ * @ignore
+ */
+ Code.prototype.toJSON = function () {
+ return { scope: this.scope, code: this.code };
+ };
+
+ module.exports = Code;
+ module.exports.Code = Code;
+
+/***/ }),
+/* 352 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var Long = __webpack_require__(335);
+
+ var PARSE_STRING_REGEXP = /^(\+|-)?(\d+|(\d*\.\d*))?(E|e)?([-+])?(\d+)?$/;
+ var PARSE_INF_REGEXP = /^(\+|-)?(Infinity|inf)$/i;
+ var PARSE_NAN_REGEXP = /^(\+|-)?NaN$/i;
+
+ var EXPONENT_MAX = 6111;
+ var EXPONENT_MIN = -6176;
+ var EXPONENT_BIAS = 6176;
+ var MAX_DIGITS = 34;
+
+ // Nan value bits as 32 bit values (due to lack of longs)
+ var NAN_BUFFER = [0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00].reverse();
+ // Infinity value bits 32 bit values (due to lack of longs)
+ var INF_NEGATIVE_BUFFER = [0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00].reverse();
+ var INF_POSITIVE_BUFFER = [0x78, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00].reverse();
+
+ var EXPONENT_REGEX = /^([-+])?(\d+)?$/;
+
+ var utils = __webpack_require__(344);
+
+ // Detect if the value is a digit
+ var isDigit = function (value) {
+ return !isNaN(parseInt(value, 10));
+ };
+
+ // Divide two uint128 values
+ var divideu128 = function (value) {
+ var DIVISOR = Long.fromNumber(1000 * 1000 * 1000);
+ var _rem = Long.fromNumber(0);
+ var i = 0;
+
+ if (!value.parts[0] && !value.parts[1] && !value.parts[2] && !value.parts[3]) {
+ return { quotient: value, rem: _rem };
+ }
+
+ for (i = 0; i <= 3; i++) {
+ // Adjust remainder to match value of next dividend
+ _rem = _rem.shiftLeft(32);
+ // Add the divided to _rem
+ _rem = _rem.add(new Long(value.parts[i], 0));
+ value.parts[i] = _rem.div(DIVISOR).low_;
+ _rem = _rem.modulo(DIVISOR);
+ }
+
+ return { quotient: value, rem: _rem };
+ };
+
+ // Multiply two Long values and return the 128 bit value
+ var multiply64x2 = function (left, right) {
+ if (!left && !right) {
+ return { high: Long.fromNumber(0), low: Long.fromNumber(0) };
+ }
+
+ var leftHigh = left.shiftRightUnsigned(32);
+ var leftLow = new Long(left.getLowBits(), 0);
+ var rightHigh = right.shiftRightUnsigned(32);
+ var rightLow = new Long(right.getLowBits(), 0);
+
+ var productHigh = leftHigh.multiply(rightHigh);
+ var productMid = leftHigh.multiply(rightLow);
+ var productMid2 = leftLow.multiply(rightHigh);
+ var productLow = leftLow.multiply(rightLow);
+
+ productHigh = productHigh.add(productMid.shiftRightUnsigned(32));
+ productMid = new Long(productMid.getLowBits(), 0).add(productMid2).add(productLow.shiftRightUnsigned(32));
+
+ productHigh = productHigh.add(productMid.shiftRightUnsigned(32));
+ productLow = productMid.shiftLeft(32).add(new Long(productLow.getLowBits(), 0));
+
+ // Return the 128 bit result
+ return { high: productHigh, low: productLow };
+ };
+
+ var lessThan = function (left, right) {
+ // Make values unsigned
+ var uhleft = left.high_ >>> 0;
+ var uhright = right.high_ >>> 0;
+
+ // Compare high bits first
+ if (uhleft < uhright) {
+ return true;
+ } else if (uhleft === uhright) {
+ var ulleft = left.low_ >>> 0;
+ var ulright = right.low_ >>> 0;
+ if (ulleft < ulright) return true;
+ }
+
+ return false;
+ };
+
+ // var longtoHex = function(value) {
+ // var buffer = utils.allocBuffer(8);
+ // var index = 0;
+ // // Encode the low 64 bits of the decimal
+ // // Encode low bits
+ // buffer[index++] = value.low_ & 0xff;
+ // buffer[index++] = (value.low_ >> 8) & 0xff;
+ // buffer[index++] = (value.low_ >> 16) & 0xff;
+ // buffer[index++] = (value.low_ >> 24) & 0xff;
+ // // Encode high bits
+ // buffer[index++] = value.high_ & 0xff;
+ // buffer[index++] = (value.high_ >> 8) & 0xff;
+ // buffer[index++] = (value.high_ >> 16) & 0xff;
+ // buffer[index++] = (value.high_ >> 24) & 0xff;
+ // return buffer.reverse().toString('hex');
+ // };
+
+ // var int32toHex = function(value) {
+ // var buffer = utils.allocBuffer(4);
+ // var index = 0;
+ // // Encode the low 64 bits of the decimal
+ // // Encode low bits
+ // buffer[index++] = value & 0xff;
+ // buffer[index++] = (value >> 8) & 0xff;
+ // buffer[index++] = (value >> 16) & 0xff;
+ // buffer[index++] = (value >> 24) & 0xff;
+ // return buffer.reverse().toString('hex');
+ // };
+
+ /**
+ * A class representation of the BSON Decimal128 type.
+ *
+ * @class
+ * @param {Buffer} bytes a buffer containing the raw Decimal128 bytes.
+ * @return {Double}
+ */
+ var Decimal128 = function (bytes) {
+ this._bsontype = 'Decimal128';
+ this.bytes = bytes;
+ };
+
+ /**
+ * Create a Decimal128 instance from a string representation
+ *
+ * @method
+ * @param {string} string a numeric string representation.
+ * @return {Decimal128} returns a Decimal128 instance.
+ */
+ Decimal128.fromString = function (string) {
+ // Parse state tracking
+ var isNegative = false;
+ var sawRadix = false;
+ var foundNonZero = false;
+
+ // Total number of significant digits (no leading or trailing zero)
+ var significantDigits = 0;
+ // Total number of significand digits read
+ var nDigitsRead = 0;
+ // Total number of digits (no leading zeros)
+ var nDigits = 0;
+ // The number of the digits after radix
+ var radixPosition = 0;
+ // The index of the first non-zero in *str*
+ var firstNonZero = 0;
+
+ // Digits Array
+ var digits = [0];
+ // The number of digits in digits
+ var nDigitsStored = 0;
+ // Insertion pointer for digits
+ var digitsInsert = 0;
+ // The index of the first non-zero digit
+ var firstDigit = 0;
+ // The index of the last digit
+ var lastDigit = 0;
+
+ // Exponent
+ var exponent = 0;
+ // loop index over array
+ var i = 0;
+ // The high 17 digits of the significand
+ var significandHigh = [0, 0];
+ // The low 17 digits of the significand
+ var significandLow = [0, 0];
+ // The biased exponent
+ var biasedExponent = 0;
+
+ // Read index
+ var index = 0;
+
+ // Trim the string
+ string = string.trim();
+
+ // Naively prevent against REDOS attacks.
+ // TODO: implementing a custom parsing for this, or refactoring the regex would yield
+ // further gains.
+ if (string.length >= 7000) {
+ throw new Error('' + string + ' not a valid Decimal128 string');
+ }
+
+ // Results
+ var stringMatch = string.match(PARSE_STRING_REGEXP);
+ var infMatch = string.match(PARSE_INF_REGEXP);
+ var nanMatch = string.match(PARSE_NAN_REGEXP);
+
+ // Validate the string
+ if (!stringMatch && !infMatch && !nanMatch || string.length === 0) {
+ throw new Error('' + string + ' not a valid Decimal128 string');
+ }
+
+ // Check if we have an illegal exponent format
+ if (stringMatch && stringMatch[4] && stringMatch[2] === undefined) {
+ throw new Error('' + string + ' not a valid Decimal128 string');
+ }
+
+ // Get the negative or positive sign
+ if (string[index] === '+' || string[index] === '-') {
+ isNegative = string[index++] === '-';
+ }
+
+ // Check if user passed Infinity or NaN
+ if (!isDigit(string[index]) && string[index] !== '.') {
+ if (string[index] === 'i' || string[index] === 'I') {
+ return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER));
+ } else if (string[index] === 'N') {
+ return new Decimal128(utils.toBuffer(NAN_BUFFER));
+ }
+ }
+
+ // Read all the digits
+ while (isDigit(string[index]) || string[index] === '.') {
+ if (string[index] === '.') {
+ if (sawRadix) {
+ return new Decimal128(utils.toBuffer(NAN_BUFFER));
+ }
+
+ sawRadix = true;
+ index = index + 1;
+ continue;
+ }
+
+ if (nDigitsStored < 34) {
+ if (string[index] !== '0' || foundNonZero) {
+ if (!foundNonZero) {
+ firstNonZero = nDigitsRead;
+ }
+
+ foundNonZero = true;
+
+ // Only store 34 digits
+ digits[digitsInsert++] = parseInt(string[index], 10);
+ nDigitsStored = nDigitsStored + 1;
+ }
+ }
+
+ if (foundNonZero) {
+ nDigits = nDigits + 1;
+ }
+
+ if (sawRadix) {
+ radixPosition = radixPosition + 1;
+ }
+
+ nDigitsRead = nDigitsRead + 1;
+ index = index + 1;
+ }
+
+ if (sawRadix && !nDigitsRead) {
+ throw new Error('' + string + ' not a valid Decimal128 string');
+ }
+
+ // Read exponent if exists
+ if (string[index] === 'e' || string[index] === 'E') {
+ // Read exponent digits
+ var match = string.substr(++index).match(EXPONENT_REGEX);
+
+ // No digits read
+ if (!match || !match[2]) {
+ return new Decimal128(utils.toBuffer(NAN_BUFFER));
+ }
+
+ // Get exponent
+ exponent = parseInt(match[0], 10);
+
+ // Adjust the index
+ index = index + match[0].length;
+ }
+
+ // Return not a number
+ if (string[index]) {
+ return new Decimal128(utils.toBuffer(NAN_BUFFER));
+ }
+
+ // Done reading input
+ // Find first non-zero digit in digits
+ firstDigit = 0;
+
+ if (!nDigitsStored) {
+ firstDigit = 0;
+ lastDigit = 0;
+ digits[0] = 0;
+ nDigits = 1;
+ nDigitsStored = 1;
+ significantDigits = 0;
+ } else {
+ lastDigit = nDigitsStored - 1;
+ significantDigits = nDigits;
+
+ if (exponent !== 0 && significantDigits !== 1) {
+ while (string[firstNonZero + significantDigits - 1] === '0') {
+ significantDigits = significantDigits - 1;
+ }
+ }
+ }
+
+ // Normalization of exponent
+ // Correct exponent based on radix position, and shift significand as needed
+ // to represent user input
+
+ // Overflow prevention
+ if (exponent <= radixPosition && radixPosition - exponent > 1 << 14) {
+ exponent = EXPONENT_MIN;
+ } else {
+ exponent = exponent - radixPosition;
+ }
+
+ // Attempt to normalize the exponent
+ while (exponent > EXPONENT_MAX) {
+ // Shift exponent to significand and decrease
+ lastDigit = lastDigit + 1;
+
+ if (lastDigit - firstDigit > MAX_DIGITS) {
+ // Check if we have a zero then just hard clamp, otherwise fail
+ var digitsString = digits.join('');
+ if (digitsString.match(/^0+$/)) {
+ exponent = EXPONENT_MAX;
+ break;
+ } else {
+ return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER));
+ }
+ }
+
+ exponent = exponent - 1;
+ }
+
+ while (exponent < EXPONENT_MIN || nDigitsStored < nDigits) {
+ // Shift last digit
+ if (lastDigit === 0) {
+ exponent = EXPONENT_MIN;
+ significantDigits = 0;
+ break;
+ }
+
+ if (nDigitsStored < nDigits) {
+ // adjust to match digits not stored
+ nDigits = nDigits - 1;
+ } else {
+ // adjust to round
+ lastDigit = lastDigit - 1;
+ }
+
+ if (exponent < EXPONENT_MAX) {
+ exponent = exponent + 1;
+ } else {
+ // Check if we have a zero then just hard clamp, otherwise fail
+ digitsString = digits.join('');
+ if (digitsString.match(/^0+$/)) {
+ exponent = EXPONENT_MAX;
+ break;
+ } else {
+ return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER));
+ }
+ }
+ }
+
+ // Round
+ // We've normalized the exponent, but might still need to round.
+ if (lastDigit - firstDigit + 1 < significantDigits && string[significantDigits] !== '0') {
+ var endOfString = nDigitsRead;
+
+ // If we have seen a radix point, 'string' is 1 longer than we have
+ // documented with ndigits_read, so inc the position of the first nonzero
+ // digit and the position that digits are read to.
+ if (sawRadix && exponent === EXPONENT_MIN) {
+ firstNonZero = firstNonZero + 1;
+ endOfString = endOfString + 1;
+ }
+
+ var roundDigit = parseInt(string[firstNonZero + lastDigit + 1], 10);
+ var roundBit = 0;
+
+ if (roundDigit >= 5) {
+ roundBit = 1;
+
+ if (roundDigit === 5) {
+ roundBit = digits[lastDigit] % 2 === 1;
+
+ for (i = firstNonZero + lastDigit + 2; i < endOfString; i++) {
+ if (parseInt(string[i], 10)) {
+ roundBit = 1;
+ break;
+ }
+ }
+ }
+ }
+
+ if (roundBit) {
+ var dIdx = lastDigit;
+
+ for (; dIdx >= 0; dIdx--) {
+ if (++digits[dIdx] > 9) {
+ digits[dIdx] = 0;
+
+ // overflowed most significant digit
+ if (dIdx === 0) {
+ if (exponent < EXPONENT_MAX) {
+ exponent = exponent + 1;
+ digits[dIdx] = 1;
+ } else {
+ return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER));
+ }
+ }
+ } else {
+ break;
+ }
+ }
+ }
+ }
+
+ // Encode significand
+ // The high 17 digits of the significand
+ significandHigh = Long.fromNumber(0);
+ // The low 17 digits of the significand
+ significandLow = Long.fromNumber(0);
+
+ // read a zero
+ if (significantDigits === 0) {
+ significandHigh = Long.fromNumber(0);
+ significandLow = Long.fromNumber(0);
+ } else if (lastDigit - firstDigit < 17) {
+ dIdx = firstDigit;
+ significandLow = Long.fromNumber(digits[dIdx++]);
+ significandHigh = new Long(0, 0);
+
+ for (; dIdx <= lastDigit; dIdx++) {
+ significandLow = significandLow.multiply(Long.fromNumber(10));
+ significandLow = significandLow.add(Long.fromNumber(digits[dIdx]));
+ }
+ } else {
+ dIdx = firstDigit;
+ significandHigh = Long.fromNumber(digits[dIdx++]);
+
+ for (; dIdx <= lastDigit - 17; dIdx++) {
+ significandHigh = significandHigh.multiply(Long.fromNumber(10));
+ significandHigh = significandHigh.add(Long.fromNumber(digits[dIdx]));
+ }
+
+ significandLow = Long.fromNumber(digits[dIdx++]);
+
+ for (; dIdx <= lastDigit; dIdx++) {
+ significandLow = significandLow.multiply(Long.fromNumber(10));
+ significandLow = significandLow.add(Long.fromNumber(digits[dIdx]));
+ }
+ }
+
+ var significand = multiply64x2(significandHigh, Long.fromString('100000000000000000'));
+
+ significand.low = significand.low.add(significandLow);
+
+ if (lessThan(significand.low, significandLow)) {
+ significand.high = significand.high.add(Long.fromNumber(1));
+ }
+
+ // Biased exponent
+ biasedExponent = exponent + EXPONENT_BIAS;
+ var dec = { low: Long.fromNumber(0), high: Long.fromNumber(0) };
+
+ // Encode combination, exponent, and significand.
+ if (significand.high.shiftRightUnsigned(49).and(Long.fromNumber(1)).equals(Long.fromNumber)) {
+ // Encode '11' into bits 1 to 3
+ dec.high = dec.high.or(Long.fromNumber(0x3).shiftLeft(61));
+ dec.high = dec.high.or(Long.fromNumber(biasedExponent).and(Long.fromNumber(0x3fff).shiftLeft(47)));
+ dec.high = dec.high.or(significand.high.and(Long.fromNumber(0x7fffffffffff)));
+ } else {
+ dec.high = dec.high.or(Long.fromNumber(biasedExponent & 0x3fff).shiftLeft(49));
+ dec.high = dec.high.or(significand.high.and(Long.fromNumber(0x1ffffffffffff)));
+ }
+
+ dec.low = significand.low;
+
+ // Encode sign
+ if (isNegative) {
+ dec.high = dec.high.or(Long.fromString('9223372036854775808'));
+ }
+
+ // Encode into a buffer
+ var buffer = utils.allocBuffer(16);
+ index = 0;
+
+ // Encode the low 64 bits of the decimal
+ // Encode low bits
+ buffer[index++] = dec.low.low_ & 0xff;
+ buffer[index++] = dec.low.low_ >> 8 & 0xff;
+ buffer[index++] = dec.low.low_ >> 16 & 0xff;
+ buffer[index++] = dec.low.low_ >> 24 & 0xff;
+ // Encode high bits
+ buffer[index++] = dec.low.high_ & 0xff;
+ buffer[index++] = dec.low.high_ >> 8 & 0xff;
+ buffer[index++] = dec.low.high_ >> 16 & 0xff;
+ buffer[index++] = dec.low.high_ >> 24 & 0xff;
+
+ // Encode the high 64 bits of the decimal
+ // Encode low bits
+ buffer[index++] = dec.high.low_ & 0xff;
+ buffer[index++] = dec.high.low_ >> 8 & 0xff;
+ buffer[index++] = dec.high.low_ >> 16 & 0xff;
+ buffer[index++] = dec.high.low_ >> 24 & 0xff;
+ // Encode high bits
+ buffer[index++] = dec.high.high_ & 0xff;
+ buffer[index++] = dec.high.high_ >> 8 & 0xff;
+ buffer[index++] = dec.high.high_ >> 16 & 0xff;
+ buffer[index++] = dec.high.high_ >> 24 & 0xff;
+
+ // Return the new Decimal128
+ return new Decimal128(buffer);
+ };
+
+ // Extract least significant 5 bits
+ var COMBINATION_MASK = 0x1f;
+ // Extract least significant 14 bits
+ var EXPONENT_MASK = 0x3fff;
+ // Value of combination field for Inf
+ var COMBINATION_INFINITY = 30;
+ // Value of combination field for NaN
+ var COMBINATION_NAN = 31;
+ // Value of combination field for NaN
+ // var COMBINATION_SNAN = 32;
+ // decimal128 exponent bias
+ EXPONENT_BIAS = 6176;
+
+ /**
+ * Create a string representation of the raw Decimal128 value
+ *
+ * @method
+ * @return {string} returns a Decimal128 string representation.
+ */
+ Decimal128.prototype.toString = function () {
+ // Note: bits in this routine are referred to starting at 0,
+ // from the sign bit, towards the coefficient.
+
+ // bits 0 - 31
+ var high;
+ // bits 32 - 63
+ var midh;
+ // bits 64 - 95
+ var midl;
+ // bits 96 - 127
+ var low;
+ // bits 1 - 5
+ var combination;
+ // decoded biased exponent (14 bits)
+ var biased_exponent;
+ // the number of significand digits
+ var significand_digits = 0;
+ // the base-10 digits in the significand
+ var significand = new Array(36);
+ for (var i = 0; i < significand.length; i++) significand[i] = 0;
+ // read pointer into significand
+ var index = 0;
+
+ // unbiased exponent
+ var exponent;
+ // the exponent if scientific notation is used
+ var scientific_exponent;
+
+ // true if the number is zero
+ var is_zero = false;
+
+ // the most signifcant significand bits (50-46)
+ var significand_msb;
+ // temporary storage for significand decoding
+ var significand128 = { parts: new Array(4) };
+ // indexing variables
+ i;
+ var j, k;
+
+ // Output string
+ var string = [];
+
+ // Unpack index
+ index = 0;
+
+ // Buffer reference
+ var buffer = this.bytes;
+
+ // Unpack the low 64bits into a long
+ low = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ midl = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+
+ // Unpack the high 64bits into a long
+ midh = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ high = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+
+ // Unpack index
+ index = 0;
+
+ // Create the state of the decimal
+ var dec = {
+ low: new Long(low, midl),
+ high: new Long(midh, high)
+ };
+
+ if (dec.high.lessThan(Long.ZERO)) {
+ string.push('-');
+ }
+
+ // Decode combination field and exponent
+ combination = high >> 26 & COMBINATION_MASK;
+
+ if (combination >> 3 === 3) {
+ // Check for 'special' values
+ if (combination === COMBINATION_INFINITY) {
+ return string.join('') + 'Infinity';
+ } else if (combination === COMBINATION_NAN) {
+ return 'NaN';
+ } else {
+ biased_exponent = high >> 15 & EXPONENT_MASK;
+ significand_msb = 0x08 + (high >> 14 & 0x01);
+ }
+ } else {
+ significand_msb = high >> 14 & 0x07;
+ biased_exponent = high >> 17 & EXPONENT_MASK;
+ }
+
+ exponent = biased_exponent - EXPONENT_BIAS;
+
+ // Create string of significand digits
+
+ // Convert the 114-bit binary number represented by
+ // (significand_high, significand_low) to at most 34 decimal
+ // digits through modulo and division.
+ significand128.parts[0] = (high & 0x3fff) + ((significand_msb & 0xf) << 14);
+ significand128.parts[1] = midh;
+ significand128.parts[2] = midl;
+ significand128.parts[3] = low;
+
+ if (significand128.parts[0] === 0 && significand128.parts[1] === 0 && significand128.parts[2] === 0 && significand128.parts[3] === 0) {
+ is_zero = true;
+ } else {
+ for (k = 3; k >= 0; k--) {
+ var least_digits = 0;
+ // Peform the divide
+ var result = divideu128(significand128);
+ significand128 = result.quotient;
+ least_digits = result.rem.low_;
+
+ // We now have the 9 least significant digits (in base 2).
+ // Convert and output to string.
+ if (!least_digits) continue;
+
+ for (j = 8; j >= 0; j--) {
+ // significand[k * 9 + j] = Math.round(least_digits % 10);
+ significand[k * 9 + j] = least_digits % 10;
+ // least_digits = Math.round(least_digits / 10);
+ least_digits = Math.floor(least_digits / 10);
+ }
+ }
+ }
+
+ // Output format options:
+ // Scientific - [-]d.dddE(+/-)dd or [-]dE(+/-)dd
+ // Regular - ddd.ddd
+
+ if (is_zero) {
+ significand_digits = 1;
+ significand[index] = 0;
+ } else {
+ significand_digits = 36;
+ i = 0;
+
+ while (!significand[index]) {
+ i++;
+ significand_digits = significand_digits - 1;
+ index = index + 1;
+ }
+ }
+
+ scientific_exponent = significand_digits - 1 + exponent;
+
+ // The scientific exponent checks are dictated by the string conversion
+ // specification and are somewhat arbitrary cutoffs.
+ //
+ // We must check exponent > 0, because if this is the case, the number
+ // has trailing zeros. However, we *cannot* output these trailing zeros,
+ // because doing so would change the precision of the value, and would
+ // change stored data if the string converted number is round tripped.
+
+ if (scientific_exponent >= 34 || scientific_exponent <= -7 || exponent > 0) {
+ // Scientific format
+ string.push(significand[index++]);
+ significand_digits = significand_digits - 1;
+
+ if (significand_digits) {
+ string.push('.');
+ }
+
+ for (i = 0; i < significand_digits; i++) {
+ string.push(significand[index++]);
+ }
+
+ // Exponent
+ string.push('E');
+ if (scientific_exponent > 0) {
+ string.push('+' + scientific_exponent);
+ } else {
+ string.push(scientific_exponent);
+ }
+ } else {
+ // Regular format with no decimal place
+ if (exponent >= 0) {
+ for (i = 0; i < significand_digits; i++) {
+ string.push(significand[index++]);
+ }
+ } else {
+ var radix_position = significand_digits + exponent;
+
+ // non-zero digits before radix
+ if (radix_position > 0) {
+ for (i = 0; i < radix_position; i++) {
+ string.push(significand[index++]);
+ }
+ } else {
+ string.push('0');
+ }
+
+ string.push('.');
+ // add leading zeros after radix
+ while (radix_position++ < 0) {
+ string.push('0');
+ }
+
+ for (i = 0; i < significand_digits - Math.max(radix_position - 1, 0); i++) {
+ string.push(significand[index++]);
+ }
+ }
+ }
+
+ return string.join('');
+ };
+
+ Decimal128.prototype.toJSON = function () {
+ return { $numberDecimal: this.toString() };
+ };
+
+ module.exports = Decimal128;
+ module.exports.Decimal128 = Decimal128;
+
+/***/ }),
+/* 353 */
+/***/ (function(module, exports) {
+
+ /**
+ * A class representation of the BSON MinKey type.
+ *
+ * @class
+ * @return {MinKey} A MinKey instance
+ */
+ function MinKey() {
+ if (!(this instanceof MinKey)) return new MinKey();
+
+ this._bsontype = 'MinKey';
+ }
+
+ module.exports = MinKey;
+ module.exports.MinKey = MinKey;
+
+/***/ }),
+/* 354 */
+/***/ (function(module, exports) {
+
+ /**
+ * A class representation of the BSON MaxKey type.
+ *
+ * @class
+ * @return {MaxKey} A MaxKey instance
+ */
+ function MaxKey() {
+ if (!(this instanceof MaxKey)) return new MaxKey();
+
+ this._bsontype = 'MaxKey';
+ }
+
+ module.exports = MaxKey;
+ module.exports.MaxKey = MaxKey;
+
+/***/ }),
+/* 355 */
+/***/ (function(module, exports) {
+
+ /**
+ * A class representation of the BSON DBRef type.
+ *
+ * @class
+ * @param {string} namespace the collection name.
+ * @param {ObjectID} oid the reference ObjectID.
+ * @param {string} [db] optional db name, if omitted the reference is local to the current db.
+ * @return {DBRef}
+ */
+ function DBRef(namespace, oid, db) {
+ if (!(this instanceof DBRef)) return new DBRef(namespace, oid, db);
+
+ this._bsontype = 'DBRef';
+ this.namespace = namespace;
+ this.oid = oid;
+ this.db = db;
+ }
+
+ /**
+ * @ignore
+ * @api private
+ */
+ DBRef.prototype.toJSON = function () {
+ return {
+ $ref: this.namespace,
+ $id: this.oid,
+ $db: this.db == null ? '' : this.db
+ };
+ };
+
+ module.exports = DBRef;
+ module.exports.DBRef = DBRef;
+
+/***/ }),
+/* 356 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(global) {/**
+ * Module dependencies.
+ * @ignore
+ */
+
+ // Test if we're in Node via presence of "global" not absence of "window"
+ // to support hybrid environments like Electron
+ if (typeof global !== 'undefined') {
+ var Buffer = __webpack_require__(339).Buffer; // TODO just use global Buffer
+ }
+
+ var utils = __webpack_require__(344);
+
+ /**
+ * A class representation of the BSON Binary type.
+ *
+ * Sub types
+ * - **BSON.BSON_BINARY_SUBTYPE_DEFAULT**, default BSON type.
+ * - **BSON.BSON_BINARY_SUBTYPE_FUNCTION**, BSON function type.
+ * - **BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY**, BSON byte array type.
+ * - **BSON.BSON_BINARY_SUBTYPE_UUID**, BSON uuid type.
+ * - **BSON.BSON_BINARY_SUBTYPE_MD5**, BSON md5 type.
+ * - **BSON.BSON_BINARY_SUBTYPE_USER_DEFINED**, BSON user defined type.
+ *
+ * @class
+ * @param {Buffer} buffer a buffer object containing the binary data.
+ * @param {Number} [subType] the option binary type.
+ * @return {Binary}
+ */
+ function Binary(buffer, subType) {
+ if (!(this instanceof Binary)) return new Binary(buffer, subType);
+
+ if (buffer != null && !(typeof buffer === 'string') && !Buffer.isBuffer(buffer) && !(buffer instanceof Uint8Array) && !Array.isArray(buffer)) {
+ throw new Error('only String, Buffer, Uint8Array or Array accepted');
+ }
+
+ this._bsontype = 'Binary';
+
+ if (buffer instanceof Number) {
+ this.sub_type = buffer;
+ this.position = 0;
+ } else {
+ this.sub_type = subType == null ? BSON_BINARY_SUBTYPE_DEFAULT : subType;
+ this.position = 0;
+ }
+
+ if (buffer != null && !(buffer instanceof Number)) {
+ // Only accept Buffer, Uint8Array or Arrays
+ if (typeof buffer === 'string') {
+ // Different ways of writing the length of the string for the different types
+ if (typeof Buffer !== 'undefined') {
+ this.buffer = utils.toBuffer(buffer);
+ } else if (typeof Uint8Array !== 'undefined' || Object.prototype.toString.call(buffer) === '[object Array]') {
+ this.buffer = writeStringToArray(buffer);
+ } else {
+ throw new Error('only String, Buffer, Uint8Array or Array accepted');
+ }
+ } else {
+ this.buffer = buffer;
+ }
+ this.position = buffer.length;
+ } else {
+ if (typeof Buffer !== 'undefined') {
+ this.buffer = utils.allocBuffer(Binary.BUFFER_SIZE);
+ } else if (typeof Uint8Array !== 'undefined') {
+ this.buffer = new Uint8Array(new ArrayBuffer(Binary.BUFFER_SIZE));
+ } else {
+ this.buffer = new Array(Binary.BUFFER_SIZE);
+ }
+ // Set position to start of buffer
+ this.position = 0;
+ }
+ }
+
+ /**
+ * Updates this binary with byte_value.
+ *
+ * @method
+ * @param {string} byte_value a single byte we wish to write.
+ */
+ Binary.prototype.put = function put(byte_value) {
+ // If it's a string and a has more than one character throw an error
+ if (byte_value['length'] != null && typeof byte_value !== 'number' && byte_value.length !== 1) throw new Error('only accepts single character String, Uint8Array or Array');
+ if (typeof byte_value !== 'number' && byte_value < 0 || byte_value > 255) throw new Error('only accepts number in a valid unsigned byte range 0-255');
+
+ // Decode the byte value once
+ var decoded_byte = null;
+ if (typeof byte_value === 'string') {
+ decoded_byte = byte_value.charCodeAt(0);
+ } else if (byte_value['length'] != null) {
+ decoded_byte = byte_value[0];
+ } else {
+ decoded_byte = byte_value;
+ }
+
+ if (this.buffer.length > this.position) {
+ this.buffer[this.position++] = decoded_byte;
+ } else {
+ if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) {
+ // Create additional overflow buffer
+ var buffer = utils.allocBuffer(Binary.BUFFER_SIZE + this.buffer.length);
+ // Combine the two buffers together
+ this.buffer.copy(buffer, 0, 0, this.buffer.length);
+ this.buffer = buffer;
+ this.buffer[this.position++] = decoded_byte;
+ } else {
+ buffer = null;
+ // Create a new buffer (typed or normal array)
+ if (Object.prototype.toString.call(this.buffer) === '[object Uint8Array]') {
+ buffer = new Uint8Array(new ArrayBuffer(Binary.BUFFER_SIZE + this.buffer.length));
+ } else {
+ buffer = new Array(Binary.BUFFER_SIZE + this.buffer.length);
+ }
+
+ // We need to copy all the content to the new array
+ for (var i = 0; i < this.buffer.length; i++) {
+ buffer[i] = this.buffer[i];
+ }
+
+ // Reassign the buffer
+ this.buffer = buffer;
+ // Write the byte
+ this.buffer[this.position++] = decoded_byte;
+ }
+ }
+ };
+
+ /**
+ * Writes a buffer or string to the binary.
+ *
+ * @method
+ * @param {(Buffer|string)} string a string or buffer to be written to the Binary BSON object.
+ * @param {number} offset specify the binary of where to write the content.
+ * @return {null}
+ */
+ Binary.prototype.write = function write(string, offset) {
+ offset = typeof offset === 'number' ? offset : this.position;
+
+ // If the buffer is to small let's extend the buffer
+ if (this.buffer.length < offset + string.length) {
+ var buffer = null;
+ // If we are in node.js
+ if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) {
+ buffer = utils.allocBuffer(this.buffer.length + string.length);
+ this.buffer.copy(buffer, 0, 0, this.buffer.length);
+ } else if (Object.prototype.toString.call(this.buffer) === '[object Uint8Array]') {
+ // Create a new buffer
+ buffer = new Uint8Array(new ArrayBuffer(this.buffer.length + string.length));
+ // Copy the content
+ for (var i = 0; i < this.position; i++) {
+ buffer[i] = this.buffer[i];
+ }
+ }
+
+ // Assign the new buffer
+ this.buffer = buffer;
+ }
+
+ if (typeof Buffer !== 'undefined' && Buffer.isBuffer(string) && Buffer.isBuffer(this.buffer)) {
+ string.copy(this.buffer, offset, 0, string.length);
+ this.position = offset + string.length > this.position ? offset + string.length : this.position;
+ // offset = string.length
+ } else if (typeof Buffer !== 'undefined' && typeof string === 'string' && Buffer.isBuffer(this.buffer)) {
+ this.buffer.write(string, offset, 'binary');
+ this.position = offset + string.length > this.position ? offset + string.length : this.position;
+ // offset = string.length;
+ } else if (Object.prototype.toString.call(string) === '[object Uint8Array]' || Object.prototype.toString.call(string) === '[object Array]' && typeof string !== 'string') {
+ for (i = 0; i < string.length; i++) {
+ this.buffer[offset++] = string[i];
+ }
+
+ this.position = offset > this.position ? offset : this.position;
+ } else if (typeof string === 'string') {
+ for (i = 0; i < string.length; i++) {
+ this.buffer[offset++] = string.charCodeAt(i);
+ }
+
+ this.position = offset > this.position ? offset : this.position;
+ }
+ };
+
+ /**
+ * Reads **length** bytes starting at **position**.
+ *
+ * @method
+ * @param {number} position read from the given position in the Binary.
+ * @param {number} length the number of bytes to read.
+ * @return {Buffer}
+ */
+ Binary.prototype.read = function read(position, length) {
+ length = length && length > 0 ? length : this.position;
+
+ // Let's return the data based on the type we have
+ if (this.buffer['slice']) {
+ return this.buffer.slice(position, position + length);
+ } else {
+ // Create a buffer to keep the result
+ var buffer = typeof Uint8Array !== 'undefined' ? new Uint8Array(new ArrayBuffer(length)) : new Array(length);
+ for (var i = 0; i < length; i++) {
+ buffer[i] = this.buffer[position++];
+ }
+ }
+ // Return the buffer
+ return buffer;
+ };
+
+ /**
+ * Returns the value of this binary as a string.
+ *
+ * @method
+ * @return {string}
+ */
+ Binary.prototype.value = function value(asRaw) {
+ asRaw = asRaw == null ? false : asRaw;
+
+ // Optimize to serialize for the situation where the data == size of buffer
+ if (asRaw && typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer) && this.buffer.length === this.position) return this.buffer;
+
+ // If it's a node.js buffer object
+ if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) {
+ return asRaw ? this.buffer.slice(0, this.position) : this.buffer.toString('binary', 0, this.position);
+ } else {
+ if (asRaw) {
+ // we support the slice command use it
+ if (this.buffer['slice'] != null) {
+ return this.buffer.slice(0, this.position);
+ } else {
+ // Create a new buffer to copy content to
+ var newBuffer = Object.prototype.toString.call(this.buffer) === '[object Uint8Array]' ? new Uint8Array(new ArrayBuffer(this.position)) : new Array(this.position);
+ // Copy content
+ for (var i = 0; i < this.position; i++) {
+ newBuffer[i] = this.buffer[i];
+ }
+ // Return the buffer
+ return newBuffer;
+ }
+ } else {
+ return convertArraytoUtf8BinaryString(this.buffer, 0, this.position);
+ }
+ }
+ };
+
+ /**
+ * Length.
+ *
+ * @method
+ * @return {number} the length of the binary.
+ */
+ Binary.prototype.length = function length() {
+ return this.position;
+ };
+
+ /**
+ * @ignore
+ */
+ Binary.prototype.toJSON = function () {
+ return this.buffer != null ? this.buffer.toString('base64') : '';
+ };
+
+ /**
+ * @ignore
+ */
+ Binary.prototype.toString = function (format) {
+ return this.buffer != null ? this.buffer.slice(0, this.position).toString(format) : '';
+ };
+
+ /**
+ * Binary default subtype
+ * @ignore
+ */
+ var BSON_BINARY_SUBTYPE_DEFAULT = 0;
+
+ /**
+ * @ignore
+ */
+ var writeStringToArray = function (data) {
+ // Create a buffer
+ var buffer = typeof Uint8Array !== 'undefined' ? new Uint8Array(new ArrayBuffer(data.length)) : new Array(data.length);
+ // Write the content to the buffer
+ for (var i = 0; i < data.length; i++) {
+ buffer[i] = data.charCodeAt(i);
+ }
+ // Write the string to the buffer
+ return buffer;
+ };
+
+ /**
+ * Convert Array ot Uint8Array to Binary String
+ *
+ * @ignore
+ */
+ var convertArraytoUtf8BinaryString = function (byteArray, startIndex, endIndex) {
+ var result = '';
+ for (var i = startIndex; i < endIndex; i++) {
+ result = result + String.fromCharCode(byteArray[i]);
+ }
+ return result;
+ };
+
+ Binary.BUFFER_SIZE = 256;
+
+ /**
+ * Default BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+ Binary.SUBTYPE_DEFAULT = 0;
+ /**
+ * Function BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+ Binary.SUBTYPE_FUNCTION = 1;
+ /**
+ * Byte Array BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+ Binary.SUBTYPE_BYTE_ARRAY = 2;
+ /**
+ * OLD UUID BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+ Binary.SUBTYPE_UUID_OLD = 3;
+ /**
+ * UUID BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+ Binary.SUBTYPE_UUID = 4;
+ /**
+ * MD5 BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+ Binary.SUBTYPE_MD5 = 5;
+ /**
+ * User BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+ Binary.SUBTYPE_USER_DEFINED = 128;
+
+ /**
+ * Expose.
+ */
+ module.exports = Binary;
+ module.exports.Binary = Binary;
+ /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }())))
+
+/***/ }),
+/* 357 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ 'use strict';
+
+ var Long = __webpack_require__(335).Long,
+ Double = __webpack_require__(336).Double,
+ Timestamp = __webpack_require__(337).Timestamp,
+ ObjectID = __webpack_require__(338).ObjectID,
+ Symbol = __webpack_require__(349).Symbol,
+ Code = __webpack_require__(351).Code,
+ MinKey = __webpack_require__(353).MinKey,
+ MaxKey = __webpack_require__(354).MaxKey,
+ Decimal128 = __webpack_require__(352),
+ Int32 = __webpack_require__(350),
+ DBRef = __webpack_require__(355).DBRef,
+ BSONRegExp = __webpack_require__(348).BSONRegExp,
+ Binary = __webpack_require__(356).Binary;
+
+ var utils = __webpack_require__(344);
+
+ var deserialize = function (buffer, options, isArray) {
+ options = options == null ? {} : options;
+ var index = options && options.index ? options.index : 0;
+ // Read the document size
+ var size = buffer[index] | buffer[index + 1] << 8 | buffer[index + 2] << 16 | buffer[index + 3] << 24;
+
+ // Ensure buffer is valid size
+ if (size < 5 || buffer.length < size || size + index > buffer.length) {
+ throw new Error('corrupt bson message');
+ }
+
+ // Illegal end value
+ if (buffer[index + size - 1] !== 0) {
+ throw new Error("One object, sized correctly, with a spot for an EOO, but the EOO isn't 0x00");
+ }
+
+ // Start deserializtion
+ return deserializeObject(buffer, index, options, isArray);
+ };
+
+ var deserializeObject = function (buffer, index, options, isArray) {
+ var evalFunctions = options['evalFunctions'] == null ? false : options['evalFunctions'];
+ var cacheFunctions = options['cacheFunctions'] == null ? false : options['cacheFunctions'];
+ var cacheFunctionsCrc32 = options['cacheFunctionsCrc32'] == null ? false : options['cacheFunctionsCrc32'];
+
+ if (!cacheFunctionsCrc32) var crc32 = null;
+
+ var fieldsAsRaw = options['fieldsAsRaw'] == null ? null : options['fieldsAsRaw'];
+
+ // Return raw bson buffer instead of parsing it
+ var raw = options['raw'] == null ? false : options['raw'];
+
+ // Return BSONRegExp objects instead of native regular expressions
+ var bsonRegExp = typeof options['bsonRegExp'] === 'boolean' ? options['bsonRegExp'] : false;
+
+ // Controls the promotion of values vs wrapper classes
+ var promoteBuffers = options['promoteBuffers'] == null ? false : options['promoteBuffers'];
+ var promoteLongs = options['promoteLongs'] == null ? true : options['promoteLongs'];
+ var promoteValues = options['promoteValues'] == null ? true : options['promoteValues'];
+
+ // Set the start index
+ var startIndex = index;
+
+ // Validate that we have at least 4 bytes of buffer
+ if (buffer.length < 5) throw new Error('corrupt bson message < 5 bytes long');
+
+ // Read the document size
+ var size = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+
+ // Ensure buffer is valid size
+ if (size < 5 || size > buffer.length) throw new Error('corrupt bson message');
+
+ // Create holding object
+ var object = isArray ? [] : {};
+ // Used for arrays to skip having to perform utf8 decoding
+ var arrayIndex = 0;
+
+ var done = false;
+
+ // While we have more left data left keep parsing
+ // while (buffer[index + 1] !== 0) {
+ while (!done) {
+ // Read the type
+ var elementType = buffer[index++];
+ // If we get a zero it's the last byte, exit
+ if (elementType === 0) break;
+
+ // Get the start search index
+ var i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ var name = isArray ? arrayIndex++ : buffer.toString('utf8', index, i);
+
+ index = i + 1;
+
+ if (elementType === BSON.BSON_DATA_STRING) {
+ var stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson');
+ object[name] = buffer.toString('utf8', index, index + stringSize - 1);
+ index = index + stringSize;
+ } else if (elementType === BSON.BSON_DATA_OID) {
+ var oid = utils.allocBuffer(12);
+ buffer.copy(oid, 0, index, index + 12);
+ object[name] = new ObjectID(oid);
+ index = index + 12;
+ } else if (elementType === BSON.BSON_DATA_INT && promoteValues === false) {
+ object[name] = new Int32(buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24);
+ } else if (elementType === BSON.BSON_DATA_INT) {
+ object[name] = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ } else if (elementType === BSON.BSON_DATA_NUMBER && promoteValues === false) {
+ object[name] = new Double(buffer.readDoubleLE(index));
+ index = index + 8;
+ } else if (elementType === BSON.BSON_DATA_NUMBER) {
+ object[name] = buffer.readDoubleLE(index);
+ index = index + 8;
+ } else if (elementType === BSON.BSON_DATA_DATE) {
+ var lowBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ var highBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ object[name] = new Date(new Long(lowBits, highBits).toNumber());
+ } else if (elementType === BSON.BSON_DATA_BOOLEAN) {
+ if (buffer[index] !== 0 && buffer[index] !== 1) throw new Error('illegal boolean type value');
+ object[name] = buffer[index++] === 1;
+ } else if (elementType === BSON.BSON_DATA_OBJECT) {
+ var _index = index;
+ var objectSize = buffer[index] | buffer[index + 1] << 8 | buffer[index + 2] << 16 | buffer[index + 3] << 24;
+ if (objectSize <= 0 || objectSize > buffer.length - index) throw new Error('bad embedded document length in bson');
+
+ // We have a raw value
+ if (raw) {
+ object[name] = buffer.slice(index, index + objectSize);
+ } else {
+ object[name] = deserializeObject(buffer, _index, options, false);
+ }
+
+ index = index + objectSize;
+ } else if (elementType === BSON.BSON_DATA_ARRAY) {
+ _index = index;
+ objectSize = buffer[index] | buffer[index + 1] << 8 | buffer[index + 2] << 16 | buffer[index + 3] << 24;
+ var arrayOptions = options;
+
+ // Stop index
+ var stopIndex = index + objectSize;
+
+ // All elements of array to be returned as raw bson
+ if (fieldsAsRaw && fieldsAsRaw[name]) {
+ arrayOptions = {};
+ for (var n in options) arrayOptions[n] = options[n];
+ arrayOptions['raw'] = true;
+ }
+
+ object[name] = deserializeObject(buffer, _index, arrayOptions, true);
+ index = index + objectSize;
+
+ if (buffer[index - 1] !== 0) throw new Error('invalid array terminator byte');
+ if (index !== stopIndex) throw new Error('corrupted array bson');
+ } else if (elementType === BSON.BSON_DATA_UNDEFINED) {
+ object[name] = undefined;
+ } else if (elementType === BSON.BSON_DATA_NULL) {
+ object[name] = null;
+ } else if (elementType === BSON.BSON_DATA_LONG) {
+ // Unpack the low and high bits
+ lowBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ highBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ var long = new Long(lowBits, highBits);
+ // Promote the long if possible
+ if (promoteLongs && promoteValues === true) {
+ object[name] = long.lessThanOrEqual(JS_INT_MAX_LONG) && long.greaterThanOrEqual(JS_INT_MIN_LONG) ? long.toNumber() : long;
+ } else {
+ object[name] = long;
+ }
+ } else if (elementType === BSON.BSON_DATA_DECIMAL128) {
+ // Buffer to contain the decimal bytes
+ var bytes = utils.allocBuffer(16);
+ // Copy the next 16 bytes into the bytes buffer
+ buffer.copy(bytes, 0, index, index + 16);
+ // Update index
+ index = index + 16;
+ // Assign the new Decimal128 value
+ var decimal128 = new Decimal128(bytes);
+ // If we have an alternative mapper use that
+ object[name] = decimal128.toObject ? decimal128.toObject() : decimal128;
+ } else if (elementType === BSON.BSON_DATA_BINARY) {
+ var binarySize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ var totalBinarySize = binarySize;
+ var subType = buffer[index++];
+
+ // Did we have a negative binary size, throw
+ if (binarySize < 0) throw new Error('Negative binary type element size found');
+
+ // Is the length longer than the document
+ if (binarySize > buffer.length) throw new Error('Binary type size larger than document size');
+
+ // Decode as raw Buffer object if options specifies it
+ if (buffer['slice'] != null) {
+ // If we have subtype 2 skip the 4 bytes for the size
+ if (subType === Binary.SUBTYPE_BYTE_ARRAY) {
+ binarySize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ if (binarySize < 0) throw new Error('Negative binary type element size found for subtype 0x02');
+ if (binarySize > totalBinarySize - 4) throw new Error('Binary type with subtype 0x02 contains to long binary size');
+ if (binarySize < totalBinarySize - 4) throw new Error('Binary type with subtype 0x02 contains to short binary size');
+ }
+
+ if (promoteBuffers && promoteValues) {
+ object[name] = buffer.slice(index, index + binarySize);
+ } else {
+ object[name] = new Binary(buffer.slice(index, index + binarySize), subType);
+ }
+ } else {
+ var _buffer = typeof Uint8Array !== 'undefined' ? new Uint8Array(new ArrayBuffer(binarySize)) : new Array(binarySize);
+ // If we have subtype 2 skip the 4 bytes for the size
+ if (subType === Binary.SUBTYPE_BYTE_ARRAY) {
+ binarySize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ if (binarySize < 0) throw new Error('Negative binary type element size found for subtype 0x02');
+ if (binarySize > totalBinarySize - 4) throw new Error('Binary type with subtype 0x02 contains to long binary size');
+ if (binarySize < totalBinarySize - 4) throw new Error('Binary type with subtype 0x02 contains to short binary size');
+ }
+
+ // Copy the data
+ for (i = 0; i < binarySize; i++) {
+ _buffer[i] = buffer[index + i];
+ }
+
+ if (promoteBuffers && promoteValues) {
+ object[name] = _buffer;
+ } else {
+ object[name] = new Binary(_buffer, subType);
+ }
+ }
+
+ // Update the index
+ index = index + binarySize;
+ } else if (elementType === BSON.BSON_DATA_REGEXP && bsonRegExp === false) {
+ // Get the start search index
+ i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ // Return the C string
+ var source = buffer.toString('utf8', index, i);
+ // Create the regexp
+ index = i + 1;
+
+ // Get the start search index
+ i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ // Return the C string
+ var regExpOptions = buffer.toString('utf8', index, i);
+ index = i + 1;
+
+ // For each option add the corresponding one for javascript
+ var optionsArray = new Array(regExpOptions.length);
+
+ // Parse options
+ for (i = 0; i < regExpOptions.length; i++) {
+ switch (regExpOptions[i]) {
+ case 'm':
+ optionsArray[i] = 'm';
+ break;
+ case 's':
+ optionsArray[i] = 'g';
+ break;
+ case 'i':
+ optionsArray[i] = 'i';
+ break;
+ }
+ }
+
+ object[name] = new RegExp(source, optionsArray.join(''));
+ } else if (elementType === BSON.BSON_DATA_REGEXP && bsonRegExp === true) {
+ // Get the start search index
+ i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ // Return the C string
+ source = buffer.toString('utf8', index, i);
+ index = i + 1;
+
+ // Get the start search index
+ i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ // Return the C string
+ regExpOptions = buffer.toString('utf8', index, i);
+ index = i + 1;
+
+ // Set the object
+ object[name] = new BSONRegExp(source, regExpOptions);
+ } else if (elementType === BSON.BSON_DATA_SYMBOL) {
+ stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson');
+ object[name] = new Symbol(buffer.toString('utf8', index, index + stringSize - 1));
+ index = index + stringSize;
+ } else if (elementType === BSON.BSON_DATA_TIMESTAMP) {
+ lowBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ highBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ object[name] = new Timestamp(lowBits, highBits);
+ } else if (elementType === BSON.BSON_DATA_MIN_KEY) {
+ object[name] = new MinKey();
+ } else if (elementType === BSON.BSON_DATA_MAX_KEY) {
+ object[name] = new MaxKey();
+ } else if (elementType === BSON.BSON_DATA_CODE) {
+ stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson');
+ var functionString = buffer.toString('utf8', index, index + stringSize - 1);
+
+ // If we are evaluating the functions
+ if (evalFunctions) {
+ // If we have cache enabled let's look for the md5 of the function in the cache
+ if (cacheFunctions) {
+ var hash = cacheFunctionsCrc32 ? crc32(functionString) : functionString;
+ // Got to do this to avoid V8 deoptimizing the call due to finding eval
+ object[name] = isolateEvalWithHash(functionCache, hash, functionString, object);
+ } else {
+ object[name] = isolateEval(functionString);
+ }
+ } else {
+ object[name] = new Code(functionString);
+ }
+
+ // Update parse index position
+ index = index + stringSize;
+ } else if (elementType === BSON.BSON_DATA_CODE_W_SCOPE) {
+ var totalSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+
+ // Element cannot be shorter than totalSize + stringSize + documentSize + terminator
+ if (totalSize < 4 + 4 + 4 + 1) {
+ throw new Error('code_w_scope total size shorter minimum expected length');
+ }
+
+ // Get the code string size
+ stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ // Check if we have a valid string
+ if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson');
+
+ // Javascript function
+ functionString = buffer.toString('utf8', index, index + stringSize - 1);
+ // Update parse index position
+ index = index + stringSize;
+ // Parse the element
+ _index = index;
+ // Decode the size of the object document
+ objectSize = buffer[index] | buffer[index + 1] << 8 | buffer[index + 2] << 16 | buffer[index + 3] << 24;
+ // Decode the scope object
+ var scopeObject = deserializeObject(buffer, _index, options, false);
+ // Adjust the index
+ index = index + objectSize;
+
+ // Check if field length is to short
+ if (totalSize < 4 + 4 + objectSize + stringSize) {
+ throw new Error('code_w_scope total size is to short, truncating scope');
+ }
+
+ // Check if totalSize field is to long
+ if (totalSize > 4 + 4 + objectSize + stringSize) {
+ throw new Error('code_w_scope total size is to long, clips outer document');
+ }
+
+ // If we are evaluating the functions
+ if (evalFunctions) {
+ // If we have cache enabled let's look for the md5 of the function in the cache
+ if (cacheFunctions) {
+ hash = cacheFunctionsCrc32 ? crc32(functionString) : functionString;
+ // Got to do this to avoid V8 deoptimizing the call due to finding eval
+ object[name] = isolateEvalWithHash(functionCache, hash, functionString, object);
+ } else {
+ object[name] = isolateEval(functionString);
+ }
+
+ object[name].scope = scopeObject;
+ } else {
+ object[name] = new Code(functionString, scopeObject);
+ }
+ } else if (elementType === BSON.BSON_DATA_DBPOINTER) {
+ // Get the code string size
+ stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24;
+ // Check if we have a valid string
+ if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson');
+ // Namespace
+ var namespace = buffer.toString('utf8', index, index + stringSize - 1);
+ // Update parse index position
+ index = index + stringSize;
+
+ // Read the oid
+ var oidBuffer = utils.allocBuffer(12);
+ buffer.copy(oidBuffer, 0, index, index + 12);
+ oid = new ObjectID(oidBuffer);
+
+ // Update the index
+ index = index + 12;
+
+ // Split the namespace
+ var parts = namespace.split('.');
+ var db = parts.shift();
+ var collection = parts.join('.');
+ // Upgrade to DBRef type
+ object[name] = new DBRef(collection, oid, db);
+ } else {
+ throw new Error('Detected unknown BSON type ' + elementType.toString(16) + ' for fieldname "' + name + '", are you using the latest BSON parser');
+ }
+ }
+
+ // Check if the deserialization was against a valid array/object
+ if (size !== index - startIndex) {
+ if (isArray) throw new Error('corrupt array bson');
+ throw new Error('corrupt object bson');
+ }
+
+ // Check if we have a db ref object
+ if (object['$id'] != null) object = new DBRef(object['$ref'], object['$id'], object['$db']);
+ return object;
+ };
+
+ /**
+ * Ensure eval is isolated.
+ *
+ * @ignore
+ * @api private
+ */
+ var isolateEvalWithHash = function (functionCache, hash, functionString, object) {
+ // Contains the value we are going to set
+ var value = null;
+
+ // Check for cache hit, eval if missing and return cached function
+ if (functionCache[hash] == null) {
+ eval('value = ' + functionString);
+ functionCache[hash] = value;
+ }
+ // Set the object
+ return functionCache[hash].bind(object);
+ };
+
+ /**
+ * Ensure eval is isolated.
+ *
+ * @ignore
+ * @api private
+ */
+ var isolateEval = function (functionString) {
+ // Contains the value we are going to set
+ var value = null;
+ // Eval the function
+ eval('value = ' + functionString);
+ return value;
+ };
+
+ var BSON = {};
+
+ /**
+ * Contains the function cache if we have that enable to allow for avoiding the eval step on each deserialization, comparison is by md5
+ *
+ * @ignore
+ * @api private
+ */
+ var functionCache = BSON.functionCache = {};
+
+ /**
+ * Number BSON Type
+ *
+ * @classconstant BSON_DATA_NUMBER
+ **/
+ BSON.BSON_DATA_NUMBER = 1;
+ /**
+ * String BSON Type
+ *
+ * @classconstant BSON_DATA_STRING
+ **/
+ BSON.BSON_DATA_STRING = 2;
+ /**
+ * Object BSON Type
+ *
+ * @classconstant BSON_DATA_OBJECT
+ **/
+ BSON.BSON_DATA_OBJECT = 3;
+ /**
+ * Array BSON Type
+ *
+ * @classconstant BSON_DATA_ARRAY
+ **/
+ BSON.BSON_DATA_ARRAY = 4;
+ /**
+ * Binary BSON Type
+ *
+ * @classconstant BSON_DATA_BINARY
+ **/
+ BSON.BSON_DATA_BINARY = 5;
+ /**
+ * Binary BSON Type
+ *
+ * @classconstant BSON_DATA_UNDEFINED
+ **/
+ BSON.BSON_DATA_UNDEFINED = 6;
+ /**
+ * ObjectID BSON Type
+ *
+ * @classconstant BSON_DATA_OID
+ **/
+ BSON.BSON_DATA_OID = 7;
+ /**
+ * Boolean BSON Type
+ *
+ * @classconstant BSON_DATA_BOOLEAN
+ **/
+ BSON.BSON_DATA_BOOLEAN = 8;
+ /**
+ * Date BSON Type
+ *
+ * @classconstant BSON_DATA_DATE
+ **/
+ BSON.BSON_DATA_DATE = 9;
+ /**
+ * null BSON Type
+ *
+ * @classconstant BSON_DATA_NULL
+ **/
+ BSON.BSON_DATA_NULL = 10;
+ /**
+ * RegExp BSON Type
+ *
+ * @classconstant BSON_DATA_REGEXP
+ **/
+ BSON.BSON_DATA_REGEXP = 11;
+ /**
+ * Code BSON Type
+ *
+ * @classconstant BSON_DATA_DBPOINTER
+ **/
+ BSON.BSON_DATA_DBPOINTER = 12;
+ /**
+ * Code BSON Type
+ *
+ * @classconstant BSON_DATA_CODE
+ **/
+ BSON.BSON_DATA_CODE = 13;
+ /**
+ * Symbol BSON Type
+ *
+ * @classconstant BSON_DATA_SYMBOL
+ **/
+ BSON.BSON_DATA_SYMBOL = 14;
+ /**
+ * Code with Scope BSON Type
+ *
+ * @classconstant BSON_DATA_CODE_W_SCOPE
+ **/
+ BSON.BSON_DATA_CODE_W_SCOPE = 15;
+ /**
+ * 32 bit Integer BSON Type
+ *
+ * @classconstant BSON_DATA_INT
+ **/
+ BSON.BSON_DATA_INT = 16;
+ /**
+ * Timestamp BSON Type
+ *
+ * @classconstant BSON_DATA_TIMESTAMP
+ **/
+ BSON.BSON_DATA_TIMESTAMP = 17;
+ /**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_LONG
+ **/
+ BSON.BSON_DATA_LONG = 18;
+ /**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_DECIMAL128
+ **/
+ BSON.BSON_DATA_DECIMAL128 = 19;
+ /**
+ * MinKey BSON Type
+ *
+ * @classconstant BSON_DATA_MIN_KEY
+ **/
+ BSON.BSON_DATA_MIN_KEY = 0xff;
+ /**
+ * MaxKey BSON Type
+ *
+ * @classconstant BSON_DATA_MAX_KEY
+ **/
+ BSON.BSON_DATA_MAX_KEY = 0x7f;
+
+ /**
+ * Binary Default Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_DEFAULT
+ **/
+ BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0;
+ /**
+ * Binary Function Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_FUNCTION
+ **/
+ BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1;
+ /**
+ * Binary Byte Array Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY
+ **/
+ BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2;
+ /**
+ * Binary UUID Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_UUID
+ **/
+ BSON.BSON_BINARY_SUBTYPE_UUID = 3;
+ /**
+ * Binary MD5 Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_MD5
+ **/
+ BSON.BSON_BINARY_SUBTYPE_MD5 = 4;
+ /**
+ * Binary User Defined Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED
+ **/
+ BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128;
+
+ // BSON MAX VALUES
+ BSON.BSON_INT32_MAX = 0x7fffffff;
+ BSON.BSON_INT32_MIN = -0x80000000;
+
+ BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1;
+ BSON.BSON_INT64_MIN = -Math.pow(2, 63);
+
+ // JS MAX PRECISE VALUES
+ BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+ BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+ // Internal long versions
+ var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double.
+ var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double.
+
+ module.exports = deserialize;
+
+/***/ }),
+/* 358 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(Buffer) {'use strict';
+
+ var writeIEEE754 = __webpack_require__(359).writeIEEE754,
+ Long = __webpack_require__(335).Long,
+ Map = __webpack_require__(334),
+ Binary = __webpack_require__(356).Binary;
+
+ var normalizedFunctionString = __webpack_require__(344).normalizedFunctionString;
+
+ // try {
+ // var _Buffer = Uint8Array;
+ // } catch (e) {
+ // _Buffer = Buffer;
+ // }
+
+ var regexp = /\x00/; // eslint-disable-line no-control-regex
+ var ignoreKeys = ['$db', '$ref', '$id', '$clusterTime'];
+
+ // To ensure that 0.4 of node works correctly
+ var isDate = function isDate(d) {
+ return typeof d === 'object' && Object.prototype.toString.call(d) === '[object Date]';
+ };
+
+ var isRegExp = function isRegExp(d) {
+ return Object.prototype.toString.call(d) === '[object RegExp]';
+ };
+
+ var serializeString = function (buffer, key, value, index, isArray) {
+ // Encode String type
+ buffer[index++] = BSON.BSON_DATA_STRING;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes + 1;
+ buffer[index - 1] = 0;
+ // Write the string
+ var size = buffer.write(value, index + 4, 'utf8');
+ // Write the size of the string to buffer
+ buffer[index + 3] = size + 1 >> 24 & 0xff;
+ buffer[index + 2] = size + 1 >> 16 & 0xff;
+ buffer[index + 1] = size + 1 >> 8 & 0xff;
+ buffer[index] = size + 1 & 0xff;
+ // Update index
+ index = index + 4 + size;
+ // Write zero
+ buffer[index++] = 0;
+ return index;
+ };
+
+ var serializeNumber = function (buffer, key, value, index, isArray) {
+ // We have an integer value
+ if (Math.floor(value) === value && value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) {
+ // If the value fits in 32 bits encode as int, if it fits in a double
+ // encode it as a double, otherwise long
+ if (value >= BSON.BSON_INT32_MIN && value <= BSON.BSON_INT32_MAX) {
+ // Set int type 32 bits or less
+ buffer[index++] = BSON.BSON_DATA_INT;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the int value
+ buffer[index++] = value & 0xff;
+ buffer[index++] = value >> 8 & 0xff;
+ buffer[index++] = value >> 16 & 0xff;
+ buffer[index++] = value >> 24 & 0xff;
+ } else if (value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) {
+ // Encode as double
+ buffer[index++] = BSON.BSON_DATA_NUMBER;
+ // Number of written bytes
+ numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write float
+ writeIEEE754(buffer, value, index, 'little', 52, 8);
+ // Ajust index
+ index = index + 8;
+ } else {
+ // Set long type
+ buffer[index++] = BSON.BSON_DATA_LONG;
+ // Number of written bytes
+ numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ var longVal = Long.fromNumber(value);
+ var lowBits = longVal.getLowBits();
+ var highBits = longVal.getHighBits();
+ // Encode low bits
+ buffer[index++] = lowBits & 0xff;
+ buffer[index++] = lowBits >> 8 & 0xff;
+ buffer[index++] = lowBits >> 16 & 0xff;
+ buffer[index++] = lowBits >> 24 & 0xff;
+ // Encode high bits
+ buffer[index++] = highBits & 0xff;
+ buffer[index++] = highBits >> 8 & 0xff;
+ buffer[index++] = highBits >> 16 & 0xff;
+ buffer[index++] = highBits >> 24 & 0xff;
+ }
+ } else {
+ // Encode as double
+ buffer[index++] = BSON.BSON_DATA_NUMBER;
+ // Number of written bytes
+ numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write float
+ writeIEEE754(buffer, value, index, 'little', 52, 8);
+ // Ajust index
+ index = index + 8;
+ }
+
+ return index;
+ };
+
+ var serializeNull = function (buffer, key, value, index, isArray) {
+ // Set long type
+ buffer[index++] = BSON.BSON_DATA_NULL;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ return index;
+ };
+
+ var serializeBoolean = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_BOOLEAN;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Encode the boolean value
+ buffer[index++] = value ? 1 : 0;
+ return index;
+ };
+
+ var serializeDate = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_DATE;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ // Write the date
+ var dateInMilis = Long.fromNumber(value.getTime());
+ var lowBits = dateInMilis.getLowBits();
+ var highBits = dateInMilis.getHighBits();
+ // Encode low bits
+ buffer[index++] = lowBits & 0xff;
+ buffer[index++] = lowBits >> 8 & 0xff;
+ buffer[index++] = lowBits >> 16 & 0xff;
+ buffer[index++] = lowBits >> 24 & 0xff;
+ // Encode high bits
+ buffer[index++] = highBits & 0xff;
+ buffer[index++] = highBits >> 8 & 0xff;
+ buffer[index++] = highBits >> 16 & 0xff;
+ buffer[index++] = highBits >> 24 & 0xff;
+ return index;
+ };
+
+ var serializeRegExp = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_REGEXP;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ if (value.source && value.source.match(regexp) != null) {
+ throw Error('value ' + value.source + ' must not contain null bytes');
+ }
+ // Adjust the index
+ index = index + buffer.write(value.source, index, 'utf8');
+ // Write zero
+ buffer[index++] = 0x00;
+ // Write the parameters
+ if (value.global) buffer[index++] = 0x73; // s
+ if (value.ignoreCase) buffer[index++] = 0x69; // i
+ if (value.multiline) buffer[index++] = 0x6d; // m
+ // Add ending zero
+ buffer[index++] = 0x00;
+ return index;
+ };
+
+ var serializeBSONRegExp = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_REGEXP;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ // Check the pattern for 0 bytes
+ if (value.pattern.match(regexp) != null) {
+ // The BSON spec doesn't allow keys with null bytes because keys are
+ // null-terminated.
+ throw Error('pattern ' + value.pattern + ' must not contain null bytes');
+ }
+
+ // Adjust the index
+ index = index + buffer.write(value.pattern, index, 'utf8');
+ // Write zero
+ buffer[index++] = 0x00;
+ // Write the options
+ index = index + buffer.write(value.options.split('').sort().join(''), index, 'utf8');
+ // Add ending zero
+ buffer[index++] = 0x00;
+ return index;
+ };
+
+ var serializeMinMax = function (buffer, key, value, index, isArray) {
+ // Write the type of either min or max key
+ if (value === null) {
+ buffer[index++] = BSON.BSON_DATA_NULL;
+ } else if (value._bsontype === 'MinKey') {
+ buffer[index++] = BSON.BSON_DATA_MIN_KEY;
+ } else {
+ buffer[index++] = BSON.BSON_DATA_MAX_KEY;
+ }
+
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ return index;
+ };
+
+ var serializeObjectId = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_OID;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ // Write the objectId into the shared buffer
+ if (typeof value.id === 'string') {
+ buffer.write(value.id, index, 'binary');
+ } else if (value.id && value.id.copy) {
+ value.id.copy(buffer, index, 0, 12);
+ } else {
+ throw new Error('object [' + JSON.stringify(value) + '] is not a valid ObjectId');
+ }
+
+ // Ajust index
+ return index + 12;
+ };
+
+ var serializeBuffer = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_BINARY;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Get size of the buffer (current write point)
+ var size = value.length;
+ // Write the size of the string to buffer
+ buffer[index++] = size & 0xff;
+ buffer[index++] = size >> 8 & 0xff;
+ buffer[index++] = size >> 16 & 0xff;
+ buffer[index++] = size >> 24 & 0xff;
+ // Write the default subtype
+ buffer[index++] = BSON.BSON_BINARY_SUBTYPE_DEFAULT;
+ // Copy the content form the binary field to the buffer
+ value.copy(buffer, index, 0, size);
+ // Adjust the index
+ index = index + size;
+ return index;
+ };
+
+ var serializeObject = function (buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, isArray, path) {
+ for (var i = 0; i < path.length; i++) {
+ if (path[i] === value) throw new Error('cyclic dependency detected');
+ }
+
+ // Push value to stack
+ path.push(value);
+ // Write the type
+ buffer[index++] = Array.isArray(value) ? BSON.BSON_DATA_ARRAY : BSON.BSON_DATA_OBJECT;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ var endIndex = serializeInto(buffer, value, checkKeys, index, depth + 1, serializeFunctions, ignoreUndefined, path);
+ // Pop stack
+ path.pop();
+ // Write size
+ return endIndex;
+ };
+
+ var serializeDecimal128 = function (buffer, key, value, index, isArray) {
+ buffer[index++] = BSON.BSON_DATA_DECIMAL128;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the data from the value
+ value.bytes.copy(buffer, index, 0, 16);
+ return index + 16;
+ };
+
+ var serializeLong = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = value._bsontype === 'Long' ? BSON.BSON_DATA_LONG : BSON.BSON_DATA_TIMESTAMP;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the date
+ var lowBits = value.getLowBits();
+ var highBits = value.getHighBits();
+ // Encode low bits
+ buffer[index++] = lowBits & 0xff;
+ buffer[index++] = lowBits >> 8 & 0xff;
+ buffer[index++] = lowBits >> 16 & 0xff;
+ buffer[index++] = lowBits >> 24 & 0xff;
+ // Encode high bits
+ buffer[index++] = highBits & 0xff;
+ buffer[index++] = highBits >> 8 & 0xff;
+ buffer[index++] = highBits >> 16 & 0xff;
+ buffer[index++] = highBits >> 24 & 0xff;
+ return index;
+ };
+
+ var serializeInt32 = function (buffer, key, value, index, isArray) {
+ // Set int type 32 bits or less
+ buffer[index++] = BSON.BSON_DATA_INT;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the int value
+ buffer[index++] = value & 0xff;
+ buffer[index++] = value >> 8 & 0xff;
+ buffer[index++] = value >> 16 & 0xff;
+ buffer[index++] = value >> 24 & 0xff;
+ return index;
+ };
+
+ var serializeDouble = function (buffer, key, value, index, isArray) {
+ // Encode as double
+ buffer[index++] = BSON.BSON_DATA_NUMBER;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write float
+ writeIEEE754(buffer, value, index, 'little', 52, 8);
+ // Ajust index
+ index = index + 8;
+ return index;
+ };
+
+ var serializeFunction = function (buffer, key, value, index, checkKeys, depth, isArray) {
+ buffer[index++] = BSON.BSON_DATA_CODE;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Function string
+ var functionString = normalizedFunctionString(value);
+
+ // Write the string
+ var size = buffer.write(functionString, index + 4, 'utf8') + 1;
+ // Write the size of the string to buffer
+ buffer[index] = size & 0xff;
+ buffer[index + 1] = size >> 8 & 0xff;
+ buffer[index + 2] = size >> 16 & 0xff;
+ buffer[index + 3] = size >> 24 & 0xff;
+ // Update index
+ index = index + 4 + size - 1;
+ // Write zero
+ buffer[index++] = 0;
+ return index;
+ };
+
+ var serializeCode = function (buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, isArray) {
+ if (value.scope && typeof value.scope === 'object') {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_CODE_W_SCOPE;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ // Starting index
+ var startIndex = index;
+
+ // Serialize the function
+ // Get the function string
+ var functionString = typeof value.code === 'string' ? value.code : value.code.toString();
+ // Index adjustment
+ index = index + 4;
+ // Write string into buffer
+ var codeSize = buffer.write(functionString, index + 4, 'utf8') + 1;
+ // Write the size of the string to buffer
+ buffer[index] = codeSize & 0xff;
+ buffer[index + 1] = codeSize >> 8 & 0xff;
+ buffer[index + 2] = codeSize >> 16 & 0xff;
+ buffer[index + 3] = codeSize >> 24 & 0xff;
+ // Write end 0
+ buffer[index + 4 + codeSize - 1] = 0;
+ // Write the
+ index = index + codeSize + 4;
+
+ //
+ // Serialize the scope value
+ var endIndex = serializeInto(buffer, value.scope, checkKeys, index, depth + 1, serializeFunctions, ignoreUndefined);
+ index = endIndex - 1;
+
+ // Writ the total
+ var totalSize = endIndex - startIndex;
+
+ // Write the total size of the object
+ buffer[startIndex++] = totalSize & 0xff;
+ buffer[startIndex++] = totalSize >> 8 & 0xff;
+ buffer[startIndex++] = totalSize >> 16 & 0xff;
+ buffer[startIndex++] = totalSize >> 24 & 0xff;
+ // Write trailing zero
+ buffer[index++] = 0;
+ } else {
+ buffer[index++] = BSON.BSON_DATA_CODE;
+ // Number of written bytes
+ numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Function string
+ functionString = value.code.toString();
+ // Write the string
+ var size = buffer.write(functionString, index + 4, 'utf8') + 1;
+ // Write the size of the string to buffer
+ buffer[index] = size & 0xff;
+ buffer[index + 1] = size >> 8 & 0xff;
+ buffer[index + 2] = size >> 16 & 0xff;
+ buffer[index + 3] = size >> 24 & 0xff;
+ // Update index
+ index = index + 4 + size - 1;
+ // Write zero
+ buffer[index++] = 0;
+ }
+
+ return index;
+ };
+
+ var serializeBinary = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_BINARY;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Extract the buffer
+ var data = value.value(true);
+ // Calculate size
+ var size = value.position;
+ // Add the deprecated 02 type 4 bytes of size to total
+ if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) size = size + 4;
+ // Write the size of the string to buffer
+ buffer[index++] = size & 0xff;
+ buffer[index++] = size >> 8 & 0xff;
+ buffer[index++] = size >> 16 & 0xff;
+ buffer[index++] = size >> 24 & 0xff;
+ // Write the subtype to the buffer
+ buffer[index++] = value.sub_type;
+
+ // If we have binary type 2 the 4 first bytes are the size
+ if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) {
+ size = size - 4;
+ buffer[index++] = size & 0xff;
+ buffer[index++] = size >> 8 & 0xff;
+ buffer[index++] = size >> 16 & 0xff;
+ buffer[index++] = size >> 24 & 0xff;
+ }
+
+ // Write the data to the object
+ data.copy(buffer, index, 0, value.position);
+ // Adjust the index
+ index = index + value.position;
+ return index;
+ };
+
+ var serializeSymbol = function (buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_SYMBOL;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the string
+ var size = buffer.write(value.value, index + 4, 'utf8') + 1;
+ // Write the size of the string to buffer
+ buffer[index] = size & 0xff;
+ buffer[index + 1] = size >> 8 & 0xff;
+ buffer[index + 2] = size >> 16 & 0xff;
+ buffer[index + 3] = size >> 24 & 0xff;
+ // Update index
+ index = index + 4 + size - 1;
+ // Write zero
+ buffer[index++] = 0x00;
+ return index;
+ };
+
+ var serializeDBRef = function (buffer, key, value, index, depth, serializeFunctions, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_OBJECT;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii');
+
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ var startIndex = index;
+ var endIndex;
+
+ // Serialize object
+ if (null != value.db) {
+ endIndex = serializeInto(buffer, {
+ $ref: value.namespace,
+ $id: value.oid,
+ $db: value.db
+ }, false, index, depth + 1, serializeFunctions);
+ } else {
+ endIndex = serializeInto(buffer, {
+ $ref: value.namespace,
+ $id: value.oid
+ }, false, index, depth + 1, serializeFunctions);
+ }
+
+ // Calculate object size
+ var size = endIndex - startIndex;
+ // Write the size
+ buffer[startIndex++] = size & 0xff;
+ buffer[startIndex++] = size >> 8 & 0xff;
+ buffer[startIndex++] = size >> 16 & 0xff;
+ buffer[startIndex++] = size >> 24 & 0xff;
+ // Set index
+ return endIndex;
+ };
+
+ var serializeInto = function serializeInto(buffer, object, checkKeys, startingIndex, depth, serializeFunctions, ignoreUndefined, path) {
+ startingIndex = startingIndex || 0;
+ path = path || [];
+
+ // Push the object to the path
+ path.push(object);
+
+ // Start place to serialize into
+ var index = startingIndex + 4;
+ // var self = this;
+
+ // Special case isArray
+ if (Array.isArray(object)) {
+ // Get object keys
+ for (var i = 0; i < object.length; i++) {
+ var key = '' + i;
+ var value = object[i];
+
+ // Is there an override value
+ if (value && value.toBSON) {
+ if (typeof value.toBSON !== 'function') throw new Error('toBSON is not a function');
+ value = value.toBSON();
+ }
+
+ var type = typeof value;
+ if (type === 'string') {
+ index = serializeString(buffer, key, value, index, true);
+ } else if (type === 'number') {
+ index = serializeNumber(buffer, key, value, index, true);
+ } else if (type === 'boolean') {
+ index = serializeBoolean(buffer, key, value, index, true);
+ } else if (value instanceof Date || isDate(value)) {
+ index = serializeDate(buffer, key, value, index, true);
+ } else if (value === undefined) {
+ index = serializeNull(buffer, key, value, index, true);
+ } else if (value === null) {
+ index = serializeNull(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') {
+ index = serializeObjectId(buffer, key, value, index, true);
+ } else if (Buffer.isBuffer(value)) {
+ index = serializeBuffer(buffer, key, value, index, true);
+ } else if (value instanceof RegExp || isRegExp(value)) {
+ index = serializeRegExp(buffer, key, value, index, true);
+ } else if (type === 'object' && value['_bsontype'] == null) {
+ index = serializeObject(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, true, path);
+ } else if (type === 'object' && value['_bsontype'] === 'Decimal128') {
+ index = serializeDecimal128(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') {
+ index = serializeLong(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'Double') {
+ index = serializeDouble(buffer, key, value, index, true);
+ } else if (typeof value === 'function' && serializeFunctions) {
+ index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions, true);
+ } else if (value['_bsontype'] === 'Code') {
+ index = serializeCode(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, true);
+ } else if (value['_bsontype'] === 'Binary') {
+ index = serializeBinary(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'Symbol') {
+ index = serializeSymbol(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'DBRef') {
+ index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions, true);
+ } else if (value['_bsontype'] === 'BSONRegExp') {
+ index = serializeBSONRegExp(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'Int32') {
+ index = serializeInt32(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') {
+ index = serializeMinMax(buffer, key, value, index, true);
+ }
+ }
+ } else if (object instanceof Map) {
+ var iterator = object.entries();
+ var done = false;
+
+ while (!done) {
+ // Unpack the next entry
+ var entry = iterator.next();
+ done = entry.done;
+ // Are we done, then skip and terminate
+ if (done) continue;
+
+ // Get the entry values
+ key = entry.value[0];
+ value = entry.value[1];
+
+ // Check the type of the value
+ type = typeof value;
+
+ // Check the key and throw error if it's illegal
+ if (typeof key === 'string' && ignoreKeys.indexOf(key) === -1) {
+ if (key.match(regexp) != null) {
+ // The BSON spec doesn't allow keys with null bytes because keys are
+ // null-terminated.
+ throw Error('key ' + key + ' must not contain null bytes');
+ }
+
+ if (checkKeys) {
+ if ('$' === key[0]) {
+ throw Error('key ' + key + " must not start with '$'");
+ } else if (~key.indexOf('.')) {
+ throw Error('key ' + key + " must not contain '.'");
+ }
+ }
+ }
+
+ if (type === 'string') {
+ index = serializeString(buffer, key, value, index);
+ } else if (type === 'number') {
+ index = serializeNumber(buffer, key, value, index);
+ } else if (type === 'boolean') {
+ index = serializeBoolean(buffer, key, value, index);
+ } else if (value instanceof Date || isDate(value)) {
+ index = serializeDate(buffer, key, value, index);
+ // } else if (value === undefined && ignoreUndefined === true) {
+ } else if (value === null || value === undefined && ignoreUndefined === false) {
+ index = serializeNull(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') {
+ index = serializeObjectId(buffer, key, value, index);
+ } else if (Buffer.isBuffer(value)) {
+ index = serializeBuffer(buffer, key, value, index);
+ } else if (value instanceof RegExp || isRegExp(value)) {
+ index = serializeRegExp(buffer, key, value, index);
+ } else if (type === 'object' && value['_bsontype'] == null) {
+ index = serializeObject(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, false, path);
+ } else if (type === 'object' && value['_bsontype'] === 'Decimal128') {
+ index = serializeDecimal128(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') {
+ index = serializeLong(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Double') {
+ index = serializeDouble(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Code') {
+ index = serializeCode(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined);
+ } else if (typeof value === 'function' && serializeFunctions) {
+ index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions);
+ } else if (value['_bsontype'] === 'Binary') {
+ index = serializeBinary(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Symbol') {
+ index = serializeSymbol(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'DBRef') {
+ index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions);
+ } else if (value['_bsontype'] === 'BSONRegExp') {
+ index = serializeBSONRegExp(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Int32') {
+ index = serializeInt32(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') {
+ index = serializeMinMax(buffer, key, value, index);
+ }
+ }
+ } else {
+ // Did we provide a custom serialization method
+ if (object.toBSON) {
+ if (typeof object.toBSON !== 'function') throw new Error('toBSON is not a function');
+ object = object.toBSON();
+ if (object != null && typeof object !== 'object') throw new Error('toBSON function did not return an object');
+ }
+
+ // Iterate over all the keys
+ for (key in object) {
+ value = object[key];
+ // Is there an override value
+ if (value && value.toBSON) {
+ if (typeof value.toBSON !== 'function') throw new Error('toBSON is not a function');
+ value = value.toBSON();
+ }
+
+ // Check the type of the value
+ type = typeof value;
+
+ // Check the key and throw error if it's illegal
+ if (typeof key === 'string' && ignoreKeys.indexOf(key) === -1) {
+ if (key.match(regexp) != null) {
+ // The BSON spec doesn't allow keys with null bytes because keys are
+ // null-terminated.
+ throw Error('key ' + key + ' must not contain null bytes');
+ }
+
+ if (checkKeys) {
+ if ('$' === key[0]) {
+ throw Error('key ' + key + " must not start with '$'");
+ } else if (~key.indexOf('.')) {
+ throw Error('key ' + key + " must not contain '.'");
+ }
+ }
+ }
+
+ if (type === 'string') {
+ index = serializeString(buffer, key, value, index);
+ } else if (type === 'number') {
+ index = serializeNumber(buffer, key, value, index);
+ } else if (type === 'boolean') {
+ index = serializeBoolean(buffer, key, value, index);
+ } else if (value instanceof Date || isDate(value)) {
+ index = serializeDate(buffer, key, value, index);
+ } else if (value === undefined) {
+ if (ignoreUndefined === false) index = serializeNull(buffer, key, value, index);
+ } else if (value === null) {
+ index = serializeNull(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') {
+ index = serializeObjectId(buffer, key, value, index);
+ } else if (Buffer.isBuffer(value)) {
+ index = serializeBuffer(buffer, key, value, index);
+ } else if (value instanceof RegExp || isRegExp(value)) {
+ index = serializeRegExp(buffer, key, value, index);
+ } else if (type === 'object' && value['_bsontype'] == null) {
+ index = serializeObject(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, false, path);
+ } else if (type === 'object' && value['_bsontype'] === 'Decimal128') {
+ index = serializeDecimal128(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') {
+ index = serializeLong(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Double') {
+ index = serializeDouble(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Code') {
+ index = serializeCode(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined);
+ } else if (typeof value === 'function' && serializeFunctions) {
+ index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions);
+ } else if (value['_bsontype'] === 'Binary') {
+ index = serializeBinary(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Symbol') {
+ index = serializeSymbol(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'DBRef') {
+ index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions);
+ } else if (value['_bsontype'] === 'BSONRegExp') {
+ index = serializeBSONRegExp(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Int32') {
+ index = serializeInt32(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') {
+ index = serializeMinMax(buffer, key, value, index);
+ }
+ }
+ }
+
+ // Remove the path
+ path.pop();
+
+ // Final padding byte for object
+ buffer[index++] = 0x00;
+
+ // Final size
+ var size = index - startingIndex;
+ // Write the size of the object
+ buffer[startingIndex++] = size & 0xff;
+ buffer[startingIndex++] = size >> 8 & 0xff;
+ buffer[startingIndex++] = size >> 16 & 0xff;
+ buffer[startingIndex++] = size >> 24 & 0xff;
+ return index;
+ };
+
+ var BSON = {};
+
+ /**
+ * Contains the function cache if we have that enable to allow for avoiding the eval step on each deserialization, comparison is by md5
+ *
+ * @ignore
+ * @api private
+ */
+ // var functionCache = (BSON.functionCache = {});
+
+ /**
+ * Number BSON Type
+ *
+ * @classconstant BSON_DATA_NUMBER
+ **/
+ BSON.BSON_DATA_NUMBER = 1;
+ /**
+ * String BSON Type
+ *
+ * @classconstant BSON_DATA_STRING
+ **/
+ BSON.BSON_DATA_STRING = 2;
+ /**
+ * Object BSON Type
+ *
+ * @classconstant BSON_DATA_OBJECT
+ **/
+ BSON.BSON_DATA_OBJECT = 3;
+ /**
+ * Array BSON Type
+ *
+ * @classconstant BSON_DATA_ARRAY
+ **/
+ BSON.BSON_DATA_ARRAY = 4;
+ /**
+ * Binary BSON Type
+ *
+ * @classconstant BSON_DATA_BINARY
+ **/
+ BSON.BSON_DATA_BINARY = 5;
+ /**
+ * ObjectID BSON Type, deprecated
+ *
+ * @classconstant BSON_DATA_UNDEFINED
+ **/
+ BSON.BSON_DATA_UNDEFINED = 6;
+ /**
+ * ObjectID BSON Type
+ *
+ * @classconstant BSON_DATA_OID
+ **/
+ BSON.BSON_DATA_OID = 7;
+ /**
+ * Boolean BSON Type
+ *
+ * @classconstant BSON_DATA_BOOLEAN
+ **/
+ BSON.BSON_DATA_BOOLEAN = 8;
+ /**
+ * Date BSON Type
+ *
+ * @classconstant BSON_DATA_DATE
+ **/
+ BSON.BSON_DATA_DATE = 9;
+ /**
+ * null BSON Type
+ *
+ * @classconstant BSON_DATA_NULL
+ **/
+ BSON.BSON_DATA_NULL = 10;
+ /**
+ * RegExp BSON Type
+ *
+ * @classconstant BSON_DATA_REGEXP
+ **/
+ BSON.BSON_DATA_REGEXP = 11;
+ /**
+ * Code BSON Type
+ *
+ * @classconstant BSON_DATA_CODE
+ **/
+ BSON.BSON_DATA_CODE = 13;
+ /**
+ * Symbol BSON Type
+ *
+ * @classconstant BSON_DATA_SYMBOL
+ **/
+ BSON.BSON_DATA_SYMBOL = 14;
+ /**
+ * Code with Scope BSON Type
+ *
+ * @classconstant BSON_DATA_CODE_W_SCOPE
+ **/
+ BSON.BSON_DATA_CODE_W_SCOPE = 15;
+ /**
+ * 32 bit Integer BSON Type
+ *
+ * @classconstant BSON_DATA_INT
+ **/
+ BSON.BSON_DATA_INT = 16;
+ /**
+ * Timestamp BSON Type
+ *
+ * @classconstant BSON_DATA_TIMESTAMP
+ **/
+ BSON.BSON_DATA_TIMESTAMP = 17;
+ /**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_LONG
+ **/
+ BSON.BSON_DATA_LONG = 18;
+ /**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_DECIMAL128
+ **/
+ BSON.BSON_DATA_DECIMAL128 = 19;
+ /**
+ * MinKey BSON Type
+ *
+ * @classconstant BSON_DATA_MIN_KEY
+ **/
+ BSON.BSON_DATA_MIN_KEY = 0xff;
+ /**
+ * MaxKey BSON Type
+ *
+ * @classconstant BSON_DATA_MAX_KEY
+ **/
+ BSON.BSON_DATA_MAX_KEY = 0x7f;
+ /**
+ * Binary Default Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_DEFAULT
+ **/
+ BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0;
+ /**
+ * Binary Function Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_FUNCTION
+ **/
+ BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1;
+ /**
+ * Binary Byte Array Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY
+ **/
+ BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2;
+ /**
+ * Binary UUID Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_UUID
+ **/
+ BSON.BSON_BINARY_SUBTYPE_UUID = 3;
+ /**
+ * Binary MD5 Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_MD5
+ **/
+ BSON.BSON_BINARY_SUBTYPE_MD5 = 4;
+ /**
+ * Binary User Defined Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED
+ **/
+ BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128;
+
+ // BSON MAX VALUES
+ BSON.BSON_INT32_MAX = 0x7fffffff;
+ BSON.BSON_INT32_MIN = -0x80000000;
+
+ BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1;
+ BSON.BSON_INT64_MIN = -Math.pow(2, 63);
+
+ // JS MAX PRECISE VALUES
+ BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+ BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+ // Internal long versions
+ // var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double.
+ // var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double.
+
+ module.exports = serializeInto;
+ /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer))
+
+/***/ }),
+/* 359 */
+/***/ (function(module, exports) {
+
+ // Copyright (c) 2008, Fair Oaks Labs, Inc.
+ // All rights reserved.
+ //
+ // Redistribution and use in source and binary forms, with or without
+ // modification, are permitted provided that the following conditions are met:
+ //
+ // * Redistributions of source code must retain the above copyright notice,
+ // this list of conditions and the following disclaimer.
+ //
+ // * Redistributions in binary form must reproduce the above copyright notice,
+ // this list of conditions and the following disclaimer in the documentation
+ // and/or other materials provided with the distribution.
+ //
+ // * Neither the name of Fair Oaks Labs, Inc. nor the names of its contributors
+ // may be used to endorse or promote products derived from this software
+ // without specific prior written permission.
+ //
+ // THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+ // AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+ // IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ // ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE
+ // LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+ // CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+ // SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ // INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
+ // CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+ // ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+ // POSSIBILITY OF SUCH DAMAGE.
+ //
+ //
+ // Modifications to writeIEEE754 to support negative zeroes made by Brian White
+
+ var readIEEE754 = function (buffer, offset, endian, mLen, nBytes) {
+ var e,
+ m,
+ bBE = endian === 'big',
+ eLen = nBytes * 8 - mLen - 1,
+ eMax = (1 << eLen) - 1,
+ eBias = eMax >> 1,
+ nBits = -7,
+ i = bBE ? 0 : nBytes - 1,
+ d = bBE ? 1 : -1,
+ s = buffer[offset + i];
+
+ i += d;
+
+ e = s & (1 << -nBits) - 1;
+ s >>= -nBits;
+ nBits += eLen;
+ for (; nBits > 0; e = e * 256 + buffer[offset + i], i += d, nBits -= 8);
+
+ m = e & (1 << -nBits) - 1;
+ e >>= -nBits;
+ nBits += mLen;
+ for (; nBits > 0; m = m * 256 + buffer[offset + i], i += d, nBits -= 8);
+
+ if (e === 0) {
+ e = 1 - eBias;
+ } else if (e === eMax) {
+ return m ? NaN : (s ? -1 : 1) * Infinity;
+ } else {
+ m = m + Math.pow(2, mLen);
+ e = e - eBias;
+ }
+ return (s ? -1 : 1) * m * Math.pow(2, e - mLen);
+ };
+
+ var writeIEEE754 = function (buffer, value, offset, endian, mLen, nBytes) {
+ var e,
+ m,
+ c,
+ bBE = endian === 'big',
+ eLen = nBytes * 8 - mLen - 1,
+ eMax = (1 << eLen) - 1,
+ eBias = eMax >> 1,
+ rt = mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0,
+ i = bBE ? nBytes - 1 : 0,
+ d = bBE ? -1 : 1,
+ s = value < 0 || value === 0 && 1 / value < 0 ? 1 : 0;
+
+ value = Math.abs(value);
+
+ if (isNaN(value) || value === Infinity) {
+ m = isNaN(value) ? 1 : 0;
+ e = eMax;
+ } else {
+ e = Math.floor(Math.log(value) / Math.LN2);
+ if (value * (c = Math.pow(2, -e)) < 1) {
+ e--;
+ c *= 2;
+ }
+ if (e + eBias >= 1) {
+ value += rt / c;
+ } else {
+ value += rt * Math.pow(2, 1 - eBias);
+ }
+ if (value * c >= 2) {
+ e++;
+ c /= 2;
+ }
+
+ if (e + eBias >= eMax) {
+ m = 0;
+ e = eMax;
+ } else if (e + eBias >= 1) {
+ m = (value * c - 1) * Math.pow(2, mLen);
+ e = e + eBias;
+ } else {
+ m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen);
+ e = 0;
+ }
+ }
+
+ for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8);
+
+ e = e << mLen | m;
+ eLen += mLen;
+ for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8);
+
+ buffer[offset + i - d] |= s * 128;
+ };
+
+ exports.readIEEE754 = readIEEE754;
+ exports.writeIEEE754 = writeIEEE754;
+
+/***/ }),
+/* 360 */
+/***/ (function(module, exports, __webpack_require__) {
+
+ /* WEBPACK VAR INJECTION */(function(Buffer) {'use strict';
+
+ var Long = __webpack_require__(335).Long,
+ Double = __webpack_require__(336).Double,
+ Timestamp = __webpack_require__(337).Timestamp,
+ ObjectID = __webpack_require__(338).ObjectID,
+ Symbol = __webpack_require__(349).Symbol,
+ BSONRegExp = __webpack_require__(348).BSONRegExp,
+ Code = __webpack_require__(351).Code,
+ Decimal128 = __webpack_require__(352),
+ MinKey = __webpack_require__(353).MinKey,
+ MaxKey = __webpack_require__(354).MaxKey,
+ DBRef = __webpack_require__(355).DBRef,
+ Binary = __webpack_require__(356).Binary;
+
+ var normalizedFunctionString = __webpack_require__(344).normalizedFunctionString;
+
+ // To ensure that 0.4 of node works correctly
+ var isDate = function isDate(d) {
+ return typeof d === 'object' && Object.prototype.toString.call(d) === '[object Date]';
+ };
+
+ var calculateObjectSize = function calculateObjectSize(object, serializeFunctions, ignoreUndefined) {
+ var totalLength = 4 + 1;
+
+ if (Array.isArray(object)) {
+ for (var i = 0; i < object.length; i++) {
+ totalLength += calculateElement(i.toString(), object[i], serializeFunctions, true, ignoreUndefined);
+ }
+ } else {
+ // If we have toBSON defined, override the current object
+ if (object.toBSON) {
+ object = object.toBSON();
+ }
+
+ // Calculate size
+ for (var key in object) {
+ totalLength += calculateElement(key, object[key], serializeFunctions, false, ignoreUndefined);
+ }
+ }
+
+ return totalLength;
+ };
+
+ /**
+ * @ignore
+ * @api private
+ */
+ function calculateElement(name, value, serializeFunctions, isArray, ignoreUndefined) {
+ // If we have toBSON defined, override the current object
+ if (value && value.toBSON) {
+ value = value.toBSON();
+ }
+
+ switch (typeof value) {
+ case 'string':
+ return 1 + Buffer.byteLength(name, 'utf8') + 1 + 4 + Buffer.byteLength(value, 'utf8') + 1;
+ case 'number':
+ if (Math.floor(value) === value && value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) {
+ if (value >= BSON.BSON_INT32_MIN && value <= BSON.BSON_INT32_MAX) {
+ // 32 bit
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (4 + 1);
+ } else {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1);
+ }
+ } else {
+ // 64 bit
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1);
+ }
+ case 'undefined':
+ if (isArray || !ignoreUndefined) return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1;
+ return 0;
+ case 'boolean':
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (1 + 1);
+ case 'object':
+ if (value == null || value instanceof MinKey || value instanceof MaxKey || value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1;
+ } else if (value instanceof ObjectID || value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (12 + 1);
+ } else if (value instanceof Date || isDate(value)) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1);
+ } else if (typeof Buffer !== 'undefined' && Buffer.isBuffer(value)) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (1 + 4 + 1) + value.length;
+ } else if (value instanceof Long || value instanceof Double || value instanceof Timestamp || value['_bsontype'] === 'Long' || value['_bsontype'] === 'Double' || value['_bsontype'] === 'Timestamp') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1);
+ } else if (value instanceof Decimal128 || value['_bsontype'] === 'Decimal128') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (16 + 1);
+ } else if (value instanceof Code || value['_bsontype'] === 'Code') {
+ // Calculate size depending on the availability of a scope
+ if (value.scope != null && Object.keys(value.scope).length > 0) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + 4 + 4 + Buffer.byteLength(value.code.toString(), 'utf8') + 1 + calculateObjectSize(value.scope, serializeFunctions, ignoreUndefined);
+ } else {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + 4 + Buffer.byteLength(value.code.toString(), 'utf8') + 1;
+ }
+ } else if (value instanceof Binary || value['_bsontype'] === 'Binary') {
+ // Check what kind of subtype we have
+ if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (value.position + 1 + 4 + 1 + 4);
+ } else {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (value.position + 1 + 4 + 1);
+ }
+ } else if (value instanceof Symbol || value['_bsontype'] === 'Symbol') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + Buffer.byteLength(value.value, 'utf8') + 4 + 1 + 1;
+ } else if (value instanceof DBRef || value['_bsontype'] === 'DBRef') {
+ // Set up correct object for serialization
+ var ordered_values = {
+ $ref: value.namespace,
+ $id: value.oid
+ };
+
+ // Add db reference if it exists
+ if (null != value.db) {
+ ordered_values['$db'] = value.db;
+ }
+
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + calculateObjectSize(ordered_values, serializeFunctions, ignoreUndefined);
+ } else if (value instanceof RegExp || Object.prototype.toString.call(value) === '[object RegExp]') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + Buffer.byteLength(value.source, 'utf8') + 1 + (value.global ? 1 : 0) + (value.ignoreCase ? 1 : 0) + (value.multiline ? 1 : 0) + 1;
+ } else if (value instanceof BSONRegExp || value['_bsontype'] === 'BSONRegExp') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + Buffer.byteLength(value.pattern, 'utf8') + 1 + Buffer.byteLength(value.options, 'utf8') + 1;
+ } else {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + calculateObjectSize(value, serializeFunctions, ignoreUndefined) + 1;
+ }
+ case 'function':
+ // WTF for 0.4.X where typeof /someregexp/ === 'function'
+ if (value instanceof RegExp || Object.prototype.toString.call(value) === '[object RegExp]' || String.call(value) === '[object RegExp]') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + Buffer.byteLength(value.source, 'utf8') + 1 + (value.global ? 1 : 0) + (value.ignoreCase ? 1 : 0) + (value.multiline ? 1 : 0) + 1;
+ } else {
+ if (serializeFunctions && value.scope != null && Object.keys(value.scope).length > 0) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + 4 + 4 + Buffer.byteLength(normalizedFunctionString(value), 'utf8') + 1 + calculateObjectSize(value.scope, serializeFunctions, ignoreUndefined);
+ } else if (serializeFunctions) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + 4 + Buffer.byteLength(normalizedFunctionString(value), 'utf8') + 1;
+ }
+ }
+ }
+
+ return 0;
+ }
+
+ var BSON = {};
+
+ // BSON MAX VALUES
+ BSON.BSON_INT32_MAX = 0x7fffffff;
+ BSON.BSON_INT32_MIN = -0x80000000;
+
+ // JS MAX PRECISE VALUES
+ BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+ BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+ module.exports = calculateObjectSize;
+ /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer))
+
+/***/ })
+/******/ ])
+});
+;
\ No newline at end of file
diff --git a/Restaurant/node_modules/bson/browser_build/package.json b/Restaurant/node_modules/bson/browser_build/package.json
new file mode 100644
index 0000000..980db7f
--- /dev/null
+++ b/Restaurant/node_modules/bson/browser_build/package.json
@@ -0,0 +1,8 @@
+{ "name" : "bson"
+, "description" : "A bson parser for node.js and the browser"
+, "main": "../"
+, "directories" : { "lib" : "../lib/bson" }
+, "engines" : { "node" : ">=0.6.0" }
+, "licenses" : [ { "type" : "Apache License, Version 2.0"
+ , "url" : "http://www.apache.org/licenses/LICENSE-2.0" } ]
+}
diff --git a/Restaurant/node_modules/bson/index.js b/Restaurant/node_modules/bson/index.js
new file mode 100644
index 0000000..6502552
--- /dev/null
+++ b/Restaurant/node_modules/bson/index.js
@@ -0,0 +1,46 @@
+var BSON = require('./lib/bson/bson'),
+ Binary = require('./lib/bson/binary'),
+ Code = require('./lib/bson/code'),
+ DBRef = require('./lib/bson/db_ref'),
+ Decimal128 = require('./lib/bson/decimal128'),
+ Double = require('./lib/bson/double'),
+ Int32 = require('./lib/bson/int_32'),
+ Long = require('./lib/bson/long'),
+ Map = require('./lib/bson/map'),
+ MaxKey = require('./lib/bson/max_key'),
+ MinKey = require('./lib/bson/min_key'),
+ ObjectId = require('./lib/bson/objectid'),
+ BSONRegExp = require('./lib/bson/regexp'),
+ Symbol = require('./lib/bson/symbol'),
+ Timestamp = require('./lib/bson/timestamp');
+
+// BSON MAX VALUES
+BSON.BSON_INT32_MAX = 0x7fffffff;
+BSON.BSON_INT32_MIN = -0x80000000;
+
+BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1;
+BSON.BSON_INT64_MIN = -Math.pow(2, 63);
+
+// JS MAX PRECISE VALUES
+BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+// Add BSON types to function creation
+BSON.Binary = Binary;
+BSON.Code = Code;
+BSON.DBRef = DBRef;
+BSON.Decimal128 = Decimal128;
+BSON.Double = Double;
+BSON.Int32 = Int32;
+BSON.Long = Long;
+BSON.Map = Map;
+BSON.MaxKey = MaxKey;
+BSON.MinKey = MinKey;
+BSON.ObjectId = ObjectId;
+BSON.ObjectID = ObjectId;
+BSON.BSONRegExp = BSONRegExp;
+BSON.Symbol = Symbol;
+BSON.Timestamp = Timestamp;
+
+// Return the BSON
+module.exports = BSON;
diff --git a/Restaurant/node_modules/bson/lib/bson/binary.js b/Restaurant/node_modules/bson/lib/bson/binary.js
new file mode 100644
index 0000000..6d190bc
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/binary.js
@@ -0,0 +1,384 @@
+/**
+ * Module dependencies.
+ * @ignore
+ */
+
+// Test if we're in Node via presence of "global" not absence of "window"
+// to support hybrid environments like Electron
+if (typeof global !== 'undefined') {
+ var Buffer = require('buffer').Buffer; // TODO just use global Buffer
+}
+
+var utils = require('./parser/utils');
+
+/**
+ * A class representation of the BSON Binary type.
+ *
+ * Sub types
+ * - **BSON.BSON_BINARY_SUBTYPE_DEFAULT**, default BSON type.
+ * - **BSON.BSON_BINARY_SUBTYPE_FUNCTION**, BSON function type.
+ * - **BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY**, BSON byte array type.
+ * - **BSON.BSON_BINARY_SUBTYPE_UUID**, BSON uuid type.
+ * - **BSON.BSON_BINARY_SUBTYPE_MD5**, BSON md5 type.
+ * - **BSON.BSON_BINARY_SUBTYPE_USER_DEFINED**, BSON user defined type.
+ *
+ * @class
+ * @param {Buffer} buffer a buffer object containing the binary data.
+ * @param {Number} [subType] the option binary type.
+ * @return {Binary}
+ */
+function Binary(buffer, subType) {
+ if (!(this instanceof Binary)) return new Binary(buffer, subType);
+
+ if (
+ buffer != null &&
+ !(typeof buffer === 'string') &&
+ !Buffer.isBuffer(buffer) &&
+ !(buffer instanceof Uint8Array) &&
+ !Array.isArray(buffer)
+ ) {
+ throw new Error('only String, Buffer, Uint8Array or Array accepted');
+ }
+
+ this._bsontype = 'Binary';
+
+ if (buffer instanceof Number) {
+ this.sub_type = buffer;
+ this.position = 0;
+ } else {
+ this.sub_type = subType == null ? BSON_BINARY_SUBTYPE_DEFAULT : subType;
+ this.position = 0;
+ }
+
+ if (buffer != null && !(buffer instanceof Number)) {
+ // Only accept Buffer, Uint8Array or Arrays
+ if (typeof buffer === 'string') {
+ // Different ways of writing the length of the string for the different types
+ if (typeof Buffer !== 'undefined') {
+ this.buffer = utils.toBuffer(buffer);
+ } else if (
+ typeof Uint8Array !== 'undefined' ||
+ Object.prototype.toString.call(buffer) === '[object Array]'
+ ) {
+ this.buffer = writeStringToArray(buffer);
+ } else {
+ throw new Error('only String, Buffer, Uint8Array or Array accepted');
+ }
+ } else {
+ this.buffer = buffer;
+ }
+ this.position = buffer.length;
+ } else {
+ if (typeof Buffer !== 'undefined') {
+ this.buffer = utils.allocBuffer(Binary.BUFFER_SIZE);
+ } else if (typeof Uint8Array !== 'undefined') {
+ this.buffer = new Uint8Array(new ArrayBuffer(Binary.BUFFER_SIZE));
+ } else {
+ this.buffer = new Array(Binary.BUFFER_SIZE);
+ }
+ // Set position to start of buffer
+ this.position = 0;
+ }
+}
+
+/**
+ * Updates this binary with byte_value.
+ *
+ * @method
+ * @param {string} byte_value a single byte we wish to write.
+ */
+Binary.prototype.put = function put(byte_value) {
+ // If it's a string and a has more than one character throw an error
+ if (byte_value['length'] != null && typeof byte_value !== 'number' && byte_value.length !== 1)
+ throw new Error('only accepts single character String, Uint8Array or Array');
+ if ((typeof byte_value !== 'number' && byte_value < 0) || byte_value > 255)
+ throw new Error('only accepts number in a valid unsigned byte range 0-255');
+
+ // Decode the byte value once
+ var decoded_byte = null;
+ if (typeof byte_value === 'string') {
+ decoded_byte = byte_value.charCodeAt(0);
+ } else if (byte_value['length'] != null) {
+ decoded_byte = byte_value[0];
+ } else {
+ decoded_byte = byte_value;
+ }
+
+ if (this.buffer.length > this.position) {
+ this.buffer[this.position++] = decoded_byte;
+ } else {
+ if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) {
+ // Create additional overflow buffer
+ var buffer = utils.allocBuffer(Binary.BUFFER_SIZE + this.buffer.length);
+ // Combine the two buffers together
+ this.buffer.copy(buffer, 0, 0, this.buffer.length);
+ this.buffer = buffer;
+ this.buffer[this.position++] = decoded_byte;
+ } else {
+ buffer = null;
+ // Create a new buffer (typed or normal array)
+ if (Object.prototype.toString.call(this.buffer) === '[object Uint8Array]') {
+ buffer = new Uint8Array(new ArrayBuffer(Binary.BUFFER_SIZE + this.buffer.length));
+ } else {
+ buffer = new Array(Binary.BUFFER_SIZE + this.buffer.length);
+ }
+
+ // We need to copy all the content to the new array
+ for (var i = 0; i < this.buffer.length; i++) {
+ buffer[i] = this.buffer[i];
+ }
+
+ // Reassign the buffer
+ this.buffer = buffer;
+ // Write the byte
+ this.buffer[this.position++] = decoded_byte;
+ }
+ }
+};
+
+/**
+ * Writes a buffer or string to the binary.
+ *
+ * @method
+ * @param {(Buffer|string)} string a string or buffer to be written to the Binary BSON object.
+ * @param {number} offset specify the binary of where to write the content.
+ * @return {null}
+ */
+Binary.prototype.write = function write(string, offset) {
+ offset = typeof offset === 'number' ? offset : this.position;
+
+ // If the buffer is to small let's extend the buffer
+ if (this.buffer.length < offset + string.length) {
+ var buffer = null;
+ // If we are in node.js
+ if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) {
+ buffer = utils.allocBuffer(this.buffer.length + string.length);
+ this.buffer.copy(buffer, 0, 0, this.buffer.length);
+ } else if (Object.prototype.toString.call(this.buffer) === '[object Uint8Array]') {
+ // Create a new buffer
+ buffer = new Uint8Array(new ArrayBuffer(this.buffer.length + string.length));
+ // Copy the content
+ for (var i = 0; i < this.position; i++) {
+ buffer[i] = this.buffer[i];
+ }
+ }
+
+ // Assign the new buffer
+ this.buffer = buffer;
+ }
+
+ if (typeof Buffer !== 'undefined' && Buffer.isBuffer(string) && Buffer.isBuffer(this.buffer)) {
+ string.copy(this.buffer, offset, 0, string.length);
+ this.position = offset + string.length > this.position ? offset + string.length : this.position;
+ // offset = string.length
+ } else if (
+ typeof Buffer !== 'undefined' &&
+ typeof string === 'string' &&
+ Buffer.isBuffer(this.buffer)
+ ) {
+ this.buffer.write(string, offset, 'binary');
+ this.position = offset + string.length > this.position ? offset + string.length : this.position;
+ // offset = string.length;
+ } else if (
+ Object.prototype.toString.call(string) === '[object Uint8Array]' ||
+ (Object.prototype.toString.call(string) === '[object Array]' && typeof string !== 'string')
+ ) {
+ for (i = 0; i < string.length; i++) {
+ this.buffer[offset++] = string[i];
+ }
+
+ this.position = offset > this.position ? offset : this.position;
+ } else if (typeof string === 'string') {
+ for (i = 0; i < string.length; i++) {
+ this.buffer[offset++] = string.charCodeAt(i);
+ }
+
+ this.position = offset > this.position ? offset : this.position;
+ }
+};
+
+/**
+ * Reads **length** bytes starting at **position**.
+ *
+ * @method
+ * @param {number} position read from the given position in the Binary.
+ * @param {number} length the number of bytes to read.
+ * @return {Buffer}
+ */
+Binary.prototype.read = function read(position, length) {
+ length = length && length > 0 ? length : this.position;
+
+ // Let's return the data based on the type we have
+ if (this.buffer['slice']) {
+ return this.buffer.slice(position, position + length);
+ } else {
+ // Create a buffer to keep the result
+ var buffer =
+ typeof Uint8Array !== 'undefined'
+ ? new Uint8Array(new ArrayBuffer(length))
+ : new Array(length);
+ for (var i = 0; i < length; i++) {
+ buffer[i] = this.buffer[position++];
+ }
+ }
+ // Return the buffer
+ return buffer;
+};
+
+/**
+ * Returns the value of this binary as a string.
+ *
+ * @method
+ * @return {string}
+ */
+Binary.prototype.value = function value(asRaw) {
+ asRaw = asRaw == null ? false : asRaw;
+
+ // Optimize to serialize for the situation where the data == size of buffer
+ if (
+ asRaw &&
+ typeof Buffer !== 'undefined' &&
+ Buffer.isBuffer(this.buffer) &&
+ this.buffer.length === this.position
+ )
+ return this.buffer;
+
+ // If it's a node.js buffer object
+ if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) {
+ return asRaw
+ ? this.buffer.slice(0, this.position)
+ : this.buffer.toString('binary', 0, this.position);
+ } else {
+ if (asRaw) {
+ // we support the slice command use it
+ if (this.buffer['slice'] != null) {
+ return this.buffer.slice(0, this.position);
+ } else {
+ // Create a new buffer to copy content to
+ var newBuffer =
+ Object.prototype.toString.call(this.buffer) === '[object Uint8Array]'
+ ? new Uint8Array(new ArrayBuffer(this.position))
+ : new Array(this.position);
+ // Copy content
+ for (var i = 0; i < this.position; i++) {
+ newBuffer[i] = this.buffer[i];
+ }
+ // Return the buffer
+ return newBuffer;
+ }
+ } else {
+ return convertArraytoUtf8BinaryString(this.buffer, 0, this.position);
+ }
+ }
+};
+
+/**
+ * Length.
+ *
+ * @method
+ * @return {number} the length of the binary.
+ */
+Binary.prototype.length = function length() {
+ return this.position;
+};
+
+/**
+ * @ignore
+ */
+Binary.prototype.toJSON = function() {
+ return this.buffer != null ? this.buffer.toString('base64') : '';
+};
+
+/**
+ * @ignore
+ */
+Binary.prototype.toString = function(format) {
+ return this.buffer != null ? this.buffer.slice(0, this.position).toString(format) : '';
+};
+
+/**
+ * Binary default subtype
+ * @ignore
+ */
+var BSON_BINARY_SUBTYPE_DEFAULT = 0;
+
+/**
+ * @ignore
+ */
+var writeStringToArray = function(data) {
+ // Create a buffer
+ var buffer =
+ typeof Uint8Array !== 'undefined'
+ ? new Uint8Array(new ArrayBuffer(data.length))
+ : new Array(data.length);
+ // Write the content to the buffer
+ for (var i = 0; i < data.length; i++) {
+ buffer[i] = data.charCodeAt(i);
+ }
+ // Write the string to the buffer
+ return buffer;
+};
+
+/**
+ * Convert Array ot Uint8Array to Binary String
+ *
+ * @ignore
+ */
+var convertArraytoUtf8BinaryString = function(byteArray, startIndex, endIndex) {
+ var result = '';
+ for (var i = startIndex; i < endIndex; i++) {
+ result = result + String.fromCharCode(byteArray[i]);
+ }
+ return result;
+};
+
+Binary.BUFFER_SIZE = 256;
+
+/**
+ * Default BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+Binary.SUBTYPE_DEFAULT = 0;
+/**
+ * Function BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+Binary.SUBTYPE_FUNCTION = 1;
+/**
+ * Byte Array BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+Binary.SUBTYPE_BYTE_ARRAY = 2;
+/**
+ * OLD UUID BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+Binary.SUBTYPE_UUID_OLD = 3;
+/**
+ * UUID BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+Binary.SUBTYPE_UUID = 4;
+/**
+ * MD5 BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+Binary.SUBTYPE_MD5 = 5;
+/**
+ * User BSON type
+ *
+ * @classconstant SUBTYPE_DEFAULT
+ **/
+Binary.SUBTYPE_USER_DEFINED = 128;
+
+/**
+ * Expose.
+ */
+module.exports = Binary;
+module.exports.Binary = Binary;
diff --git a/Restaurant/node_modules/bson/lib/bson/bson.js b/Restaurant/node_modules/bson/lib/bson/bson.js
new file mode 100644
index 0000000..912c5b9
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/bson.js
@@ -0,0 +1,386 @@
+'use strict';
+
+var Map = require('./map'),
+ Long = require('./long'),
+ Double = require('./double'),
+ Timestamp = require('./timestamp'),
+ ObjectID = require('./objectid'),
+ BSONRegExp = require('./regexp'),
+ Symbol = require('./symbol'),
+ Int32 = require('./int_32'),
+ Code = require('./code'),
+ Decimal128 = require('./decimal128'),
+ MinKey = require('./min_key'),
+ MaxKey = require('./max_key'),
+ DBRef = require('./db_ref'),
+ Binary = require('./binary');
+
+// Parts of the parser
+var deserialize = require('./parser/deserializer'),
+ serializer = require('./parser/serializer'),
+ calculateObjectSize = require('./parser/calculate_size'),
+ utils = require('./parser/utils');
+
+/**
+ * @ignore
+ * @api private
+ */
+// Default Max Size
+var MAXSIZE = 1024 * 1024 * 17;
+
+// Current Internal Temporary Serialization Buffer
+var buffer = utils.allocBuffer(MAXSIZE);
+
+var BSON = function() {};
+
+/**
+ * Serialize a Javascript object.
+ *
+ * @param {Object} object the Javascript object to serialize.
+ * @param {Boolean} [options.checkKeys] the serializer will check if keys are valid.
+ * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**.
+ * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**.
+ * @param {Number} [options.minInternalBufferSize=1024*1024*17] minimum size of the internal temporary serialization buffer **(default:1024*1024*17)**.
+ * @return {Buffer} returns the Buffer object containing the serialized object.
+ * @api public
+ */
+BSON.prototype.serialize = function serialize(object, options) {
+ options = options || {};
+ // Unpack the options
+ var checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false;
+ var serializeFunctions =
+ typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
+ var ignoreUndefined =
+ typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true;
+ var minInternalBufferSize =
+ typeof options.minInternalBufferSize === 'number' ? options.minInternalBufferSize : MAXSIZE;
+
+ // Resize the internal serialization buffer if needed
+ if (buffer.length < minInternalBufferSize) {
+ buffer = utils.allocBuffer(minInternalBufferSize);
+ }
+
+ // Attempt to serialize
+ var serializationIndex = serializer(
+ buffer,
+ object,
+ checkKeys,
+ 0,
+ 0,
+ serializeFunctions,
+ ignoreUndefined,
+ []
+ );
+ // Create the final buffer
+ var finishedBuffer = utils.allocBuffer(serializationIndex);
+ // Copy into the finished buffer
+ buffer.copy(finishedBuffer, 0, 0, finishedBuffer.length);
+ // Return the buffer
+ return finishedBuffer;
+};
+
+/**
+ * Serialize a Javascript object using a predefined Buffer and index into the buffer, useful when pre-allocating the space for serialization.
+ *
+ * @param {Object} object the Javascript object to serialize.
+ * @param {Buffer} buffer the Buffer you pre-allocated to store the serialized BSON object.
+ * @param {Boolean} [options.checkKeys] the serializer will check if keys are valid.
+ * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**.
+ * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**.
+ * @param {Number} [options.index] the index in the buffer where we wish to start serializing into.
+ * @return {Number} returns the index pointing to the last written byte in the buffer.
+ * @api public
+ */
+BSON.prototype.serializeWithBufferAndIndex = function(object, finalBuffer, options) {
+ options = options || {};
+ // Unpack the options
+ var checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false;
+ var serializeFunctions =
+ typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
+ var ignoreUndefined =
+ typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true;
+ var startIndex = typeof options.index === 'number' ? options.index : 0;
+
+ // Attempt to serialize
+ var serializationIndex = serializer(
+ finalBuffer,
+ object,
+ checkKeys,
+ startIndex || 0,
+ 0,
+ serializeFunctions,
+ ignoreUndefined
+ );
+
+ // Return the index
+ return serializationIndex - 1;
+};
+
+/**
+ * Deserialize data as BSON.
+ *
+ * @param {Buffer} buffer the buffer containing the serialized set of BSON documents.
+ * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized.
+ * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse.
+ * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function.
+ * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits
+ * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a node.js Buffer instance.
+ * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types.
+ * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer.
+ * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances.
+ * @return {Object} returns the deserialized Javascript Object.
+ * @api public
+ */
+BSON.prototype.deserialize = function(buffer, options) {
+ return deserialize(buffer, options);
+};
+
+/**
+ * Calculate the bson size for a passed in Javascript object.
+ *
+ * @param {Object} object the Javascript object to calculate the BSON byte size for.
+ * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**.
+ * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**.
+ * @return {Number} returns the number of bytes the BSON object will take up.
+ * @api public
+ */
+BSON.prototype.calculateObjectSize = function(object, options) {
+ options = options || {};
+
+ var serializeFunctions =
+ typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
+ var ignoreUndefined =
+ typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true;
+
+ return calculateObjectSize(object, serializeFunctions, ignoreUndefined);
+};
+
+/**
+ * Deserialize stream data as BSON documents.
+ *
+ * @param {Buffer} data the buffer containing the serialized set of BSON documents.
+ * @param {Number} startIndex the start index in the data Buffer where the deserialization is to start.
+ * @param {Number} numberOfDocuments number of documents to deserialize.
+ * @param {Array} documents an array where to store the deserialized documents.
+ * @param {Number} docStartIndex the index in the documents array from where to start inserting documents.
+ * @param {Object} [options] additional options used for the deserialization.
+ * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized.
+ * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse.
+ * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function.
+ * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits
+ * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a node.js Buffer instance.
+ * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types.
+ * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer.
+ * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances.
+ * @return {Number} returns the next index in the buffer after deserialization **x** numbers of documents.
+ * @api public
+ */
+BSON.prototype.deserializeStream = function(
+ data,
+ startIndex,
+ numberOfDocuments,
+ documents,
+ docStartIndex,
+ options
+) {
+ options = options != null ? options : {};
+ var index = startIndex;
+ // Loop over all documents
+ for (var i = 0; i < numberOfDocuments; i++) {
+ // Find size of the document
+ var size =
+ data[index] | (data[index + 1] << 8) | (data[index + 2] << 16) | (data[index + 3] << 24);
+ // Update options with index
+ options['index'] = index;
+ // Parse the document at this point
+ documents[docStartIndex + i] = this.deserialize(data, options);
+ // Adjust index by the document size
+ index = index + size;
+ }
+
+ // Return object containing end index of parsing and list of documents
+ return index;
+};
+
+/**
+ * @ignore
+ * @api private
+ */
+// BSON MAX VALUES
+BSON.BSON_INT32_MAX = 0x7fffffff;
+BSON.BSON_INT32_MIN = -0x80000000;
+
+BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1;
+BSON.BSON_INT64_MIN = -Math.pow(2, 63);
+
+// JS MAX PRECISE VALUES
+BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+// Internal long versions
+// var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double.
+// var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double.
+
+/**
+ * Number BSON Type
+ *
+ * @classconstant BSON_DATA_NUMBER
+ **/
+BSON.BSON_DATA_NUMBER = 1;
+/**
+ * String BSON Type
+ *
+ * @classconstant BSON_DATA_STRING
+ **/
+BSON.BSON_DATA_STRING = 2;
+/**
+ * Object BSON Type
+ *
+ * @classconstant BSON_DATA_OBJECT
+ **/
+BSON.BSON_DATA_OBJECT = 3;
+/**
+ * Array BSON Type
+ *
+ * @classconstant BSON_DATA_ARRAY
+ **/
+BSON.BSON_DATA_ARRAY = 4;
+/**
+ * Binary BSON Type
+ *
+ * @classconstant BSON_DATA_BINARY
+ **/
+BSON.BSON_DATA_BINARY = 5;
+/**
+ * ObjectID BSON Type
+ *
+ * @classconstant BSON_DATA_OID
+ **/
+BSON.BSON_DATA_OID = 7;
+/**
+ * Boolean BSON Type
+ *
+ * @classconstant BSON_DATA_BOOLEAN
+ **/
+BSON.BSON_DATA_BOOLEAN = 8;
+/**
+ * Date BSON Type
+ *
+ * @classconstant BSON_DATA_DATE
+ **/
+BSON.BSON_DATA_DATE = 9;
+/**
+ * null BSON Type
+ *
+ * @classconstant BSON_DATA_NULL
+ **/
+BSON.BSON_DATA_NULL = 10;
+/**
+ * RegExp BSON Type
+ *
+ * @classconstant BSON_DATA_REGEXP
+ **/
+BSON.BSON_DATA_REGEXP = 11;
+/**
+ * Code BSON Type
+ *
+ * @classconstant BSON_DATA_CODE
+ **/
+BSON.BSON_DATA_CODE = 13;
+/**
+ * Symbol BSON Type
+ *
+ * @classconstant BSON_DATA_SYMBOL
+ **/
+BSON.BSON_DATA_SYMBOL = 14;
+/**
+ * Code with Scope BSON Type
+ *
+ * @classconstant BSON_DATA_CODE_W_SCOPE
+ **/
+BSON.BSON_DATA_CODE_W_SCOPE = 15;
+/**
+ * 32 bit Integer BSON Type
+ *
+ * @classconstant BSON_DATA_INT
+ **/
+BSON.BSON_DATA_INT = 16;
+/**
+ * Timestamp BSON Type
+ *
+ * @classconstant BSON_DATA_TIMESTAMP
+ **/
+BSON.BSON_DATA_TIMESTAMP = 17;
+/**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_LONG
+ **/
+BSON.BSON_DATA_LONG = 18;
+/**
+ * MinKey BSON Type
+ *
+ * @classconstant BSON_DATA_MIN_KEY
+ **/
+BSON.BSON_DATA_MIN_KEY = 0xff;
+/**
+ * MaxKey BSON Type
+ *
+ * @classconstant BSON_DATA_MAX_KEY
+ **/
+BSON.BSON_DATA_MAX_KEY = 0x7f;
+
+/**
+ * Binary Default Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_DEFAULT
+ **/
+BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0;
+/**
+ * Binary Function Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_FUNCTION
+ **/
+BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1;
+/**
+ * Binary Byte Array Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY
+ **/
+BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2;
+/**
+ * Binary UUID Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_UUID
+ **/
+BSON.BSON_BINARY_SUBTYPE_UUID = 3;
+/**
+ * Binary MD5 Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_MD5
+ **/
+BSON.BSON_BINARY_SUBTYPE_MD5 = 4;
+/**
+ * Binary User Defined Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED
+ **/
+BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128;
+
+// Return BSON
+module.exports = BSON;
+module.exports.Code = Code;
+module.exports.Map = Map;
+module.exports.Symbol = Symbol;
+module.exports.BSON = BSON;
+module.exports.DBRef = DBRef;
+module.exports.Binary = Binary;
+module.exports.ObjectID = ObjectID;
+module.exports.Long = Long;
+module.exports.Timestamp = Timestamp;
+module.exports.Double = Double;
+module.exports.Int32 = Int32;
+module.exports.MinKey = MinKey;
+module.exports.MaxKey = MaxKey;
+module.exports.BSONRegExp = BSONRegExp;
+module.exports.Decimal128 = Decimal128;
diff --git a/Restaurant/node_modules/bson/lib/bson/code.js b/Restaurant/node_modules/bson/lib/bson/code.js
new file mode 100644
index 0000000..c2984cd
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/code.js
@@ -0,0 +1,24 @@
+/**
+ * A class representation of the BSON Code type.
+ *
+ * @class
+ * @param {(string|function)} code a string or function.
+ * @param {Object} [scope] an optional scope for the function.
+ * @return {Code}
+ */
+var Code = function Code(code, scope) {
+ if (!(this instanceof Code)) return new Code(code, scope);
+ this._bsontype = 'Code';
+ this.code = code;
+ this.scope = scope;
+};
+
+/**
+ * @ignore
+ */
+Code.prototype.toJSON = function() {
+ return { scope: this.scope, code: this.code };
+};
+
+module.exports = Code;
+module.exports.Code = Code;
diff --git a/Restaurant/node_modules/bson/lib/bson/db_ref.js b/Restaurant/node_modules/bson/lib/bson/db_ref.js
new file mode 100644
index 0000000..f95795b
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/db_ref.js
@@ -0,0 +1,32 @@
+/**
+ * A class representation of the BSON DBRef type.
+ *
+ * @class
+ * @param {string} namespace the collection name.
+ * @param {ObjectID} oid the reference ObjectID.
+ * @param {string} [db] optional db name, if omitted the reference is local to the current db.
+ * @return {DBRef}
+ */
+function DBRef(namespace, oid, db) {
+ if (!(this instanceof DBRef)) return new DBRef(namespace, oid, db);
+
+ this._bsontype = 'DBRef';
+ this.namespace = namespace;
+ this.oid = oid;
+ this.db = db;
+}
+
+/**
+ * @ignore
+ * @api private
+ */
+DBRef.prototype.toJSON = function() {
+ return {
+ $ref: this.namespace,
+ $id: this.oid,
+ $db: this.db == null ? '' : this.db
+ };
+};
+
+module.exports = DBRef;
+module.exports.DBRef = DBRef;
diff --git a/Restaurant/node_modules/bson/lib/bson/decimal128.js b/Restaurant/node_modules/bson/lib/bson/decimal128.js
new file mode 100644
index 0000000..924513f
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/decimal128.js
@@ -0,0 +1,820 @@
+'use strict';
+
+var Long = require('./long');
+
+var PARSE_STRING_REGEXP = /^(\+|-)?(\d+|(\d*\.\d*))?(E|e)?([-+])?(\d+)?$/;
+var PARSE_INF_REGEXP = /^(\+|-)?(Infinity|inf)$/i;
+var PARSE_NAN_REGEXP = /^(\+|-)?NaN$/i;
+
+var EXPONENT_MAX = 6111;
+var EXPONENT_MIN = -6176;
+var EXPONENT_BIAS = 6176;
+var MAX_DIGITS = 34;
+
+// Nan value bits as 32 bit values (due to lack of longs)
+var NAN_BUFFER = [
+ 0x7c,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00
+].reverse();
+// Infinity value bits 32 bit values (due to lack of longs)
+var INF_NEGATIVE_BUFFER = [
+ 0xf8,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00
+].reverse();
+var INF_POSITIVE_BUFFER = [
+ 0x78,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00,
+ 0x00
+].reverse();
+
+var EXPONENT_REGEX = /^([-+])?(\d+)?$/;
+
+var utils = require('./parser/utils');
+
+// Detect if the value is a digit
+var isDigit = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+// Divide two uint128 values
+var divideu128 = function(value) {
+ var DIVISOR = Long.fromNumber(1000 * 1000 * 1000);
+ var _rem = Long.fromNumber(0);
+ var i = 0;
+
+ if (!value.parts[0] && !value.parts[1] && !value.parts[2] && !value.parts[3]) {
+ return { quotient: value, rem: _rem };
+ }
+
+ for (i = 0; i <= 3; i++) {
+ // Adjust remainder to match value of next dividend
+ _rem = _rem.shiftLeft(32);
+ // Add the divided to _rem
+ _rem = _rem.add(new Long(value.parts[i], 0));
+ value.parts[i] = _rem.div(DIVISOR).low_;
+ _rem = _rem.modulo(DIVISOR);
+ }
+
+ return { quotient: value, rem: _rem };
+};
+
+// Multiply two Long values and return the 128 bit value
+var multiply64x2 = function(left, right) {
+ if (!left && !right) {
+ return { high: Long.fromNumber(0), low: Long.fromNumber(0) };
+ }
+
+ var leftHigh = left.shiftRightUnsigned(32);
+ var leftLow = new Long(left.getLowBits(), 0);
+ var rightHigh = right.shiftRightUnsigned(32);
+ var rightLow = new Long(right.getLowBits(), 0);
+
+ var productHigh = leftHigh.multiply(rightHigh);
+ var productMid = leftHigh.multiply(rightLow);
+ var productMid2 = leftLow.multiply(rightHigh);
+ var productLow = leftLow.multiply(rightLow);
+
+ productHigh = productHigh.add(productMid.shiftRightUnsigned(32));
+ productMid = new Long(productMid.getLowBits(), 0)
+ .add(productMid2)
+ .add(productLow.shiftRightUnsigned(32));
+
+ productHigh = productHigh.add(productMid.shiftRightUnsigned(32));
+ productLow = productMid.shiftLeft(32).add(new Long(productLow.getLowBits(), 0));
+
+ // Return the 128 bit result
+ return { high: productHigh, low: productLow };
+};
+
+var lessThan = function(left, right) {
+ // Make values unsigned
+ var uhleft = left.high_ >>> 0;
+ var uhright = right.high_ >>> 0;
+
+ // Compare high bits first
+ if (uhleft < uhright) {
+ return true;
+ } else if (uhleft === uhright) {
+ var ulleft = left.low_ >>> 0;
+ var ulright = right.low_ >>> 0;
+ if (ulleft < ulright) return true;
+ }
+
+ return false;
+};
+
+// var longtoHex = function(value) {
+// var buffer = utils.allocBuffer(8);
+// var index = 0;
+// // Encode the low 64 bits of the decimal
+// // Encode low bits
+// buffer[index++] = value.low_ & 0xff;
+// buffer[index++] = (value.low_ >> 8) & 0xff;
+// buffer[index++] = (value.low_ >> 16) & 0xff;
+// buffer[index++] = (value.low_ >> 24) & 0xff;
+// // Encode high bits
+// buffer[index++] = value.high_ & 0xff;
+// buffer[index++] = (value.high_ >> 8) & 0xff;
+// buffer[index++] = (value.high_ >> 16) & 0xff;
+// buffer[index++] = (value.high_ >> 24) & 0xff;
+// return buffer.reverse().toString('hex');
+// };
+
+// var int32toHex = function(value) {
+// var buffer = utils.allocBuffer(4);
+// var index = 0;
+// // Encode the low 64 bits of the decimal
+// // Encode low bits
+// buffer[index++] = value & 0xff;
+// buffer[index++] = (value >> 8) & 0xff;
+// buffer[index++] = (value >> 16) & 0xff;
+// buffer[index++] = (value >> 24) & 0xff;
+// return buffer.reverse().toString('hex');
+// };
+
+/**
+ * A class representation of the BSON Decimal128 type.
+ *
+ * @class
+ * @param {Buffer} bytes a buffer containing the raw Decimal128 bytes.
+ * @return {Double}
+ */
+var Decimal128 = function(bytes) {
+ this._bsontype = 'Decimal128';
+ this.bytes = bytes;
+};
+
+/**
+ * Create a Decimal128 instance from a string representation
+ *
+ * @method
+ * @param {string} string a numeric string representation.
+ * @return {Decimal128} returns a Decimal128 instance.
+ */
+Decimal128.fromString = function(string) {
+ // Parse state tracking
+ var isNegative = false;
+ var sawRadix = false;
+ var foundNonZero = false;
+
+ // Total number of significant digits (no leading or trailing zero)
+ var significantDigits = 0;
+ // Total number of significand digits read
+ var nDigitsRead = 0;
+ // Total number of digits (no leading zeros)
+ var nDigits = 0;
+ // The number of the digits after radix
+ var radixPosition = 0;
+ // The index of the first non-zero in *str*
+ var firstNonZero = 0;
+
+ // Digits Array
+ var digits = [0];
+ // The number of digits in digits
+ var nDigitsStored = 0;
+ // Insertion pointer for digits
+ var digitsInsert = 0;
+ // The index of the first non-zero digit
+ var firstDigit = 0;
+ // The index of the last digit
+ var lastDigit = 0;
+
+ // Exponent
+ var exponent = 0;
+ // loop index over array
+ var i = 0;
+ // The high 17 digits of the significand
+ var significandHigh = [0, 0];
+ // The low 17 digits of the significand
+ var significandLow = [0, 0];
+ // The biased exponent
+ var biasedExponent = 0;
+
+ // Read index
+ var index = 0;
+
+ // Trim the string
+ string = string.trim();
+
+ // Naively prevent against REDOS attacks.
+ // TODO: implementing a custom parsing for this, or refactoring the regex would yield
+ // further gains.
+ if (string.length >= 7000) {
+ throw new Error('' + string + ' not a valid Decimal128 string');
+ }
+
+ // Results
+ var stringMatch = string.match(PARSE_STRING_REGEXP);
+ var infMatch = string.match(PARSE_INF_REGEXP);
+ var nanMatch = string.match(PARSE_NAN_REGEXP);
+
+ // Validate the string
+ if ((!stringMatch && !infMatch && !nanMatch) || string.length === 0) {
+ throw new Error('' + string + ' not a valid Decimal128 string');
+ }
+
+ // Check if we have an illegal exponent format
+ if (stringMatch && stringMatch[4] && stringMatch[2] === undefined) {
+ throw new Error('' + string + ' not a valid Decimal128 string');
+ }
+
+ // Get the negative or positive sign
+ if (string[index] === '+' || string[index] === '-') {
+ isNegative = string[index++] === '-';
+ }
+
+ // Check if user passed Infinity or NaN
+ if (!isDigit(string[index]) && string[index] !== '.') {
+ if (string[index] === 'i' || string[index] === 'I') {
+ return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER));
+ } else if (string[index] === 'N') {
+ return new Decimal128(utils.toBuffer(NAN_BUFFER));
+ }
+ }
+
+ // Read all the digits
+ while (isDigit(string[index]) || string[index] === '.') {
+ if (string[index] === '.') {
+ if (sawRadix) {
+ return new Decimal128(utils.toBuffer(NAN_BUFFER));
+ }
+
+ sawRadix = true;
+ index = index + 1;
+ continue;
+ }
+
+ if (nDigitsStored < 34) {
+ if (string[index] !== '0' || foundNonZero) {
+ if (!foundNonZero) {
+ firstNonZero = nDigitsRead;
+ }
+
+ foundNonZero = true;
+
+ // Only store 34 digits
+ digits[digitsInsert++] = parseInt(string[index], 10);
+ nDigitsStored = nDigitsStored + 1;
+ }
+ }
+
+ if (foundNonZero) {
+ nDigits = nDigits + 1;
+ }
+
+ if (sawRadix) {
+ radixPosition = radixPosition + 1;
+ }
+
+ nDigitsRead = nDigitsRead + 1;
+ index = index + 1;
+ }
+
+ if (sawRadix && !nDigitsRead) {
+ throw new Error('' + string + ' not a valid Decimal128 string');
+ }
+
+ // Read exponent if exists
+ if (string[index] === 'e' || string[index] === 'E') {
+ // Read exponent digits
+ var match = string.substr(++index).match(EXPONENT_REGEX);
+
+ // No digits read
+ if (!match || !match[2]) {
+ return new Decimal128(utils.toBuffer(NAN_BUFFER));
+ }
+
+ // Get exponent
+ exponent = parseInt(match[0], 10);
+
+ // Adjust the index
+ index = index + match[0].length;
+ }
+
+ // Return not a number
+ if (string[index]) {
+ return new Decimal128(utils.toBuffer(NAN_BUFFER));
+ }
+
+ // Done reading input
+ // Find first non-zero digit in digits
+ firstDigit = 0;
+
+ if (!nDigitsStored) {
+ firstDigit = 0;
+ lastDigit = 0;
+ digits[0] = 0;
+ nDigits = 1;
+ nDigitsStored = 1;
+ significantDigits = 0;
+ } else {
+ lastDigit = nDigitsStored - 1;
+ significantDigits = nDigits;
+
+ if (exponent !== 0 && significantDigits !== 1) {
+ while (string[firstNonZero + significantDigits - 1] === '0') {
+ significantDigits = significantDigits - 1;
+ }
+ }
+ }
+
+ // Normalization of exponent
+ // Correct exponent based on radix position, and shift significand as needed
+ // to represent user input
+
+ // Overflow prevention
+ if (exponent <= radixPosition && radixPosition - exponent > 1 << 14) {
+ exponent = EXPONENT_MIN;
+ } else {
+ exponent = exponent - radixPosition;
+ }
+
+ // Attempt to normalize the exponent
+ while (exponent > EXPONENT_MAX) {
+ // Shift exponent to significand and decrease
+ lastDigit = lastDigit + 1;
+
+ if (lastDigit - firstDigit > MAX_DIGITS) {
+ // Check if we have a zero then just hard clamp, otherwise fail
+ var digitsString = digits.join('');
+ if (digitsString.match(/^0+$/)) {
+ exponent = EXPONENT_MAX;
+ break;
+ } else {
+ return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER));
+ }
+ }
+
+ exponent = exponent - 1;
+ }
+
+ while (exponent < EXPONENT_MIN || nDigitsStored < nDigits) {
+ // Shift last digit
+ if (lastDigit === 0) {
+ exponent = EXPONENT_MIN;
+ significantDigits = 0;
+ break;
+ }
+
+ if (nDigitsStored < nDigits) {
+ // adjust to match digits not stored
+ nDigits = nDigits - 1;
+ } else {
+ // adjust to round
+ lastDigit = lastDigit - 1;
+ }
+
+ if (exponent < EXPONENT_MAX) {
+ exponent = exponent + 1;
+ } else {
+ // Check if we have a zero then just hard clamp, otherwise fail
+ digitsString = digits.join('');
+ if (digitsString.match(/^0+$/)) {
+ exponent = EXPONENT_MAX;
+ break;
+ } else {
+ return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER));
+ }
+ }
+ }
+
+ // Round
+ // We've normalized the exponent, but might still need to round.
+ if (lastDigit - firstDigit + 1 < significantDigits && string[significantDigits] !== '0') {
+ var endOfString = nDigitsRead;
+
+ // If we have seen a radix point, 'string' is 1 longer than we have
+ // documented with ndigits_read, so inc the position of the first nonzero
+ // digit and the position that digits are read to.
+ if (sawRadix && exponent === EXPONENT_MIN) {
+ firstNonZero = firstNonZero + 1;
+ endOfString = endOfString + 1;
+ }
+
+ var roundDigit = parseInt(string[firstNonZero + lastDigit + 1], 10);
+ var roundBit = 0;
+
+ if (roundDigit >= 5) {
+ roundBit = 1;
+
+ if (roundDigit === 5) {
+ roundBit = digits[lastDigit] % 2 === 1;
+
+ for (i = firstNonZero + lastDigit + 2; i < endOfString; i++) {
+ if (parseInt(string[i], 10)) {
+ roundBit = 1;
+ break;
+ }
+ }
+ }
+ }
+
+ if (roundBit) {
+ var dIdx = lastDigit;
+
+ for (; dIdx >= 0; dIdx--) {
+ if (++digits[dIdx] > 9) {
+ digits[dIdx] = 0;
+
+ // overflowed most significant digit
+ if (dIdx === 0) {
+ if (exponent < EXPONENT_MAX) {
+ exponent = exponent + 1;
+ digits[dIdx] = 1;
+ } else {
+ return new Decimal128(
+ utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER)
+ );
+ }
+ }
+ } else {
+ break;
+ }
+ }
+ }
+ }
+
+ // Encode significand
+ // The high 17 digits of the significand
+ significandHigh = Long.fromNumber(0);
+ // The low 17 digits of the significand
+ significandLow = Long.fromNumber(0);
+
+ // read a zero
+ if (significantDigits === 0) {
+ significandHigh = Long.fromNumber(0);
+ significandLow = Long.fromNumber(0);
+ } else if (lastDigit - firstDigit < 17) {
+ dIdx = firstDigit;
+ significandLow = Long.fromNumber(digits[dIdx++]);
+ significandHigh = new Long(0, 0);
+
+ for (; dIdx <= lastDigit; dIdx++) {
+ significandLow = significandLow.multiply(Long.fromNumber(10));
+ significandLow = significandLow.add(Long.fromNumber(digits[dIdx]));
+ }
+ } else {
+ dIdx = firstDigit;
+ significandHigh = Long.fromNumber(digits[dIdx++]);
+
+ for (; dIdx <= lastDigit - 17; dIdx++) {
+ significandHigh = significandHigh.multiply(Long.fromNumber(10));
+ significandHigh = significandHigh.add(Long.fromNumber(digits[dIdx]));
+ }
+
+ significandLow = Long.fromNumber(digits[dIdx++]);
+
+ for (; dIdx <= lastDigit; dIdx++) {
+ significandLow = significandLow.multiply(Long.fromNumber(10));
+ significandLow = significandLow.add(Long.fromNumber(digits[dIdx]));
+ }
+ }
+
+ var significand = multiply64x2(significandHigh, Long.fromString('100000000000000000'));
+
+ significand.low = significand.low.add(significandLow);
+
+ if (lessThan(significand.low, significandLow)) {
+ significand.high = significand.high.add(Long.fromNumber(1));
+ }
+
+ // Biased exponent
+ biasedExponent = exponent + EXPONENT_BIAS;
+ var dec = { low: Long.fromNumber(0), high: Long.fromNumber(0) };
+
+ // Encode combination, exponent, and significand.
+ if (
+ significand.high
+ .shiftRightUnsigned(49)
+ .and(Long.fromNumber(1))
+ .equals(Long.fromNumber)
+ ) {
+ // Encode '11' into bits 1 to 3
+ dec.high = dec.high.or(Long.fromNumber(0x3).shiftLeft(61));
+ dec.high = dec.high.or(
+ Long.fromNumber(biasedExponent).and(Long.fromNumber(0x3fff).shiftLeft(47))
+ );
+ dec.high = dec.high.or(significand.high.and(Long.fromNumber(0x7fffffffffff)));
+ } else {
+ dec.high = dec.high.or(Long.fromNumber(biasedExponent & 0x3fff).shiftLeft(49));
+ dec.high = dec.high.or(significand.high.and(Long.fromNumber(0x1ffffffffffff)));
+ }
+
+ dec.low = significand.low;
+
+ // Encode sign
+ if (isNegative) {
+ dec.high = dec.high.or(Long.fromString('9223372036854775808'));
+ }
+
+ // Encode into a buffer
+ var buffer = utils.allocBuffer(16);
+ index = 0;
+
+ // Encode the low 64 bits of the decimal
+ // Encode low bits
+ buffer[index++] = dec.low.low_ & 0xff;
+ buffer[index++] = (dec.low.low_ >> 8) & 0xff;
+ buffer[index++] = (dec.low.low_ >> 16) & 0xff;
+ buffer[index++] = (dec.low.low_ >> 24) & 0xff;
+ // Encode high bits
+ buffer[index++] = dec.low.high_ & 0xff;
+ buffer[index++] = (dec.low.high_ >> 8) & 0xff;
+ buffer[index++] = (dec.low.high_ >> 16) & 0xff;
+ buffer[index++] = (dec.low.high_ >> 24) & 0xff;
+
+ // Encode the high 64 bits of the decimal
+ // Encode low bits
+ buffer[index++] = dec.high.low_ & 0xff;
+ buffer[index++] = (dec.high.low_ >> 8) & 0xff;
+ buffer[index++] = (dec.high.low_ >> 16) & 0xff;
+ buffer[index++] = (dec.high.low_ >> 24) & 0xff;
+ // Encode high bits
+ buffer[index++] = dec.high.high_ & 0xff;
+ buffer[index++] = (dec.high.high_ >> 8) & 0xff;
+ buffer[index++] = (dec.high.high_ >> 16) & 0xff;
+ buffer[index++] = (dec.high.high_ >> 24) & 0xff;
+
+ // Return the new Decimal128
+ return new Decimal128(buffer);
+};
+
+// Extract least significant 5 bits
+var COMBINATION_MASK = 0x1f;
+// Extract least significant 14 bits
+var EXPONENT_MASK = 0x3fff;
+// Value of combination field for Inf
+var COMBINATION_INFINITY = 30;
+// Value of combination field for NaN
+var COMBINATION_NAN = 31;
+// Value of combination field for NaN
+// var COMBINATION_SNAN = 32;
+// decimal128 exponent bias
+EXPONENT_BIAS = 6176;
+
+/**
+ * Create a string representation of the raw Decimal128 value
+ *
+ * @method
+ * @return {string} returns a Decimal128 string representation.
+ */
+Decimal128.prototype.toString = function() {
+ // Note: bits in this routine are referred to starting at 0,
+ // from the sign bit, towards the coefficient.
+
+ // bits 0 - 31
+ var high;
+ // bits 32 - 63
+ var midh;
+ // bits 64 - 95
+ var midl;
+ // bits 96 - 127
+ var low;
+ // bits 1 - 5
+ var combination;
+ // decoded biased exponent (14 bits)
+ var biased_exponent;
+ // the number of significand digits
+ var significand_digits = 0;
+ // the base-10 digits in the significand
+ var significand = new Array(36);
+ for (var i = 0; i < significand.length; i++) significand[i] = 0;
+ // read pointer into significand
+ var index = 0;
+
+ // unbiased exponent
+ var exponent;
+ // the exponent if scientific notation is used
+ var scientific_exponent;
+
+ // true if the number is zero
+ var is_zero = false;
+
+ // the most signifcant significand bits (50-46)
+ var significand_msb;
+ // temporary storage for significand decoding
+ var significand128 = { parts: new Array(4) };
+ // indexing variables
+ i;
+ var j, k;
+
+ // Output string
+ var string = [];
+
+ // Unpack index
+ index = 0;
+
+ // Buffer reference
+ var buffer = this.bytes;
+
+ // Unpack the low 64bits into a long
+ low =
+ buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24);
+ midl =
+ buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24);
+
+ // Unpack the high 64bits into a long
+ midh =
+ buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24);
+ high =
+ buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24);
+
+ // Unpack index
+ index = 0;
+
+ // Create the state of the decimal
+ var dec = {
+ low: new Long(low, midl),
+ high: new Long(midh, high)
+ };
+
+ if (dec.high.lessThan(Long.ZERO)) {
+ string.push('-');
+ }
+
+ // Decode combination field and exponent
+ combination = (high >> 26) & COMBINATION_MASK;
+
+ if (combination >> 3 === 3) {
+ // Check for 'special' values
+ if (combination === COMBINATION_INFINITY) {
+ return string.join('') + 'Infinity';
+ } else if (combination === COMBINATION_NAN) {
+ return 'NaN';
+ } else {
+ biased_exponent = (high >> 15) & EXPONENT_MASK;
+ significand_msb = 0x08 + ((high >> 14) & 0x01);
+ }
+ } else {
+ significand_msb = (high >> 14) & 0x07;
+ biased_exponent = (high >> 17) & EXPONENT_MASK;
+ }
+
+ exponent = biased_exponent - EXPONENT_BIAS;
+
+ // Create string of significand digits
+
+ // Convert the 114-bit binary number represented by
+ // (significand_high, significand_low) to at most 34 decimal
+ // digits through modulo and division.
+ significand128.parts[0] = (high & 0x3fff) + ((significand_msb & 0xf) << 14);
+ significand128.parts[1] = midh;
+ significand128.parts[2] = midl;
+ significand128.parts[3] = low;
+
+ if (
+ significand128.parts[0] === 0 &&
+ significand128.parts[1] === 0 &&
+ significand128.parts[2] === 0 &&
+ significand128.parts[3] === 0
+ ) {
+ is_zero = true;
+ } else {
+ for (k = 3; k >= 0; k--) {
+ var least_digits = 0;
+ // Peform the divide
+ var result = divideu128(significand128);
+ significand128 = result.quotient;
+ least_digits = result.rem.low_;
+
+ // We now have the 9 least significant digits (in base 2).
+ // Convert and output to string.
+ if (!least_digits) continue;
+
+ for (j = 8; j >= 0; j--) {
+ // significand[k * 9 + j] = Math.round(least_digits % 10);
+ significand[k * 9 + j] = least_digits % 10;
+ // least_digits = Math.round(least_digits / 10);
+ least_digits = Math.floor(least_digits / 10);
+ }
+ }
+ }
+
+ // Output format options:
+ // Scientific - [-]d.dddE(+/-)dd or [-]dE(+/-)dd
+ // Regular - ddd.ddd
+
+ if (is_zero) {
+ significand_digits = 1;
+ significand[index] = 0;
+ } else {
+ significand_digits = 36;
+ i = 0;
+
+ while (!significand[index]) {
+ i++;
+ significand_digits = significand_digits - 1;
+ index = index + 1;
+ }
+ }
+
+ scientific_exponent = significand_digits - 1 + exponent;
+
+ // The scientific exponent checks are dictated by the string conversion
+ // specification and are somewhat arbitrary cutoffs.
+ //
+ // We must check exponent > 0, because if this is the case, the number
+ // has trailing zeros. However, we *cannot* output these trailing zeros,
+ // because doing so would change the precision of the value, and would
+ // change stored data if the string converted number is round tripped.
+
+ if (scientific_exponent >= 34 || scientific_exponent <= -7 || exponent > 0) {
+ // Scientific format
+ string.push(significand[index++]);
+ significand_digits = significand_digits - 1;
+
+ if (significand_digits) {
+ string.push('.');
+ }
+
+ for (i = 0; i < significand_digits; i++) {
+ string.push(significand[index++]);
+ }
+
+ // Exponent
+ string.push('E');
+ if (scientific_exponent > 0) {
+ string.push('+' + scientific_exponent);
+ } else {
+ string.push(scientific_exponent);
+ }
+ } else {
+ // Regular format with no decimal place
+ if (exponent >= 0) {
+ for (i = 0; i < significand_digits; i++) {
+ string.push(significand[index++]);
+ }
+ } else {
+ var radix_position = significand_digits + exponent;
+
+ // non-zero digits before radix
+ if (radix_position > 0) {
+ for (i = 0; i < radix_position; i++) {
+ string.push(significand[index++]);
+ }
+ } else {
+ string.push('0');
+ }
+
+ string.push('.');
+ // add leading zeros after radix
+ while (radix_position++ < 0) {
+ string.push('0');
+ }
+
+ for (i = 0; i < significand_digits - Math.max(radix_position - 1, 0); i++) {
+ string.push(significand[index++]);
+ }
+ }
+ }
+
+ return string.join('');
+};
+
+Decimal128.prototype.toJSON = function() {
+ return { $numberDecimal: this.toString() };
+};
+
+module.exports = Decimal128;
+module.exports.Decimal128 = Decimal128;
diff --git a/Restaurant/node_modules/bson/lib/bson/double.js b/Restaurant/node_modules/bson/lib/bson/double.js
new file mode 100644
index 0000000..523c21f
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/double.js
@@ -0,0 +1,33 @@
+/**
+ * A class representation of the BSON Double type.
+ *
+ * @class
+ * @param {number} value the number we want to represent as a double.
+ * @return {Double}
+ */
+function Double(value) {
+ if (!(this instanceof Double)) return new Double(value);
+
+ this._bsontype = 'Double';
+ this.value = value;
+}
+
+/**
+ * Access the number value.
+ *
+ * @method
+ * @return {number} returns the wrapped double number.
+ */
+Double.prototype.valueOf = function() {
+ return this.value;
+};
+
+/**
+ * @ignore
+ */
+Double.prototype.toJSON = function() {
+ return this.value;
+};
+
+module.exports = Double;
+module.exports.Double = Double;
diff --git a/Restaurant/node_modules/bson/lib/bson/float_parser.js b/Restaurant/node_modules/bson/lib/bson/float_parser.js
new file mode 100644
index 0000000..0054a2f
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/float_parser.js
@@ -0,0 +1,124 @@
+// Copyright (c) 2008, Fair Oaks Labs, Inc.
+// All rights reserved.
+//
+// Redistribution and use in source and binary forms, with or without
+// modification, are permitted provided that the following conditions are met:
+//
+// * Redistributions of source code must retain the above copyright notice,
+// this list of conditions and the following disclaimer.
+//
+// * Redistributions in binary form must reproduce the above copyright notice,
+// this list of conditions and the following disclaimer in the documentation
+// and/or other materials provided with the distribution.
+//
+// * Neither the name of Fair Oaks Labs, Inc. nor the names of its contributors
+// may be used to endorse or promote products derived from this software
+// without specific prior written permission.
+//
+// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+// AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+// IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+// ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE
+// LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+// CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+// SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+// INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
+// CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+// ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+// POSSIBILITY OF SUCH DAMAGE.
+//
+//
+// Modifications to writeIEEE754 to support negative zeroes made by Brian White
+
+var readIEEE754 = function(buffer, offset, endian, mLen, nBytes) {
+ var e,
+ m,
+ bBE = endian === 'big',
+ eLen = nBytes * 8 - mLen - 1,
+ eMax = (1 << eLen) - 1,
+ eBias = eMax >> 1,
+ nBits = -7,
+ i = bBE ? 0 : nBytes - 1,
+ d = bBE ? 1 : -1,
+ s = buffer[offset + i];
+
+ i += d;
+
+ e = s & ((1 << -nBits) - 1);
+ s >>= -nBits;
+ nBits += eLen;
+ for (; nBits > 0; e = e * 256 + buffer[offset + i], i += d, nBits -= 8);
+
+ m = e & ((1 << -nBits) - 1);
+ e >>= -nBits;
+ nBits += mLen;
+ for (; nBits > 0; m = m * 256 + buffer[offset + i], i += d, nBits -= 8);
+
+ if (e === 0) {
+ e = 1 - eBias;
+ } else if (e === eMax) {
+ return m ? NaN : (s ? -1 : 1) * Infinity;
+ } else {
+ m = m + Math.pow(2, mLen);
+ e = e - eBias;
+ }
+ return (s ? -1 : 1) * m * Math.pow(2, e - mLen);
+};
+
+var writeIEEE754 = function(buffer, value, offset, endian, mLen, nBytes) {
+ var e,
+ m,
+ c,
+ bBE = endian === 'big',
+ eLen = nBytes * 8 - mLen - 1,
+ eMax = (1 << eLen) - 1,
+ eBias = eMax >> 1,
+ rt = mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0,
+ i = bBE ? nBytes - 1 : 0,
+ d = bBE ? -1 : 1,
+ s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0;
+
+ value = Math.abs(value);
+
+ if (isNaN(value) || value === Infinity) {
+ m = isNaN(value) ? 1 : 0;
+ e = eMax;
+ } else {
+ e = Math.floor(Math.log(value) / Math.LN2);
+ if (value * (c = Math.pow(2, -e)) < 1) {
+ e--;
+ c *= 2;
+ }
+ if (e + eBias >= 1) {
+ value += rt / c;
+ } else {
+ value += rt * Math.pow(2, 1 - eBias);
+ }
+ if (value * c >= 2) {
+ e++;
+ c /= 2;
+ }
+
+ if (e + eBias >= eMax) {
+ m = 0;
+ e = eMax;
+ } else if (e + eBias >= 1) {
+ m = (value * c - 1) * Math.pow(2, mLen);
+ e = e + eBias;
+ } else {
+ m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen);
+ e = 0;
+ }
+ }
+
+ for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8);
+
+ e = (e << mLen) | m;
+ eLen += mLen;
+ for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8);
+
+ buffer[offset + i - d] |= s * 128;
+};
+
+exports.readIEEE754 = readIEEE754;
+exports.writeIEEE754 = writeIEEE754;
diff --git a/Restaurant/node_modules/bson/lib/bson/int_32.js b/Restaurant/node_modules/bson/lib/bson/int_32.js
new file mode 100644
index 0000000..85dbdec
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/int_32.js
@@ -0,0 +1,33 @@
+/**
+ * A class representation of a BSON Int32 type.
+ *
+ * @class
+ * @param {number} value the number we want to represent as an int32.
+ * @return {Int32}
+ */
+var Int32 = function(value) {
+ if (!(this instanceof Int32)) return new Int32(value);
+
+ this._bsontype = 'Int32';
+ this.value = value;
+};
+
+/**
+ * Access the number value.
+ *
+ * @method
+ * @return {number} returns the wrapped int32 number.
+ */
+Int32.prototype.valueOf = function() {
+ return this.value;
+};
+
+/**
+ * @ignore
+ */
+Int32.prototype.toJSON = function() {
+ return this.value;
+};
+
+module.exports = Int32;
+module.exports.Int32 = Int32;
diff --git a/Restaurant/node_modules/bson/lib/bson/long.js b/Restaurant/node_modules/bson/lib/bson/long.js
new file mode 100644
index 0000000..78215aa
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/long.js
@@ -0,0 +1,851 @@
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+// Copyright 2009 Google Inc. All Rights Reserved
+
+/**
+ * Defines a Long class for representing a 64-bit two's-complement
+ * integer value, which faithfully simulates the behavior of a Java "Long". This
+ * implementation is derived from LongLib in GWT.
+ *
+ * Constructs a 64-bit two's-complement integer, given its low and high 32-bit
+ * values as *signed* integers. See the from* functions below for more
+ * convenient ways of constructing Longs.
+ *
+ * The internal representation of a Long is the two given signed, 32-bit values.
+ * We use 32-bit pieces because these are the size of integers on which
+ * Javascript performs bit-operations. For operations like addition and
+ * multiplication, we split each number into 16-bit pieces, which can easily be
+ * multiplied within Javascript's floating-point representation without overflow
+ * or change in sign.
+ *
+ * In the algorithms below, we frequently reduce the negative case to the
+ * positive case by negating the input(s) and then post-processing the result.
+ * Note that we must ALWAYS check specially whether those values are MIN_VALUE
+ * (-2^63) because -MIN_VALUE == MIN_VALUE (since 2^63 cannot be represented as
+ * a positive number, it overflows back into a negative). Not handling this
+ * case would often result in infinite recursion.
+ *
+ * @class
+ * @param {number} low the low (signed) 32 bits of the Long.
+ * @param {number} high the high (signed) 32 bits of the Long.
+ * @return {Long}
+ */
+function Long(low, high) {
+ if (!(this instanceof Long)) return new Long(low, high);
+
+ this._bsontype = 'Long';
+ /**
+ * @type {number}
+ * @ignore
+ */
+ this.low_ = low | 0; // force into 32 signed bits.
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ this.high_ = high | 0; // force into 32 signed bits.
+}
+
+/**
+ * Return the int value.
+ *
+ * @method
+ * @return {number} the value, assuming it is a 32-bit integer.
+ */
+Long.prototype.toInt = function() {
+ return this.low_;
+};
+
+/**
+ * Return the Number value.
+ *
+ * @method
+ * @return {number} the closest floating-point representation to this value.
+ */
+Long.prototype.toNumber = function() {
+ return this.high_ * Long.TWO_PWR_32_DBL_ + this.getLowBitsUnsigned();
+};
+
+/**
+ * Return the JSON value.
+ *
+ * @method
+ * @return {string} the JSON representation.
+ */
+Long.prototype.toJSON = function() {
+ return this.toString();
+};
+
+/**
+ * Return the String value.
+ *
+ * @method
+ * @param {number} [opt_radix] the radix in which the text should be written.
+ * @return {string} the textual representation of this value.
+ */
+Long.prototype.toString = function(opt_radix) {
+ var radix = opt_radix || 10;
+ if (radix < 2 || 36 < radix) {
+ throw Error('radix out of range: ' + radix);
+ }
+
+ if (this.isZero()) {
+ return '0';
+ }
+
+ if (this.isNegative()) {
+ if (this.equals(Long.MIN_VALUE)) {
+ // We need to change the Long value before it can be negated, so we remove
+ // the bottom-most digit in this base and then recurse to do the rest.
+ var radixLong = Long.fromNumber(radix);
+ var div = this.div(radixLong);
+ var rem = div.multiply(radixLong).subtract(this);
+ return div.toString(radix) + rem.toInt().toString(radix);
+ } else {
+ return '-' + this.negate().toString(radix);
+ }
+ }
+
+ // Do several (6) digits each time through the loop, so as to
+ // minimize the calls to the very expensive emulated div.
+ var radixToPower = Long.fromNumber(Math.pow(radix, 6));
+
+ rem = this;
+ var result = '';
+
+ while (!rem.isZero()) {
+ var remDiv = rem.div(radixToPower);
+ var intval = rem.subtract(remDiv.multiply(radixToPower)).toInt();
+ var digits = intval.toString(radix);
+
+ rem = remDiv;
+ if (rem.isZero()) {
+ return digits + result;
+ } else {
+ while (digits.length < 6) {
+ digits = '0' + digits;
+ }
+ result = '' + digits + result;
+ }
+ }
+};
+
+/**
+ * Return the high 32-bits value.
+ *
+ * @method
+ * @return {number} the high 32-bits as a signed value.
+ */
+Long.prototype.getHighBits = function() {
+ return this.high_;
+};
+
+/**
+ * Return the low 32-bits value.
+ *
+ * @method
+ * @return {number} the low 32-bits as a signed value.
+ */
+Long.prototype.getLowBits = function() {
+ return this.low_;
+};
+
+/**
+ * Return the low unsigned 32-bits value.
+ *
+ * @method
+ * @return {number} the low 32-bits as an unsigned value.
+ */
+Long.prototype.getLowBitsUnsigned = function() {
+ return this.low_ >= 0 ? this.low_ : Long.TWO_PWR_32_DBL_ + this.low_;
+};
+
+/**
+ * Returns the number of bits needed to represent the absolute value of this Long.
+ *
+ * @method
+ * @return {number} Returns the number of bits needed to represent the absolute value of this Long.
+ */
+Long.prototype.getNumBitsAbs = function() {
+ if (this.isNegative()) {
+ if (this.equals(Long.MIN_VALUE)) {
+ return 64;
+ } else {
+ return this.negate().getNumBitsAbs();
+ }
+ } else {
+ var val = this.high_ !== 0 ? this.high_ : this.low_;
+ for (var bit = 31; bit > 0; bit--) {
+ if ((val & (1 << bit)) !== 0) {
+ break;
+ }
+ }
+ return this.high_ !== 0 ? bit + 33 : bit + 1;
+ }
+};
+
+/**
+ * Return whether this value is zero.
+ *
+ * @method
+ * @return {boolean} whether this value is zero.
+ */
+Long.prototype.isZero = function() {
+ return this.high_ === 0 && this.low_ === 0;
+};
+
+/**
+ * Return whether this value is negative.
+ *
+ * @method
+ * @return {boolean} whether this value is negative.
+ */
+Long.prototype.isNegative = function() {
+ return this.high_ < 0;
+};
+
+/**
+ * Return whether this value is odd.
+ *
+ * @method
+ * @return {boolean} whether this value is odd.
+ */
+Long.prototype.isOdd = function() {
+ return (this.low_ & 1) === 1;
+};
+
+/**
+ * Return whether this Long equals the other
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long equals the other
+ */
+Long.prototype.equals = function(other) {
+ return this.high_ === other.high_ && this.low_ === other.low_;
+};
+
+/**
+ * Return whether this Long does not equal the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long does not equal the other.
+ */
+Long.prototype.notEquals = function(other) {
+ return this.high_ !== other.high_ || this.low_ !== other.low_;
+};
+
+/**
+ * Return whether this Long is less than the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long is less than the other.
+ */
+Long.prototype.lessThan = function(other) {
+ return this.compare(other) < 0;
+};
+
+/**
+ * Return whether this Long is less than or equal to the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long is less than or equal to the other.
+ */
+Long.prototype.lessThanOrEqual = function(other) {
+ return this.compare(other) <= 0;
+};
+
+/**
+ * Return whether this Long is greater than the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long is greater than the other.
+ */
+Long.prototype.greaterThan = function(other) {
+ return this.compare(other) > 0;
+};
+
+/**
+ * Return whether this Long is greater than or equal to the other.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} whether this Long is greater than or equal to the other.
+ */
+Long.prototype.greaterThanOrEqual = function(other) {
+ return this.compare(other) >= 0;
+};
+
+/**
+ * Compares this Long with the given one.
+ *
+ * @method
+ * @param {Long} other Long to compare against.
+ * @return {boolean} 0 if they are the same, 1 if the this is greater, and -1 if the given one is greater.
+ */
+Long.prototype.compare = function(other) {
+ if (this.equals(other)) {
+ return 0;
+ }
+
+ var thisNeg = this.isNegative();
+ var otherNeg = other.isNegative();
+ if (thisNeg && !otherNeg) {
+ return -1;
+ }
+ if (!thisNeg && otherNeg) {
+ return 1;
+ }
+
+ // at this point, the signs are the same, so subtraction will not overflow
+ if (this.subtract(other).isNegative()) {
+ return -1;
+ } else {
+ return 1;
+ }
+};
+
+/**
+ * The negation of this value.
+ *
+ * @method
+ * @return {Long} the negation of this value.
+ */
+Long.prototype.negate = function() {
+ if (this.equals(Long.MIN_VALUE)) {
+ return Long.MIN_VALUE;
+ } else {
+ return this.not().add(Long.ONE);
+ }
+};
+
+/**
+ * Returns the sum of this and the given Long.
+ *
+ * @method
+ * @param {Long} other Long to add to this one.
+ * @return {Long} the sum of this and the given Long.
+ */
+Long.prototype.add = function(other) {
+ // Divide each number into 4 chunks of 16 bits, and then sum the chunks.
+
+ var a48 = this.high_ >>> 16;
+ var a32 = this.high_ & 0xffff;
+ var a16 = this.low_ >>> 16;
+ var a00 = this.low_ & 0xffff;
+
+ var b48 = other.high_ >>> 16;
+ var b32 = other.high_ & 0xffff;
+ var b16 = other.low_ >>> 16;
+ var b00 = other.low_ & 0xffff;
+
+ var c48 = 0,
+ c32 = 0,
+ c16 = 0,
+ c00 = 0;
+ c00 += a00 + b00;
+ c16 += c00 >>> 16;
+ c00 &= 0xffff;
+ c16 += a16 + b16;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c32 += a32 + b32;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c48 += a48 + b48;
+ c48 &= 0xffff;
+ return Long.fromBits((c16 << 16) | c00, (c48 << 16) | c32);
+};
+
+/**
+ * Returns the difference of this and the given Long.
+ *
+ * @method
+ * @param {Long} other Long to subtract from this.
+ * @return {Long} the difference of this and the given Long.
+ */
+Long.prototype.subtract = function(other) {
+ return this.add(other.negate());
+};
+
+/**
+ * Returns the product of this and the given Long.
+ *
+ * @method
+ * @param {Long} other Long to multiply with this.
+ * @return {Long} the product of this and the other.
+ */
+Long.prototype.multiply = function(other) {
+ if (this.isZero()) {
+ return Long.ZERO;
+ } else if (other.isZero()) {
+ return Long.ZERO;
+ }
+
+ if (this.equals(Long.MIN_VALUE)) {
+ return other.isOdd() ? Long.MIN_VALUE : Long.ZERO;
+ } else if (other.equals(Long.MIN_VALUE)) {
+ return this.isOdd() ? Long.MIN_VALUE : Long.ZERO;
+ }
+
+ if (this.isNegative()) {
+ if (other.isNegative()) {
+ return this.negate().multiply(other.negate());
+ } else {
+ return this.negate()
+ .multiply(other)
+ .negate();
+ }
+ } else if (other.isNegative()) {
+ return this.multiply(other.negate()).negate();
+ }
+
+ // If both Longs are small, use float multiplication
+ if (this.lessThan(Long.TWO_PWR_24_) && other.lessThan(Long.TWO_PWR_24_)) {
+ return Long.fromNumber(this.toNumber() * other.toNumber());
+ }
+
+ // Divide each Long into 4 chunks of 16 bits, and then add up 4x4 products.
+ // We can skip products that would overflow.
+
+ var a48 = this.high_ >>> 16;
+ var a32 = this.high_ & 0xffff;
+ var a16 = this.low_ >>> 16;
+ var a00 = this.low_ & 0xffff;
+
+ var b48 = other.high_ >>> 16;
+ var b32 = other.high_ & 0xffff;
+ var b16 = other.low_ >>> 16;
+ var b00 = other.low_ & 0xffff;
+
+ var c48 = 0,
+ c32 = 0,
+ c16 = 0,
+ c00 = 0;
+ c00 += a00 * b00;
+ c16 += c00 >>> 16;
+ c00 &= 0xffff;
+ c16 += a16 * b00;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c16 += a00 * b16;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c32 += a32 * b00;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c32 += a16 * b16;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c32 += a00 * b32;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c48 += a48 * b00 + a32 * b16 + a16 * b32 + a00 * b48;
+ c48 &= 0xffff;
+ return Long.fromBits((c16 << 16) | c00, (c48 << 16) | c32);
+};
+
+/**
+ * Returns this Long divided by the given one.
+ *
+ * @method
+ * @param {Long} other Long by which to divide.
+ * @return {Long} this Long divided by the given one.
+ */
+Long.prototype.div = function(other) {
+ if (other.isZero()) {
+ throw Error('division by zero');
+ } else if (this.isZero()) {
+ return Long.ZERO;
+ }
+
+ if (this.equals(Long.MIN_VALUE)) {
+ if (other.equals(Long.ONE) || other.equals(Long.NEG_ONE)) {
+ return Long.MIN_VALUE; // recall that -MIN_VALUE == MIN_VALUE
+ } else if (other.equals(Long.MIN_VALUE)) {
+ return Long.ONE;
+ } else {
+ // At this point, we have |other| >= 2, so |this/other| < |MIN_VALUE|.
+ var halfThis = this.shiftRight(1);
+ var approx = halfThis.div(other).shiftLeft(1);
+ if (approx.equals(Long.ZERO)) {
+ return other.isNegative() ? Long.ONE : Long.NEG_ONE;
+ } else {
+ var rem = this.subtract(other.multiply(approx));
+ var result = approx.add(rem.div(other));
+ return result;
+ }
+ }
+ } else if (other.equals(Long.MIN_VALUE)) {
+ return Long.ZERO;
+ }
+
+ if (this.isNegative()) {
+ if (other.isNegative()) {
+ return this.negate().div(other.negate());
+ } else {
+ return this.negate()
+ .div(other)
+ .negate();
+ }
+ } else if (other.isNegative()) {
+ return this.div(other.negate()).negate();
+ }
+
+ // Repeat the following until the remainder is less than other: find a
+ // floating-point that approximates remainder / other *from below*, add this
+ // into the result, and subtract it from the remainder. It is critical that
+ // the approximate value is less than or equal to the real value so that the
+ // remainder never becomes negative.
+ var res = Long.ZERO;
+ rem = this;
+ while (rem.greaterThanOrEqual(other)) {
+ // Approximate the result of division. This may be a little greater or
+ // smaller than the actual value.
+ approx = Math.max(1, Math.floor(rem.toNumber() / other.toNumber()));
+
+ // We will tweak the approximate result by changing it in the 48-th digit or
+ // the smallest non-fractional digit, whichever is larger.
+ var log2 = Math.ceil(Math.log(approx) / Math.LN2);
+ var delta = log2 <= 48 ? 1 : Math.pow(2, log2 - 48);
+
+ // Decrease the approximation until it is smaller than the remainder. Note
+ // that if it is too large, the product overflows and is negative.
+ var approxRes = Long.fromNumber(approx);
+ var approxRem = approxRes.multiply(other);
+ while (approxRem.isNegative() || approxRem.greaterThan(rem)) {
+ approx -= delta;
+ approxRes = Long.fromNumber(approx);
+ approxRem = approxRes.multiply(other);
+ }
+
+ // We know the answer can't be zero... and actually, zero would cause
+ // infinite recursion since we would make no progress.
+ if (approxRes.isZero()) {
+ approxRes = Long.ONE;
+ }
+
+ res = res.add(approxRes);
+ rem = rem.subtract(approxRem);
+ }
+ return res;
+};
+
+/**
+ * Returns this Long modulo the given one.
+ *
+ * @method
+ * @param {Long} other Long by which to mod.
+ * @return {Long} this Long modulo the given one.
+ */
+Long.prototype.modulo = function(other) {
+ return this.subtract(this.div(other).multiply(other));
+};
+
+/**
+ * The bitwise-NOT of this value.
+ *
+ * @method
+ * @return {Long} the bitwise-NOT of this value.
+ */
+Long.prototype.not = function() {
+ return Long.fromBits(~this.low_, ~this.high_);
+};
+
+/**
+ * Returns the bitwise-AND of this Long and the given one.
+ *
+ * @method
+ * @param {Long} other the Long with which to AND.
+ * @return {Long} the bitwise-AND of this and the other.
+ */
+Long.prototype.and = function(other) {
+ return Long.fromBits(this.low_ & other.low_, this.high_ & other.high_);
+};
+
+/**
+ * Returns the bitwise-OR of this Long and the given one.
+ *
+ * @method
+ * @param {Long} other the Long with which to OR.
+ * @return {Long} the bitwise-OR of this and the other.
+ */
+Long.prototype.or = function(other) {
+ return Long.fromBits(this.low_ | other.low_, this.high_ | other.high_);
+};
+
+/**
+ * Returns the bitwise-XOR of this Long and the given one.
+ *
+ * @method
+ * @param {Long} other the Long with which to XOR.
+ * @return {Long} the bitwise-XOR of this and the other.
+ */
+Long.prototype.xor = function(other) {
+ return Long.fromBits(this.low_ ^ other.low_, this.high_ ^ other.high_);
+};
+
+/**
+ * Returns this Long with bits shifted to the left by the given amount.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Long} this shifted to the left by the given amount.
+ */
+Long.prototype.shiftLeft = function(numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var low = this.low_;
+ if (numBits < 32) {
+ var high = this.high_;
+ return Long.fromBits(low << numBits, (high << numBits) | (low >>> (32 - numBits)));
+ } else {
+ return Long.fromBits(0, low << (numBits - 32));
+ }
+ }
+};
+
+/**
+ * Returns this Long with bits shifted to the right by the given amount.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Long} this shifted to the right by the given amount.
+ */
+Long.prototype.shiftRight = function(numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var high = this.high_;
+ if (numBits < 32) {
+ var low = this.low_;
+ return Long.fromBits((low >>> numBits) | (high << (32 - numBits)), high >> numBits);
+ } else {
+ return Long.fromBits(high >> (numBits - 32), high >= 0 ? 0 : -1);
+ }
+ }
+};
+
+/**
+ * Returns this Long with bits shifted to the right by the given amount, with the new top bits matching the current sign bit.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Long} this shifted to the right by the given amount, with zeros placed into the new leading bits.
+ */
+Long.prototype.shiftRightUnsigned = function(numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var high = this.high_;
+ if (numBits < 32) {
+ var low = this.low_;
+ return Long.fromBits((low >>> numBits) | (high << (32 - numBits)), high >>> numBits);
+ } else if (numBits === 32) {
+ return Long.fromBits(high, 0);
+ } else {
+ return Long.fromBits(high >>> (numBits - 32), 0);
+ }
+ }
+};
+
+/**
+ * Returns a Long representing the given (32-bit) integer value.
+ *
+ * @method
+ * @param {number} value the 32-bit integer in question.
+ * @return {Long} the corresponding Long value.
+ */
+Long.fromInt = function(value) {
+ if (-128 <= value && value < 128) {
+ var cachedObj = Long.INT_CACHE_[value];
+ if (cachedObj) {
+ return cachedObj;
+ }
+ }
+
+ var obj = new Long(value | 0, value < 0 ? -1 : 0);
+ if (-128 <= value && value < 128) {
+ Long.INT_CACHE_[value] = obj;
+ }
+ return obj;
+};
+
+/**
+ * Returns a Long representing the given value, provided that it is a finite number. Otherwise, zero is returned.
+ *
+ * @method
+ * @param {number} value the number in question.
+ * @return {Long} the corresponding Long value.
+ */
+Long.fromNumber = function(value) {
+ if (isNaN(value) || !isFinite(value)) {
+ return Long.ZERO;
+ } else if (value <= -Long.TWO_PWR_63_DBL_) {
+ return Long.MIN_VALUE;
+ } else if (value + 1 >= Long.TWO_PWR_63_DBL_) {
+ return Long.MAX_VALUE;
+ } else if (value < 0) {
+ return Long.fromNumber(-value).negate();
+ } else {
+ return new Long((value % Long.TWO_PWR_32_DBL_) | 0, (value / Long.TWO_PWR_32_DBL_) | 0);
+ }
+};
+
+/**
+ * Returns a Long representing the 64-bit integer that comes by concatenating the given high and low bits. Each is assumed to use 32 bits.
+ *
+ * @method
+ * @param {number} lowBits the low 32-bits.
+ * @param {number} highBits the high 32-bits.
+ * @return {Long} the corresponding Long value.
+ */
+Long.fromBits = function(lowBits, highBits) {
+ return new Long(lowBits, highBits);
+};
+
+/**
+ * Returns a Long representation of the given string, written using the given radix.
+ *
+ * @method
+ * @param {string} str the textual representation of the Long.
+ * @param {number} opt_radix the radix in which the text is written.
+ * @return {Long} the corresponding Long value.
+ */
+Long.fromString = function(str, opt_radix) {
+ if (str.length === 0) {
+ throw Error('number format error: empty string');
+ }
+
+ var radix = opt_radix || 10;
+ if (radix < 2 || 36 < radix) {
+ throw Error('radix out of range: ' + radix);
+ }
+
+ if (str.charAt(0) === '-') {
+ return Long.fromString(str.substring(1), radix).negate();
+ } else if (str.indexOf('-') >= 0) {
+ throw Error('number format error: interior "-" character: ' + str);
+ }
+
+ // Do several (8) digits each time through the loop, so as to
+ // minimize the calls to the very expensive emulated div.
+ var radixToPower = Long.fromNumber(Math.pow(radix, 8));
+
+ var result = Long.ZERO;
+ for (var i = 0; i < str.length; i += 8) {
+ var size = Math.min(8, str.length - i);
+ var value = parseInt(str.substring(i, i + size), radix);
+ if (size < 8) {
+ var power = Long.fromNumber(Math.pow(radix, size));
+ result = result.multiply(power).add(Long.fromNumber(value));
+ } else {
+ result = result.multiply(radixToPower);
+ result = result.add(Long.fromNumber(value));
+ }
+ }
+ return result;
+};
+
+// NOTE: Common constant values ZERO, ONE, NEG_ONE, etc. are defined below the
+// from* methods on which they depend.
+
+/**
+ * A cache of the Long representations of small integer values.
+ * @type {Object}
+ * @ignore
+ */
+Long.INT_CACHE_ = {};
+
+// NOTE: the compiler should inline these constant values below and then remove
+// these variables, so there should be no runtime penalty for these.
+
+/**
+ * Number used repeated below in calculations. This must appear before the
+ * first call to any from* function below.
+ * @type {number}
+ * @ignore
+ */
+Long.TWO_PWR_16_DBL_ = 1 << 16;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Long.TWO_PWR_24_DBL_ = 1 << 24;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Long.TWO_PWR_32_DBL_ = Long.TWO_PWR_16_DBL_ * Long.TWO_PWR_16_DBL_;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Long.TWO_PWR_31_DBL_ = Long.TWO_PWR_32_DBL_ / 2;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Long.TWO_PWR_48_DBL_ = Long.TWO_PWR_32_DBL_ * Long.TWO_PWR_16_DBL_;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Long.TWO_PWR_64_DBL_ = Long.TWO_PWR_32_DBL_ * Long.TWO_PWR_32_DBL_;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Long.TWO_PWR_63_DBL_ = Long.TWO_PWR_64_DBL_ / 2;
+
+/** @type {Long} */
+Long.ZERO = Long.fromInt(0);
+
+/** @type {Long} */
+Long.ONE = Long.fromInt(1);
+
+/** @type {Long} */
+Long.NEG_ONE = Long.fromInt(-1);
+
+/** @type {Long} */
+Long.MAX_VALUE = Long.fromBits(0xffffffff | 0, 0x7fffffff | 0);
+
+/** @type {Long} */
+Long.MIN_VALUE = Long.fromBits(0, 0x80000000 | 0);
+
+/**
+ * @type {Long}
+ * @ignore
+ */
+Long.TWO_PWR_24_ = Long.fromInt(1 << 24);
+
+/**
+ * Expose.
+ */
+module.exports = Long;
+module.exports.Long = Long;
diff --git a/Restaurant/node_modules/bson/lib/bson/map.js b/Restaurant/node_modules/bson/lib/bson/map.js
new file mode 100644
index 0000000..7edb4f2
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/map.js
@@ -0,0 +1,128 @@
+'use strict';
+
+// We have an ES6 Map available, return the native instance
+if (typeof global.Map !== 'undefined') {
+ module.exports = global.Map;
+ module.exports.Map = global.Map;
+} else {
+ // We will return a polyfill
+ var Map = function(array) {
+ this._keys = [];
+ this._values = {};
+
+ for (var i = 0; i < array.length; i++) {
+ if (array[i] == null) continue; // skip null and undefined
+ var entry = array[i];
+ var key = entry[0];
+ var value = entry[1];
+ // Add the key to the list of keys in order
+ this._keys.push(key);
+ // Add the key and value to the values dictionary with a point
+ // to the location in the ordered keys list
+ this._values[key] = { v: value, i: this._keys.length - 1 };
+ }
+ };
+
+ Map.prototype.clear = function() {
+ this._keys = [];
+ this._values = {};
+ };
+
+ Map.prototype.delete = function(key) {
+ var value = this._values[key];
+ if (value == null) return false;
+ // Delete entry
+ delete this._values[key];
+ // Remove the key from the ordered keys list
+ this._keys.splice(value.i, 1);
+ return true;
+ };
+
+ Map.prototype.entries = function() {
+ var self = this;
+ var index = 0;
+
+ return {
+ next: function() {
+ var key = self._keys[index++];
+ return {
+ value: key !== undefined ? [key, self._values[key].v] : undefined,
+ done: key !== undefined ? false : true
+ };
+ }
+ };
+ };
+
+ Map.prototype.forEach = function(callback, self) {
+ self = self || this;
+
+ for (var i = 0; i < this._keys.length; i++) {
+ var key = this._keys[i];
+ // Call the forEach callback
+ callback.call(self, this._values[key].v, key, self);
+ }
+ };
+
+ Map.prototype.get = function(key) {
+ return this._values[key] ? this._values[key].v : undefined;
+ };
+
+ Map.prototype.has = function(key) {
+ return this._values[key] != null;
+ };
+
+ Map.prototype.keys = function() {
+ var self = this;
+ var index = 0;
+
+ return {
+ next: function() {
+ var key = self._keys[index++];
+ return {
+ value: key !== undefined ? key : undefined,
+ done: key !== undefined ? false : true
+ };
+ }
+ };
+ };
+
+ Map.prototype.set = function(key, value) {
+ if (this._values[key]) {
+ this._values[key].v = value;
+ return this;
+ }
+
+ // Add the key to the list of keys in order
+ this._keys.push(key);
+ // Add the key and value to the values dictionary with a point
+ // to the location in the ordered keys list
+ this._values[key] = { v: value, i: this._keys.length - 1 };
+ return this;
+ };
+
+ Map.prototype.values = function() {
+ var self = this;
+ var index = 0;
+
+ return {
+ next: function() {
+ var key = self._keys[index++];
+ return {
+ value: key !== undefined ? self._values[key].v : undefined,
+ done: key !== undefined ? false : true
+ };
+ }
+ };
+ };
+
+ // Last ismaster
+ Object.defineProperty(Map.prototype, 'size', {
+ enumerable: true,
+ get: function() {
+ return this._keys.length;
+ }
+ });
+
+ module.exports = Map;
+ module.exports.Map = Map;
+}
diff --git a/Restaurant/node_modules/bson/lib/bson/max_key.js b/Restaurant/node_modules/bson/lib/bson/max_key.js
new file mode 100644
index 0000000..eebca7b
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/max_key.js
@@ -0,0 +1,14 @@
+/**
+ * A class representation of the BSON MaxKey type.
+ *
+ * @class
+ * @return {MaxKey} A MaxKey instance
+ */
+function MaxKey() {
+ if (!(this instanceof MaxKey)) return new MaxKey();
+
+ this._bsontype = 'MaxKey';
+}
+
+module.exports = MaxKey;
+module.exports.MaxKey = MaxKey;
diff --git a/Restaurant/node_modules/bson/lib/bson/min_key.js b/Restaurant/node_modules/bson/lib/bson/min_key.js
new file mode 100644
index 0000000..15f4522
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/min_key.js
@@ -0,0 +1,14 @@
+/**
+ * A class representation of the BSON MinKey type.
+ *
+ * @class
+ * @return {MinKey} A MinKey instance
+ */
+function MinKey() {
+ if (!(this instanceof MinKey)) return new MinKey();
+
+ this._bsontype = 'MinKey';
+}
+
+module.exports = MinKey;
+module.exports.MinKey = MinKey;
diff --git a/Restaurant/node_modules/bson/lib/bson/objectid.js b/Restaurant/node_modules/bson/lib/bson/objectid.js
new file mode 100644
index 0000000..79de40d
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/objectid.js
@@ -0,0 +1,389 @@
+// Custom inspect property name / symbol.
+var inspect = 'inspect';
+
+var utils = require('./parser/utils');
+
+/**
+ * Machine id.
+ *
+ * Create a random 3-byte value (i.e. unique for this
+ * process). Other drivers use a md5 of the machine id here, but
+ * that would mean an asyc call to gethostname, so we don't bother.
+ * @ignore
+ */
+var MACHINE_ID = parseInt(Math.random() * 0xffffff, 10);
+
+// Regular expression that checks for hex value
+var checkForHexRegExp = new RegExp('^[0-9a-fA-F]{24}$');
+
+// Check if buffer exists
+try {
+ if (Buffer && Buffer.from) {
+ var hasBufferType = true;
+ inspect = require('util').inspect.custom || 'inspect';
+ }
+} catch (err) {
+ hasBufferType = false;
+}
+
+/**
+* Create a new ObjectID instance
+*
+* @class
+* @param {(string|number)} id Can be a 24 byte hex string, 12 byte binary string or a Number.
+* @property {number} generationTime The generation time of this ObjectId instance
+* @return {ObjectID} instance of ObjectID.
+*/
+var ObjectID = function ObjectID(id) {
+ // Duck-typing to support ObjectId from different npm packages
+ if (id instanceof ObjectID) return id;
+ if (!(this instanceof ObjectID)) return new ObjectID(id);
+
+ this._bsontype = 'ObjectID';
+
+ // The most common usecase (blank id, new objectId instance)
+ if (id == null || typeof id === 'number') {
+ // Generate a new id
+ this.id = this.generate(id);
+ // If we are caching the hex string
+ if (ObjectID.cacheHexString) this.__id = this.toString('hex');
+ // Return the object
+ return;
+ }
+
+ // Check if the passed in id is valid
+ var valid = ObjectID.isValid(id);
+
+ // Throw an error if it's not a valid setup
+ if (!valid && id != null) {
+ throw new Error(
+ 'Argument passed in must be a single String of 12 bytes or a string of 24 hex characters'
+ );
+ } else if (valid && typeof id === 'string' && id.length === 24 && hasBufferType) {
+ return new ObjectID(utils.toBuffer(id, 'hex'));
+ } else if (valid && typeof id === 'string' && id.length === 24) {
+ return ObjectID.createFromHexString(id);
+ } else if (id != null && id.length === 12) {
+ // assume 12 byte string
+ this.id = id;
+ } else if (id != null && id.toHexString) {
+ // Duck-typing to support ObjectId from different npm packages
+ return id;
+ } else {
+ throw new Error(
+ 'Argument passed in must be a single String of 12 bytes or a string of 24 hex characters'
+ );
+ }
+
+ if (ObjectID.cacheHexString) this.__id = this.toString('hex');
+};
+
+// Allow usage of ObjectId as well as ObjectID
+// var ObjectId = ObjectID;
+
+// Precomputed hex table enables speedy hex string conversion
+var hexTable = [];
+for (var i = 0; i < 256; i++) {
+ hexTable[i] = (i <= 15 ? '0' : '') + i.toString(16);
+}
+
+/**
+* Return the ObjectID id as a 24 byte hex string representation
+*
+* @method
+* @return {string} return the 24 byte hex string representation.
+*/
+ObjectID.prototype.toHexString = function() {
+ if (ObjectID.cacheHexString && this.__id) return this.__id;
+
+ var hexString = '';
+ if (!this.id || !this.id.length) {
+ throw new Error(
+ 'invalid ObjectId, ObjectId.id must be either a string or a Buffer, but is [' +
+ JSON.stringify(this.id) +
+ ']'
+ );
+ }
+
+ if (this.id instanceof _Buffer) {
+ hexString = convertToHex(this.id);
+ if (ObjectID.cacheHexString) this.__id = hexString;
+ return hexString;
+ }
+
+ for (var i = 0; i < this.id.length; i++) {
+ hexString += hexTable[this.id.charCodeAt(i)];
+ }
+
+ if (ObjectID.cacheHexString) this.__id = hexString;
+ return hexString;
+};
+
+/**
+* Update the ObjectID index used in generating new ObjectID's on the driver
+*
+* @method
+* @return {number} returns next index value.
+* @ignore
+*/
+ObjectID.prototype.get_inc = function() {
+ return (ObjectID.index = (ObjectID.index + 1) % 0xffffff);
+};
+
+/**
+* Update the ObjectID index used in generating new ObjectID's on the driver
+*
+* @method
+* @return {number} returns next index value.
+* @ignore
+*/
+ObjectID.prototype.getInc = function() {
+ return this.get_inc();
+};
+
+/**
+* Generate a 12 byte id buffer used in ObjectID's
+*
+* @method
+* @param {number} [time] optional parameter allowing to pass in a second based timestamp.
+* @return {Buffer} return the 12 byte id buffer string.
+*/
+ObjectID.prototype.generate = function(time) {
+ if ('number' !== typeof time) {
+ time = ~~(Date.now() / 1000);
+ }
+
+ // Use pid
+ var pid =
+ (typeof process === 'undefined' || process.pid === 1
+ ? Math.floor(Math.random() * 100000)
+ : process.pid) % 0xffff;
+ var inc = this.get_inc();
+ // Buffer used
+ var buffer = utils.allocBuffer(12);
+ // Encode time
+ buffer[3] = time & 0xff;
+ buffer[2] = (time >> 8) & 0xff;
+ buffer[1] = (time >> 16) & 0xff;
+ buffer[0] = (time >> 24) & 0xff;
+ // Encode machine
+ buffer[6] = MACHINE_ID & 0xff;
+ buffer[5] = (MACHINE_ID >> 8) & 0xff;
+ buffer[4] = (MACHINE_ID >> 16) & 0xff;
+ // Encode pid
+ buffer[8] = pid & 0xff;
+ buffer[7] = (pid >> 8) & 0xff;
+ // Encode index
+ buffer[11] = inc & 0xff;
+ buffer[10] = (inc >> 8) & 0xff;
+ buffer[9] = (inc >> 16) & 0xff;
+ // Return the buffer
+ return buffer;
+};
+
+/**
+* Converts the id into a 24 byte hex string for printing
+*
+* @param {String} format The Buffer toString format parameter.
+* @return {String} return the 24 byte hex string representation.
+* @ignore
+*/
+ObjectID.prototype.toString = function(format) {
+ // Is the id a buffer then use the buffer toString method to return the format
+ if (this.id && this.id.copy) {
+ return this.id.toString(typeof format === 'string' ? format : 'hex');
+ }
+
+ // if(this.buffer )
+ return this.toHexString();
+};
+
+/**
+* Converts to a string representation of this Id.
+*
+* @return {String} return the 24 byte hex string representation.
+* @ignore
+*/
+ObjectID.prototype[inspect] = ObjectID.prototype.toString;
+
+/**
+* Converts to its JSON representation.
+*
+* @return {String} return the 24 byte hex string representation.
+* @ignore
+*/
+ObjectID.prototype.toJSON = function() {
+ return this.toHexString();
+};
+
+/**
+* Compares the equality of this ObjectID with `otherID`.
+*
+* @method
+* @param {object} otherID ObjectID instance to compare against.
+* @return {boolean} the result of comparing two ObjectID's
+*/
+ObjectID.prototype.equals = function equals(otherId) {
+ // var id;
+
+ if (otherId instanceof ObjectID) {
+ return this.toString() === otherId.toString();
+ } else if (
+ typeof otherId === 'string' &&
+ ObjectID.isValid(otherId) &&
+ otherId.length === 12 &&
+ this.id instanceof _Buffer
+ ) {
+ return otherId === this.id.toString('binary');
+ } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 24) {
+ return otherId.toLowerCase() === this.toHexString();
+ } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 12) {
+ return otherId === this.id;
+ } else if (otherId != null && (otherId instanceof ObjectID || otherId.toHexString)) {
+ return otherId.toHexString() === this.toHexString();
+ } else {
+ return false;
+ }
+};
+
+/**
+* Returns the generation date (accurate up to the second) that this ID was generated.
+*
+* @method
+* @return {date} the generation date
+*/
+ObjectID.prototype.getTimestamp = function() {
+ var timestamp = new Date();
+ var time = this.id[3] | (this.id[2] << 8) | (this.id[1] << 16) | (this.id[0] << 24);
+ timestamp.setTime(Math.floor(time) * 1000);
+ return timestamp;
+};
+
+/**
+* @ignore
+*/
+ObjectID.index = ~~(Math.random() * 0xffffff);
+
+/**
+* @ignore
+*/
+ObjectID.createPk = function createPk() {
+ return new ObjectID();
+};
+
+/**
+* Creates an ObjectID from a second based number, with the rest of the ObjectID zeroed out. Used for comparisons or sorting the ObjectID.
+*
+* @method
+* @param {number} time an integer number representing a number of seconds.
+* @return {ObjectID} return the created ObjectID
+*/
+ObjectID.createFromTime = function createFromTime(time) {
+ var buffer = utils.toBuffer([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]);
+ // Encode time into first 4 bytes
+ buffer[3] = time & 0xff;
+ buffer[2] = (time >> 8) & 0xff;
+ buffer[1] = (time >> 16) & 0xff;
+ buffer[0] = (time >> 24) & 0xff;
+ // Return the new objectId
+ return new ObjectID(buffer);
+};
+
+// Lookup tables
+//var encodeLookup = '0123456789abcdef'.split('');
+var decodeLookup = [];
+i = 0;
+while (i < 10) decodeLookup[0x30 + i] = i++;
+while (i < 16) decodeLookup[0x41 - 10 + i] = decodeLookup[0x61 - 10 + i] = i++;
+
+var _Buffer = Buffer;
+var convertToHex = function(bytes) {
+ return bytes.toString('hex');
+};
+
+/**
+* Creates an ObjectID from a hex string representation of an ObjectID.
+*
+* @method
+* @param {string} hexString create a ObjectID from a passed in 24 byte hexstring.
+* @return {ObjectID} return the created ObjectID
+*/
+ObjectID.createFromHexString = function createFromHexString(string) {
+ // Throw an error if it's not a valid setup
+ if (typeof string === 'undefined' || (string != null && string.length !== 24)) {
+ throw new Error(
+ 'Argument passed in must be a single String of 12 bytes or a string of 24 hex characters'
+ );
+ }
+
+ // Use Buffer.from method if available
+ if (hasBufferType) return new ObjectID(utils.toBuffer(string, 'hex'));
+
+ // Calculate lengths
+ var array = new _Buffer(12);
+ var n = 0;
+ var i = 0;
+
+ while (i < 24) {
+ array[n++] = (decodeLookup[string.charCodeAt(i++)] << 4) | decodeLookup[string.charCodeAt(i++)];
+ }
+
+ return new ObjectID(array);
+};
+
+/**
+* Checks if a value is a valid bson ObjectId
+*
+* @method
+* @return {boolean} return true if the value is a valid bson ObjectId, return false otherwise.
+*/
+ObjectID.isValid = function isValid(id) {
+ if (id == null) return false;
+
+ if (typeof id === 'number') {
+ return true;
+ }
+
+ if (typeof id === 'string') {
+ return id.length === 12 || (id.length === 24 && checkForHexRegExp.test(id));
+ }
+
+ if (id instanceof ObjectID) {
+ return true;
+ }
+
+ if (id instanceof _Buffer) {
+ return true;
+ }
+
+ // Duck-Typing detection of ObjectId like objects
+ if (id.toHexString) {
+ return id.id.length === 12 || (id.id.length === 24 && checkForHexRegExp.test(id.id));
+ }
+
+ return false;
+};
+
+/**
+* @ignore
+*/
+Object.defineProperty(ObjectID.prototype, 'generationTime', {
+ enumerable: true,
+ get: function() {
+ return this.id[3] | (this.id[2] << 8) | (this.id[1] << 16) | (this.id[0] << 24);
+ },
+ set: function(value) {
+ // Encode time into first 4 bytes
+ this.id[3] = value & 0xff;
+ this.id[2] = (value >> 8) & 0xff;
+ this.id[1] = (value >> 16) & 0xff;
+ this.id[0] = (value >> 24) & 0xff;
+ }
+});
+
+/**
+ * Expose.
+ */
+module.exports = ObjectID;
+module.exports.ObjectID = ObjectID;
+module.exports.ObjectId = ObjectID;
diff --git a/Restaurant/node_modules/bson/lib/bson/parser/calculate_size.js b/Restaurant/node_modules/bson/lib/bson/parser/calculate_size.js
new file mode 100644
index 0000000..7e0026c
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/parser/calculate_size.js
@@ -0,0 +1,255 @@
+'use strict';
+
+var Long = require('../long').Long,
+ Double = require('../double').Double,
+ Timestamp = require('../timestamp').Timestamp,
+ ObjectID = require('../objectid').ObjectID,
+ Symbol = require('../symbol').Symbol,
+ BSONRegExp = require('../regexp').BSONRegExp,
+ Code = require('../code').Code,
+ Decimal128 = require('../decimal128'),
+ MinKey = require('../min_key').MinKey,
+ MaxKey = require('../max_key').MaxKey,
+ DBRef = require('../db_ref').DBRef,
+ Binary = require('../binary').Binary;
+
+var normalizedFunctionString = require('./utils').normalizedFunctionString;
+
+// To ensure that 0.4 of node works correctly
+var isDate = function isDate(d) {
+ return typeof d === 'object' && Object.prototype.toString.call(d) === '[object Date]';
+};
+
+var calculateObjectSize = function calculateObjectSize(
+ object,
+ serializeFunctions,
+ ignoreUndefined
+) {
+ var totalLength = 4 + 1;
+
+ if (Array.isArray(object)) {
+ for (var i = 0; i < object.length; i++) {
+ totalLength += calculateElement(
+ i.toString(),
+ object[i],
+ serializeFunctions,
+ true,
+ ignoreUndefined
+ );
+ }
+ } else {
+ // If we have toBSON defined, override the current object
+ if (object.toBSON) {
+ object = object.toBSON();
+ }
+
+ // Calculate size
+ for (var key in object) {
+ totalLength += calculateElement(key, object[key], serializeFunctions, false, ignoreUndefined);
+ }
+ }
+
+ return totalLength;
+};
+
+/**
+ * @ignore
+ * @api private
+ */
+function calculateElement(name, value, serializeFunctions, isArray, ignoreUndefined) {
+ // If we have toBSON defined, override the current object
+ if (value && value.toBSON) {
+ value = value.toBSON();
+ }
+
+ switch (typeof value) {
+ case 'string':
+ return 1 + Buffer.byteLength(name, 'utf8') + 1 + 4 + Buffer.byteLength(value, 'utf8') + 1;
+ case 'number':
+ if (Math.floor(value) === value && value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) {
+ if (value >= BSON.BSON_INT32_MIN && value <= BSON.BSON_INT32_MAX) {
+ // 32 bit
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (4 + 1);
+ } else {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1);
+ }
+ } else {
+ // 64 bit
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1);
+ }
+ case 'undefined':
+ if (isArray || !ignoreUndefined)
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1;
+ return 0;
+ case 'boolean':
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (1 + 1);
+ case 'object':
+ if (
+ value == null ||
+ value instanceof MinKey ||
+ value instanceof MaxKey ||
+ value['_bsontype'] === 'MinKey' ||
+ value['_bsontype'] === 'MaxKey'
+ ) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1;
+ } else if (value instanceof ObjectID || value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (12 + 1);
+ } else if (value instanceof Date || isDate(value)) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1);
+ } else if (typeof Buffer !== 'undefined' && Buffer.isBuffer(value)) {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (1 + 4 + 1) + value.length
+ );
+ } else if (
+ value instanceof Long ||
+ value instanceof Double ||
+ value instanceof Timestamp ||
+ value['_bsontype'] === 'Long' ||
+ value['_bsontype'] === 'Double' ||
+ value['_bsontype'] === 'Timestamp'
+ ) {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1);
+ } else if (value instanceof Decimal128 || value['_bsontype'] === 'Decimal128') {
+ return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (16 + 1);
+ } else if (value instanceof Code || value['_bsontype'] === 'Code') {
+ // Calculate size depending on the availability of a scope
+ if (value.scope != null && Object.keys(value.scope).length > 0) {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ 1 +
+ 4 +
+ 4 +
+ Buffer.byteLength(value.code.toString(), 'utf8') +
+ 1 +
+ calculateObjectSize(value.scope, serializeFunctions, ignoreUndefined)
+ );
+ } else {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ 1 +
+ 4 +
+ Buffer.byteLength(value.code.toString(), 'utf8') +
+ 1
+ );
+ }
+ } else if (value instanceof Binary || value['_bsontype'] === 'Binary') {
+ // Check what kind of subtype we have
+ if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ (value.position + 1 + 4 + 1 + 4)
+ );
+ } else {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (value.position + 1 + 4 + 1)
+ );
+ }
+ } else if (value instanceof Symbol || value['_bsontype'] === 'Symbol') {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ Buffer.byteLength(value.value, 'utf8') +
+ 4 +
+ 1 +
+ 1
+ );
+ } else if (value instanceof DBRef || value['_bsontype'] === 'DBRef') {
+ // Set up correct object for serialization
+ var ordered_values = {
+ $ref: value.namespace,
+ $id: value.oid
+ };
+
+ // Add db reference if it exists
+ if (null != value.db) {
+ ordered_values['$db'] = value.db;
+ }
+
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ 1 +
+ calculateObjectSize(ordered_values, serializeFunctions, ignoreUndefined)
+ );
+ } else if (
+ value instanceof RegExp ||
+ Object.prototype.toString.call(value) === '[object RegExp]'
+ ) {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ 1 +
+ Buffer.byteLength(value.source, 'utf8') +
+ 1 +
+ (value.global ? 1 : 0) +
+ (value.ignoreCase ? 1 : 0) +
+ (value.multiline ? 1 : 0) +
+ 1
+ );
+ } else if (value instanceof BSONRegExp || value['_bsontype'] === 'BSONRegExp') {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ 1 +
+ Buffer.byteLength(value.pattern, 'utf8') +
+ 1 +
+ Buffer.byteLength(value.options, 'utf8') +
+ 1
+ );
+ } else {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ calculateObjectSize(value, serializeFunctions, ignoreUndefined) +
+ 1
+ );
+ }
+ case 'function':
+ // WTF for 0.4.X where typeof /someregexp/ === 'function'
+ if (
+ value instanceof RegExp ||
+ Object.prototype.toString.call(value) === '[object RegExp]' ||
+ String.call(value) === '[object RegExp]'
+ ) {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ 1 +
+ Buffer.byteLength(value.source, 'utf8') +
+ 1 +
+ (value.global ? 1 : 0) +
+ (value.ignoreCase ? 1 : 0) +
+ (value.multiline ? 1 : 0) +
+ 1
+ );
+ } else {
+ if (serializeFunctions && value.scope != null && Object.keys(value.scope).length > 0) {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ 1 +
+ 4 +
+ 4 +
+ Buffer.byteLength(normalizedFunctionString(value), 'utf8') +
+ 1 +
+ calculateObjectSize(value.scope, serializeFunctions, ignoreUndefined)
+ );
+ } else if (serializeFunctions) {
+ return (
+ (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) +
+ 1 +
+ 4 +
+ Buffer.byteLength(normalizedFunctionString(value), 'utf8') +
+ 1
+ );
+ }
+ }
+ }
+
+ return 0;
+}
+
+var BSON = {};
+
+// BSON MAX VALUES
+BSON.BSON_INT32_MAX = 0x7fffffff;
+BSON.BSON_INT32_MIN = -0x80000000;
+
+// JS MAX PRECISE VALUES
+BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+module.exports = calculateObjectSize;
diff --git a/Restaurant/node_modules/bson/lib/bson/parser/deserializer.js b/Restaurant/node_modules/bson/lib/bson/parser/deserializer.js
new file mode 100644
index 0000000..be3c865
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/parser/deserializer.js
@@ -0,0 +1,782 @@
+'use strict';
+
+var Long = require('../long').Long,
+ Double = require('../double').Double,
+ Timestamp = require('../timestamp').Timestamp,
+ ObjectID = require('../objectid').ObjectID,
+ Symbol = require('../symbol').Symbol,
+ Code = require('../code').Code,
+ MinKey = require('../min_key').MinKey,
+ MaxKey = require('../max_key').MaxKey,
+ Decimal128 = require('../decimal128'),
+ Int32 = require('../int_32'),
+ DBRef = require('../db_ref').DBRef,
+ BSONRegExp = require('../regexp').BSONRegExp,
+ Binary = require('../binary').Binary;
+
+var utils = require('./utils');
+
+var deserialize = function(buffer, options, isArray) {
+ options = options == null ? {} : options;
+ var index = options && options.index ? options.index : 0;
+ // Read the document size
+ var size =
+ buffer[index] |
+ (buffer[index + 1] << 8) |
+ (buffer[index + 2] << 16) |
+ (buffer[index + 3] << 24);
+
+ // Ensure buffer is valid size
+ if (size < 5 || buffer.length < size || size + index > buffer.length) {
+ throw new Error('corrupt bson message');
+ }
+
+ // Illegal end value
+ if (buffer[index + size - 1] !== 0) {
+ throw new Error("One object, sized correctly, with a spot for an EOO, but the EOO isn't 0x00");
+ }
+
+ // Start deserializtion
+ return deserializeObject(buffer, index, options, isArray);
+};
+
+var deserializeObject = function(buffer, index, options, isArray) {
+ var evalFunctions = options['evalFunctions'] == null ? false : options['evalFunctions'];
+ var cacheFunctions = options['cacheFunctions'] == null ? false : options['cacheFunctions'];
+ var cacheFunctionsCrc32 =
+ options['cacheFunctionsCrc32'] == null ? false : options['cacheFunctionsCrc32'];
+
+ if (!cacheFunctionsCrc32) var crc32 = null;
+
+ var fieldsAsRaw = options['fieldsAsRaw'] == null ? null : options['fieldsAsRaw'];
+
+ // Return raw bson buffer instead of parsing it
+ var raw = options['raw'] == null ? false : options['raw'];
+
+ // Return BSONRegExp objects instead of native regular expressions
+ var bsonRegExp = typeof options['bsonRegExp'] === 'boolean' ? options['bsonRegExp'] : false;
+
+ // Controls the promotion of values vs wrapper classes
+ var promoteBuffers = options['promoteBuffers'] == null ? false : options['promoteBuffers'];
+ var promoteLongs = options['promoteLongs'] == null ? true : options['promoteLongs'];
+ var promoteValues = options['promoteValues'] == null ? true : options['promoteValues'];
+
+ // Set the start index
+ var startIndex = index;
+
+ // Validate that we have at least 4 bytes of buffer
+ if (buffer.length < 5) throw new Error('corrupt bson message < 5 bytes long');
+
+ // Read the document size
+ var size =
+ buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24);
+
+ // Ensure buffer is valid size
+ if (size < 5 || size > buffer.length) throw new Error('corrupt bson message');
+
+ // Create holding object
+ var object = isArray ? [] : {};
+ // Used for arrays to skip having to perform utf8 decoding
+ var arrayIndex = 0;
+
+ var done = false;
+
+ // While we have more left data left keep parsing
+ // while (buffer[index + 1] !== 0) {
+ while (!done) {
+ // Read the type
+ var elementType = buffer[index++];
+ // If we get a zero it's the last byte, exit
+ if (elementType === 0) break;
+
+ // Get the start search index
+ var i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ var name = isArray ? arrayIndex++ : buffer.toString('utf8', index, i);
+
+ index = i + 1;
+
+ if (elementType === BSON.BSON_DATA_STRING) {
+ var stringSize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ if (
+ stringSize <= 0 ||
+ stringSize > buffer.length - index ||
+ buffer[index + stringSize - 1] !== 0
+ )
+ throw new Error('bad string length in bson');
+ object[name] = buffer.toString('utf8', index, index + stringSize - 1);
+ index = index + stringSize;
+ } else if (elementType === BSON.BSON_DATA_OID) {
+ var oid = utils.allocBuffer(12);
+ buffer.copy(oid, 0, index, index + 12);
+ object[name] = new ObjectID(oid);
+ index = index + 12;
+ } else if (elementType === BSON.BSON_DATA_INT && promoteValues === false) {
+ object[name] = new Int32(
+ buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24)
+ );
+ } else if (elementType === BSON.BSON_DATA_INT) {
+ object[name] =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ } else if (elementType === BSON.BSON_DATA_NUMBER && promoteValues === false) {
+ object[name] = new Double(buffer.readDoubleLE(index));
+ index = index + 8;
+ } else if (elementType === BSON.BSON_DATA_NUMBER) {
+ object[name] = buffer.readDoubleLE(index);
+ index = index + 8;
+ } else if (elementType === BSON.BSON_DATA_DATE) {
+ var lowBits =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ var highBits =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ object[name] = new Date(new Long(lowBits, highBits).toNumber());
+ } else if (elementType === BSON.BSON_DATA_BOOLEAN) {
+ if (buffer[index] !== 0 && buffer[index] !== 1) throw new Error('illegal boolean type value');
+ object[name] = buffer[index++] === 1;
+ } else if (elementType === BSON.BSON_DATA_OBJECT) {
+ var _index = index;
+ var objectSize =
+ buffer[index] |
+ (buffer[index + 1] << 8) |
+ (buffer[index + 2] << 16) |
+ (buffer[index + 3] << 24);
+ if (objectSize <= 0 || objectSize > buffer.length - index)
+ throw new Error('bad embedded document length in bson');
+
+ // We have a raw value
+ if (raw) {
+ object[name] = buffer.slice(index, index + objectSize);
+ } else {
+ object[name] = deserializeObject(buffer, _index, options, false);
+ }
+
+ index = index + objectSize;
+ } else if (elementType === BSON.BSON_DATA_ARRAY) {
+ _index = index;
+ objectSize =
+ buffer[index] |
+ (buffer[index + 1] << 8) |
+ (buffer[index + 2] << 16) |
+ (buffer[index + 3] << 24);
+ var arrayOptions = options;
+
+ // Stop index
+ var stopIndex = index + objectSize;
+
+ // All elements of array to be returned as raw bson
+ if (fieldsAsRaw && fieldsAsRaw[name]) {
+ arrayOptions = {};
+ for (var n in options) arrayOptions[n] = options[n];
+ arrayOptions['raw'] = true;
+ }
+
+ object[name] = deserializeObject(buffer, _index, arrayOptions, true);
+ index = index + objectSize;
+
+ if (buffer[index - 1] !== 0) throw new Error('invalid array terminator byte');
+ if (index !== stopIndex) throw new Error('corrupted array bson');
+ } else if (elementType === BSON.BSON_DATA_UNDEFINED) {
+ object[name] = undefined;
+ } else if (elementType === BSON.BSON_DATA_NULL) {
+ object[name] = null;
+ } else if (elementType === BSON.BSON_DATA_LONG) {
+ // Unpack the low and high bits
+ lowBits =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ highBits =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ var long = new Long(lowBits, highBits);
+ // Promote the long if possible
+ if (promoteLongs && promoteValues === true) {
+ object[name] =
+ long.lessThanOrEqual(JS_INT_MAX_LONG) && long.greaterThanOrEqual(JS_INT_MIN_LONG)
+ ? long.toNumber()
+ : long;
+ } else {
+ object[name] = long;
+ }
+ } else if (elementType === BSON.BSON_DATA_DECIMAL128) {
+ // Buffer to contain the decimal bytes
+ var bytes = utils.allocBuffer(16);
+ // Copy the next 16 bytes into the bytes buffer
+ buffer.copy(bytes, 0, index, index + 16);
+ // Update index
+ index = index + 16;
+ // Assign the new Decimal128 value
+ var decimal128 = new Decimal128(bytes);
+ // If we have an alternative mapper use that
+ object[name] = decimal128.toObject ? decimal128.toObject() : decimal128;
+ } else if (elementType === BSON.BSON_DATA_BINARY) {
+ var binarySize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ var totalBinarySize = binarySize;
+ var subType = buffer[index++];
+
+ // Did we have a negative binary size, throw
+ if (binarySize < 0) throw new Error('Negative binary type element size found');
+
+ // Is the length longer than the document
+ if (binarySize > buffer.length) throw new Error('Binary type size larger than document size');
+
+ // Decode as raw Buffer object if options specifies it
+ if (buffer['slice'] != null) {
+ // If we have subtype 2 skip the 4 bytes for the size
+ if (subType === Binary.SUBTYPE_BYTE_ARRAY) {
+ binarySize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ if (binarySize < 0)
+ throw new Error('Negative binary type element size found for subtype 0x02');
+ if (binarySize > totalBinarySize - 4)
+ throw new Error('Binary type with subtype 0x02 contains to long binary size');
+ if (binarySize < totalBinarySize - 4)
+ throw new Error('Binary type with subtype 0x02 contains to short binary size');
+ }
+
+ if (promoteBuffers && promoteValues) {
+ object[name] = buffer.slice(index, index + binarySize);
+ } else {
+ object[name] = new Binary(buffer.slice(index, index + binarySize), subType);
+ }
+ } else {
+ var _buffer =
+ typeof Uint8Array !== 'undefined'
+ ? new Uint8Array(new ArrayBuffer(binarySize))
+ : new Array(binarySize);
+ // If we have subtype 2 skip the 4 bytes for the size
+ if (subType === Binary.SUBTYPE_BYTE_ARRAY) {
+ binarySize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ if (binarySize < 0)
+ throw new Error('Negative binary type element size found for subtype 0x02');
+ if (binarySize > totalBinarySize - 4)
+ throw new Error('Binary type with subtype 0x02 contains to long binary size');
+ if (binarySize < totalBinarySize - 4)
+ throw new Error('Binary type with subtype 0x02 contains to short binary size');
+ }
+
+ // Copy the data
+ for (i = 0; i < binarySize; i++) {
+ _buffer[i] = buffer[index + i];
+ }
+
+ if (promoteBuffers && promoteValues) {
+ object[name] = _buffer;
+ } else {
+ object[name] = new Binary(_buffer, subType);
+ }
+ }
+
+ // Update the index
+ index = index + binarySize;
+ } else if (elementType === BSON.BSON_DATA_REGEXP && bsonRegExp === false) {
+ // Get the start search index
+ i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ // Return the C string
+ var source = buffer.toString('utf8', index, i);
+ // Create the regexp
+ index = i + 1;
+
+ // Get the start search index
+ i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ // Return the C string
+ var regExpOptions = buffer.toString('utf8', index, i);
+ index = i + 1;
+
+ // For each option add the corresponding one for javascript
+ var optionsArray = new Array(regExpOptions.length);
+
+ // Parse options
+ for (i = 0; i < regExpOptions.length; i++) {
+ switch (regExpOptions[i]) {
+ case 'm':
+ optionsArray[i] = 'm';
+ break;
+ case 's':
+ optionsArray[i] = 'g';
+ break;
+ case 'i':
+ optionsArray[i] = 'i';
+ break;
+ }
+ }
+
+ object[name] = new RegExp(source, optionsArray.join(''));
+ } else if (elementType === BSON.BSON_DATA_REGEXP && bsonRegExp === true) {
+ // Get the start search index
+ i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ // Return the C string
+ source = buffer.toString('utf8', index, i);
+ index = i + 1;
+
+ // Get the start search index
+ i = index;
+ // Locate the end of the c string
+ while (buffer[i] !== 0x00 && i < buffer.length) {
+ i++;
+ }
+ // If are at the end of the buffer there is a problem with the document
+ if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString');
+ // Return the C string
+ regExpOptions = buffer.toString('utf8', index, i);
+ index = i + 1;
+
+ // Set the object
+ object[name] = new BSONRegExp(source, regExpOptions);
+ } else if (elementType === BSON.BSON_DATA_SYMBOL) {
+ stringSize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ if (
+ stringSize <= 0 ||
+ stringSize > buffer.length - index ||
+ buffer[index + stringSize - 1] !== 0
+ )
+ throw new Error('bad string length in bson');
+ object[name] = new Symbol(buffer.toString('utf8', index, index + stringSize - 1));
+ index = index + stringSize;
+ } else if (elementType === BSON.BSON_DATA_TIMESTAMP) {
+ lowBits =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ highBits =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ object[name] = new Timestamp(lowBits, highBits);
+ } else if (elementType === BSON.BSON_DATA_MIN_KEY) {
+ object[name] = new MinKey();
+ } else if (elementType === BSON.BSON_DATA_MAX_KEY) {
+ object[name] = new MaxKey();
+ } else if (elementType === BSON.BSON_DATA_CODE) {
+ stringSize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ if (
+ stringSize <= 0 ||
+ stringSize > buffer.length - index ||
+ buffer[index + stringSize - 1] !== 0
+ )
+ throw new Error('bad string length in bson');
+ var functionString = buffer.toString('utf8', index, index + stringSize - 1);
+
+ // If we are evaluating the functions
+ if (evalFunctions) {
+ // If we have cache enabled let's look for the md5 of the function in the cache
+ if (cacheFunctions) {
+ var hash = cacheFunctionsCrc32 ? crc32(functionString) : functionString;
+ // Got to do this to avoid V8 deoptimizing the call due to finding eval
+ object[name] = isolateEvalWithHash(functionCache, hash, functionString, object);
+ } else {
+ object[name] = isolateEval(functionString);
+ }
+ } else {
+ object[name] = new Code(functionString);
+ }
+
+ // Update parse index position
+ index = index + stringSize;
+ } else if (elementType === BSON.BSON_DATA_CODE_W_SCOPE) {
+ var totalSize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+
+ // Element cannot be shorter than totalSize + stringSize + documentSize + terminator
+ if (totalSize < 4 + 4 + 4 + 1) {
+ throw new Error('code_w_scope total size shorter minimum expected length');
+ }
+
+ // Get the code string size
+ stringSize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ // Check if we have a valid string
+ if (
+ stringSize <= 0 ||
+ stringSize > buffer.length - index ||
+ buffer[index + stringSize - 1] !== 0
+ )
+ throw new Error('bad string length in bson');
+
+ // Javascript function
+ functionString = buffer.toString('utf8', index, index + stringSize - 1);
+ // Update parse index position
+ index = index + stringSize;
+ // Parse the element
+ _index = index;
+ // Decode the size of the object document
+ objectSize =
+ buffer[index] |
+ (buffer[index + 1] << 8) |
+ (buffer[index + 2] << 16) |
+ (buffer[index + 3] << 24);
+ // Decode the scope object
+ var scopeObject = deserializeObject(buffer, _index, options, false);
+ // Adjust the index
+ index = index + objectSize;
+
+ // Check if field length is to short
+ if (totalSize < 4 + 4 + objectSize + stringSize) {
+ throw new Error('code_w_scope total size is to short, truncating scope');
+ }
+
+ // Check if totalSize field is to long
+ if (totalSize > 4 + 4 + objectSize + stringSize) {
+ throw new Error('code_w_scope total size is to long, clips outer document');
+ }
+
+ // If we are evaluating the functions
+ if (evalFunctions) {
+ // If we have cache enabled let's look for the md5 of the function in the cache
+ if (cacheFunctions) {
+ hash = cacheFunctionsCrc32 ? crc32(functionString) : functionString;
+ // Got to do this to avoid V8 deoptimizing the call due to finding eval
+ object[name] = isolateEvalWithHash(functionCache, hash, functionString, object);
+ } else {
+ object[name] = isolateEval(functionString);
+ }
+
+ object[name].scope = scopeObject;
+ } else {
+ object[name] = new Code(functionString, scopeObject);
+ }
+ } else if (elementType === BSON.BSON_DATA_DBPOINTER) {
+ // Get the code string size
+ stringSize =
+ buffer[index++] |
+ (buffer[index++] << 8) |
+ (buffer[index++] << 16) |
+ (buffer[index++] << 24);
+ // Check if we have a valid string
+ if (
+ stringSize <= 0 ||
+ stringSize > buffer.length - index ||
+ buffer[index + stringSize - 1] !== 0
+ )
+ throw new Error('bad string length in bson');
+ // Namespace
+ var namespace = buffer.toString('utf8', index, index + stringSize - 1);
+ // Update parse index position
+ index = index + stringSize;
+
+ // Read the oid
+ var oidBuffer = utils.allocBuffer(12);
+ buffer.copy(oidBuffer, 0, index, index + 12);
+ oid = new ObjectID(oidBuffer);
+
+ // Update the index
+ index = index + 12;
+
+ // Split the namespace
+ var parts = namespace.split('.');
+ var db = parts.shift();
+ var collection = parts.join('.');
+ // Upgrade to DBRef type
+ object[name] = new DBRef(collection, oid, db);
+ } else {
+ throw new Error(
+ 'Detected unknown BSON type ' +
+ elementType.toString(16) +
+ ' for fieldname "' +
+ name +
+ '", are you using the latest BSON parser'
+ );
+ }
+ }
+
+ // Check if the deserialization was against a valid array/object
+ if (size !== index - startIndex) {
+ if (isArray) throw new Error('corrupt array bson');
+ throw new Error('corrupt object bson');
+ }
+
+ // Check if we have a db ref object
+ if (object['$id'] != null) object = new DBRef(object['$ref'], object['$id'], object['$db']);
+ return object;
+};
+
+/**
+ * Ensure eval is isolated.
+ *
+ * @ignore
+ * @api private
+ */
+var isolateEvalWithHash = function(functionCache, hash, functionString, object) {
+ // Contains the value we are going to set
+ var value = null;
+
+ // Check for cache hit, eval if missing and return cached function
+ if (functionCache[hash] == null) {
+ eval('value = ' + functionString);
+ functionCache[hash] = value;
+ }
+ // Set the object
+ return functionCache[hash].bind(object);
+};
+
+/**
+ * Ensure eval is isolated.
+ *
+ * @ignore
+ * @api private
+ */
+var isolateEval = function(functionString) {
+ // Contains the value we are going to set
+ var value = null;
+ // Eval the function
+ eval('value = ' + functionString);
+ return value;
+};
+
+var BSON = {};
+
+/**
+ * Contains the function cache if we have that enable to allow for avoiding the eval step on each deserialization, comparison is by md5
+ *
+ * @ignore
+ * @api private
+ */
+var functionCache = (BSON.functionCache = {});
+
+/**
+ * Number BSON Type
+ *
+ * @classconstant BSON_DATA_NUMBER
+ **/
+BSON.BSON_DATA_NUMBER = 1;
+/**
+ * String BSON Type
+ *
+ * @classconstant BSON_DATA_STRING
+ **/
+BSON.BSON_DATA_STRING = 2;
+/**
+ * Object BSON Type
+ *
+ * @classconstant BSON_DATA_OBJECT
+ **/
+BSON.BSON_DATA_OBJECT = 3;
+/**
+ * Array BSON Type
+ *
+ * @classconstant BSON_DATA_ARRAY
+ **/
+BSON.BSON_DATA_ARRAY = 4;
+/**
+ * Binary BSON Type
+ *
+ * @classconstant BSON_DATA_BINARY
+ **/
+BSON.BSON_DATA_BINARY = 5;
+/**
+ * Binary BSON Type
+ *
+ * @classconstant BSON_DATA_UNDEFINED
+ **/
+BSON.BSON_DATA_UNDEFINED = 6;
+/**
+ * ObjectID BSON Type
+ *
+ * @classconstant BSON_DATA_OID
+ **/
+BSON.BSON_DATA_OID = 7;
+/**
+ * Boolean BSON Type
+ *
+ * @classconstant BSON_DATA_BOOLEAN
+ **/
+BSON.BSON_DATA_BOOLEAN = 8;
+/**
+ * Date BSON Type
+ *
+ * @classconstant BSON_DATA_DATE
+ **/
+BSON.BSON_DATA_DATE = 9;
+/**
+ * null BSON Type
+ *
+ * @classconstant BSON_DATA_NULL
+ **/
+BSON.BSON_DATA_NULL = 10;
+/**
+ * RegExp BSON Type
+ *
+ * @classconstant BSON_DATA_REGEXP
+ **/
+BSON.BSON_DATA_REGEXP = 11;
+/**
+ * Code BSON Type
+ *
+ * @classconstant BSON_DATA_DBPOINTER
+ **/
+BSON.BSON_DATA_DBPOINTER = 12;
+/**
+ * Code BSON Type
+ *
+ * @classconstant BSON_DATA_CODE
+ **/
+BSON.BSON_DATA_CODE = 13;
+/**
+ * Symbol BSON Type
+ *
+ * @classconstant BSON_DATA_SYMBOL
+ **/
+BSON.BSON_DATA_SYMBOL = 14;
+/**
+ * Code with Scope BSON Type
+ *
+ * @classconstant BSON_DATA_CODE_W_SCOPE
+ **/
+BSON.BSON_DATA_CODE_W_SCOPE = 15;
+/**
+ * 32 bit Integer BSON Type
+ *
+ * @classconstant BSON_DATA_INT
+ **/
+BSON.BSON_DATA_INT = 16;
+/**
+ * Timestamp BSON Type
+ *
+ * @classconstant BSON_DATA_TIMESTAMP
+ **/
+BSON.BSON_DATA_TIMESTAMP = 17;
+/**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_LONG
+ **/
+BSON.BSON_DATA_LONG = 18;
+/**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_DECIMAL128
+ **/
+BSON.BSON_DATA_DECIMAL128 = 19;
+/**
+ * MinKey BSON Type
+ *
+ * @classconstant BSON_DATA_MIN_KEY
+ **/
+BSON.BSON_DATA_MIN_KEY = 0xff;
+/**
+ * MaxKey BSON Type
+ *
+ * @classconstant BSON_DATA_MAX_KEY
+ **/
+BSON.BSON_DATA_MAX_KEY = 0x7f;
+
+/**
+ * Binary Default Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_DEFAULT
+ **/
+BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0;
+/**
+ * Binary Function Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_FUNCTION
+ **/
+BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1;
+/**
+ * Binary Byte Array Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY
+ **/
+BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2;
+/**
+ * Binary UUID Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_UUID
+ **/
+BSON.BSON_BINARY_SUBTYPE_UUID = 3;
+/**
+ * Binary MD5 Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_MD5
+ **/
+BSON.BSON_BINARY_SUBTYPE_MD5 = 4;
+/**
+ * Binary User Defined Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED
+ **/
+BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128;
+
+// BSON MAX VALUES
+BSON.BSON_INT32_MAX = 0x7fffffff;
+BSON.BSON_INT32_MIN = -0x80000000;
+
+BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1;
+BSON.BSON_INT64_MIN = -Math.pow(2, 63);
+
+// JS MAX PRECISE VALUES
+BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+// Internal long versions
+var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double.
+var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double.
+
+module.exports = deserialize;
diff --git a/Restaurant/node_modules/bson/lib/bson/parser/serializer.js b/Restaurant/node_modules/bson/lib/bson/parser/serializer.js
new file mode 100644
index 0000000..e4ff2bd
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/parser/serializer.js
@@ -0,0 +1,1182 @@
+'use strict';
+
+var writeIEEE754 = require('../float_parser').writeIEEE754,
+ Long = require('../long').Long,
+ Map = require('../map'),
+ Binary = require('../binary').Binary;
+
+var normalizedFunctionString = require('./utils').normalizedFunctionString;
+
+// try {
+// var _Buffer = Uint8Array;
+// } catch (e) {
+// _Buffer = Buffer;
+// }
+
+var regexp = /\x00/; // eslint-disable-line no-control-regex
+var ignoreKeys = ['$db', '$ref', '$id', '$clusterTime'];
+
+// To ensure that 0.4 of node works correctly
+var isDate = function isDate(d) {
+ return typeof d === 'object' && Object.prototype.toString.call(d) === '[object Date]';
+};
+
+var isRegExp = function isRegExp(d) {
+ return Object.prototype.toString.call(d) === '[object RegExp]';
+};
+
+var serializeString = function(buffer, key, value, index, isArray) {
+ // Encode String type
+ buffer[index++] = BSON.BSON_DATA_STRING;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes + 1;
+ buffer[index - 1] = 0;
+ // Write the string
+ var size = buffer.write(value, index + 4, 'utf8');
+ // Write the size of the string to buffer
+ buffer[index + 3] = ((size + 1) >> 24) & 0xff;
+ buffer[index + 2] = ((size + 1) >> 16) & 0xff;
+ buffer[index + 1] = ((size + 1) >> 8) & 0xff;
+ buffer[index] = (size + 1) & 0xff;
+ // Update index
+ index = index + 4 + size;
+ // Write zero
+ buffer[index++] = 0;
+ return index;
+};
+
+var serializeNumber = function(buffer, key, value, index, isArray) {
+ // We have an integer value
+ if (Math.floor(value) === value && value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) {
+ // If the value fits in 32 bits encode as int, if it fits in a double
+ // encode it as a double, otherwise long
+ if (value >= BSON.BSON_INT32_MIN && value <= BSON.BSON_INT32_MAX) {
+ // Set int type 32 bits or less
+ buffer[index++] = BSON.BSON_DATA_INT;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the int value
+ buffer[index++] = value & 0xff;
+ buffer[index++] = (value >> 8) & 0xff;
+ buffer[index++] = (value >> 16) & 0xff;
+ buffer[index++] = (value >> 24) & 0xff;
+ } else if (value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) {
+ // Encode as double
+ buffer[index++] = BSON.BSON_DATA_NUMBER;
+ // Number of written bytes
+ numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write float
+ writeIEEE754(buffer, value, index, 'little', 52, 8);
+ // Ajust index
+ index = index + 8;
+ } else {
+ // Set long type
+ buffer[index++] = BSON.BSON_DATA_LONG;
+ // Number of written bytes
+ numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ var longVal = Long.fromNumber(value);
+ var lowBits = longVal.getLowBits();
+ var highBits = longVal.getHighBits();
+ // Encode low bits
+ buffer[index++] = lowBits & 0xff;
+ buffer[index++] = (lowBits >> 8) & 0xff;
+ buffer[index++] = (lowBits >> 16) & 0xff;
+ buffer[index++] = (lowBits >> 24) & 0xff;
+ // Encode high bits
+ buffer[index++] = highBits & 0xff;
+ buffer[index++] = (highBits >> 8) & 0xff;
+ buffer[index++] = (highBits >> 16) & 0xff;
+ buffer[index++] = (highBits >> 24) & 0xff;
+ }
+ } else {
+ // Encode as double
+ buffer[index++] = BSON.BSON_DATA_NUMBER;
+ // Number of written bytes
+ numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write float
+ writeIEEE754(buffer, value, index, 'little', 52, 8);
+ // Ajust index
+ index = index + 8;
+ }
+
+ return index;
+};
+
+var serializeNull = function(buffer, key, value, index, isArray) {
+ // Set long type
+ buffer[index++] = BSON.BSON_DATA_NULL;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ return index;
+};
+
+var serializeBoolean = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_BOOLEAN;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Encode the boolean value
+ buffer[index++] = value ? 1 : 0;
+ return index;
+};
+
+var serializeDate = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_DATE;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ // Write the date
+ var dateInMilis = Long.fromNumber(value.getTime());
+ var lowBits = dateInMilis.getLowBits();
+ var highBits = dateInMilis.getHighBits();
+ // Encode low bits
+ buffer[index++] = lowBits & 0xff;
+ buffer[index++] = (lowBits >> 8) & 0xff;
+ buffer[index++] = (lowBits >> 16) & 0xff;
+ buffer[index++] = (lowBits >> 24) & 0xff;
+ // Encode high bits
+ buffer[index++] = highBits & 0xff;
+ buffer[index++] = (highBits >> 8) & 0xff;
+ buffer[index++] = (highBits >> 16) & 0xff;
+ buffer[index++] = (highBits >> 24) & 0xff;
+ return index;
+};
+
+var serializeRegExp = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_REGEXP;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ if (value.source && value.source.match(regexp) != null) {
+ throw Error('value ' + value.source + ' must not contain null bytes');
+ }
+ // Adjust the index
+ index = index + buffer.write(value.source, index, 'utf8');
+ // Write zero
+ buffer[index++] = 0x00;
+ // Write the parameters
+ if (value.global) buffer[index++] = 0x73; // s
+ if (value.ignoreCase) buffer[index++] = 0x69; // i
+ if (value.multiline) buffer[index++] = 0x6d; // m
+ // Add ending zero
+ buffer[index++] = 0x00;
+ return index;
+};
+
+var serializeBSONRegExp = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_REGEXP;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ // Check the pattern for 0 bytes
+ if (value.pattern.match(regexp) != null) {
+ // The BSON spec doesn't allow keys with null bytes because keys are
+ // null-terminated.
+ throw Error('pattern ' + value.pattern + ' must not contain null bytes');
+ }
+
+ // Adjust the index
+ index = index + buffer.write(value.pattern, index, 'utf8');
+ // Write zero
+ buffer[index++] = 0x00;
+ // Write the options
+ index =
+ index +
+ buffer.write(
+ value.options
+ .split('')
+ .sort()
+ .join(''),
+ index,
+ 'utf8'
+ );
+ // Add ending zero
+ buffer[index++] = 0x00;
+ return index;
+};
+
+var serializeMinMax = function(buffer, key, value, index, isArray) {
+ // Write the type of either min or max key
+ if (value === null) {
+ buffer[index++] = BSON.BSON_DATA_NULL;
+ } else if (value._bsontype === 'MinKey') {
+ buffer[index++] = BSON.BSON_DATA_MIN_KEY;
+ } else {
+ buffer[index++] = BSON.BSON_DATA_MAX_KEY;
+ }
+
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ return index;
+};
+
+var serializeObjectId = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_OID;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ // Write the objectId into the shared buffer
+ if (typeof value.id === 'string') {
+ buffer.write(value.id, index, 'binary');
+ } else if (value.id && value.id.copy) {
+ value.id.copy(buffer, index, 0, 12);
+ } else {
+ throw new Error('object [' + JSON.stringify(value) + '] is not a valid ObjectId');
+ }
+
+ // Ajust index
+ return index + 12;
+};
+
+var serializeBuffer = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_BINARY;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Get size of the buffer (current write point)
+ var size = value.length;
+ // Write the size of the string to buffer
+ buffer[index++] = size & 0xff;
+ buffer[index++] = (size >> 8) & 0xff;
+ buffer[index++] = (size >> 16) & 0xff;
+ buffer[index++] = (size >> 24) & 0xff;
+ // Write the default subtype
+ buffer[index++] = BSON.BSON_BINARY_SUBTYPE_DEFAULT;
+ // Copy the content form the binary field to the buffer
+ value.copy(buffer, index, 0, size);
+ // Adjust the index
+ index = index + size;
+ return index;
+};
+
+var serializeObject = function(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ ignoreUndefined,
+ isArray,
+ path
+) {
+ for (var i = 0; i < path.length; i++) {
+ if (path[i] === value) throw new Error('cyclic dependency detected');
+ }
+
+ // Push value to stack
+ path.push(value);
+ // Write the type
+ buffer[index++] = Array.isArray(value) ? BSON.BSON_DATA_ARRAY : BSON.BSON_DATA_OBJECT;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ var endIndex = serializeInto(
+ buffer,
+ value,
+ checkKeys,
+ index,
+ depth + 1,
+ serializeFunctions,
+ ignoreUndefined,
+ path
+ );
+ // Pop stack
+ path.pop();
+ // Write size
+ return endIndex;
+};
+
+var serializeDecimal128 = function(buffer, key, value, index, isArray) {
+ buffer[index++] = BSON.BSON_DATA_DECIMAL128;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the data from the value
+ value.bytes.copy(buffer, index, 0, 16);
+ return index + 16;
+};
+
+var serializeLong = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = value._bsontype === 'Long' ? BSON.BSON_DATA_LONG : BSON.BSON_DATA_TIMESTAMP;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the date
+ var lowBits = value.getLowBits();
+ var highBits = value.getHighBits();
+ // Encode low bits
+ buffer[index++] = lowBits & 0xff;
+ buffer[index++] = (lowBits >> 8) & 0xff;
+ buffer[index++] = (lowBits >> 16) & 0xff;
+ buffer[index++] = (lowBits >> 24) & 0xff;
+ // Encode high bits
+ buffer[index++] = highBits & 0xff;
+ buffer[index++] = (highBits >> 8) & 0xff;
+ buffer[index++] = (highBits >> 16) & 0xff;
+ buffer[index++] = (highBits >> 24) & 0xff;
+ return index;
+};
+
+var serializeInt32 = function(buffer, key, value, index, isArray) {
+ // Set int type 32 bits or less
+ buffer[index++] = BSON.BSON_DATA_INT;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the int value
+ buffer[index++] = value & 0xff;
+ buffer[index++] = (value >> 8) & 0xff;
+ buffer[index++] = (value >> 16) & 0xff;
+ buffer[index++] = (value >> 24) & 0xff;
+ return index;
+};
+
+var serializeDouble = function(buffer, key, value, index, isArray) {
+ // Encode as double
+ buffer[index++] = BSON.BSON_DATA_NUMBER;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write float
+ writeIEEE754(buffer, value, index, 'little', 52, 8);
+ // Ajust index
+ index = index + 8;
+ return index;
+};
+
+var serializeFunction = function(buffer, key, value, index, checkKeys, depth, isArray) {
+ buffer[index++] = BSON.BSON_DATA_CODE;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Function string
+ var functionString = normalizedFunctionString(value);
+
+ // Write the string
+ var size = buffer.write(functionString, index + 4, 'utf8') + 1;
+ // Write the size of the string to buffer
+ buffer[index] = size & 0xff;
+ buffer[index + 1] = (size >> 8) & 0xff;
+ buffer[index + 2] = (size >> 16) & 0xff;
+ buffer[index + 3] = (size >> 24) & 0xff;
+ // Update index
+ index = index + 4 + size - 1;
+ // Write zero
+ buffer[index++] = 0;
+ return index;
+};
+
+var serializeCode = function(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ ignoreUndefined,
+ isArray
+) {
+ if (value.scope && typeof value.scope === 'object') {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_CODE_W_SCOPE;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ // Starting index
+ var startIndex = index;
+
+ // Serialize the function
+ // Get the function string
+ var functionString = typeof value.code === 'string' ? value.code : value.code.toString();
+ // Index adjustment
+ index = index + 4;
+ // Write string into buffer
+ var codeSize = buffer.write(functionString, index + 4, 'utf8') + 1;
+ // Write the size of the string to buffer
+ buffer[index] = codeSize & 0xff;
+ buffer[index + 1] = (codeSize >> 8) & 0xff;
+ buffer[index + 2] = (codeSize >> 16) & 0xff;
+ buffer[index + 3] = (codeSize >> 24) & 0xff;
+ // Write end 0
+ buffer[index + 4 + codeSize - 1] = 0;
+ // Write the
+ index = index + codeSize + 4;
+
+ //
+ // Serialize the scope value
+ var endIndex = serializeInto(
+ buffer,
+ value.scope,
+ checkKeys,
+ index,
+ depth + 1,
+ serializeFunctions,
+ ignoreUndefined
+ );
+ index = endIndex - 1;
+
+ // Writ the total
+ var totalSize = endIndex - startIndex;
+
+ // Write the total size of the object
+ buffer[startIndex++] = totalSize & 0xff;
+ buffer[startIndex++] = (totalSize >> 8) & 0xff;
+ buffer[startIndex++] = (totalSize >> 16) & 0xff;
+ buffer[startIndex++] = (totalSize >> 24) & 0xff;
+ // Write trailing zero
+ buffer[index++] = 0;
+ } else {
+ buffer[index++] = BSON.BSON_DATA_CODE;
+ // Number of written bytes
+ numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Function string
+ functionString = value.code.toString();
+ // Write the string
+ var size = buffer.write(functionString, index + 4, 'utf8') + 1;
+ // Write the size of the string to buffer
+ buffer[index] = size & 0xff;
+ buffer[index + 1] = (size >> 8) & 0xff;
+ buffer[index + 2] = (size >> 16) & 0xff;
+ buffer[index + 3] = (size >> 24) & 0xff;
+ // Update index
+ index = index + 4 + size - 1;
+ // Write zero
+ buffer[index++] = 0;
+ }
+
+ return index;
+};
+
+var serializeBinary = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_BINARY;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Extract the buffer
+ var data = value.value(true);
+ // Calculate size
+ var size = value.position;
+ // Add the deprecated 02 type 4 bytes of size to total
+ if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) size = size + 4;
+ // Write the size of the string to buffer
+ buffer[index++] = size & 0xff;
+ buffer[index++] = (size >> 8) & 0xff;
+ buffer[index++] = (size >> 16) & 0xff;
+ buffer[index++] = (size >> 24) & 0xff;
+ // Write the subtype to the buffer
+ buffer[index++] = value.sub_type;
+
+ // If we have binary type 2 the 4 first bytes are the size
+ if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) {
+ size = size - 4;
+ buffer[index++] = size & 0xff;
+ buffer[index++] = (size >> 8) & 0xff;
+ buffer[index++] = (size >> 16) & 0xff;
+ buffer[index++] = (size >> 24) & 0xff;
+ }
+
+ // Write the data to the object
+ data.copy(buffer, index, 0, value.position);
+ // Adjust the index
+ index = index + value.position;
+ return index;
+};
+
+var serializeSymbol = function(buffer, key, value, index, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_SYMBOL;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+ // Write the string
+ var size = buffer.write(value.value, index + 4, 'utf8') + 1;
+ // Write the size of the string to buffer
+ buffer[index] = size & 0xff;
+ buffer[index + 1] = (size >> 8) & 0xff;
+ buffer[index + 2] = (size >> 16) & 0xff;
+ buffer[index + 3] = (size >> 24) & 0xff;
+ // Update index
+ index = index + 4 + size - 1;
+ // Write zero
+ buffer[index++] = 0x00;
+ return index;
+};
+
+var serializeDBRef = function(buffer, key, value, index, depth, serializeFunctions, isArray) {
+ // Write the type
+ buffer[index++] = BSON.BSON_DATA_OBJECT;
+ // Number of written bytes
+ var numberOfWrittenBytes = !isArray
+ ? buffer.write(key, index, 'utf8')
+ : buffer.write(key, index, 'ascii');
+
+ // Encode the name
+ index = index + numberOfWrittenBytes;
+ buffer[index++] = 0;
+
+ var startIndex = index;
+ var endIndex;
+
+ // Serialize object
+ if (null != value.db) {
+ endIndex = serializeInto(
+ buffer,
+ {
+ $ref: value.namespace,
+ $id: value.oid,
+ $db: value.db
+ },
+ false,
+ index,
+ depth + 1,
+ serializeFunctions
+ );
+ } else {
+ endIndex = serializeInto(
+ buffer,
+ {
+ $ref: value.namespace,
+ $id: value.oid
+ },
+ false,
+ index,
+ depth + 1,
+ serializeFunctions
+ );
+ }
+
+ // Calculate object size
+ var size = endIndex - startIndex;
+ // Write the size
+ buffer[startIndex++] = size & 0xff;
+ buffer[startIndex++] = (size >> 8) & 0xff;
+ buffer[startIndex++] = (size >> 16) & 0xff;
+ buffer[startIndex++] = (size >> 24) & 0xff;
+ // Set index
+ return endIndex;
+};
+
+var serializeInto = function serializeInto(
+ buffer,
+ object,
+ checkKeys,
+ startingIndex,
+ depth,
+ serializeFunctions,
+ ignoreUndefined,
+ path
+) {
+ startingIndex = startingIndex || 0;
+ path = path || [];
+
+ // Push the object to the path
+ path.push(object);
+
+ // Start place to serialize into
+ var index = startingIndex + 4;
+ // var self = this;
+
+ // Special case isArray
+ if (Array.isArray(object)) {
+ // Get object keys
+ for (var i = 0; i < object.length; i++) {
+ var key = '' + i;
+ var value = object[i];
+
+ // Is there an override value
+ if (value && value.toBSON) {
+ if (typeof value.toBSON !== 'function') throw new Error('toBSON is not a function');
+ value = value.toBSON();
+ }
+
+ var type = typeof value;
+ if (type === 'string') {
+ index = serializeString(buffer, key, value, index, true);
+ } else if (type === 'number') {
+ index = serializeNumber(buffer, key, value, index, true);
+ } else if (type === 'boolean') {
+ index = serializeBoolean(buffer, key, value, index, true);
+ } else if (value instanceof Date || isDate(value)) {
+ index = serializeDate(buffer, key, value, index, true);
+ } else if (value === undefined) {
+ index = serializeNull(buffer, key, value, index, true);
+ } else if (value === null) {
+ index = serializeNull(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') {
+ index = serializeObjectId(buffer, key, value, index, true);
+ } else if (Buffer.isBuffer(value)) {
+ index = serializeBuffer(buffer, key, value, index, true);
+ } else if (value instanceof RegExp || isRegExp(value)) {
+ index = serializeRegExp(buffer, key, value, index, true);
+ } else if (type === 'object' && value['_bsontype'] == null) {
+ index = serializeObject(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ ignoreUndefined,
+ true,
+ path
+ );
+ } else if (type === 'object' && value['_bsontype'] === 'Decimal128') {
+ index = serializeDecimal128(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') {
+ index = serializeLong(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'Double') {
+ index = serializeDouble(buffer, key, value, index, true);
+ } else if (typeof value === 'function' && serializeFunctions) {
+ index = serializeFunction(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ true
+ );
+ } else if (value['_bsontype'] === 'Code') {
+ index = serializeCode(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ ignoreUndefined,
+ true
+ );
+ } else if (value['_bsontype'] === 'Binary') {
+ index = serializeBinary(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'Symbol') {
+ index = serializeSymbol(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'DBRef') {
+ index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions, true);
+ } else if (value['_bsontype'] === 'BSONRegExp') {
+ index = serializeBSONRegExp(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'Int32') {
+ index = serializeInt32(buffer, key, value, index, true);
+ } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') {
+ index = serializeMinMax(buffer, key, value, index, true);
+ }
+ }
+ } else if (object instanceof Map) {
+ var iterator = object.entries();
+ var done = false;
+
+ while (!done) {
+ // Unpack the next entry
+ var entry = iterator.next();
+ done = entry.done;
+ // Are we done, then skip and terminate
+ if (done) continue;
+
+ // Get the entry values
+ key = entry.value[0];
+ value = entry.value[1];
+
+ // Check the type of the value
+ type = typeof value;
+
+ // Check the key and throw error if it's illegal
+ if (typeof key === 'string' && ignoreKeys.indexOf(key) === -1) {
+ if (key.match(regexp) != null) {
+ // The BSON spec doesn't allow keys with null bytes because keys are
+ // null-terminated.
+ throw Error('key ' + key + ' must not contain null bytes');
+ }
+
+ if (checkKeys) {
+ if ('$' === key[0]) {
+ throw Error('key ' + key + " must not start with '$'");
+ } else if (~key.indexOf('.')) {
+ throw Error('key ' + key + " must not contain '.'");
+ }
+ }
+ }
+
+ if (type === 'string') {
+ index = serializeString(buffer, key, value, index);
+ } else if (type === 'number') {
+ index = serializeNumber(buffer, key, value, index);
+ } else if (type === 'boolean') {
+ index = serializeBoolean(buffer, key, value, index);
+ } else if (value instanceof Date || isDate(value)) {
+ index = serializeDate(buffer, key, value, index);
+ // } else if (value === undefined && ignoreUndefined === true) {
+ } else if (value === null || (value === undefined && ignoreUndefined === false)) {
+ index = serializeNull(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') {
+ index = serializeObjectId(buffer, key, value, index);
+ } else if (Buffer.isBuffer(value)) {
+ index = serializeBuffer(buffer, key, value, index);
+ } else if (value instanceof RegExp || isRegExp(value)) {
+ index = serializeRegExp(buffer, key, value, index);
+ } else if (type === 'object' && value['_bsontype'] == null) {
+ index = serializeObject(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ ignoreUndefined,
+ false,
+ path
+ );
+ } else if (type === 'object' && value['_bsontype'] === 'Decimal128') {
+ index = serializeDecimal128(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') {
+ index = serializeLong(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Double') {
+ index = serializeDouble(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Code') {
+ index = serializeCode(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ ignoreUndefined
+ );
+ } else if (typeof value === 'function' && serializeFunctions) {
+ index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions);
+ } else if (value['_bsontype'] === 'Binary') {
+ index = serializeBinary(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Symbol') {
+ index = serializeSymbol(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'DBRef') {
+ index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions);
+ } else if (value['_bsontype'] === 'BSONRegExp') {
+ index = serializeBSONRegExp(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Int32') {
+ index = serializeInt32(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') {
+ index = serializeMinMax(buffer, key, value, index);
+ }
+ }
+ } else {
+ // Did we provide a custom serialization method
+ if (object.toBSON) {
+ if (typeof object.toBSON !== 'function') throw new Error('toBSON is not a function');
+ object = object.toBSON();
+ if (object != null && typeof object !== 'object')
+ throw new Error('toBSON function did not return an object');
+ }
+
+ // Iterate over all the keys
+ for (key in object) {
+ value = object[key];
+ // Is there an override value
+ if (value && value.toBSON) {
+ if (typeof value.toBSON !== 'function') throw new Error('toBSON is not a function');
+ value = value.toBSON();
+ }
+
+ // Check the type of the value
+ type = typeof value;
+
+ // Check the key and throw error if it's illegal
+ if (typeof key === 'string' && ignoreKeys.indexOf(key) === -1) {
+ if (key.match(regexp) != null) {
+ // The BSON spec doesn't allow keys with null bytes because keys are
+ // null-terminated.
+ throw Error('key ' + key + ' must not contain null bytes');
+ }
+
+ if (checkKeys) {
+ if ('$' === key[0]) {
+ throw Error('key ' + key + " must not start with '$'");
+ } else if (~key.indexOf('.')) {
+ throw Error('key ' + key + " must not contain '.'");
+ }
+ }
+ }
+
+ if (type === 'string') {
+ index = serializeString(buffer, key, value, index);
+ } else if (type === 'number') {
+ index = serializeNumber(buffer, key, value, index);
+ } else if (type === 'boolean') {
+ index = serializeBoolean(buffer, key, value, index);
+ } else if (value instanceof Date || isDate(value)) {
+ index = serializeDate(buffer, key, value, index);
+ } else if (value === undefined) {
+ if (ignoreUndefined === false) index = serializeNull(buffer, key, value, index);
+ } else if (value === null) {
+ index = serializeNull(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') {
+ index = serializeObjectId(buffer, key, value, index);
+ } else if (Buffer.isBuffer(value)) {
+ index = serializeBuffer(buffer, key, value, index);
+ } else if (value instanceof RegExp || isRegExp(value)) {
+ index = serializeRegExp(buffer, key, value, index);
+ } else if (type === 'object' && value['_bsontype'] == null) {
+ index = serializeObject(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ ignoreUndefined,
+ false,
+ path
+ );
+ } else if (type === 'object' && value['_bsontype'] === 'Decimal128') {
+ index = serializeDecimal128(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') {
+ index = serializeLong(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Double') {
+ index = serializeDouble(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Code') {
+ index = serializeCode(
+ buffer,
+ key,
+ value,
+ index,
+ checkKeys,
+ depth,
+ serializeFunctions,
+ ignoreUndefined
+ );
+ } else if (typeof value === 'function' && serializeFunctions) {
+ index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions);
+ } else if (value['_bsontype'] === 'Binary') {
+ index = serializeBinary(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Symbol') {
+ index = serializeSymbol(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'DBRef') {
+ index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions);
+ } else if (value['_bsontype'] === 'BSONRegExp') {
+ index = serializeBSONRegExp(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'Int32') {
+ index = serializeInt32(buffer, key, value, index);
+ } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') {
+ index = serializeMinMax(buffer, key, value, index);
+ }
+ }
+ }
+
+ // Remove the path
+ path.pop();
+
+ // Final padding byte for object
+ buffer[index++] = 0x00;
+
+ // Final size
+ var size = index - startingIndex;
+ // Write the size of the object
+ buffer[startingIndex++] = size & 0xff;
+ buffer[startingIndex++] = (size >> 8) & 0xff;
+ buffer[startingIndex++] = (size >> 16) & 0xff;
+ buffer[startingIndex++] = (size >> 24) & 0xff;
+ return index;
+};
+
+var BSON = {};
+
+/**
+ * Contains the function cache if we have that enable to allow for avoiding the eval step on each deserialization, comparison is by md5
+ *
+ * @ignore
+ * @api private
+ */
+// var functionCache = (BSON.functionCache = {});
+
+/**
+ * Number BSON Type
+ *
+ * @classconstant BSON_DATA_NUMBER
+ **/
+BSON.BSON_DATA_NUMBER = 1;
+/**
+ * String BSON Type
+ *
+ * @classconstant BSON_DATA_STRING
+ **/
+BSON.BSON_DATA_STRING = 2;
+/**
+ * Object BSON Type
+ *
+ * @classconstant BSON_DATA_OBJECT
+ **/
+BSON.BSON_DATA_OBJECT = 3;
+/**
+ * Array BSON Type
+ *
+ * @classconstant BSON_DATA_ARRAY
+ **/
+BSON.BSON_DATA_ARRAY = 4;
+/**
+ * Binary BSON Type
+ *
+ * @classconstant BSON_DATA_BINARY
+ **/
+BSON.BSON_DATA_BINARY = 5;
+/**
+ * ObjectID BSON Type, deprecated
+ *
+ * @classconstant BSON_DATA_UNDEFINED
+ **/
+BSON.BSON_DATA_UNDEFINED = 6;
+/**
+ * ObjectID BSON Type
+ *
+ * @classconstant BSON_DATA_OID
+ **/
+BSON.BSON_DATA_OID = 7;
+/**
+ * Boolean BSON Type
+ *
+ * @classconstant BSON_DATA_BOOLEAN
+ **/
+BSON.BSON_DATA_BOOLEAN = 8;
+/**
+ * Date BSON Type
+ *
+ * @classconstant BSON_DATA_DATE
+ **/
+BSON.BSON_DATA_DATE = 9;
+/**
+ * null BSON Type
+ *
+ * @classconstant BSON_DATA_NULL
+ **/
+BSON.BSON_DATA_NULL = 10;
+/**
+ * RegExp BSON Type
+ *
+ * @classconstant BSON_DATA_REGEXP
+ **/
+BSON.BSON_DATA_REGEXP = 11;
+/**
+ * Code BSON Type
+ *
+ * @classconstant BSON_DATA_CODE
+ **/
+BSON.BSON_DATA_CODE = 13;
+/**
+ * Symbol BSON Type
+ *
+ * @classconstant BSON_DATA_SYMBOL
+ **/
+BSON.BSON_DATA_SYMBOL = 14;
+/**
+ * Code with Scope BSON Type
+ *
+ * @classconstant BSON_DATA_CODE_W_SCOPE
+ **/
+BSON.BSON_DATA_CODE_W_SCOPE = 15;
+/**
+ * 32 bit Integer BSON Type
+ *
+ * @classconstant BSON_DATA_INT
+ **/
+BSON.BSON_DATA_INT = 16;
+/**
+ * Timestamp BSON Type
+ *
+ * @classconstant BSON_DATA_TIMESTAMP
+ **/
+BSON.BSON_DATA_TIMESTAMP = 17;
+/**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_LONG
+ **/
+BSON.BSON_DATA_LONG = 18;
+/**
+ * Long BSON Type
+ *
+ * @classconstant BSON_DATA_DECIMAL128
+ **/
+BSON.BSON_DATA_DECIMAL128 = 19;
+/**
+ * MinKey BSON Type
+ *
+ * @classconstant BSON_DATA_MIN_KEY
+ **/
+BSON.BSON_DATA_MIN_KEY = 0xff;
+/**
+ * MaxKey BSON Type
+ *
+ * @classconstant BSON_DATA_MAX_KEY
+ **/
+BSON.BSON_DATA_MAX_KEY = 0x7f;
+/**
+ * Binary Default Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_DEFAULT
+ **/
+BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0;
+/**
+ * Binary Function Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_FUNCTION
+ **/
+BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1;
+/**
+ * Binary Byte Array Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY
+ **/
+BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2;
+/**
+ * Binary UUID Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_UUID
+ **/
+BSON.BSON_BINARY_SUBTYPE_UUID = 3;
+/**
+ * Binary MD5 Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_MD5
+ **/
+BSON.BSON_BINARY_SUBTYPE_MD5 = 4;
+/**
+ * Binary User Defined Type
+ *
+ * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED
+ **/
+BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128;
+
+// BSON MAX VALUES
+BSON.BSON_INT32_MAX = 0x7fffffff;
+BSON.BSON_INT32_MIN = -0x80000000;
+
+BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1;
+BSON.BSON_INT64_MIN = -Math.pow(2, 63);
+
+// JS MAX PRECISE VALUES
+BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double.
+BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double.
+
+// Internal long versions
+// var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double.
+// var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double.
+
+module.exports = serializeInto;
diff --git a/Restaurant/node_modules/bson/lib/bson/parser/utils.js b/Restaurant/node_modules/bson/lib/bson/parser/utils.js
new file mode 100644
index 0000000..6faa439
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/parser/utils.js
@@ -0,0 +1,28 @@
+'use strict';
+
+/**
+ * Normalizes our expected stringified form of a function across versions of node
+ * @param {Function} fn The function to stringify
+ */
+function normalizedFunctionString(fn) {
+ return fn.toString().replace(/function *\(/, 'function (');
+}
+
+function newBuffer(item, encoding) {
+ return new Buffer(item, encoding);
+}
+
+function allocBuffer() {
+ return Buffer.alloc.apply(Buffer, arguments);
+}
+
+function toBuffer() {
+ return Buffer.from.apply(Buffer, arguments);
+}
+
+module.exports = {
+ normalizedFunctionString: normalizedFunctionString,
+ allocBuffer: typeof Buffer.alloc === 'function' ? allocBuffer : newBuffer,
+ toBuffer: typeof Buffer.from === 'function' ? toBuffer : newBuffer
+};
+
diff --git a/Restaurant/node_modules/bson/lib/bson/regexp.js b/Restaurant/node_modules/bson/lib/bson/regexp.js
new file mode 100644
index 0000000..108f016
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/regexp.js
@@ -0,0 +1,33 @@
+/**
+ * A class representation of the BSON RegExp type.
+ *
+ * @class
+ * @return {BSONRegExp} A MinKey instance
+ */
+function BSONRegExp(pattern, options) {
+ if (!(this instanceof BSONRegExp)) return new BSONRegExp();
+
+ // Execute
+ this._bsontype = 'BSONRegExp';
+ this.pattern = pattern || '';
+ this.options = options || '';
+
+ // Validate options
+ for (var i = 0; i < this.options.length; i++) {
+ if (
+ !(
+ this.options[i] === 'i' ||
+ this.options[i] === 'm' ||
+ this.options[i] === 'x' ||
+ this.options[i] === 'l' ||
+ this.options[i] === 's' ||
+ this.options[i] === 'u'
+ )
+ ) {
+ throw new Error('the regular expression options [' + this.options[i] + '] is not supported');
+ }
+ }
+}
+
+module.exports = BSONRegExp;
+module.exports.BSONRegExp = BSONRegExp;
diff --git a/Restaurant/node_modules/bson/lib/bson/symbol.js b/Restaurant/node_modules/bson/lib/bson/symbol.js
new file mode 100644
index 0000000..ba20cab
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/symbol.js
@@ -0,0 +1,50 @@
+// Custom inspect property name / symbol.
+var inspect = Buffer ? require('util').inspect.custom || 'inspect' : 'inspect';
+
+/**
+ * A class representation of the BSON Symbol type.
+ *
+ * @class
+ * @deprecated
+ * @param {string} value the string representing the symbol.
+ * @return {Symbol}
+ */
+function Symbol(value) {
+ if (!(this instanceof Symbol)) return new Symbol(value);
+ this._bsontype = 'Symbol';
+ this.value = value;
+}
+
+/**
+ * Access the wrapped string value.
+ *
+ * @method
+ * @return {String} returns the wrapped string.
+ */
+Symbol.prototype.valueOf = function() {
+ return this.value;
+};
+
+/**
+ * @ignore
+ */
+Symbol.prototype.toString = function() {
+ return this.value;
+};
+
+/**
+ * @ignore
+ */
+Symbol.prototype[inspect] = function() {
+ return this.value;
+};
+
+/**
+ * @ignore
+ */
+Symbol.prototype.toJSON = function() {
+ return this.value;
+};
+
+module.exports = Symbol;
+module.exports.Symbol = Symbol;
diff --git a/Restaurant/node_modules/bson/lib/bson/timestamp.js b/Restaurant/node_modules/bson/lib/bson/timestamp.js
new file mode 100644
index 0000000..dc61a6c
--- /dev/null
+++ b/Restaurant/node_modules/bson/lib/bson/timestamp.js
@@ -0,0 +1,854 @@
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+// Copyright 2009 Google Inc. All Rights Reserved
+
+/**
+ * This type is for INTERNAL use in MongoDB only and should not be used in applications.
+ * The appropriate corresponding type is the JavaScript Date type.
+ *
+ * Defines a Timestamp class for representing a 64-bit two's-complement
+ * integer value, which faithfully simulates the behavior of a Java "Timestamp". This
+ * implementation is derived from TimestampLib in GWT.
+ *
+ * Constructs a 64-bit two's-complement integer, given its low and high 32-bit
+ * values as *signed* integers. See the from* functions below for more
+ * convenient ways of constructing Timestamps.
+ *
+ * The internal representation of a Timestamp is the two given signed, 32-bit values.
+ * We use 32-bit pieces because these are the size of integers on which
+ * Javascript performs bit-operations. For operations like addition and
+ * multiplication, we split each number into 16-bit pieces, which can easily be
+ * multiplied within Javascript's floating-point representation without overflow
+ * or change in sign.
+ *
+ * In the algorithms below, we frequently reduce the negative case to the
+ * positive case by negating the input(s) and then post-processing the result.
+ * Note that we must ALWAYS check specially whether those values are MIN_VALUE
+ * (-2^63) because -MIN_VALUE == MIN_VALUE (since 2^63 cannot be represented as
+ * a positive number, it overflows back into a negative). Not handling this
+ * case would often result in infinite recursion.
+ *
+ * @class
+ * @param {number} low the low (signed) 32 bits of the Timestamp.
+ * @param {number} high the high (signed) 32 bits of the Timestamp.
+ */
+function Timestamp(low, high) {
+ if (!(this instanceof Timestamp)) return new Timestamp(low, high);
+ this._bsontype = 'Timestamp';
+ /**
+ * @type {number}
+ * @ignore
+ */
+ this.low_ = low | 0; // force into 32 signed bits.
+
+ /**
+ * @type {number}
+ * @ignore
+ */
+ this.high_ = high | 0; // force into 32 signed bits.
+}
+
+/**
+ * Return the int value.
+ *
+ * @return {number} the value, assuming it is a 32-bit integer.
+ */
+Timestamp.prototype.toInt = function() {
+ return this.low_;
+};
+
+/**
+ * Return the Number value.
+ *
+ * @method
+ * @return {number} the closest floating-point representation to this value.
+ */
+Timestamp.prototype.toNumber = function() {
+ return this.high_ * Timestamp.TWO_PWR_32_DBL_ + this.getLowBitsUnsigned();
+};
+
+/**
+ * Return the JSON value.
+ *
+ * @method
+ * @return {string} the JSON representation.
+ */
+Timestamp.prototype.toJSON = function() {
+ return this.toString();
+};
+
+/**
+ * Return the String value.
+ *
+ * @method
+ * @param {number} [opt_radix] the radix in which the text should be written.
+ * @return {string} the textual representation of this value.
+ */
+Timestamp.prototype.toString = function(opt_radix) {
+ var radix = opt_radix || 10;
+ if (radix < 2 || 36 < radix) {
+ throw Error('radix out of range: ' + radix);
+ }
+
+ if (this.isZero()) {
+ return '0';
+ }
+
+ if (this.isNegative()) {
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ // We need to change the Timestamp value before it can be negated, so we remove
+ // the bottom-most digit in this base and then recurse to do the rest.
+ var radixTimestamp = Timestamp.fromNumber(radix);
+ var div = this.div(radixTimestamp);
+ var rem = div.multiply(radixTimestamp).subtract(this);
+ return div.toString(radix) + rem.toInt().toString(radix);
+ } else {
+ return '-' + this.negate().toString(radix);
+ }
+ }
+
+ // Do several (6) digits each time through the loop, so as to
+ // minimize the calls to the very expensive emulated div.
+ var radixToPower = Timestamp.fromNumber(Math.pow(radix, 6));
+
+ rem = this;
+ var result = '';
+
+ while (!rem.isZero()) {
+ var remDiv = rem.div(radixToPower);
+ var intval = rem.subtract(remDiv.multiply(radixToPower)).toInt();
+ var digits = intval.toString(radix);
+
+ rem = remDiv;
+ if (rem.isZero()) {
+ return digits + result;
+ } else {
+ while (digits.length < 6) {
+ digits = '0' + digits;
+ }
+ result = '' + digits + result;
+ }
+ }
+};
+
+/**
+ * Return the high 32-bits value.
+ *
+ * @method
+ * @return {number} the high 32-bits as a signed value.
+ */
+Timestamp.prototype.getHighBits = function() {
+ return this.high_;
+};
+
+/**
+ * Return the low 32-bits value.
+ *
+ * @method
+ * @return {number} the low 32-bits as a signed value.
+ */
+Timestamp.prototype.getLowBits = function() {
+ return this.low_;
+};
+
+/**
+ * Return the low unsigned 32-bits value.
+ *
+ * @method
+ * @return {number} the low 32-bits as an unsigned value.
+ */
+Timestamp.prototype.getLowBitsUnsigned = function() {
+ return this.low_ >= 0 ? this.low_ : Timestamp.TWO_PWR_32_DBL_ + this.low_;
+};
+
+/**
+ * Returns the number of bits needed to represent the absolute value of this Timestamp.
+ *
+ * @method
+ * @return {number} Returns the number of bits needed to represent the absolute value of this Timestamp.
+ */
+Timestamp.prototype.getNumBitsAbs = function() {
+ if (this.isNegative()) {
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ return 64;
+ } else {
+ return this.negate().getNumBitsAbs();
+ }
+ } else {
+ var val = this.high_ !== 0 ? this.high_ : this.low_;
+ for (var bit = 31; bit > 0; bit--) {
+ if ((val & (1 << bit)) !== 0) {
+ break;
+ }
+ }
+ return this.high_ !== 0 ? bit + 33 : bit + 1;
+ }
+};
+
+/**
+ * Return whether this value is zero.
+ *
+ * @method
+ * @return {boolean} whether this value is zero.
+ */
+Timestamp.prototype.isZero = function() {
+ return this.high_ === 0 && this.low_ === 0;
+};
+
+/**
+ * Return whether this value is negative.
+ *
+ * @method
+ * @return {boolean} whether this value is negative.
+ */
+Timestamp.prototype.isNegative = function() {
+ return this.high_ < 0;
+};
+
+/**
+ * Return whether this value is odd.
+ *
+ * @method
+ * @return {boolean} whether this value is odd.
+ */
+Timestamp.prototype.isOdd = function() {
+ return (this.low_ & 1) === 1;
+};
+
+/**
+ * Return whether this Timestamp equals the other
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp equals the other
+ */
+Timestamp.prototype.equals = function(other) {
+ return this.high_ === other.high_ && this.low_ === other.low_;
+};
+
+/**
+ * Return whether this Timestamp does not equal the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp does not equal the other.
+ */
+Timestamp.prototype.notEquals = function(other) {
+ return this.high_ !== other.high_ || this.low_ !== other.low_;
+};
+
+/**
+ * Return whether this Timestamp is less than the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp is less than the other.
+ */
+Timestamp.prototype.lessThan = function(other) {
+ return this.compare(other) < 0;
+};
+
+/**
+ * Return whether this Timestamp is less than or equal to the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp is less than or equal to the other.
+ */
+Timestamp.prototype.lessThanOrEqual = function(other) {
+ return this.compare(other) <= 0;
+};
+
+/**
+ * Return whether this Timestamp is greater than the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp is greater than the other.
+ */
+Timestamp.prototype.greaterThan = function(other) {
+ return this.compare(other) > 0;
+};
+
+/**
+ * Return whether this Timestamp is greater than or equal to the other.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} whether this Timestamp is greater than or equal to the other.
+ */
+Timestamp.prototype.greaterThanOrEqual = function(other) {
+ return this.compare(other) >= 0;
+};
+
+/**
+ * Compares this Timestamp with the given one.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to compare against.
+ * @return {boolean} 0 if they are the same, 1 if the this is greater, and -1 if the given one is greater.
+ */
+Timestamp.prototype.compare = function(other) {
+ if (this.equals(other)) {
+ return 0;
+ }
+
+ var thisNeg = this.isNegative();
+ var otherNeg = other.isNegative();
+ if (thisNeg && !otherNeg) {
+ return -1;
+ }
+ if (!thisNeg && otherNeg) {
+ return 1;
+ }
+
+ // at this point, the signs are the same, so subtraction will not overflow
+ if (this.subtract(other).isNegative()) {
+ return -1;
+ } else {
+ return 1;
+ }
+};
+
+/**
+ * The negation of this value.
+ *
+ * @method
+ * @return {Timestamp} the negation of this value.
+ */
+Timestamp.prototype.negate = function() {
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ return Timestamp.MIN_VALUE;
+ } else {
+ return this.not().add(Timestamp.ONE);
+ }
+};
+
+/**
+ * Returns the sum of this and the given Timestamp.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to add to this one.
+ * @return {Timestamp} the sum of this and the given Timestamp.
+ */
+Timestamp.prototype.add = function(other) {
+ // Divide each number into 4 chunks of 16 bits, and then sum the chunks.
+
+ var a48 = this.high_ >>> 16;
+ var a32 = this.high_ & 0xffff;
+ var a16 = this.low_ >>> 16;
+ var a00 = this.low_ & 0xffff;
+
+ var b48 = other.high_ >>> 16;
+ var b32 = other.high_ & 0xffff;
+ var b16 = other.low_ >>> 16;
+ var b00 = other.low_ & 0xffff;
+
+ var c48 = 0,
+ c32 = 0,
+ c16 = 0,
+ c00 = 0;
+ c00 += a00 + b00;
+ c16 += c00 >>> 16;
+ c00 &= 0xffff;
+ c16 += a16 + b16;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c32 += a32 + b32;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c48 += a48 + b48;
+ c48 &= 0xffff;
+ return Timestamp.fromBits((c16 << 16) | c00, (c48 << 16) | c32);
+};
+
+/**
+ * Returns the difference of this and the given Timestamp.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to subtract from this.
+ * @return {Timestamp} the difference of this and the given Timestamp.
+ */
+Timestamp.prototype.subtract = function(other) {
+ return this.add(other.negate());
+};
+
+/**
+ * Returns the product of this and the given Timestamp.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp to multiply with this.
+ * @return {Timestamp} the product of this and the other.
+ */
+Timestamp.prototype.multiply = function(other) {
+ if (this.isZero()) {
+ return Timestamp.ZERO;
+ } else if (other.isZero()) {
+ return Timestamp.ZERO;
+ }
+
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ return other.isOdd() ? Timestamp.MIN_VALUE : Timestamp.ZERO;
+ } else if (other.equals(Timestamp.MIN_VALUE)) {
+ return this.isOdd() ? Timestamp.MIN_VALUE : Timestamp.ZERO;
+ }
+
+ if (this.isNegative()) {
+ if (other.isNegative()) {
+ return this.negate().multiply(other.negate());
+ } else {
+ return this.negate()
+ .multiply(other)
+ .negate();
+ }
+ } else if (other.isNegative()) {
+ return this.multiply(other.negate()).negate();
+ }
+
+ // If both Timestamps are small, use float multiplication
+ if (this.lessThan(Timestamp.TWO_PWR_24_) && other.lessThan(Timestamp.TWO_PWR_24_)) {
+ return Timestamp.fromNumber(this.toNumber() * other.toNumber());
+ }
+
+ // Divide each Timestamp into 4 chunks of 16 bits, and then add up 4x4 products.
+ // We can skip products that would overflow.
+
+ var a48 = this.high_ >>> 16;
+ var a32 = this.high_ & 0xffff;
+ var a16 = this.low_ >>> 16;
+ var a00 = this.low_ & 0xffff;
+
+ var b48 = other.high_ >>> 16;
+ var b32 = other.high_ & 0xffff;
+ var b16 = other.low_ >>> 16;
+ var b00 = other.low_ & 0xffff;
+
+ var c48 = 0,
+ c32 = 0,
+ c16 = 0,
+ c00 = 0;
+ c00 += a00 * b00;
+ c16 += c00 >>> 16;
+ c00 &= 0xffff;
+ c16 += a16 * b00;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c16 += a00 * b16;
+ c32 += c16 >>> 16;
+ c16 &= 0xffff;
+ c32 += a32 * b00;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c32 += a16 * b16;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c32 += a00 * b32;
+ c48 += c32 >>> 16;
+ c32 &= 0xffff;
+ c48 += a48 * b00 + a32 * b16 + a16 * b32 + a00 * b48;
+ c48 &= 0xffff;
+ return Timestamp.fromBits((c16 << 16) | c00, (c48 << 16) | c32);
+};
+
+/**
+ * Returns this Timestamp divided by the given one.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp by which to divide.
+ * @return {Timestamp} this Timestamp divided by the given one.
+ */
+Timestamp.prototype.div = function(other) {
+ if (other.isZero()) {
+ throw Error('division by zero');
+ } else if (this.isZero()) {
+ return Timestamp.ZERO;
+ }
+
+ if (this.equals(Timestamp.MIN_VALUE)) {
+ if (other.equals(Timestamp.ONE) || other.equals(Timestamp.NEG_ONE)) {
+ return Timestamp.MIN_VALUE; // recall that -MIN_VALUE == MIN_VALUE
+ } else if (other.equals(Timestamp.MIN_VALUE)) {
+ return Timestamp.ONE;
+ } else {
+ // At this point, we have |other| >= 2, so |this/other| < |MIN_VALUE|.
+ var halfThis = this.shiftRight(1);
+ var approx = halfThis.div(other).shiftLeft(1);
+ if (approx.equals(Timestamp.ZERO)) {
+ return other.isNegative() ? Timestamp.ONE : Timestamp.NEG_ONE;
+ } else {
+ var rem = this.subtract(other.multiply(approx));
+ var result = approx.add(rem.div(other));
+ return result;
+ }
+ }
+ } else if (other.equals(Timestamp.MIN_VALUE)) {
+ return Timestamp.ZERO;
+ }
+
+ if (this.isNegative()) {
+ if (other.isNegative()) {
+ return this.negate().div(other.negate());
+ } else {
+ return this.negate()
+ .div(other)
+ .negate();
+ }
+ } else if (other.isNegative()) {
+ return this.div(other.negate()).negate();
+ }
+
+ // Repeat the following until the remainder is less than other: find a
+ // floating-point that approximates remainder / other *from below*, add this
+ // into the result, and subtract it from the remainder. It is critical that
+ // the approximate value is less than or equal to the real value so that the
+ // remainder never becomes negative.
+ var res = Timestamp.ZERO;
+ rem = this;
+ while (rem.greaterThanOrEqual(other)) {
+ // Approximate the result of division. This may be a little greater or
+ // smaller than the actual value.
+ approx = Math.max(1, Math.floor(rem.toNumber() / other.toNumber()));
+
+ // We will tweak the approximate result by changing it in the 48-th digit or
+ // the smallest non-fractional digit, whichever is larger.
+ var log2 = Math.ceil(Math.log(approx) / Math.LN2);
+ var delta = log2 <= 48 ? 1 : Math.pow(2, log2 - 48);
+
+ // Decrease the approximation until it is smaller than the remainder. Note
+ // that if it is too large, the product overflows and is negative.
+ var approxRes = Timestamp.fromNumber(approx);
+ var approxRem = approxRes.multiply(other);
+ while (approxRem.isNegative() || approxRem.greaterThan(rem)) {
+ approx -= delta;
+ approxRes = Timestamp.fromNumber(approx);
+ approxRem = approxRes.multiply(other);
+ }
+
+ // We know the answer can't be zero... and actually, zero would cause
+ // infinite recursion since we would make no progress.
+ if (approxRes.isZero()) {
+ approxRes = Timestamp.ONE;
+ }
+
+ res = res.add(approxRes);
+ rem = rem.subtract(approxRem);
+ }
+ return res;
+};
+
+/**
+ * Returns this Timestamp modulo the given one.
+ *
+ * @method
+ * @param {Timestamp} other Timestamp by which to mod.
+ * @return {Timestamp} this Timestamp modulo the given one.
+ */
+Timestamp.prototype.modulo = function(other) {
+ return this.subtract(this.div(other).multiply(other));
+};
+
+/**
+ * The bitwise-NOT of this value.
+ *
+ * @method
+ * @return {Timestamp} the bitwise-NOT of this value.
+ */
+Timestamp.prototype.not = function() {
+ return Timestamp.fromBits(~this.low_, ~this.high_);
+};
+
+/**
+ * Returns the bitwise-AND of this Timestamp and the given one.
+ *
+ * @method
+ * @param {Timestamp} other the Timestamp with which to AND.
+ * @return {Timestamp} the bitwise-AND of this and the other.
+ */
+Timestamp.prototype.and = function(other) {
+ return Timestamp.fromBits(this.low_ & other.low_, this.high_ & other.high_);
+};
+
+/**
+ * Returns the bitwise-OR of this Timestamp and the given one.
+ *
+ * @method
+ * @param {Timestamp} other the Timestamp with which to OR.
+ * @return {Timestamp} the bitwise-OR of this and the other.
+ */
+Timestamp.prototype.or = function(other) {
+ return Timestamp.fromBits(this.low_ | other.low_, this.high_ | other.high_);
+};
+
+/**
+ * Returns the bitwise-XOR of this Timestamp and the given one.
+ *
+ * @method
+ * @param {Timestamp} other the Timestamp with which to XOR.
+ * @return {Timestamp} the bitwise-XOR of this and the other.
+ */
+Timestamp.prototype.xor = function(other) {
+ return Timestamp.fromBits(this.low_ ^ other.low_, this.high_ ^ other.high_);
+};
+
+/**
+ * Returns this Timestamp with bits shifted to the left by the given amount.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Timestamp} this shifted to the left by the given amount.
+ */
+Timestamp.prototype.shiftLeft = function(numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var low = this.low_;
+ if (numBits < 32) {
+ var high = this.high_;
+ return Timestamp.fromBits(low << numBits, (high << numBits) | (low >>> (32 - numBits)));
+ } else {
+ return Timestamp.fromBits(0, low << (numBits - 32));
+ }
+ }
+};
+
+/**
+ * Returns this Timestamp with bits shifted to the right by the given amount.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Timestamp} this shifted to the right by the given amount.
+ */
+Timestamp.prototype.shiftRight = function(numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var high = this.high_;
+ if (numBits < 32) {
+ var low = this.low_;
+ return Timestamp.fromBits((low >>> numBits) | (high << (32 - numBits)), high >> numBits);
+ } else {
+ return Timestamp.fromBits(high >> (numBits - 32), high >= 0 ? 0 : -1);
+ }
+ }
+};
+
+/**
+ * Returns this Timestamp with bits shifted to the right by the given amount, with the new top bits matching the current sign bit.
+ *
+ * @method
+ * @param {number} numBits the number of bits by which to shift.
+ * @return {Timestamp} this shifted to the right by the given amount, with zeros placed into the new leading bits.
+ */
+Timestamp.prototype.shiftRightUnsigned = function(numBits) {
+ numBits &= 63;
+ if (numBits === 0) {
+ return this;
+ } else {
+ var high = this.high_;
+ if (numBits < 32) {
+ var low = this.low_;
+ return Timestamp.fromBits((low >>> numBits) | (high << (32 - numBits)), high >>> numBits);
+ } else if (numBits === 32) {
+ return Timestamp.fromBits(high, 0);
+ } else {
+ return Timestamp.fromBits(high >>> (numBits - 32), 0);
+ }
+ }
+};
+
+/**
+ * Returns a Timestamp representing the given (32-bit) integer value.
+ *
+ * @method
+ * @param {number} value the 32-bit integer in question.
+ * @return {Timestamp} the corresponding Timestamp value.
+ */
+Timestamp.fromInt = function(value) {
+ if (-128 <= value && value < 128) {
+ var cachedObj = Timestamp.INT_CACHE_[value];
+ if (cachedObj) {
+ return cachedObj;
+ }
+ }
+
+ var obj = new Timestamp(value | 0, value < 0 ? -1 : 0);
+ if (-128 <= value && value < 128) {
+ Timestamp.INT_CACHE_[value] = obj;
+ }
+ return obj;
+};
+
+/**
+ * Returns a Timestamp representing the given value, provided that it is a finite number. Otherwise, zero is returned.
+ *
+ * @method
+ * @param {number} value the number in question.
+ * @return {Timestamp} the corresponding Timestamp value.
+ */
+Timestamp.fromNumber = function(value) {
+ if (isNaN(value) || !isFinite(value)) {
+ return Timestamp.ZERO;
+ } else if (value <= -Timestamp.TWO_PWR_63_DBL_) {
+ return Timestamp.MIN_VALUE;
+ } else if (value + 1 >= Timestamp.TWO_PWR_63_DBL_) {
+ return Timestamp.MAX_VALUE;
+ } else if (value < 0) {
+ return Timestamp.fromNumber(-value).negate();
+ } else {
+ return new Timestamp(
+ (value % Timestamp.TWO_PWR_32_DBL_) | 0,
+ (value / Timestamp.TWO_PWR_32_DBL_) | 0
+ );
+ }
+};
+
+/**
+ * Returns a Timestamp representing the 64-bit integer that comes by concatenating the given high and low bits. Each is assumed to use 32 bits.
+ *
+ * @method
+ * @param {number} lowBits the low 32-bits.
+ * @param {number} highBits the high 32-bits.
+ * @return {Timestamp} the corresponding Timestamp value.
+ */
+Timestamp.fromBits = function(lowBits, highBits) {
+ return new Timestamp(lowBits, highBits);
+};
+
+/**
+ * Returns a Timestamp representation of the given string, written using the given radix.
+ *
+ * @method
+ * @param {string} str the textual representation of the Timestamp.
+ * @param {number} opt_radix the radix in which the text is written.
+ * @return {Timestamp} the corresponding Timestamp value.
+ */
+Timestamp.fromString = function(str, opt_radix) {
+ if (str.length === 0) {
+ throw Error('number format error: empty string');
+ }
+
+ var radix = opt_radix || 10;
+ if (radix < 2 || 36 < radix) {
+ throw Error('radix out of range: ' + radix);
+ }
+
+ if (str.charAt(0) === '-') {
+ return Timestamp.fromString(str.substring(1), radix).negate();
+ } else if (str.indexOf('-') >= 0) {
+ throw Error('number format error: interior "-" character: ' + str);
+ }
+
+ // Do several (8) digits each time through the loop, so as to
+ // minimize the calls to the very expensive emulated div.
+ var radixToPower = Timestamp.fromNumber(Math.pow(radix, 8));
+
+ var result = Timestamp.ZERO;
+ for (var i = 0; i < str.length; i += 8) {
+ var size = Math.min(8, str.length - i);
+ var value = parseInt(str.substring(i, i + size), radix);
+ if (size < 8) {
+ var power = Timestamp.fromNumber(Math.pow(radix, size));
+ result = result.multiply(power).add(Timestamp.fromNumber(value));
+ } else {
+ result = result.multiply(radixToPower);
+ result = result.add(Timestamp.fromNumber(value));
+ }
+ }
+ return result;
+};
+
+// NOTE: Common constant values ZERO, ONE, NEG_ONE, etc. are defined below the
+// from* methods on which they depend.
+
+/**
+ * A cache of the Timestamp representations of small integer values.
+ * @type {Object}
+ * @ignore
+ */
+Timestamp.INT_CACHE_ = {};
+
+// NOTE: the compiler should inline these constant values below and then remove
+// these variables, so there should be no runtime penalty for these.
+
+/**
+ * Number used repeated below in calculations. This must appear before the
+ * first call to any from* function below.
+ * @type {number}
+ * @ignore
+ */
+Timestamp.TWO_PWR_16_DBL_ = 1 << 16;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Timestamp.TWO_PWR_24_DBL_ = 1 << 24;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Timestamp.TWO_PWR_32_DBL_ = Timestamp.TWO_PWR_16_DBL_ * Timestamp.TWO_PWR_16_DBL_;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Timestamp.TWO_PWR_31_DBL_ = Timestamp.TWO_PWR_32_DBL_ / 2;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Timestamp.TWO_PWR_48_DBL_ = Timestamp.TWO_PWR_32_DBL_ * Timestamp.TWO_PWR_16_DBL_;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Timestamp.TWO_PWR_64_DBL_ = Timestamp.TWO_PWR_32_DBL_ * Timestamp.TWO_PWR_32_DBL_;
+
+/**
+ * @type {number}
+ * @ignore
+ */
+Timestamp.TWO_PWR_63_DBL_ = Timestamp.TWO_PWR_64_DBL_ / 2;
+
+/** @type {Timestamp} */
+Timestamp.ZERO = Timestamp.fromInt(0);
+
+/** @type {Timestamp} */
+Timestamp.ONE = Timestamp.fromInt(1);
+
+/** @type {Timestamp} */
+Timestamp.NEG_ONE = Timestamp.fromInt(-1);
+
+/** @type {Timestamp} */
+Timestamp.MAX_VALUE = Timestamp.fromBits(0xffffffff | 0, 0x7fffffff | 0);
+
+/** @type {Timestamp} */
+Timestamp.MIN_VALUE = Timestamp.fromBits(0, 0x80000000 | 0);
+
+/**
+ * @type {Timestamp}
+ * @ignore
+ */
+Timestamp.TWO_PWR_24_ = Timestamp.fromInt(1 << 24);
+
+/**
+ * Expose.
+ */
+module.exports = Timestamp;
+module.exports.Timestamp = Timestamp;
diff --git a/Restaurant/node_modules/bson/package.json b/Restaurant/node_modules/bson/package.json
new file mode 100644
index 0000000..8ddc10e
--- /dev/null
+++ b/Restaurant/node_modules/bson/package.json
@@ -0,0 +1,87 @@
+{
+ "_from": "bson@^1.1.1",
+ "_id": "bson@1.1.3",
+ "_inBundle": false,
+ "_integrity": "sha512-TdiJxMVnodVS7r0BdL42y/pqC9cL2iKynVwA0Ho3qbsQYr428veL3l7BQyuqiw+Q5SqqoT0m4srSY/BlZ9AxXg==",
+ "_location": "/bson",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "bson@^1.1.1",
+ "name": "bson",
+ "escapedName": "bson",
+ "rawSpec": "^1.1.1",
+ "saveSpec": null,
+ "fetchSpec": "^1.1.1"
+ },
+ "_requiredBy": [
+ "/mongodb"
+ ],
+ "_resolved": "https://registry.npmjs.org/bson/-/bson-1.1.3.tgz",
+ "_shasum": "aa82cb91f9a453aaa060d6209d0675114a8154d3",
+ "_spec": "bson@^1.1.1",
+ "_where": "F:\\Restaurant\\node_modules\\mongodb",
+ "author": {
+ "name": "Christian Amor Kvalheim",
+ "email": "christkv@gmail.com"
+ },
+ "browser": "lib/bson/bson.js",
+ "bugs": {
+ "url": "https://github.com/mongodb/js-bson/issues"
+ },
+ "bundleDependencies": false,
+ "config": {
+ "native": false
+ },
+ "contributors": [],
+ "deprecated": false,
+ "description": "A bson parser for node.js and the browser",
+ "devDependencies": {
+ "babel-core": "^6.14.0",
+ "babel-loader": "^6.2.5",
+ "babel-polyfill": "^6.13.0",
+ "babel-preset-es2015": "^6.14.0",
+ "babel-preset-stage-0": "^6.5.0",
+ "babel-register": "^6.14.0",
+ "benchmark": "1.0.0",
+ "colors": "1.1.0",
+ "conventional-changelog-cli": "^1.3.5",
+ "nodeunit": "0.9.0",
+ "webpack": "^1.13.2",
+ "webpack-polyfills-plugin": "0.0.9"
+ },
+ "directories": {
+ "lib": "./lib/bson"
+ },
+ "engines": {
+ "node": ">=0.6.19"
+ },
+ "files": [
+ "lib",
+ "index.js",
+ "browser_build",
+ "bower.json"
+ ],
+ "homepage": "https://github.com/mongodb/js-bson#readme",
+ "keywords": [
+ "mongodb",
+ "bson",
+ "parser"
+ ],
+ "license": "Apache-2.0",
+ "main": "./index",
+ "name": "bson",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/mongodb/js-bson.git"
+ },
+ "scripts": {
+ "build": "webpack --config ./webpack.dist.config.js",
+ "changelog": "conventional-changelog -p angular -i HISTORY.md -s",
+ "format": "prettier --print-width 100 --tab-width 2 --single-quote --write 'test/**/*.js' 'lib/**/*.js'",
+ "lint": "eslint lib test",
+ "test": "nodeunit ./test/node"
+ },
+ "version": "1.1.3"
+}
diff --git a/Restaurant/node_modules/bytes/History.md b/Restaurant/node_modules/bytes/History.md
new file mode 100644
index 0000000..cf6a5bb
--- /dev/null
+++ b/Restaurant/node_modules/bytes/History.md
@@ -0,0 +1,87 @@
+3.1.0 / 2019-01-22
+==================
+
+ * Add petabyte (`pb`) support
+
+3.0.0 / 2017-08-31
+==================
+
+ * Change "kB" to "KB" in format output
+ * Remove support for Node.js 0.6
+ * Remove support for ComponentJS
+
+2.5.0 / 2017-03-24
+==================
+
+ * Add option "unit"
+
+2.4.0 / 2016-06-01
+==================
+
+ * Add option "unitSeparator"
+
+2.3.0 / 2016-02-15
+==================
+
+ * Drop partial bytes on all parsed units
+ * Fix non-finite numbers to `.format` to return `null`
+ * Fix parsing byte string that looks like hex
+ * perf: hoist regular expressions
+
+2.2.0 / 2015-11-13
+==================
+
+ * add option "decimalPlaces"
+ * add option "fixedDecimals"
+
+2.1.0 / 2015-05-21
+==================
+
+ * add `.format` export
+ * add `.parse` export
+
+2.0.2 / 2015-05-20
+==================
+
+ * remove map recreation
+ * remove unnecessary object construction
+
+2.0.1 / 2015-05-07
+==================
+
+ * fix browserify require
+ * remove node.extend dependency
+
+2.0.0 / 2015-04-12
+==================
+
+ * add option "case"
+ * add option "thousandsSeparator"
+ * return "null" on invalid parse input
+ * support proper round-trip: bytes(bytes(num)) === num
+ * units no longer case sensitive when parsing
+
+1.0.0 / 2014-05-05
+==================
+
+ * add negative support. fixes #6
+
+0.3.0 / 2014-03-19
+==================
+
+ * added terabyte support
+
+0.2.1 / 2013-04-01
+==================
+
+ * add .component
+
+0.2.0 / 2012-10-28
+==================
+
+ * bytes(200).should.eql('200b')
+
+0.1.0 / 2012-07-04
+==================
+
+ * add bytes to string conversion [yields]
diff --git a/Restaurant/node_modules/bytes/LICENSE b/Restaurant/node_modules/bytes/LICENSE
new file mode 100644
index 0000000..63e95a9
--- /dev/null
+++ b/Restaurant/node_modules/bytes/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 TJ Holowaychuk
+Copyright (c) 2015 Jed Watson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/Restaurant/node_modules/bytes/Readme.md b/Restaurant/node_modules/bytes/Readme.md
new file mode 100644
index 0000000..6ad1ec6
--- /dev/null
+++ b/Restaurant/node_modules/bytes/Readme.md
@@ -0,0 +1,126 @@
+# Bytes utility
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```bash
+$ npm install bytes
+```
+
+## Usage
+
+```js
+var bytes = require('bytes');
+```
+
+#### bytes.format(number value, [options]): string｜null
+
+Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is
+ rounded.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number` | Value in bytes |
+| options | `Object` | Conversion options |
+
+**Options**
+
+| Property | Type | Description |
+|-------------------|--------|-----------------------------------------------------------------------------------------|
+| decimalPlaces | `number`｜`null` | Maximum number of decimal places to include in output. Default value to `2`. |
+| fixedDecimals | `boolean`｜`null` | Whether to always display the maximum number of decimal places. Default value to `false` |
+| thousandsSeparator | `string`｜`null` | Example of values: `' '`, `','` and `.`... Default value to `''`. |
+| unit | `string`｜`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). |
+| unitSeparator | `string`｜`null` | Separator to use between number and unit. Default value to `''`. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`｜`null` | Return null upon error. String value otherwise. |
+
+**Example**
+
+```js
+bytes(1024);
+// output: '1KB'
+
+bytes(1000);
+// output: '1000B'
+
+bytes(1000, {thousandsSeparator: ' '});
+// output: '1 000B'
+
+bytes(1024 * 1.7, {decimalPlaces: 0});
+// output: '2KB'
+
+bytes(1024, {unitSeparator: ' '});
+// output: '1 KB'
+
+```
+
+#### bytes.parse(string｜number value): number｜null
+
+Parse the string value into an integer in bytes. If no unit is given, or `value`
+is a number, it is assumed the value is in bytes.
+
+Supported units and abbreviations are as follows and are case-insensitive:
+
+ * `b` for bytes
+ * `kb` for kilobytes
+ * `mb` for megabytes
+ * `gb` for gigabytes
+ * `tb` for terabytes
+ * `pb` for petabytes
+
+The units are in powers of two, not ten. This means 1kb = 1024b according to this parser.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------------|--------|--------------------|
+| value | `string`｜`number` | String to parse, or number in bytes. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|-------------|-------------------------|
+| results | `number`｜`null` | Return null upon error. Value in bytes otherwise. |
+
+**Example**
+
+```js
+bytes('1KB');
+// output: 1024
+
+bytes('1024');
+// output: 1024
+
+bytes(1024);
+// output: 1KB
+```
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master
+[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master
+[downloads-image]: https://badgen.net/npm/dm/bytes
+[downloads-url]: https://npmjs.org/package/bytes
+[npm-image]: https://badgen.net/npm/node/bytes
+[npm-url]: https://npmjs.org/package/bytes
+[travis-image]: https://badgen.net/travis/visionmedia/bytes.js/master
+[travis-url]: https://travis-ci.org/visionmedia/bytes.js
diff --git a/Restaurant/node_modules/bytes/index.js b/Restaurant/node_modules/bytes/index.js
new file mode 100644
index 0000000..4975bfb
--- /dev/null
+++ b/Restaurant/node_modules/bytes/index.js
@@ -0,0 +1,162 @@
+/*!
+ * bytes
+ * Copyright(c) 2012-2014 TJ Holowaychuk
+ * Copyright(c) 2015 Jed Watson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = bytes;
+module.exports.format = format;
+module.exports.parse = parse;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g;
+
+var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/;
+
+var map = {
+ b: 1,
+ kb: 1 << 10,
+ mb: 1 << 20,
+ gb: 1 << 30,
+ tb: Math.pow(1024, 4),
+ pb: Math.pow(1024, 5),
+};
+
+var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i;
+
+/**
+ * Convert the given value in bytes into a string or parse to string to an integer in bytes.
+ *
+ * @param {string|number} value
+ * @param {{
+ * case: [string],
+ * decimalPlaces: [number]
+ * fixedDecimals: [boolean]
+ * thousandsSeparator: [string]
+ * unitSeparator: [string]
+ * }} [options] bytes options.
+ *
+ * @returns {string|number|null}
+ */
+
+function bytes(value, options) {
+ if (typeof value === 'string') {
+ return parse(value);
+ }
+
+ if (typeof value === 'number') {
+ return format(value, options);
+ }
+
+ return null;
+}
+
+/**
+ * Format the given value in bytes into a string.
+ *
+ * If the value is negative, it is kept as such. If it is a float,
+ * it is rounded.
+ *
+ * @param {number} value
+ * @param {object} [options]
+ * @param {number} [options.decimalPlaces=2]
+ * @param {number} [options.fixedDecimals=false]
+ * @param {string} [options.thousandsSeparator=]
+ * @param {string} [options.unit=]
+ * @param {string} [options.unitSeparator=]
+ *
+ * @returns {string|null}
+ * @public
+ */
+
+function format(value, options) {
+ if (!Number.isFinite(value)) {
+ return null;
+ }
+
+ var mag = Math.abs(value);
+ var thousandsSeparator = (options && options.thousandsSeparator) || '';
+ var unitSeparator = (options && options.unitSeparator) || '';
+ var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2;
+ var fixedDecimals = Boolean(options && options.fixedDecimals);
+ var unit = (options && options.unit) || '';
+
+ if (!unit || !map[unit.toLowerCase()]) {
+ if (mag >= map.pb) {
+ unit = 'PB';
+ } else if (mag >= map.tb) {
+ unit = 'TB';
+ } else if (mag >= map.gb) {
+ unit = 'GB';
+ } else if (mag >= map.mb) {
+ unit = 'MB';
+ } else if (mag >= map.kb) {
+ unit = 'KB';
+ } else {
+ unit = 'B';
+ }
+ }
+
+ var val = value / map[unit.toLowerCase()];
+ var str = val.toFixed(decimalPlaces);
+
+ if (!fixedDecimals) {
+ str = str.replace(formatDecimalsRegExp, '$1');
+ }
+
+ if (thousandsSeparator) {
+ str = str.replace(formatThousandsRegExp, thousandsSeparator);
+ }
+
+ return str + unitSeparator + unit;
+}
+
+/**
+ * Parse the string value into an integer in bytes.
+ *
+ * If no unit is given, it is assumed the value is in bytes.
+ *
+ * @param {number|string} val
+ *
+ * @returns {number|null}
+ * @public
+ */
+
+function parse(val) {
+ if (typeof val === 'number' && !isNaN(val)) {
+ return val;
+ }
+
+ if (typeof val !== 'string') {
+ return null;
+ }
+
+ // Test if the string passed is valid
+ var results = parseRegExp.exec(val);
+ var floatValue;
+ var unit = 'b';
+
+ if (!results) {
+ // Nothing could be extracted from the given string
+ floatValue = parseInt(val, 10);
+ unit = 'b'
+ } else {
+ // Retrieve the value and the unit
+ floatValue = parseFloat(results[1]);
+ unit = results[4].toLowerCase();
+ }
+
+ return Math.floor(map[unit] * floatValue);
+}
diff --git a/Restaurant/node_modules/bytes/package.json b/Restaurant/node_modules/bytes/package.json
new file mode 100644
index 0000000..892d6f4
--- /dev/null
+++ b/Restaurant/node_modules/bytes/package.json
@@ -0,0 +1,84 @@
+{
+ "_from": "bytes@3.1.0",
+ "_id": "bytes@3.1.0",
+ "_inBundle": false,
+ "_integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==",
+ "_location": "/bytes",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "bytes@3.1.0",
+ "name": "bytes",
+ "escapedName": "bytes",
+ "rawSpec": "3.1.0",
+ "saveSpec": null,
+ "fetchSpec": "3.1.0"
+ },
+ "_requiredBy": [
+ "/body-parser",
+ "/raw-body"
+ ],
+ "_resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz",
+ "_shasum": "f6cf7933a360e0588fa9fde85651cdc7f805d1f6",
+ "_spec": "bytes@3.1.0",
+ "_where": "F:\\Restaurant\\node_modules\\body-parser",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca",
+ "url": "http://tjholowaychuk.com"
+ },
+ "bugs": {
+ "url": "https://github.com/visionmedia/bytes.js/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Jed Watson",
+ "email": "jed.watson@me.com"
+ },
+ {
+ "name": "Théo FIDRY",
+ "email": "theo.fidry@gmail.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "Utility to parse a string bytes to bytes and vice-versa",
+ "devDependencies": {
+ "eslint": "5.12.1",
+ "mocha": "5.2.0",
+ "nyc": "13.1.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "files": [
+ "History.md",
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/visionmedia/bytes.js#readme",
+ "keywords": [
+ "byte",
+ "bytes",
+ "utility",
+ "parse",
+ "parser",
+ "convert",
+ "converter"
+ ],
+ "license": "MIT",
+ "name": "bytes",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/visionmedia/bytes.js.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --check-leaks --reporter spec",
+ "test-ci": "nyc --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "version": "3.1.0"
+}
diff --git a/Restaurant/node_modules/content-disposition/HISTORY.md b/Restaurant/node_modules/content-disposition/HISTORY.md
new file mode 100644
index 0000000..63a3d08
--- /dev/null
+++ b/Restaurant/node_modules/content-disposition/HISTORY.md
@@ -0,0 +1,55 @@
+0.5.3 / 2018-12-17
+==================
+
+ * Use `safe-buffer` for improved Buffer API
+
+0.5.2 / 2016-12-08
+==================
+
+ * Fix `parse` to accept any linear whitespace character
+
+0.5.1 / 2016-01-17
+==================
+
+ * perf: enable strict mode
+
+0.5.0 / 2014-10-11
+==================
+
+ * Add `parse` function
+
+0.4.0 / 2014-09-21
+==================
+
+ * Expand non-Unicode `filename` to the full ISO-8859-1 charset
+
+0.3.0 / 2014-09-20
+==================
+
+ * Add `fallback` option
+ * Add `type` option
+
+0.2.0 / 2014-09-19
+==================
+
+ * Reduce ambiguity of file names with hex escape in buggy browsers
+
+0.1.2 / 2014-09-19
+==================
+
+ * Fix periodic invalid Unicode filename header
+
+0.1.1 / 2014-09-19
+==================
+
+ * Fix invalid characters appearing in `filename*` parameter
+
+0.1.0 / 2014-09-18
+==================
+
+ * Make the `filename` argument optional
+
+0.0.0 / 2014-09-18
+==================
+
+ * Initial release
diff --git a/Restaurant/node_modules/content-disposition/LICENSE b/Restaurant/node_modules/content-disposition/LICENSE
new file mode 100644
index 0000000..84441fb
--- /dev/null
+++ b/Restaurant/node_modules/content-disposition/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/Restaurant/node_modules/content-disposition/README.md b/Restaurant/node_modules/content-disposition/README.md
new file mode 100644
index 0000000..eebef13
--- /dev/null
+++ b/Restaurant/node_modules/content-disposition/README.md
@@ -0,0 +1,148 @@
+# content-disposition
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create and parse HTTP `Content-Disposition` header
+
+## Installation
+
+```sh
+$ npm install content-disposition
+```
+
+## API
+
+
+
+```js
+var contentDisposition = require('content-disposition')
+```
+
+### contentDisposition(filename, options)
+
+Create an attachment `Content-Disposition` header value using the given file name,
+if supplied. The `filename` is optional and if no file name is desired, but you
+want to specify `options`, set `filename` to `undefined`.
+
+
+
+```js
+res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf'))
+```
+
+**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this
+header through a means different from `setHeader` in Node.js, you'll want to specify
+the `'binary'` encoding in Node.js.
+
+#### Options
+
+`contentDisposition` accepts these properties in the options object.
+
+##### fallback
+
+If the `filename` option is outside ISO-8859-1, then the file name is actually
+stored in a supplemental field for clients that support Unicode file names and
+a ISO-8859-1 version of the file name is automatically generated.
+
+This specifies the ISO-8859-1 file name to override the automatic generation or
+disables the generation all together, defaults to `true`.
+
+ - A string will specify the ISO-8859-1 file name to use in place of automatic
+ generation.
+ - `false` will disable including a ISO-8859-1 file name and only include the
+ Unicode version (unless the file name is already ISO-8859-1).
+ - `true` will enable automatic generation if the file name is outside ISO-8859-1.
+
+If the `filename` option is ISO-8859-1 and this option is specified and has a
+different value, then the `filename` option is encoded in the extended field
+and this set as the fallback field, even though they are both ISO-8859-1.
+
+##### type
+
+Specifies the disposition type, defaults to `"attachment"`. This can also be
+`"inline"`, or any other value (all values except inline are treated like
+`attachment`, but can convey additional information if both parties agree to
+it). The type is normalized to lower-case.
+
+### contentDisposition.parse(string)
+
+
+
+```js
+var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt')
+```
+
+Parse a `Content-Disposition` header string. This automatically handles extended
+("Unicode") parameters by decoding them and providing them under the standard
+parameter name. This will return an object with the following properties (examples
+are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`):
+
+ - `type`: The disposition type (always lower case). Example: `'attachment'`
+
+ - `parameters`: An object of the parameters in the disposition (name of parameter
+ always lower case and extended versions replace non-extended versions). Example:
+ `{filename: "€ rates.txt"}`
+
+## Examples
+
+### Send a file for download
+
+```js
+var contentDisposition = require('content-disposition')
+var destroy = require('destroy')
+var fs = require('fs')
+var http = require('http')
+var onFinished = require('on-finished')
+
+var filePath = '/path/to/public/plans.pdf'
+
+http.createServer(function onRequest (req, res) {
+ // set headers
+ res.setHeader('Content-Type', 'application/pdf')
+ res.setHeader('Content-Disposition', contentDisposition(filePath))
+
+ // send file
+ var stream = fs.createReadStream(filePath)
+ stream.pipe(res)
+ onFinished(res, function () {
+ destroy(stream)
+ })
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## References
+
+- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616]
+- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987]
+- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266]
+- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231]
+
+[rfc-2616]: https://tools.ietf.org/html/rfc2616
+[rfc-5987]: https://tools.ietf.org/html/rfc5987
+[rfc-6266]: https://tools.ietf.org/html/rfc6266
+[tc-2231]: http://greenbytes.de/tech/tc2231/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/content-disposition.svg
+[npm-url]: https://npmjs.org/package/content-disposition
+[node-version-image]: https://img.shields.io/node/v/content-disposition.svg
+[node-version-url]: https://nodejs.org/en/download
+[travis-image]: https://img.shields.io/travis/jshttp/content-disposition.svg
+[travis-url]: https://travis-ci.org/jshttp/content-disposition
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg
+[downloads-url]: https://npmjs.org/package/content-disposition
diff --git a/Restaurant/node_modules/content-disposition/index.js b/Restaurant/node_modules/content-disposition/index.js
new file mode 100644
index 0000000..3092a4d
--- /dev/null
+++ b/Restaurant/node_modules/content-disposition/index.js
@@ -0,0 +1,458 @@
+/*!
+ * content-disposition
+ * Copyright(c) 2014-2017 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = contentDisposition
+module.exports.parse = parse
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var basename = require('path').basename
+var Buffer = require('safe-buffer').Buffer
+
+/**
+ * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%")
+ * @private
+ */
+
+var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match percent encoding escape.
+ * @private
+ */
+
+var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/
+var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g
+
+/**
+ * RegExp to match non-latin1 characters.
+ * @private
+ */
+
+var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g
+
+/**
+ * RegExp to match quoted-pair in RFC 2616
+ *
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * @private
+ */
+
+var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 2616
+ * @private
+ */
+
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp for various RFC 2616 grammar
+ *
+ * parameter = token "=" ( token | quoted-string )
+ * token = 1*
+ * separators = "(" | ")" | "<" | ">" | "@"
+ * | "," | ";" | ":" | "\" | <">
+ * | "/" | "[" | "]" | "?" | "="
+ * | "{" | "}" | SP | HT
+ * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
+ * qdtext = >
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * TEXT =
+ * LWS = [CRLF] 1*( SP | HT )
+ * CRLF = CR LF
+ * CR =
+ * LF =
+ * SP =
+ * HT =
+ * CTL =
+ * OCTET =
+ * @private
+ */
+
+var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex
+var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/
+var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/
+
+/**
+ * RegExp for various RFC 5987 grammar
+ *
+ * ext-value = charset "'" [ language ] "'" value-chars
+ * charset = "UTF-8" / "ISO-8859-1" / mime-charset
+ * mime-charset = 1*mime-charsetc
+ * mime-charsetc = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "%" / "&"
+ * / "+" / "-" / "^" / "_" / "`"
+ * / "{" / "}" / "~"
+ * language = ( 2*3ALPHA [ extlang ] )
+ * / 4ALPHA
+ * / 5*8ALPHA
+ * extlang = *3( "-" 3ALPHA )
+ * value-chars = *( pct-encoded / attr-char )
+ * pct-encoded = "%" HEXDIG HEXDIG
+ * attr-char = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "&" / "+" / "-" / "."
+ * / "^" / "_" / "`" / "|" / "~"
+ * @private
+ */
+
+var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/
+
+/**
+ * RegExp for various RFC 6266 grammar
+ *
+ * disposition-type = "inline" | "attachment" | disp-ext-type
+ * disp-ext-type = token
+ * disposition-parm = filename-parm | disp-ext-parm
+ * filename-parm = "filename" "=" value
+ * | "filename*" "=" ext-value
+ * disp-ext-parm = token "=" value
+ * | ext-token "=" ext-value
+ * ext-token =
+ * @private
+ */
+
+var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex
+
+/**
+ * Create an attachment Content-Disposition header.
+ *
+ * @param {string} [filename]
+ * @param {object} [options]
+ * @param {string} [options.type=attachment]
+ * @param {string|boolean} [options.fallback=true]
+ * @return {string}
+ * @public
+ */
+
+function contentDisposition (filename, options) {
+ var opts = options || {}
+
+ // get type
+ var type = opts.type || 'attachment'
+
+ // get parameters
+ var params = createparams(filename, opts.fallback)
+
+ // format into string
+ return format(new ContentDisposition(type, params))
+}
+
+/**
+ * Create parameters object from filename and fallback.
+ *
+ * @param {string} [filename]
+ * @param {string|boolean} [fallback=true]
+ * @return {object}
+ * @private
+ */
+
+function createparams (filename, fallback) {
+ if (filename === undefined) {
+ return
+ }
+
+ var params = {}
+
+ if (typeof filename !== 'string') {
+ throw new TypeError('filename must be a string')
+ }
+
+ // fallback defaults to true
+ if (fallback === undefined) {
+ fallback = true
+ }
+
+ if (typeof fallback !== 'string' && typeof fallback !== 'boolean') {
+ throw new TypeError('fallback must be a string or boolean')
+ }
+
+ if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) {
+ throw new TypeError('fallback must be ISO-8859-1 string')
+ }
+
+ // restrict to file base name
+ var name = basename(filename)
+
+ // determine if name is suitable for quoted string
+ var isQuotedString = TEXT_REGEXP.test(name)
+
+ // generate fallback name
+ var fallbackName = typeof fallback !== 'string'
+ ? fallback && getlatin1(name)
+ : basename(fallback)
+ var hasFallback = typeof fallbackName === 'string' && fallbackName !== name
+
+ // set extended filename parameter
+ if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) {
+ params['filename*'] = name
+ }
+
+ // set filename parameter
+ if (isQuotedString || hasFallback) {
+ params.filename = hasFallback
+ ? fallbackName
+ : name
+ }
+
+ return params
+}
+
+/**
+ * Format object to Content-Disposition header.
+ *
+ * @param {object} obj
+ * @param {string} obj.type
+ * @param {object} [obj.parameters]
+ * @return {string}
+ * @private
+ */
+
+function format (obj) {
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ // start with normalized type
+ var string = String(type).toLowerCase()
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ var val = param.substr(-1) === '*'
+ ? ustring(parameters[param])
+ : qstring(parameters[param])
+
+ string += '; ' + param + '=' + val
+ }
+ }
+
+ return string
+}
+
+/**
+ * Decode a RFC 6987 field value (gracefully).
+ *
+ * @param {string} str
+ * @return {string}
+ * @private
+ */
+
+function decodefield (str) {
+ var match = EXT_VALUE_REGEXP.exec(str)
+
+ if (!match) {
+ throw new TypeError('invalid extended field value')
+ }
+
+ var charset = match[1].toLowerCase()
+ var encoded = match[2]
+ var value
+
+ // to binary string
+ var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode)
+
+ switch (charset) {
+ case 'iso-8859-1':
+ value = getlatin1(binary)
+ break
+ case 'utf-8':
+ value = Buffer.from(binary, 'binary').toString('utf8')
+ break
+ default:
+ throw new TypeError('unsupported charset in extended field')
+ }
+
+ return value
+}
+
+/**
+ * Get ISO-8859-1 version of string.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function getlatin1 (val) {
+ // simple Unicode -> ISO-8859-1 transformation
+ return String(val).replace(NON_LATIN1_REGEXP, '?')
+}
+
+/**
+ * Parse Content-Disposition header string.
+ *
+ * @param {string} string
+ * @return {object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string || typeof string !== 'string') {
+ throw new TypeError('argument string is required')
+ }
+
+ var match = DISPOSITION_TYPE_REGEXP.exec(string)
+
+ if (!match) {
+ throw new TypeError('invalid type format')
+ }
+
+ // normalize type
+ var index = match[0].length
+ var type = match[1].toLowerCase()
+
+ var key
+ var names = []
+ var params = {}
+ var value
+
+ // calculate index to start at
+ index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';'
+ ? index - 1
+ : index
+
+ // match parameters
+ while ((match = PARAM_REGEXP.exec(string))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (names.indexOf(key) !== -1) {
+ throw new TypeError('invalid duplicate parameter')
+ }
+
+ names.push(key)
+
+ if (key.indexOf('*') + 1 === key.length) {
+ // decode extended value
+ key = key.slice(0, -1)
+ value = decodefield(value)
+
+ // overwrite existing value
+ params[key] = value
+ continue
+ }
+
+ if (typeof params[key] === 'string') {
+ continue
+ }
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(QESC_REGEXP, '$1')
+ }
+
+ params[key] = value
+ }
+
+ if (index !== -1 && index !== string.length) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ return new ContentDisposition(type, params)
+}
+
+/**
+ * Percent decode a single character.
+ *
+ * @param {string} str
+ * @param {string} hex
+ * @return {string}
+ * @private
+ */
+
+function pdecode (str, hex) {
+ return String.fromCharCode(parseInt(hex, 16))
+}
+
+/**
+ * Percent encode a single character.
+ *
+ * @param {string} char
+ * @return {string}
+ * @private
+ */
+
+function pencode (char) {
+ return '%' + String(char)
+ .charCodeAt(0)
+ .toString(16)
+ .toUpperCase()
+}
+
+/**
+ * Quote a string for HTTP.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Encode a Unicode string for HTTP (RFC 5987).
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function ustring (val) {
+ var str = String(val)
+
+ // percent encode as UTF-8
+ var encoded = encodeURIComponent(str)
+ .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode)
+
+ return 'UTF-8\'\'' + encoded
+}
+
+/**
+ * Class for parsed Content-Disposition header for v8 optimization
+ *
+ * @public
+ * @param {string} type
+ * @param {object} parameters
+ * @constructor
+ */
+
+function ContentDisposition (type, parameters) {
+ this.type = type
+ this.parameters = parameters
+}
diff --git a/Restaurant/node_modules/content-disposition/package.json b/Restaurant/node_modules/content-disposition/package.json
new file mode 100644
index 0000000..9074300
--- /dev/null
+++ b/Restaurant/node_modules/content-disposition/package.json
@@ -0,0 +1,79 @@
+{
+ "_from": "content-disposition@0.5.3",
+ "_id": "content-disposition@0.5.3",
+ "_inBundle": false,
+ "_integrity": "sha512-ExO0774ikEObIAEV9kDo50o+79VCUdEB6n6lzKgGwupcVeRlhrj3qGAfwq8G6uBJjkqLrhT0qEYFcWng8z1z0g==",
+ "_location": "/content-disposition",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "content-disposition@0.5.3",
+ "name": "content-disposition",
+ "escapedName": "content-disposition",
+ "rawSpec": "0.5.3",
+ "saveSpec": null,
+ "fetchSpec": "0.5.3"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.3.tgz",
+ "_shasum": "e130caf7e7279087c5616c2007d0485698984fbd",
+ "_spec": "content-disposition@0.5.3",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "bugs": {
+ "url": "https://github.com/jshttp/content-disposition/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "safe-buffer": "5.1.2"
+ },
+ "deprecated": false,
+ "description": "Create and parse Content-Disposition header",
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "5.10.0",
+ "eslint-config-standard": "12.0.0",
+ "eslint-plugin-import": "2.14.0",
+ "eslint-plugin-markdown": "1.0.0-rc.1",
+ "eslint-plugin-node": "7.0.1",
+ "eslint-plugin-promise": "4.0.1",
+ "eslint-plugin-standard": "4.0.0",
+ "istanbul": "0.4.5",
+ "mocha": "5.2.0"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/content-disposition#readme",
+ "keywords": [
+ "content-disposition",
+ "http",
+ "rfc6266",
+ "res"
+ ],
+ "license": "MIT",
+ "name": "content-disposition",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/content-disposition.git"
+ },
+ "scripts": {
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "version": "0.5.3"
+}
diff --git a/Restaurant/node_modules/content-type/HISTORY.md b/Restaurant/node_modules/content-type/HISTORY.md
new file mode 100644
index 0000000..8f5cb70
--- /dev/null
+++ b/Restaurant/node_modules/content-type/HISTORY.md
@@ -0,0 +1,24 @@
+1.0.4 / 2017-09-11
+==================
+
+ * perf: skip parameter parsing when no parameters
+
+1.0.3 / 2017-09-10
+==================
+
+ * perf: remove argument reassignment
+
+1.0.2 / 2016-05-09
+==================
+
+ * perf: enable strict mode
+
+1.0.1 / 2015-02-13
+==================
+
+ * Improve missing `Content-Type` header error message
+
+1.0.0 / 2015-02-01
+==================
+
+ * Initial implementation, derived from `media-typer@0.3.0`
diff --git a/Restaurant/node_modules/content-type/LICENSE b/Restaurant/node_modules/content-type/LICENSE
new file mode 100644
index 0000000..34b1a2d
--- /dev/null
+++ b/Restaurant/node_modules/content-type/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/Restaurant/node_modules/content-type/README.md b/Restaurant/node_modules/content-type/README.md
new file mode 100644
index 0000000..3ed6741
--- /dev/null
+++ b/Restaurant/node_modules/content-type/README.md
@@ -0,0 +1,92 @@
+# content-type
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create and parse HTTP Content-Type header according to RFC 7231
+
+## Installation
+
+```sh
+$ npm install content-type
+```
+
+## API
+
+```js
+var contentType = require('content-type')
+```
+
+### contentType.parse(string)
+
+```js
+var obj = contentType.parse('image/svg+xml; charset=utf-8')
+```
+
+Parse a content type string. This will return an object with the following
+properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (the type and subtype, always lower case).
+ Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of parameter
+ always lower case). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the string is missing or invalid.
+
+### contentType.parse(req)
+
+```js
+var obj = contentType.parse(req)
+```
+
+Parse the `content-type` header from the given `req`. Short-cut for
+`contentType.parse(req.headers['content-type'])`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.parse(res)
+
+```js
+var obj = contentType.parse(res)
+```
+
+Parse the `content-type` header set on the given `res`. Short-cut for
+`contentType.parse(res.getHeader('content-type'))`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.format(obj)
+
+```js
+var str = contentType.format({type: 'image/svg+xml'})
+```
+
+Format an object into a content type string. This will return a string of the
+content type for the given object with the following properties (examples are
+shown that produce the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of the
+ parameter will be lower-cased). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the object contains an invalid type or parameter names.
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/content-type.svg
+[npm-url]: https://npmjs.org/package/content-type
+[node-version-image]: https://img.shields.io/node/v/content-type.svg
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/content-type/master.svg
+[travis-url]: https://travis-ci.org/jshttp/content-type
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-type/master.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/content-type
+[downloads-image]: https://img.shields.io/npm/dm/content-type.svg
+[downloads-url]: https://npmjs.org/package/content-type
diff --git a/Restaurant/node_modules/content-type/index.js b/Restaurant/node_modules/content-type/index.js
new file mode 100644
index 0000000..6ce03f2
--- /dev/null
+++ b/Restaurant/node_modules/content-type/index.js
@@ -0,0 +1,222 @@
+/*!
+ * content-type
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1
+ *
+ * parameter = token "=" ( token / quoted-string )
+ * token = 1*tchar
+ * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*"
+ * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~"
+ * / DIGIT / ALPHA
+ * ; any VCHAR, except delimiters
+ * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE
+ * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text
+ * obs-text = %x80-FF
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ */
+var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g
+var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/
+var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * RegExp to match quoted-pair in RFC 7230 sec 3.2.6
+ *
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ * obs-text = %x80-FF
+ */
+var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6
+ */
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp to match type in RFC 7231 sec 3.1.1.1
+ *
+ * media-type = type "/" subtype
+ * type = token
+ * subtype = token
+ */
+var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.format = format
+exports.parse = parse
+
+/**
+ * Format object to media type.
+ *
+ * @param {object} obj
+ * @return {string}
+ * @public
+ */
+
+function format (obj) {
+ if (!obj || typeof obj !== 'object') {
+ throw new TypeError('argument obj is required')
+ }
+
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || !TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ var string = type
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ if (!TOKEN_REGEXP.test(param)) {
+ throw new TypeError('invalid parameter name')
+ }
+
+ string += '; ' + param + '=' + qstring(parameters[param])
+ }
+ }
+
+ return string
+}
+
+/**
+ * Parse media type to object.
+ *
+ * @param {string|object} string
+ * @return {Object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string) {
+ throw new TypeError('argument string is required')
+ }
+
+ // support req/res-like objects as argument
+ var header = typeof string === 'object'
+ ? getcontenttype(string)
+ : string
+
+ if (typeof header !== 'string') {
+ throw new TypeError('argument string is required to be a string')
+ }
+
+ var index = header.indexOf(';')
+ var type = index !== -1
+ ? header.substr(0, index).trim()
+ : header.trim()
+
+ if (!TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid media type')
+ }
+
+ var obj = new ContentType(type.toLowerCase())
+
+ // parse parameters
+ if (index !== -1) {
+ var key
+ var match
+ var value
+
+ PARAM_REGEXP.lastIndex = index
+
+ while ((match = PARAM_REGEXP.exec(header))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(QESC_REGEXP, '$1')
+ }
+
+ obj.parameters[key] = value
+ }
+
+ if (index !== header.length) {
+ throw new TypeError('invalid parameter format')
+ }
+ }
+
+ return obj
+}
+
+/**
+ * Get content-type from req/res objects.
+ *
+ * @param {object}
+ * @return {Object}
+ * @private
+ */
+
+function getcontenttype (obj) {
+ var header
+
+ if (typeof obj.getHeader === 'function') {
+ // res-like
+ header = obj.getHeader('content-type')
+ } else if (typeof obj.headers === 'object') {
+ // req-like
+ header = obj.headers && obj.headers['content-type']
+ }
+
+ if (typeof header !== 'string') {
+ throw new TypeError('content-type header is missing from object')
+ }
+
+ return header
+}
+
+/**
+ * Quote a string if necessary.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ // no need to quote tokens
+ if (TOKEN_REGEXP.test(str)) {
+ return str
+ }
+
+ if (str.length > 0 && !TEXT_REGEXP.test(str)) {
+ throw new TypeError('invalid parameter value')
+ }
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Class to represent a content type.
+ * @private
+ */
+function ContentType (type) {
+ this.parameters = Object.create(null)
+ this.type = type
+}
diff --git a/Restaurant/node_modules/content-type/package.json b/Restaurant/node_modules/content-type/package.json
new file mode 100644
index 0000000..fa811ef
--- /dev/null
+++ b/Restaurant/node_modules/content-type/package.json
@@ -0,0 +1,76 @@
+{
+ "_from": "content-type@~1.0.4",
+ "_id": "content-type@1.0.4",
+ "_inBundle": false,
+ "_integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==",
+ "_location": "/content-type",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "content-type@~1.0.4",
+ "name": "content-type",
+ "escapedName": "content-type",
+ "rawSpec": "~1.0.4",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.4"
+ },
+ "_requiredBy": [
+ "/body-parser",
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz",
+ "_shasum": "e138cc75e040c727b1966fe5e5f8c9aee256fe3b",
+ "_spec": "content-type@~1.0.4",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "bugs": {
+ "url": "https://github.com/jshttp/content-type/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Create and parse HTTP Content-Type header",
+ "devDependencies": {
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.7.0",
+ "eslint-plugin-node": "5.1.1",
+ "eslint-plugin-promise": "3.5.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "~1.21.5"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/content-type#readme",
+ "keywords": [
+ "content-type",
+ "http",
+ "req",
+ "res",
+ "rfc7231"
+ ],
+ "license": "MIT",
+ "name": "content-type",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/content-type.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/"
+ },
+ "version": "1.0.4"
+}
diff --git a/Restaurant/node_modules/cookie-signature/.npmignore b/Restaurant/node_modules/cookie-signature/.npmignore
new file mode 100644
index 0000000..f1250e5
--- /dev/null
+++ b/Restaurant/node_modules/cookie-signature/.npmignore
@@ -0,0 +1,4 @@
+support
+test
+examples
+*.sock
diff --git a/Restaurant/node_modules/cookie-signature/History.md b/Restaurant/node_modules/cookie-signature/History.md
new file mode 100644
index 0000000..78513cc
--- /dev/null
+++ b/Restaurant/node_modules/cookie-signature/History.md
@@ -0,0 +1,38 @@
+1.0.6 / 2015-02-03
+==================
+
+* use `npm test` instead of `make test` to run tests
+* clearer assertion messages when checking input
+
+
+1.0.5 / 2014-09-05
+==================
+
+* add license to package.json
+
+1.0.4 / 2014-06-25
+==================
+
+ * corrected avoidance of timing attacks (thanks @tenbits!)
+
+1.0.3 / 2014-01-28
+==================
+
+ * [incorrect] fix for timing attacks
+
+1.0.2 / 2014-01-28
+==================
+
+ * fix missing repository warning
+ * fix typo in test
+
+1.0.1 / 2013-04-15
+==================
+
+ * Revert "Changed underlying HMAC algo. to sha512."
+ * Revert "Fix for timing attacks on MAC verification."
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/Restaurant/node_modules/cookie-signature/Readme.md b/Restaurant/node_modules/cookie-signature/Readme.md
new file mode 100644
index 0000000..2559e84
--- /dev/null
+++ b/Restaurant/node_modules/cookie-signature/Readme.md
@@ -0,0 +1,42 @@
+
+# cookie-signature
+
+ Sign and unsign cookies.
+
+## Example
+
+```js
+var cookie = require('cookie-signature');
+
+var val = cookie.sign('hello', 'tobiiscool');
+val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI');
+
+var val = cookie.sign('hello', 'tobiiscool');
+cookie.unsign(val, 'tobiiscool').should.equal('hello');
+cookie.unsign(val, 'luna').should.be.false;
+```
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2012 LearnBoost <tj@learnboost.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/Restaurant/node_modules/cookie-signature/index.js b/Restaurant/node_modules/cookie-signature/index.js
new file mode 100644
index 0000000..b8c9463
--- /dev/null
+++ b/Restaurant/node_modules/cookie-signature/index.js
@@ -0,0 +1,51 @@
+/**
+ * Module dependencies.
+ */
+
+var crypto = require('crypto');
+
+/**
+ * Sign the given `val` with `secret`.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String}
+ * @api private
+ */
+
+exports.sign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ return val + '.' + crypto
+ .createHmac('sha256', secret)
+ .update(val)
+ .digest('base64')
+ .replace(/\=+$/, '');
+};
+
+/**
+ * Unsign and decode the given `val` with `secret`,
+ * returning `false` if the signature is invalid.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String|Boolean}
+ * @api private
+ */
+
+exports.unsign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ var str = val.slice(0, val.lastIndexOf('.'))
+ , mac = exports.sign(str, secret);
+
+ return sha1(mac) == sha1(val) ? str : false;
+};
+
+/**
+ * Private
+ */
+
+function sha1(str){
+ return crypto.createHash('sha1').update(str).digest('hex');
+}
diff --git a/Restaurant/node_modules/cookie-signature/package.json b/Restaurant/node_modules/cookie-signature/package.json
new file mode 100644
index 0000000..f0ba608
--- /dev/null
+++ b/Restaurant/node_modules/cookie-signature/package.json
@@ -0,0 +1,57 @@
+{
+ "_from": "cookie-signature@1.0.6",
+ "_id": "cookie-signature@1.0.6",
+ "_inBundle": false,
+ "_integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=",
+ "_location": "/cookie-signature",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "cookie-signature@1.0.6",
+ "name": "cookie-signature",
+ "escapedName": "cookie-signature",
+ "rawSpec": "1.0.6",
+ "saveSpec": null,
+ "fetchSpec": "1.0.6"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz",
+ "_shasum": "e303a882b342cc3ee8ca513a79999734dab3ae2c",
+ "_spec": "cookie-signature@1.0.6",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@learnboost.com"
+ },
+ "bugs": {
+ "url": "https://github.com/visionmedia/node-cookie-signature/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {},
+ "deprecated": false,
+ "description": "Sign and unsign cookies",
+ "devDependencies": {
+ "mocha": "*",
+ "should": "*"
+ },
+ "homepage": "https://github.com/visionmedia/node-cookie-signature#readme",
+ "keywords": [
+ "cookie",
+ "sign",
+ "unsign"
+ ],
+ "license": "MIT",
+ "main": "index",
+ "name": "cookie-signature",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/visionmedia/node-cookie-signature.git"
+ },
+ "scripts": {
+ "test": "mocha --require should --reporter spec"
+ },
+ "version": "1.0.6"
+}
diff --git a/Restaurant/node_modules/cookie/HISTORY.md b/Restaurant/node_modules/cookie/HISTORY.md
new file mode 100644
index 0000000..da2bf24
--- /dev/null
+++ b/Restaurant/node_modules/cookie/HISTORY.md
@@ -0,0 +1,123 @@
+0.4.0 / 2019-05-15
+==================
+
+ * Add `SameSite=None` support
+
+0.3.1 / 2016-05-26
+==================
+
+ * Fix `sameSite: true` to work with draft-7 clients
+ - `true` now sends `SameSite=Strict` instead of `SameSite`
+
+0.3.0 / 2016-05-26
+==================
+
+ * Add `sameSite` option
+ - Replaces `firstPartyOnly` option, never implemented by browsers
+ * Improve error message when `encode` is not a function
+ * Improve error message when `expires` is not a `Date`
+
+0.2.4 / 2016-05-20
+==================
+
+ * perf: enable strict mode
+ * perf: use for loop in parse
+ * perf: use string concatination for serialization
+
+0.2.3 / 2015-10-25
+==================
+
+ * Fix cookie `Max-Age` to never be a floating point number
+
+0.2.2 / 2015-09-17
+==================
+
+ * Fix regression when setting empty cookie value
+ - Ease the new restriction, which is just basic header-level validation
+ * Fix typo in invalid value errors
+
+0.2.1 / 2015-09-17
+==================
+
+ * Throw on invalid values provided to `serialize`
+ - Ensures the resulting string is a valid HTTP header value
+
+0.2.0 / 2015-08-13
+==================
+
+ * Add `firstPartyOnly` option
+ * Throw better error for invalid argument to parse
+ * perf: hoist regular expression
+
+0.1.5 / 2015-09-17
+==================
+
+ * Fix regression when setting empty cookie value
+ - Ease the new restriction, which is just basic header-level validation
+ * Fix typo in invalid value errors
+
+0.1.4 / 2015-09-17
+==================
+
+ * Throw better error for invalid argument to parse
+ * Throw on invalid values provided to `serialize`
+ - Ensures the resulting string is a valid HTTP header value
+
+0.1.3 / 2015-05-19
+==================
+
+ * Reduce the scope of try-catch deopt
+ * Remove argument reassignments
+
+0.1.2 / 2014-04-16
+==================
+
+ * Remove unnecessary files from npm package
+
+0.1.1 / 2014-02-23
+==================
+
+ * Fix bad parse when cookie value contained a comma
+ * Fix support for `maxAge` of `0`
+
+0.1.0 / 2013-05-01
+==================
+
+ * Add `decode` option
+ * Add `encode` option
+
+0.0.6 / 2013-04-08
+==================
+
+ * Ignore cookie parts missing `=`
+
+0.0.5 / 2012-10-29
+==================
+
+ * Return raw cookie value if value unescape errors
+
+0.0.4 / 2012-06-21
+==================
+
+ * Use encode/decodeURIComponent for cookie encoding/decoding
+ - Improve server/client interoperability
+
+0.0.3 / 2012-06-06
+==================
+
+ * Only escape special characters per the cookie RFC
+
+0.0.2 / 2012-06-01
+==================
+
+ * Fix `maxAge` option to not throw error
+
+0.0.1 / 2012-05-28
+==================
+
+ * Add more tests
+
+0.0.0 / 2012-05-28
+==================
+
+ * Initial release
diff --git a/Restaurant/node_modules/cookie/LICENSE b/Restaurant/node_modules/cookie/LICENSE
new file mode 100644
index 0000000..058b6b4
--- /dev/null
+++ b/Restaurant/node_modules/cookie/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 Roman Shtylman
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/Restaurant/node_modules/cookie/README.md b/Restaurant/node_modules/cookie/README.md
new file mode 100644
index 0000000..857fb77
--- /dev/null
+++ b/Restaurant/node_modules/cookie/README.md
@@ -0,0 +1,253 @@
+# cookie
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Basic HTTP cookie parser and serializer for HTTP servers.
+
+## Installation
+
+```sh
+$ npm install cookie
+```
+
+## API
+
+```js
+var cookie = require('cookie');
+```
+
+### cookie.parse(str, options)
+
+Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs.
+The `str` argument is the string representing a `Cookie` header value and `options` is an
+optional object containing additional parsing options.
+
+```js
+var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2');
+// { foo: 'bar', equation: 'E=mc^2' }
+```
+
+#### Options
+
+`cookie.parse` accepts these properties in the options object.
+
+##### decode
+
+Specifies a function that will be used to decode a cookie's value. Since the value of a cookie
+has a limited character set (and must be a simple string), this function can be used to decode
+a previously-encoded cookie value into a JavaScript string or other object.
+
+The default function is the global `decodeURIComponent`, which will decode any URL-encoded
+sequences into their byte representations.
+
+**note** if an error is thrown from this function, the original, non-decoded cookie value will
+be returned as the cookie's value.
+
+### cookie.serialize(name, value, options)
+
+Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the
+name for the cookie, the `value` argument is the value to set the cookie to, and the `options`
+argument is an optional object containing additional serialization options.
+
+```js
+var setCookie = cookie.serialize('foo', 'bar');
+// foo=bar
+```
+
+#### Options
+
+`cookie.serialize` accepts these properties in the options object.
+
+##### domain
+
+Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no
+domain is set, and most clients will consider the cookie to apply to only the current domain.
+
+##### encode
+
+Specifies a function that will be used to encode a cookie's value. Since value of a cookie
+has a limited character set (and must be a simple string), this function can be used to encode
+a value into a string suited for a cookie's value.
+
+The default function is the global `encodeURIComponent`, which will encode a JavaScript string
+into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range.
+
+##### expires
+
+Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1].
+By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and
+will delete it on a condition like exiting a web browser application.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### httpOnly
+
+Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy,
+the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not allow client-side
+JavaScript to see the cookie in `document.cookie`.
+
+##### maxAge
+
+Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2].
+The given number will be converted to an integer by rounding down. By default, no maximum age is set.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### path
+
+Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path
+is considered the ["default path"][rfc-6265-5.1.4].
+
+##### sameSite
+
+Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-03-4.1.2.7].
+
+ - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+ - `false` will not set the `SameSite` attribute.
+ - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement.
+ - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie.
+ - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+
+More information about the different enforcement levels can be found in
+[the specification][rfc-6265bis-03-4.1.2.7].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### secure
+
+Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy,
+the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to
+the server in the future if the browser does not have an HTTPS connection.
+
+## Example
+
+The following example uses this module in conjunction with the Node.js core HTTP server
+to prompt a user for their name and display it back on future visits.
+
+```js
+var cookie = require('cookie');
+var escapeHtml = require('escape-html');
+var http = require('http');
+var url = require('url');
+
+function onRequest(req, res) {
+ // Parse the query string
+ var query = url.parse(req.url, true, true).query;
+
+ if (query && query.name) {
+ // Set a new cookie with the name
+ res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), {
+ httpOnly: true,
+ maxAge: 60 * 60 * 24 * 7 // 1 week
+ }));
+
+ // Redirect back after setting cookie
+ res.statusCode = 302;
+ res.setHeader('Location', req.headers.referer || '/');
+ res.end();
+ return;
+ }
+
+ // Parse the cookies on the request
+ var cookies = cookie.parse(req.headers.cookie || '');
+
+ // Get the visitor name set in the cookie
+ var name = cookies.name;
+
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8');
+
+ if (name) {
+ res.write('Welcome back, ' + escapeHtml(name) + ' !
');
+ } else {
+ res.write('Hello, new visitor!
');
+ }
+
+ res.write('');
+}
+
+http.createServer(onRequest).listen(3000);
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```
+$ npm run bench
+
+> cookie@0.3.1 bench cookie
+> node benchmark/index.js
+
+ http_parser@2.8.0
+ node@6.14.2
+ v8@5.1.281.111
+ uv@1.16.1
+ zlib@1.2.11
+ ares@1.10.1-DEV
+ icu@58.2
+ modules@48
+ napi@3
+ openssl@1.0.2o
+
+> node benchmark/parse.js
+
+ cookie.parse
+
+ 6 tests completed.
+
+ simple x 1,200,691 ops/sec ±1.12% (189 runs sampled)
+ decode x 1,012,994 ops/sec ±0.97% (186 runs sampled)
+ unquote x 1,074,174 ops/sec ±2.43% (186 runs sampled)
+ duplicates x 438,424 ops/sec ±2.17% (184 runs sampled)
+ 10 cookies x 147,154 ops/sec ±1.01% (186 runs sampled)
+ 100 cookies x 14,274 ops/sec ±1.07% (187 runs sampled)
+```
+
+## References
+
+- [RFC 6265: HTTP State Management Mechanism][rfc-6265]
+- [Same-site Cookies][rfc-6265bis-03-4.1.2.7]
+
+[rfc-6265bis-03-4.1.2.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-03#section-4.1.2.7
+[rfc-6265]: https://tools.ietf.org/html/rfc6265
+[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4
+[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1
+[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2
+[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3
+[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4
+[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5
+[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6
+[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master
+[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master
+[node-version-image]: https://badgen.net/npm/node/cookie
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/cookie
+[npm-url]: https://npmjs.org/package/cookie
+[npm-version-image]: https://badgen.net/npm/v/cookie
+[travis-image]: https://badgen.net/travis/jshttp/cookie/master
+[travis-url]: https://travis-ci.org/jshttp/cookie
diff --git a/Restaurant/node_modules/cookie/index.js b/Restaurant/node_modules/cookie/index.js
new file mode 100644
index 0000000..16f56c0
--- /dev/null
+++ b/Restaurant/node_modules/cookie/index.js
@@ -0,0 +1,198 @@
+/*!
+ * cookie
+ * Copyright(c) 2012-2014 Roman Shtylman
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.parse = parse;
+exports.serialize = serialize;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var decode = decodeURIComponent;
+var encode = encodeURIComponent;
+var pairSplitRegExp = /; */;
+
+/**
+ * RegExp to match field-content in RFC 7230 sec 3.2
+ *
+ * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ]
+ * field-vchar = VCHAR / obs-text
+ * obs-text = %x80-FF
+ */
+
+var fieldContentRegExp = /^[\u0009\u0020-\u007e\u0080-\u00ff]+$/;
+
+/**
+ * Parse a cookie header.
+ *
+ * Parse the given cookie header string into an object
+ * The object has the various cookies as keys(names) => values
+ *
+ * @param {string} str
+ * @param {object} [options]
+ * @return {object}
+ * @public
+ */
+
+function parse(str, options) {
+ if (typeof str !== 'string') {
+ throw new TypeError('argument str must be a string');
+ }
+
+ var obj = {}
+ var opt = options || {};
+ var pairs = str.split(pairSplitRegExp);
+ var dec = opt.decode || decode;
+
+ for (var i = 0; i < pairs.length; i++) {
+ var pair = pairs[i];
+ var eq_idx = pair.indexOf('=');
+
+ // skip things that don't look like key=value
+ if (eq_idx < 0) {
+ continue;
+ }
+
+ var key = pair.substr(0, eq_idx).trim()
+ var val = pair.substr(++eq_idx, pair.length).trim();
+
+ // quoted values
+ if ('"' == val[0]) {
+ val = val.slice(1, -1);
+ }
+
+ // only assign once
+ if (undefined == obj[key]) {
+ obj[key] = tryDecode(val, dec);
+ }
+ }
+
+ return obj;
+}
+
+/**
+ * Serialize data into a cookie header.
+ *
+ * Serialize the a name value pair into a cookie string suitable for
+ * http headers. An optional options object specified cookie parameters.
+ *
+ * serialize('foo', 'bar', { httpOnly: true })
+ * => "foo=bar; httpOnly"
+ *
+ * @param {string} name
+ * @param {string} val
+ * @param {object} [options]
+ * @return {string}
+ * @public
+ */
+
+function serialize(name, val, options) {
+ var opt = options || {};
+ var enc = opt.encode || encode;
+
+ if (typeof enc !== 'function') {
+ throw new TypeError('option encode is invalid');
+ }
+
+ if (!fieldContentRegExp.test(name)) {
+ throw new TypeError('argument name is invalid');
+ }
+
+ var value = enc(val);
+
+ if (value && !fieldContentRegExp.test(value)) {
+ throw new TypeError('argument val is invalid');
+ }
+
+ var str = name + '=' + value;
+
+ if (null != opt.maxAge) {
+ var maxAge = opt.maxAge - 0;
+ if (isNaN(maxAge)) throw new Error('maxAge should be a Number');
+ str += '; Max-Age=' + Math.floor(maxAge);
+ }
+
+ if (opt.domain) {
+ if (!fieldContentRegExp.test(opt.domain)) {
+ throw new TypeError('option domain is invalid');
+ }
+
+ str += '; Domain=' + opt.domain;
+ }
+
+ if (opt.path) {
+ if (!fieldContentRegExp.test(opt.path)) {
+ throw new TypeError('option path is invalid');
+ }
+
+ str += '; Path=' + opt.path;
+ }
+
+ if (opt.expires) {
+ if (typeof opt.expires.toUTCString !== 'function') {
+ throw new TypeError('option expires is invalid');
+ }
+
+ str += '; Expires=' + opt.expires.toUTCString();
+ }
+
+ if (opt.httpOnly) {
+ str += '; HttpOnly';
+ }
+
+ if (opt.secure) {
+ str += '; Secure';
+ }
+
+ if (opt.sameSite) {
+ var sameSite = typeof opt.sameSite === 'string'
+ ? opt.sameSite.toLowerCase() : opt.sameSite;
+
+ switch (sameSite) {
+ case true:
+ str += '; SameSite=Strict';
+ break;
+ case 'lax':
+ str += '; SameSite=Lax';
+ break;
+ case 'strict':
+ str += '; SameSite=Strict';
+ break;
+ case 'none':
+ str += '; SameSite=None';
+ break;
+ default:
+ throw new TypeError('option sameSite is invalid');
+ }
+ }
+
+ return str;
+}
+
+/**
+ * Try decoding a string using a decoding function.
+ *
+ * @param {string} str
+ * @param {function} decode
+ * @private
+ */
+
+function tryDecode(str, decode) {
+ try {
+ return decode(str);
+ } catch (e) {
+ return str;
+ }
+}
diff --git a/Restaurant/node_modules/cookie/package.json b/Restaurant/node_modules/cookie/package.json
new file mode 100644
index 0000000..de85562
--- /dev/null
+++ b/Restaurant/node_modules/cookie/package.json
@@ -0,0 +1,78 @@
+{
+ "_from": "cookie@0.4.0",
+ "_id": "cookie@0.4.0",
+ "_inBundle": false,
+ "_integrity": "sha512-+Hp8fLp57wnUSt0tY0tHEXh4voZRDnoIrZPqlo3DPiI4y9lwg/jqx+1Om94/W6ZaPDOUbnjOt/99w66zk+l1Xg==",
+ "_location": "/cookie",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "cookie@0.4.0",
+ "name": "cookie",
+ "escapedName": "cookie",
+ "rawSpec": "0.4.0",
+ "saveSpec": null,
+ "fetchSpec": "0.4.0"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.0.tgz",
+ "_shasum": "beb437e7022b3b6d49019d088665303ebe9c14ba",
+ "_spec": "cookie@0.4.0",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "author": {
+ "name": "Roman Shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ "bugs": {
+ "url": "https://github.com/jshttp/cookie/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "HTTP server cookie parsing and serialization",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "5.16.0",
+ "eslint-plugin-markdown": "1.0.0",
+ "istanbul": "0.4.5",
+ "mocha": "6.1.4"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/cookie#readme",
+ "keywords": [
+ "cookie",
+ "cookies"
+ ],
+ "license": "MIT",
+ "name": "cookie",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/cookie.git"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "version": "node scripts/version-history.js && git add HISTORY.md"
+ },
+ "version": "0.4.0"
+}
diff --git a/Restaurant/node_modules/debug/.coveralls.yml b/Restaurant/node_modules/debug/.coveralls.yml
new file mode 100644
index 0000000..20a7068
--- /dev/null
+++ b/Restaurant/node_modules/debug/.coveralls.yml
@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve
diff --git a/Restaurant/node_modules/debug/.eslintrc b/Restaurant/node_modules/debug/.eslintrc
new file mode 100644
index 0000000..8a37ae2
--- /dev/null
+++ b/Restaurant/node_modules/debug/.eslintrc
@@ -0,0 +1,11 @@
+{
+ "env": {
+ "browser": true,
+ "node": true
+ },
+ "rules": {
+ "no-console": 0,
+ "no-empty": [1, { "allowEmptyCatch": true }]
+ },
+ "extends": "eslint:recommended"
+}
diff --git a/Restaurant/node_modules/debug/.npmignore b/Restaurant/node_modules/debug/.npmignore
new file mode 100644
index 0000000..5f60eec
--- /dev/null
+++ b/Restaurant/node_modules/debug/.npmignore
@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json
diff --git a/Restaurant/node_modules/debug/.travis.yml b/Restaurant/node_modules/debug/.travis.yml
new file mode 100644
index 0000000..6c6090c
--- /dev/null
+++ b/Restaurant/node_modules/debug/.travis.yml
@@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+ - "6"
+ - "5"
+ - "4"
+
+install:
+ - make node_modules
+
+script:
+ - make lint
+ - make test
+ - make coveralls
diff --git a/Restaurant/node_modules/debug/CHANGELOG.md b/Restaurant/node_modules/debug/CHANGELOG.md
new file mode 100644
index 0000000..eadaa18
--- /dev/null
+++ b/Restaurant/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+ * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+ * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+ * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+ * Fix: Inline extend function in node implementation (#452, @dougwilson)
+ * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+
+ * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+ * Misc: clean up browser reference checks (#447, @thebigredgeek)
+ * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+ * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+ * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+ * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+ * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+ * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+ * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+ * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+ * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+ * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+ * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+ * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+ * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+ * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+ * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+ * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+ * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+ * Docs: fixed README typo (#391, @lurch)
+ * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+ * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+ * Fix: wrong reference in bower file (@thebigredgeek)
+ * Fix: webworker compatibility (@thebigredgeek)
+ * Fix: output formatting issue (#388, @kribblo)
+ * Fix: babel-loader compatibility (#383, @escwald)
+ * Misc: removed built asset from repo and publications (@thebigredgeek)
+ * Misc: moved source files to /src (#378, @yamikuronue)
+ * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+ * Test: coveralls integration (#378, @yamikuronue)
+ * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+ * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+ * Fix: custom log function (#379, @hsiliev)
+ * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+ * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+ * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+ * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+ * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+ * Fix: browser colors (#367, @tootallnate)
+ * Misc: travis ci integration (@thebigredgeek)
+ * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+ * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+ * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+ * Fix: revert "handle regex special characters" (@tootallnate)
+ * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+ * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+ * Improvement: allow colors in workers (#335, @botverse)
+ * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+ * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+ * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+ * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+ * Fix: be super-safe in index.js as well (@TooTallNate)
+ * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+ * Fix: Added electron compatibility (#324, @paulcbetts)
+ * Improvement: Added performance optimizations (@tootallnate)
+ * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+ * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+ * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+ * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+ * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+ * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+ * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+ * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+ * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+ * Readme: fix USE_COLORS to DEBUG_COLORS
+ * Readme: Doc fixes for format string sugar (#269, @mlucool)
+ * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+ * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+ * Readme: better docs for browser support (#224, @matthewmueller)
+ * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+ * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+ * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+ * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+ * package: update "ms" to v0.7.1 (#202, @dougwilson)
+ * README: add logging to file example (#193, @DanielOchoa)
+ * README: fixed a typo (#191, @amir-s)
+ * browser: expose `storage` (#190, @stephenmathieson)
+ * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+ * Updated stdout/stderr example (#186)
+ * Updated example/stdout.js to match debug current behaviour
+ * Renamed example/stderr.js to stdout.js
+ * Update Readme.md (#184)
+ * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+ * dist: recompile
+ * update "ms" to v0.7.0
+ * package: update "browserify" to v9.0.3
+ * component: fix "ms.js" repo location
+ * changed bower package name
+ * updated documentation about using debug in a browser
+ * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+ * browser: use `typeof` to check for `console` existence
+ * browser: check for `console.log` truthiness (fix IE 8/9)
+ * browser: add support for Chrome apps
+ * Readme: added Windows usage remarks
+ * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+ * node: implement `DEBUG_FD` env variable support
+ * package: update "browserify" to v6.1.0
+ * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+ * package: update "browserify" to v5.11.0
+ * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+ * dist: recompile
+ * example: remove `console.info()` log usage
+ * example: add "Content-Type" UTF-8 header to browser example
+ * browser: place %c marker after the space character
+ * browser: reset the "content" color via `color: inherit`
+ * browser: add colors support for Firefox >= v31
+ * debug: prefer an instance `log()` function over the global one (#119)
+ * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+ * Add support for multiple wildcards in namespaces (#122, @seegno)
+ * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+ * browser: update color palette (#113, @gscottolson)
+ * common: make console logging function configurable (#108, @timoxley)
+ * node: fix %o colors on old node <= 0.8.x
+ * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+ * browser: use `removeItem()` to clear localStorage
+ * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+ * package: add "contributors" section
+ * node: fix comment typo
+ * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+ * make ms diff be global, not be scope
+ * debug: ignore empty strings in enable()
+ * node: make DEBUG_COLORS able to disable coloring
+ * *: export the `colors` array
+ * npmignore: don't publish the `dist` dir
+ * Makefile: refactor to use browserify
+ * package: add "browserify" as a dev dependency
+ * Readme: add Web Inspector Colors section
+ * node: reset terminal color for the debug content
+ * node: map "%o" to `util.inspect()`
+ * browser: map "%j" to `JSON.stringify()`
+ * debug: add custom "formatters"
+ * debug: use "ms" module for humanizing the diff
+ * Readme: add "bash" syntax highlighting
+ * browser: add Firebug color support
+ * browser: add colors for WebKit browsers
+ * node: apply log to `console`
+ * rewrite: abstract common logic for Node & browsers
+ * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+ * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+ * add `enable()` method for nodejs. Closes #27
+ * change from stderr to stdout
+ * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+ * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+ * fix: catch localStorage security error when cookies are blocked (Chrome)
+ * add debug(err) support. Closes #46
+ * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+ * fix package.json
+ * fix: Mobile Safari (private mode) is broken with debug
+ * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+ * add repository URL to package.json
+ * add DEBUG_COLORED to force colored output
+ * add browserify support
+ * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+ * Added .component to package.json
+ * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+ * Added support for "-" prefix in DEBUG [Vinay Pulim]
+ * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+ * Added: humanize diffs. Closes #8
+ * Added `debug.disable()` to the CS variant
+ * Removed padding. Closes #10
+ * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+ * Added browser variant support for older browsers [TooTallNate]
+ * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+ * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+ * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+ * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+ * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/Restaurant/node_modules/debug/LICENSE b/Restaurant/node_modules/debug/LICENSE
new file mode 100644
index 0000000..658c933
--- /dev/null
+++ b/Restaurant/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/Restaurant/node_modules/debug/Makefile b/Restaurant/node_modules/debug/Makefile
new file mode 100644
index 0000000..584da8b
--- /dev/null
+++ b/Restaurant/node_modules/debug/Makefile
@@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+ @NODE_ENV= $(PKG) install
+ @touch node_modules
+
+lint: .FORCE
+ eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+ istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+ mkdir -p dist
+
+ @$(BROWSERIFY) \
+ --standalone debug \
+ . > dist/debug.js
+
+ karma start --single-run
+ rimraf dist
+
+test: .FORCE
+ concurrently \
+ "make test-node" \
+ "make test-browser"
+
+coveralls:
+ cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean
diff --git a/Restaurant/node_modules/debug/README.md b/Restaurant/node_modules/debug/README.md
new file mode 100644
index 0000000..f67be6b
--- /dev/null
+++ b/Restaurant/node_modules/debug/README.md
@@ -0,0 +1,312 @@
+# debug
+[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers)
+[](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+ debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+ 
+
+ 
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+ When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+ 
+
+ When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+ 
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+ The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+ You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+ When running through Node.js, you can set a few environment variables that will
+ change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+ __Note:__ The environment variables beginning with `DEBUG_` end up being
+ converted into an Options object that gets used with `%o`/`%O` formatters.
+ See the Node.js documentation for
+ [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+ for the complete list.
+
+## Formatters
+
+
+ Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+ You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+ You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+ or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+ if you don't want to build it yourself.
+
+ Debug's enable state is currently persisted by `localStorage`.
+ Consider the situation shown below where you have `worker:a` and `worker:b`,
+ and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+ Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+ option. These are WebKit web inspectors, Firefox ([since version
+ 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+ and the Firebug plugin for Firefox (any version).
+
+ Colored output looks something like:
+
+ 
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+ ([eval]-wrapper:6:22)
+ at Module._compile (module.js:456:26)
+ at evalScript (node.js:532:25)
+ at startup (node.js:80:7)
+ at node.js:902:3
+```
+
+### process.env.NO_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `NO_DEPRECATION`
+is provided as a quick solution to silencing deprecation warnings from being
+output. The format of this is similar to that of `DEBUG`:
+
+```sh
+$ NO_DEPRECATION=my-module,othermod node app.js
+```
+
+This will suppress deprecations from being output for "my-module" and "othermod".
+The value is a list of comma-separated namespaces. To suppress every warning
+across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--no-deprecation` to the `node` executable will suppress
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not suppress the deperecations given to any "deprecation"
+event listeners, just the output to STDERR.
+
+### process.env.TRACE_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION`
+is provided as a solution to getting more detailed location information in deprecation
+warnings by including the entire stack trace. The format of this is the same as
+`NO_DEPRECATION`:
+
+```sh
+$ TRACE_DEPRECATION=my-module,othermod node app.js
+```
+
+This will include stack traces for deprecations being output for "my-module" and
+"othermod". The value is a list of comma-separated namespaces. To trace every
+warning across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--trace-deprecation` to the `node` executable will trace
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`.
+
+## Display
+
+
+
+When a user calls a function in your library that you mark deprecated, they
+will see the following written to STDERR (in the given colors, similar colors
+and layout to the `debug` module):
+
+```
+bright cyan bright yellow
+| | reset cyan
+| | | |
+▼ ▼ ▼ ▼
+my-cool-module deprecated oldfunction [eval]-wrapper:6:22
+▲ ▲ ▲ ▲
+| | | |
+namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+If the user redirects their STDERR to a file or somewhere that does not support
+colors, they see (similar layout to the `debug` module):
+
+```
+Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22
+▲ ▲ ▲ ▲ ▲
+| | | | |
+timestamp of message namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+## Examples
+
+### Deprecating all calls to a function
+
+This will display a deprecated message about "oldfunction" being deprecated
+from "my-module" on STDERR.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+// message automatically derived from function name
+// Object.oldfunction
+exports.oldfunction = deprecate.function(function oldfunction () {
+ // all calls to function are deprecated
+})
+
+// specific message
+exports.oldfunction = deprecate.function(function () {
+ // all calls to function are deprecated
+}, 'oldfunction')
+```
+
+### Conditionally deprecating a function call
+
+This will display a deprecated message about "weirdfunction" being deprecated
+from "my-module" on STDERR when called with less than 2 arguments.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ }
+}
+```
+
+When calling `deprecate` as a function, the warning is counted per call site
+within your own module, so you can display different deprecations depending
+on different situations and the users will still get all the warnings:
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ } else if (typeof arguments[0] !== 'string') {
+ // calls with non-string first argument are deprecated
+ deprecate('weirdfunction non-string first arg')
+ }
+}
+```
+
+### Deprecating property access
+
+This will display a deprecated message about "oldprop" being deprecated
+from "my-module" on STDERR when accessed. A deprecation will be displayed
+when setting the value and when getting the value.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.oldprop = 'something'
+
+// message automatically derives from property name
+deprecate.property(exports, 'oldprop')
+
+// explicit message
+deprecate.property(exports, 'oldprop', 'oldprop >= 0.10')
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-version-image]: https://img.shields.io/npm/v/depd.svg
+[npm-downloads-image]: https://img.shields.io/npm/dm/depd.svg
+[npm-url]: https://npmjs.org/package/depd
+[travis-image]: https://img.shields.io/travis/dougwilson/nodejs-depd/master.svg?label=linux
+[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd
+[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/nodejs-depd/master.svg?label=windows
+[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd
+[coveralls-image]: https://img.shields.io/coveralls/dougwilson/nodejs-depd/master.svg
+[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master
+[node-image]: https://img.shields.io/node/v/depd.svg
+[node-url]: https://nodejs.org/en/download/
diff --git a/Restaurant/node_modules/depd/index.js b/Restaurant/node_modules/depd/index.js
new file mode 100644
index 0000000..d758d3c
--- /dev/null
+++ b/Restaurant/node_modules/depd/index.js
@@ -0,0 +1,522 @@
+/*!
+ * depd
+ * Copyright(c) 2014-2017 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var callSiteToString = require('./lib/compat').callSiteToString
+var eventListenerCount = require('./lib/compat').eventListenerCount
+var relative = require('path').relative
+
+/**
+ * Module exports.
+ */
+
+module.exports = depd
+
+/**
+ * Get the path to base files on.
+ */
+
+var basePath = process.cwd()
+
+/**
+ * Determine if namespace is contained in the string.
+ */
+
+function containsNamespace (str, namespace) {
+ var vals = str.split(/[ ,]+/)
+ var ns = String(namespace).toLowerCase()
+
+ for (var i = 0; i < vals.length; i++) {
+ var val = vals[i]
+
+ // namespace contained
+ if (val && (val === '*' || val.toLowerCase() === ns)) {
+ return true
+ }
+ }
+
+ return false
+}
+
+/**
+ * Convert a data descriptor to accessor descriptor.
+ */
+
+function convertDataDescriptorToAccessor (obj, prop, message) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+ var value = descriptor.value
+
+ descriptor.get = function getter () { return value }
+
+ if (descriptor.writable) {
+ descriptor.set = function setter (val) { return (value = val) }
+ }
+
+ delete descriptor.value
+ delete descriptor.writable
+
+ Object.defineProperty(obj, prop, descriptor)
+
+ return descriptor
+}
+
+/**
+ * Create arguments string to keep arity.
+ */
+
+function createArgumentsString (arity) {
+ var str = ''
+
+ for (var i = 0; i < arity; i++) {
+ str += ', arg' + i
+ }
+
+ return str.substr(2)
+}
+
+/**
+ * Create stack string from stack.
+ */
+
+function createStackString (stack) {
+ var str = this.name + ': ' + this.namespace
+
+ if (this.message) {
+ str += ' deprecated ' + this.message
+ }
+
+ for (var i = 0; i < stack.length; i++) {
+ str += '\n at ' + callSiteToString(stack[i])
+ }
+
+ return str
+}
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+ var file = site[0]
+
+ function deprecate (message) {
+ // call to self as log
+ log.call(deprecate, message)
+ }
+
+ deprecate._file = file
+ deprecate._ignored = isignored(namespace)
+ deprecate._namespace = namespace
+ deprecate._traced = istraced(namespace)
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Determine if namespace is ignored.
+ */
+
+function isignored (namespace) {
+ /* istanbul ignore next: tested in a child processs */
+ if (process.noDeprecation) {
+ // --no-deprecation support
+ return true
+ }
+
+ var str = process.env.NO_DEPRECATION || ''
+
+ // namespace ignored
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Determine if namespace is traced.
+ */
+
+function istraced (namespace) {
+ /* istanbul ignore next: tested in a child processs */
+ if (process.traceDeprecation) {
+ // --trace-deprecation support
+ return true
+ }
+
+ var str = process.env.TRACE_DEPRECATION || ''
+
+ // namespace traced
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Display deprecation message.
+ */
+
+function log (message, site) {
+ var haslisteners = eventListenerCount(process, 'deprecation') !== 0
+
+ // abort early if no destination
+ if (!haslisteners && this._ignored) {
+ return
+ }
+
+ var caller
+ var callFile
+ var callSite
+ var depSite
+ var i = 0
+ var seen = false
+ var stack = getStack()
+ var file = this._file
+
+ if (site) {
+ // provided site
+ depSite = site
+ callSite = callSiteLocation(stack[1])
+ callSite.name = depSite.name
+ file = callSite[0]
+ } else {
+ // get call site
+ i = 2
+ depSite = callSiteLocation(stack[i])
+ callSite = depSite
+ }
+
+ // get caller of deprecated thing in relation to file
+ for (; i < stack.length; i++) {
+ caller = callSiteLocation(stack[i])
+ callFile = caller[0]
+
+ if (callFile === file) {
+ seen = true
+ } else if (callFile === this._file) {
+ file = this._file
+ } else if (seen) {
+ break
+ }
+ }
+
+ var key = caller
+ ? depSite.join(':') + '__' + caller.join(':')
+ : undefined
+
+ if (key !== undefined && key in this._warned) {
+ // already warned
+ return
+ }
+
+ this._warned[key] = true
+
+ // generate automatic message from call site
+ var msg = message
+ if (!msg) {
+ msg = callSite === depSite || !callSite.name
+ ? defaultMessage(depSite)
+ : defaultMessage(callSite)
+ }
+
+ // emit deprecation if listeners exist
+ if (haslisteners) {
+ var err = DeprecationError(this._namespace, msg, stack.slice(i))
+ process.emit('deprecation', err)
+ return
+ }
+
+ // format and write message
+ var format = process.stderr.isTTY
+ ? formatColor
+ : formatPlain
+ var output = format.call(this, msg, caller, stack.slice(i))
+ process.stderr.write(output + '\n', 'utf8')
+}
+
+/**
+ * Get call site location as array.
+ */
+
+function callSiteLocation (callSite) {
+ var file = callSite.getFileName() || ''
+ var line = callSite.getLineNumber()
+ var colm = callSite.getColumnNumber()
+
+ if (callSite.isEval()) {
+ file = callSite.getEvalOrigin() + ', ' + file
+ }
+
+ var site = [file, line, colm]
+
+ site.callSite = callSite
+ site.name = callSite.getFunctionName()
+
+ return site
+}
+
+/**
+ * Generate a default message from the site.
+ */
+
+function defaultMessage (site) {
+ var callSite = site.callSite
+ var funcName = site.name
+
+ // make useful anonymous name
+ if (!funcName) {
+ funcName = ''
+ }
+
+ var context = callSite.getThis()
+ var typeName = context && callSite.getTypeName()
+
+ // ignore useless type name
+ if (typeName === 'Object') {
+ typeName = undefined
+ }
+
+ // make useful type name
+ if (typeName === 'Function') {
+ typeName = context.name || typeName
+ }
+
+ return typeName && callSite.getMethodName()
+ ? typeName + '.' + funcName
+ : funcName
+}
+
+/**
+ * Format deprecation message without color.
+ */
+
+function formatPlain (msg, caller, stack) {
+ var timestamp = new Date().toUTCString()
+
+ var formatted = timestamp +
+ ' ' + this._namespace +
+ ' deprecated ' + msg
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n at ' + callSiteToString(stack[i])
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' at ' + formatLocation(caller)
+ }
+
+ return formatted
+}
+
+/**
+ * Format deprecation message with color.
+ */
+
+function formatColor (msg, caller, stack) {
+ var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan
+ ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow
+ ' \x1b[0m' + msg + '\x1b[39m' // reset
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n \x1b[36mat ' + callSiteToString(stack[i]) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+}
+
+/**
+ * Format call site location.
+ */
+
+function formatLocation (callSite) {
+ return relative(basePath, callSite[0]) +
+ ':' + callSite[1] +
+ ':' + callSite[2]
+}
+
+/**
+ * Get the stack as array of call sites.
+ */
+
+function getStack () {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = Math.max(10, limit)
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice this function off the top
+ var stack = obj.stack.slice(1)
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack
+}
+
+/**
+ * Capture call site stack from v8.
+ */
+
+function prepareObjectStackTrace (obj, stack) {
+ return stack
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ var args = createArgumentsString(fn.length)
+ var deprecate = this // eslint-disable-line no-unused-vars
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ site.name = fn.name
+
+ // eslint-disable-next-line no-eval
+ var deprecatedfn = eval('(function (' + args + ') {\n' +
+ '"use strict"\n' +
+ 'log.call(deprecate, message, site)\n' +
+ 'return fn.apply(this, arguments)\n' +
+ '})')
+
+ return deprecatedfn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+
+ var deprecate = this
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ // set site name
+ site.name = prop
+
+ // convert data descriptor
+ if ('value' in descriptor) {
+ descriptor = convertDataDescriptorToAccessor(obj, prop, message)
+ }
+
+ var get = descriptor.get
+ var set = descriptor.set
+
+ // wrap getter
+ if (typeof get === 'function') {
+ descriptor.get = function getter () {
+ log.call(deprecate, message, site)
+ return get.apply(this, arguments)
+ }
+ }
+
+ // wrap setter
+ if (typeof set === 'function') {
+ descriptor.set = function setter () {
+ log.call(deprecate, message, site)
+ return set.apply(this, arguments)
+ }
+ }
+
+ Object.defineProperty(obj, prop, descriptor)
+}
+
+/**
+ * Create DeprecationError for deprecation
+ */
+
+function DeprecationError (namespace, message, stack) {
+ var error = new Error()
+ var stackString
+
+ Object.defineProperty(error, 'constructor', {
+ value: DeprecationError
+ })
+
+ Object.defineProperty(error, 'message', {
+ configurable: true,
+ enumerable: false,
+ value: message,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'name', {
+ enumerable: false,
+ configurable: true,
+ value: 'DeprecationError',
+ writable: true
+ })
+
+ Object.defineProperty(error, 'namespace', {
+ configurable: true,
+ enumerable: false,
+ value: namespace,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'stack', {
+ configurable: true,
+ enumerable: false,
+ get: function () {
+ if (stackString !== undefined) {
+ return stackString
+ }
+
+ // prepare stack trace
+ return (stackString = createStackString.call(this, stack))
+ },
+ set: function setter (val) {
+ stackString = val
+ }
+ })
+
+ return error
+}
diff --git a/Restaurant/node_modules/depd/lib/browser/index.js b/Restaurant/node_modules/depd/lib/browser/index.js
new file mode 100644
index 0000000..6be45cc
--- /dev/null
+++ b/Restaurant/node_modules/depd/lib/browser/index.js
@@ -0,0 +1,77 @@
+/*!
+ * depd
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = depd
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ function deprecate (message) {
+ // no-op in browser
+ }
+
+ deprecate._file = undefined
+ deprecate._ignored = true
+ deprecate._namespace = namespace
+ deprecate._traced = false
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ return fn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+}
diff --git a/Restaurant/node_modules/depd/lib/compat/callsite-tostring.js b/Restaurant/node_modules/depd/lib/compat/callsite-tostring.js
new file mode 100644
index 0000000..73186dc
--- /dev/null
+++ b/Restaurant/node_modules/depd/lib/compat/callsite-tostring.js
@@ -0,0 +1,103 @@
+/*!
+ * depd
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ */
+
+module.exports = callSiteToString
+
+/**
+ * Format a CallSite file location to a string.
+ */
+
+function callSiteFileLocation (callSite) {
+ var fileName
+ var fileLocation = ''
+
+ if (callSite.isNative()) {
+ fileLocation = 'native'
+ } else if (callSite.isEval()) {
+ fileName = callSite.getScriptNameOrSourceURL()
+ if (!fileName) {
+ fileLocation = callSite.getEvalOrigin()
+ }
+ } else {
+ fileName = callSite.getFileName()
+ }
+
+ if (fileName) {
+ fileLocation += fileName
+
+ var lineNumber = callSite.getLineNumber()
+ if (lineNumber != null) {
+ fileLocation += ':' + lineNumber
+
+ var columnNumber = callSite.getColumnNumber()
+ if (columnNumber) {
+ fileLocation += ':' + columnNumber
+ }
+ }
+ }
+
+ return fileLocation || 'unknown source'
+}
+
+/**
+ * Format a CallSite to a string.
+ */
+
+function callSiteToString (callSite) {
+ var addSuffix = true
+ var fileLocation = callSiteFileLocation(callSite)
+ var functionName = callSite.getFunctionName()
+ var isConstructor = callSite.isConstructor()
+ var isMethodCall = !(callSite.isToplevel() || isConstructor)
+ var line = ''
+
+ if (isMethodCall) {
+ var methodName = callSite.getMethodName()
+ var typeName = getConstructorName(callSite)
+
+ if (functionName) {
+ if (typeName && functionName.indexOf(typeName) !== 0) {
+ line += typeName + '.'
+ }
+
+ line += functionName
+
+ if (methodName && functionName.lastIndexOf('.' + methodName) !== functionName.length - methodName.length - 1) {
+ line += ' [as ' + methodName + ']'
+ }
+ } else {
+ line += typeName + '.' + (methodName || '')
+ }
+ } else if (isConstructor) {
+ line += 'new ' + (functionName || '')
+ } else if (functionName) {
+ line += functionName
+ } else {
+ addSuffix = false
+ line += fileLocation
+ }
+
+ if (addSuffix) {
+ line += ' (' + fileLocation + ')'
+ }
+
+ return line
+}
+
+/**
+ * Get constructor name of reviver.
+ */
+
+function getConstructorName (obj) {
+ var receiver = obj.receiver
+ return (receiver.constructor && receiver.constructor.name) || null
+}
diff --git a/Restaurant/node_modules/depd/lib/compat/event-listener-count.js b/Restaurant/node_modules/depd/lib/compat/event-listener-count.js
new file mode 100644
index 0000000..3a8925d
--- /dev/null
+++ b/Restaurant/node_modules/depd/lib/compat/event-listener-count.js
@@ -0,0 +1,22 @@
+/*!
+ * depd
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = eventListenerCount
+
+/**
+ * Get the count of listeners on an event emitter of a specific type.
+ */
+
+function eventListenerCount (emitter, type) {
+ return emitter.listeners(type).length
+}
diff --git a/Restaurant/node_modules/depd/lib/compat/index.js b/Restaurant/node_modules/depd/lib/compat/index.js
new file mode 100644
index 0000000..955b333
--- /dev/null
+++ b/Restaurant/node_modules/depd/lib/compat/index.js
@@ -0,0 +1,79 @@
+/*!
+ * depd
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var EventEmitter = require('events').EventEmitter
+
+/**
+ * Module exports.
+ * @public
+ */
+
+lazyProperty(module.exports, 'callSiteToString', function callSiteToString () {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ function prepareObjectStackTrace (obj, stack) {
+ return stack
+ }
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = 2
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice the stack
+ var stack = obj.stack.slice()
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack[0].toString ? toString : require('./callsite-tostring')
+})
+
+lazyProperty(module.exports, 'eventListenerCount', function eventListenerCount () {
+ return EventEmitter.listenerCount || require('./event-listener-count')
+})
+
+/**
+ * Define a lazy property.
+ */
+
+function lazyProperty (obj, prop, getter) {
+ function get () {
+ var val = getter()
+
+ Object.defineProperty(obj, prop, {
+ configurable: true,
+ enumerable: true,
+ value: val
+ })
+
+ return val
+ }
+
+ Object.defineProperty(obj, prop, {
+ configurable: true,
+ enumerable: true,
+ get: get
+ })
+}
+
+/**
+ * Call toString() on the obj
+ */
+
+function toString (obj) {
+ return obj.toString()
+}
diff --git a/Restaurant/node_modules/depd/package.json b/Restaurant/node_modules/depd/package.json
new file mode 100644
index 0000000..c2ba92e
--- /dev/null
+++ b/Restaurant/node_modules/depd/package.json
@@ -0,0 +1,79 @@
+{
+ "_from": "depd@~1.1.2",
+ "_id": "depd@1.1.2",
+ "_inBundle": false,
+ "_integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=",
+ "_location": "/depd",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "depd@~1.1.2",
+ "name": "depd",
+ "escapedName": "depd",
+ "rawSpec": "~1.1.2",
+ "saveSpec": null,
+ "fetchSpec": "~1.1.2"
+ },
+ "_requiredBy": [
+ "/body-parser",
+ "/express",
+ "/http-errors",
+ "/send"
+ ],
+ "_resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz",
+ "_shasum": "9bcd52e14c097763e749b274c4346ed2e560b5a9",
+ "_spec": "depd@~1.1.2",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "browser": "lib/browser/index.js",
+ "bugs": {
+ "url": "https://github.com/dougwilson/nodejs-depd/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Deprecate all the things",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "3.19.0",
+ "eslint-config-standard": "7.1.0",
+ "eslint-plugin-markdown": "1.0.0-beta.7",
+ "eslint-plugin-promise": "3.6.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "~1.21.5"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "lib/",
+ "History.md",
+ "LICENSE",
+ "index.js",
+ "Readme.md"
+ ],
+ "homepage": "https://github.com/dougwilson/nodejs-depd#readme",
+ "keywords": [
+ "deprecate",
+ "deprecated"
+ ],
+ "license": "MIT",
+ "name": "depd",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/dougwilson/nodejs-depd.git"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --no-exit test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/"
+ },
+ "version": "1.1.2"
+}
diff --git a/Restaurant/node_modules/destroy/LICENSE b/Restaurant/node_modules/destroy/LICENSE
new file mode 100644
index 0000000..a7ae8ee
--- /dev/null
+++ b/Restaurant/node_modules/destroy/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/Restaurant/node_modules/destroy/README.md b/Restaurant/node_modules/destroy/README.md
new file mode 100644
index 0000000..6474bc3
--- /dev/null
+++ b/Restaurant/node_modules/destroy/README.md
@@ -0,0 +1,60 @@
+# Destroy
+
+[![NPM version][npm-image]][npm-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+[![Gittip][gittip-image]][gittip-url]
+
+Destroy a stream.
+
+This module is meant to ensure a stream gets destroyed, handling different APIs
+and Node.js bugs.
+
+## API
+
+```js
+var destroy = require('destroy')
+```
+
+### destroy(stream)
+
+Destroy the given stream. In most cases, this is identical to a simple
+`stream.destroy()` call. The rules are as follows for a given stream:
+
+ 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()`
+ and add a listener to the `open` event to call `stream.close()` if it is
+ fired. This is for a Node.js bug that will leak a file descriptor if
+ `.destroy()` is called before `open`.
+ 2. If the `stream` is not an instance of `Stream`, then nothing happens.
+ 3. If the `stream` has a `.destroy()` method, then call it.
+
+The function returns the `stream` passed in as the argument.
+
+## Example
+
+```js
+var destroy = require('destroy')
+
+var fs = require('fs')
+var stream = fs.createReadStream('package.json')
+
+// ... and later
+destroy(stream)
+```
+
+[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/destroy
+[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square
+[github-url]: https://github.com/stream-utils/destroy/tags
+[travis-image]: https://img.shields.io/travis/stream-utils/destroy.svg?style=flat-square
+[travis-url]: https://travis-ci.org/stream-utils/destroy
+[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master
+[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/destroy
+[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
+[gittip-url]: https://www.gittip.com/jonathanong/
diff --git a/Restaurant/node_modules/destroy/index.js b/Restaurant/node_modules/destroy/index.js
new file mode 100644
index 0000000..6da2d26
--- /dev/null
+++ b/Restaurant/node_modules/destroy/index.js
@@ -0,0 +1,75 @@
+/*!
+ * destroy
+ * Copyright(c) 2014 Jonathan Ong
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var ReadStream = require('fs').ReadStream
+var Stream = require('stream')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = destroy
+
+/**
+ * Destroy a stream.
+ *
+ * @param {object} stream
+ * @public
+ */
+
+function destroy(stream) {
+ if (stream instanceof ReadStream) {
+ return destroyReadStream(stream)
+ }
+
+ if (!(stream instanceof Stream)) {
+ return stream
+ }
+
+ if (typeof stream.destroy === 'function') {
+ stream.destroy()
+ }
+
+ return stream
+}
+
+/**
+ * Destroy a ReadStream.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function destroyReadStream(stream) {
+ stream.destroy()
+
+ if (typeof stream.close === 'function') {
+ // node.js core bug work-around
+ stream.on('open', onOpenClose)
+ }
+
+ return stream
+}
+
+/**
+ * On open handler to close stream.
+ * @private
+ */
+
+function onOpenClose() {
+ if (typeof this.fd === 'number') {
+ // actually close down the fd
+ this.close()
+ }
+}
diff --git a/Restaurant/node_modules/destroy/package.json b/Restaurant/node_modules/destroy/package.json
new file mode 100644
index 0000000..905a2c6
--- /dev/null
+++ b/Restaurant/node_modules/destroy/package.json
@@ -0,0 +1,71 @@
+{
+ "_from": "destroy@~1.0.4",
+ "_id": "destroy@1.0.4",
+ "_inBundle": false,
+ "_integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=",
+ "_location": "/destroy",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "destroy@~1.0.4",
+ "name": "destroy",
+ "escapedName": "destroy",
+ "rawSpec": "~1.0.4",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.4"
+ },
+ "_requiredBy": [
+ "/send"
+ ],
+ "_resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz",
+ "_shasum": "978857442c44749e4206613e37946205826abd80",
+ "_spec": "destroy@~1.0.4",
+ "_where": "F:\\Restaurant\\node_modules\\send",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "bugs": {
+ "url": "https://github.com/stream-utils/destroy/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "destroy a stream if possible",
+ "devDependencies": {
+ "istanbul": "0.4.2",
+ "mocha": "2.3.4"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "homepage": "https://github.com/stream-utils/destroy#readme",
+ "keywords": [
+ "stream",
+ "streams",
+ "destroy",
+ "cleanup",
+ "leak",
+ "fd"
+ ],
+ "license": "MIT",
+ "name": "destroy",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/stream-utils/destroy.git"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot"
+ },
+ "version": "1.0.4"
+}
diff --git a/Restaurant/node_modules/ee-first/LICENSE b/Restaurant/node_modules/ee-first/LICENSE
new file mode 100644
index 0000000..a7ae8ee
--- /dev/null
+++ b/Restaurant/node_modules/ee-first/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/Restaurant/node_modules/ee-first/README.md b/Restaurant/node_modules/ee-first/README.md
new file mode 100644
index 0000000..cbd2478
--- /dev/null
+++ b/Restaurant/node_modules/ee-first/README.md
@@ -0,0 +1,80 @@
+# EE First
+
+[![NPM version][npm-image]][npm-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+[![Gittip][gittip-image]][gittip-url]
+
+Get the first event in a set of event emitters and event pairs,
+then clean up after itself.
+
+## Install
+
+```sh
+$ npm install ee-first
+```
+
+## API
+
+```js
+var first = require('ee-first')
+```
+
+### first(arr, listener)
+
+Invoke `listener` on the first event from the list specified in `arr`. `arr` is
+an array of arrays, with each array in the format `[ee, ...event]`. `listener`
+will be called only once, the first time any of the given events are emitted. If
+`error` is one of the listened events, then if that fires first, the `listener`
+will be given the `err` argument.
+
+The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the
+first argument emitted from an `error` event, if applicable; `ee` is the event
+emitter that fired; `event` is the string event name that fired; and `args` is an
+array of the arguments that were emitted on the event.
+
+```js
+var ee1 = new EventEmitter()
+var ee2 = new EventEmitter()
+
+first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+```
+
+#### .cancel()
+
+The group of listeners can be cancelled before being invoked and have all the event
+listeners removed from the underlying event emitters.
+
+```js
+var thunk = first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+
+// cancel and clean up
+thunk.cancel()
+```
+
+[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/ee-first
+[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square
+[github-url]: https://github.com/jonathanong/ee-first/tags
+[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square
+[travis-url]: https://travis-ci.org/jonathanong/ee-first
+[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master
+[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/ee-first
+[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
+[gittip-url]: https://www.gittip.com/jonathanong/
diff --git a/Restaurant/node_modules/ee-first/index.js b/Restaurant/node_modules/ee-first/index.js
new file mode 100644
index 0000000..501287c
--- /dev/null
+++ b/Restaurant/node_modules/ee-first/index.js
@@ -0,0 +1,95 @@
+/*!
+ * ee-first
+ * Copyright(c) 2014 Jonathan Ong
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = first
+
+/**
+ * Get the first event in a set of event emitters and event pairs.
+ *
+ * @param {array} stuff
+ * @param {function} done
+ * @public
+ */
+
+function first(stuff, done) {
+ if (!Array.isArray(stuff))
+ throw new TypeError('arg must be an array of [ee, events...] arrays')
+
+ var cleanups = []
+
+ for (var i = 0; i < stuff.length; i++) {
+ var arr = stuff[i]
+
+ if (!Array.isArray(arr) || arr.length < 2)
+ throw new TypeError('each array member must be [ee, events...]')
+
+ var ee = arr[0]
+
+ for (var j = 1; j < arr.length; j++) {
+ var event = arr[j]
+ var fn = listener(event, callback)
+
+ // listen to the event
+ ee.on(event, fn)
+ // push this listener to the list of cleanups
+ cleanups.push({
+ ee: ee,
+ event: event,
+ fn: fn,
+ })
+ }
+ }
+
+ function callback() {
+ cleanup()
+ done.apply(null, arguments)
+ }
+
+ function cleanup() {
+ var x
+ for (var i = 0; i < cleanups.length; i++) {
+ x = cleanups[i]
+ x.ee.removeListener(x.event, x.fn)
+ }
+ }
+
+ function thunk(fn) {
+ done = fn
+ }
+
+ thunk.cancel = cleanup
+
+ return thunk
+}
+
+/**
+ * Create the event listener.
+ * @private
+ */
+
+function listener(event, done) {
+ return function onevent(arg1) {
+ var args = new Array(arguments.length)
+ var ee = this
+ var err = event === 'error'
+ ? arg1
+ : null
+
+ // copy args to prevent arguments escaping scope
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i]
+ }
+
+ done(err, ee, event, args)
+ }
+}
diff --git a/Restaurant/node_modules/ee-first/package.json b/Restaurant/node_modules/ee-first/package.json
new file mode 100644
index 0000000..6d341ee
--- /dev/null
+++ b/Restaurant/node_modules/ee-first/package.json
@@ -0,0 +1,63 @@
+{
+ "_from": "ee-first@1.1.1",
+ "_id": "ee-first@1.1.1",
+ "_inBundle": false,
+ "_integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=",
+ "_location": "/ee-first",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "ee-first@1.1.1",
+ "name": "ee-first",
+ "escapedName": "ee-first",
+ "rawSpec": "1.1.1",
+ "saveSpec": null,
+ "fetchSpec": "1.1.1"
+ },
+ "_requiredBy": [
+ "/on-finished"
+ ],
+ "_resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
+ "_shasum": "590c61156b0ae2f4f0255732a158b266bc56b21d",
+ "_spec": "ee-first@1.1.1",
+ "_where": "F:\\Restaurant\\node_modules\\on-finished",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "bugs": {
+ "url": "https://github.com/jonathanong/ee-first/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "return the first event in a set of ee/event pairs",
+ "devDependencies": {
+ "istanbul": "0.3.9",
+ "mocha": "2.2.5"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "homepage": "https://github.com/jonathanong/ee-first#readme",
+ "license": "MIT",
+ "name": "ee-first",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jonathanong/ee-first.git"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "version": "1.1.1"
+}
diff --git a/Restaurant/node_modules/encodeurl/HISTORY.md b/Restaurant/node_modules/encodeurl/HISTORY.md
new file mode 100644
index 0000000..41313b2
--- /dev/null
+++ b/Restaurant/node_modules/encodeurl/HISTORY.md
@@ -0,0 +1,14 @@
+1.0.2 / 2018-01-21
+==================
+
+ * Fix encoding `%` as last character
+
+1.0.1 / 2016-06-09
+==================
+
+ * Fix encoding unpaired surrogates at start/end of string
+
+1.0.0 / 2016-06-08
+==================
+
+ * Initial release
diff --git a/Restaurant/node_modules/encodeurl/LICENSE b/Restaurant/node_modules/encodeurl/LICENSE
new file mode 100644
index 0000000..8812229
--- /dev/null
+++ b/Restaurant/node_modules/encodeurl/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/Restaurant/node_modules/encodeurl/README.md b/Restaurant/node_modules/encodeurl/README.md
new file mode 100644
index 0000000..127c5a0
--- /dev/null
+++ b/Restaurant/node_modules/encodeurl/README.md
@@ -0,0 +1,128 @@
+# encodeurl
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install encodeurl
+```
+
+## API
+
+```js
+var encodeUrl = require('encodeurl')
+```
+
+### encodeUrl(url)
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+
+This function will take an already-encoded URL and encode all the non-URL
+code points (as UTF-8 byte sequences). This function will not encode the
+"%" character unless it is not part of a valid sequence (`%20` will be
+left as-is, but `%foo` will be encoded as `%25foo`).
+
+This encode is meant to be "safe" and does not throw errors. It will try as
+hard as it can to properly encode the given URL, including replacing any raw,
+unpaired surrogate pairs with the Unicode replacement character prior to
+encoding.
+
+This function is _similar_ to the intrinsic function `encodeURI`, except it
+will not encode the `%` character if that is part of a valid sequence, will
+not encode `[` and `]` (for IPv6 hostnames) and will replace raw, unpaired
+surrogate pairs with the Unicode replacement character (instead of throwing).
+
+## Examples
+
+### Encode a URL containing user-controled data
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+
+http.createServer(function onRequest (req, res) {
+ // get encoded form of inbound url
+ var url = encodeUrl(req.url)
+
+ // create html message
+ var body = 'Location ' + escapeHtml(url) + ' not found
'
+
+ // send a 404
+ res.statusCode = 404
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.end(body, 'utf-8')
+})
+```
+
+### Encode a URL for use in a header field
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+var url = require('url')
+
+http.createServer(function onRequest (req, res) {
+ // parse inbound url
+ var href = url.parse(req)
+
+ // set new host for redirect
+ href.host = 'localhost'
+ href.protocol = 'https:'
+ href.slashes = true
+
+ // create location header
+ var location = encodeUrl(url.format(href))
+
+ // create html message
+ var body = 'Redirecting to new site: ' + escapeHtml(location) + '
'
+
+ // send a 301
+ res.statusCode = 301
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.setHeader('Location', location)
+ res.end(body, 'utf-8')
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+$ npm run lint
+```
+
+## References
+
+- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986]
+- [WHATWG URL Living Standard][whatwg-url]
+
+[rfc-3986]: https://tools.ietf.org/html/rfc3986
+[whatwg-url]: https://url.spec.whatwg.org/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/encodeurl.svg
+[npm-url]: https://npmjs.org/package/encodeurl
+[node-version-image]: https://img.shields.io/node/v/encodeurl.svg
+[node-version-url]: https://nodejs.org/en/download
+[travis-image]: https://img.shields.io/travis/pillarjs/encodeurl.svg
+[travis-url]: https://travis-ci.org/pillarjs/encodeurl
+[coveralls-image]: https://img.shields.io/coveralls/pillarjs/encodeurl.svg
+[coveralls-url]: https://coveralls.io/r/pillarjs/encodeurl?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/encodeurl.svg
+[downloads-url]: https://npmjs.org/package/encodeurl
diff --git a/Restaurant/node_modules/encodeurl/index.js b/Restaurant/node_modules/encodeurl/index.js
new file mode 100644
index 0000000..fc4906c
--- /dev/null
+++ b/Restaurant/node_modules/encodeurl/index.js
@@ -0,0 +1,60 @@
+/*!
+ * encodeurl
+ * Copyright(c) 2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = encodeUrl
+
+/**
+ * RegExp to match non-URL code points, *after* encoding (i.e. not including "%")
+ * and including invalid escape sequences.
+ * @private
+ */
+
+var ENCODE_CHARS_REGEXP = /(?:[^\x21\x25\x26-\x3B\x3D\x3F-\x5B\x5D\x5F\x61-\x7A\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g
+
+/**
+ * RegExp to match unmatched surrogate pair.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g
+
+/**
+ * String to replace unmatched surrogate pair with.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2'
+
+/**
+ * Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+ *
+ * This function will take an already-encoded URL and encode all the non-URL
+ * code points. This function will not encode the "%" character unless it is
+ * not part of a valid sequence (`%20` will be left as-is, but `%foo` will
+ * be encoded as `%25foo`).
+ *
+ * This encode is meant to be "safe" and does not throw errors. It will try as
+ * hard as it can to properly encode the given URL, including replacing any raw,
+ * unpaired surrogate pairs with the Unicode replacement character prior to
+ * encoding.
+ *
+ * @param {string} url
+ * @return {string}
+ * @public
+ */
+
+function encodeUrl (url) {
+ return String(url)
+ .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE)
+ .replace(ENCODE_CHARS_REGEXP, encodeURI)
+}
diff --git a/Restaurant/node_modules/encodeurl/package.json b/Restaurant/node_modules/encodeurl/package.json
new file mode 100644
index 0000000..7387414
--- /dev/null
+++ b/Restaurant/node_modules/encodeurl/package.json
@@ -0,0 +1,78 @@
+{
+ "_from": "encodeurl@~1.0.2",
+ "_id": "encodeurl@1.0.2",
+ "_inBundle": false,
+ "_integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=",
+ "_location": "/encodeurl",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "encodeurl@~1.0.2",
+ "name": "encodeurl",
+ "escapedName": "encodeurl",
+ "rawSpec": "~1.0.2",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.2"
+ },
+ "_requiredBy": [
+ "/express",
+ "/finalhandler",
+ "/send",
+ "/serve-static"
+ ],
+ "_resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz",
+ "_shasum": "ad3ff4c86ec2d029322f5a02c3a9a606c95b3f59",
+ "_spec": "encodeurl@~1.0.2",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "bugs": {
+ "url": "https://github.com/pillarjs/encodeurl/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences",
+ "devDependencies": {
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.8.0",
+ "eslint-plugin-node": "5.2.1",
+ "eslint-plugin-promise": "3.6.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "2.5.3"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/pillarjs/encodeurl#readme",
+ "keywords": [
+ "encode",
+ "encodeurl",
+ "url"
+ ],
+ "license": "MIT",
+ "name": "encodeurl",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/pillarjs/encodeurl.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "version": "1.0.2"
+}
diff --git a/Restaurant/node_modules/escape-html/LICENSE b/Restaurant/node_modules/escape-html/LICENSE
new file mode 100644
index 0000000..2e70de9
--- /dev/null
+++ b/Restaurant/node_modules/escape-html/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2013 TJ Holowaychuk
+Copyright (c) 2015 Andreas Lubbe
+Copyright (c) 2015 Tiancheng "Timothy" Gu
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/Restaurant/node_modules/escape-html/Readme.md b/Restaurant/node_modules/escape-html/Readme.md
new file mode 100644
index 0000000..653d9ea
--- /dev/null
+++ b/Restaurant/node_modules/escape-html/Readme.md
@@ -0,0 +1,43 @@
+
+# escape-html
+
+ Escape string for use in HTML
+
+## Example
+
+```js
+var escape = require('escape-html');
+var html = escape('foo & bar');
+// -> foo & bar
+```
+
+## Benchmark
+
+```
+$ npm run-script bench
+
+> escape-html@1.0.3 bench nodejs-escape-html
+> node benchmark/index.js
+
+
+ http_parser@1.0
+ node@0.10.33
+ v8@3.14.5.9
+ ares@1.9.0-DEV
+ uv@0.10.29
+ zlib@1.2.3
+ modules@11
+ openssl@1.0.1j
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ no special characters x 19,435,271 ops/sec ±0.85% (187 runs sampled)
+ single special character x 6,132,421 ops/sec ±0.67% (194 runs sampled)
+ many special characters x 3,175,826 ops/sec ±0.65% (193 runs sampled)
+```
+
+## License
+
+ MIT
\ No newline at end of file
diff --git a/Restaurant/node_modules/escape-html/index.js b/Restaurant/node_modules/escape-html/index.js
new file mode 100644
index 0000000..bf9e226
--- /dev/null
+++ b/Restaurant/node_modules/escape-html/index.js
@@ -0,0 +1,78 @@
+/*!
+ * escape-html
+ * Copyright(c) 2012-2013 TJ Holowaychuk
+ * Copyright(c) 2015 Andreas Lubbe
+ * Copyright(c) 2015 Tiancheng "Timothy" Gu
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var matchHtmlRegExp = /["'&<>]/;
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = escapeHtml;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @param {string} string The string to escape for inserting into HTML
+ * @return {string}
+ * @public
+ */
+
+function escapeHtml(string) {
+ var str = '' + string;
+ var match = matchHtmlRegExp.exec(str);
+
+ if (!match) {
+ return str;
+ }
+
+ var escape;
+ var html = '';
+ var index = 0;
+ var lastIndex = 0;
+
+ for (index = match.index; index < str.length; index++) {
+ switch (str.charCodeAt(index)) {
+ case 34: // "
+ escape = '"';
+ break;
+ case 38: // &
+ escape = '&';
+ break;
+ case 39: // '
+ escape = ''';
+ break;
+ case 60: // <
+ escape = '<';
+ break;
+ case 62: // >
+ escape = '>';
+ break;
+ default:
+ continue;
+ }
+
+ if (lastIndex !== index) {
+ html += str.substring(lastIndex, index);
+ }
+
+ lastIndex = index + 1;
+ html += escape;
+ }
+
+ return lastIndex !== index
+ ? html + str.substring(lastIndex, index)
+ : html;
+}
diff --git a/Restaurant/node_modules/escape-html/package.json b/Restaurant/node_modules/escape-html/package.json
new file mode 100644
index 0000000..c182b30
--- /dev/null
+++ b/Restaurant/node_modules/escape-html/package.json
@@ -0,0 +1,59 @@
+{
+ "_from": "escape-html@~1.0.3",
+ "_id": "escape-html@1.0.3",
+ "_inBundle": false,
+ "_integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=",
+ "_location": "/escape-html",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "escape-html@~1.0.3",
+ "name": "escape-html",
+ "escapedName": "escape-html",
+ "rawSpec": "~1.0.3",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.3"
+ },
+ "_requiredBy": [
+ "/express",
+ "/finalhandler",
+ "/send",
+ "/serve-static"
+ ],
+ "_resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
+ "_shasum": "0258eae4d3d0c0974de1c169188ef0051d1d1988",
+ "_spec": "escape-html@~1.0.3",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "bugs": {
+ "url": "https://github.com/component/escape-html/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Escape string for use in HTML",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "1.0.0"
+ },
+ "files": [
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/component/escape-html#readme",
+ "keywords": [
+ "escape",
+ "html",
+ "utility"
+ ],
+ "license": "MIT",
+ "name": "escape-html",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/component/escape-html.git"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js"
+ },
+ "version": "1.0.3"
+}
diff --git a/Restaurant/node_modules/etag/HISTORY.md b/Restaurant/node_modules/etag/HISTORY.md
new file mode 100644
index 0000000..222b293
--- /dev/null
+++ b/Restaurant/node_modules/etag/HISTORY.md
@@ -0,0 +1,83 @@
+1.8.1 / 2017-09-12
+==================
+
+ * perf: replace regular expression with substring
+
+1.8.0 / 2017-02-18
+==================
+
+ * Use SHA1 instead of MD5 for ETag hashing
+ - Improves performance for larger entities
+ - Works with FIPS 140-2 OpenSSL configuration
+
+1.7.0 / 2015-06-08
+==================
+
+ * Always include entity length in ETags for hash length extensions
+ * Generate non-Stats ETags using MD5 only (no longer CRC32)
+ * Improve stat performance by removing hashing
+ * Remove base64 padding in ETags to shorten
+ * Use MD5 instead of MD4 in weak ETags over 1KB
+
+1.6.0 / 2015-05-10
+==================
+
+ * Improve support for JXcore
+ * Remove requirement of `atime` in the stats object
+ * Support "fake" stats objects in environments without `fs`
+
+1.5.1 / 2014-11-19
+==================
+
+ * deps: crc@3.2.1
+ - Minor fixes
+
+1.5.0 / 2014-10-14
+==================
+
+ * Improve string performance
+ * Slightly improve speed for weak ETags over 1KB
+
+1.4.0 / 2014-09-21
+==================
+
+ * Support "fake" stats objects
+ * Support Node.js 0.6
+
+1.3.1 / 2014-09-14
+==================
+
+ * Use the (new and improved) `crc` for crc32
+
+1.3.0 / 2014-08-29
+==================
+
+ * Default strings to strong ETags
+ * Improve speed for weak ETags over 1KB
+
+1.2.1 / 2014-08-29
+==================
+
+ * Use the (much faster) `buffer-crc32` for crc32
+
+1.2.0 / 2014-08-24
+==================
+
+ * Add support for file stat objects
+
+1.1.0 / 2014-08-24
+==================
+
+ * Add fast-path for empty entity
+ * Add weak ETag generation
+ * Shrink size of generated ETags
+
+1.0.1 / 2014-08-24
+==================
+
+ * Fix behavior of string containing Unicode
+
+1.0.0 / 2014-05-18
+==================
+
+ * Initial release
diff --git a/Restaurant/node_modules/etag/LICENSE b/Restaurant/node_modules/etag/LICENSE
new file mode 100644
index 0000000..cab251c
--- /dev/null
+++ b/Restaurant/node_modules/etag/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/Restaurant/node_modules/etag/README.md b/Restaurant/node_modules/etag/README.md
new file mode 100644
index 0000000..09c2169
--- /dev/null
+++ b/Restaurant/node_modules/etag/README.md
@@ -0,0 +1,159 @@
+# etag
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create simple HTTP ETags
+
+This module generates HTTP ETags (as defined in RFC 7232) for use in
+HTTP responses.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install etag
+```
+
+## API
+
+
+
+```js
+var etag = require('etag')
+```
+
+### etag(entity, [options])
+
+Generate a strong ETag for the given entity. This should be the complete
+body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By
+default, a strong ETag is generated except for `fs.Stats`, which will
+generate a weak ETag (this can be overwritten by `options.weak`).
+
+
+
+```js
+res.setHeader('ETag', etag(body))
+```
+
+#### Options
+
+`etag` accepts these properties in the options object.
+
+##### weak
+
+Specifies if the generated ETag will include the weak validator mark (that
+is, the leading `W/`). The actual entity tag is the same. The default value
+is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`.
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```bash
+$ npm run-script bench
+
+> etag@1.8.1 bench nodejs-etag
+> node benchmark/index.js
+
+ http_parser@2.7.0
+ node@6.11.1
+ v8@5.1.281.103
+ uv@1.11.0
+ zlib@1.2.11
+ ares@1.10.1-DEV
+ icu@58.2
+ modules@48
+ openssl@1.0.2k
+
+> node benchmark/body0-100b.js
+
+ 100B body
+
+ 4 tests completed.
+
+ buffer - strong x 258,647 ops/sec ±1.07% (180 runs sampled)
+ buffer - weak x 263,812 ops/sec ±0.61% (184 runs sampled)
+ string - strong x 259,955 ops/sec ±1.19% (185 runs sampled)
+ string - weak x 264,356 ops/sec ±1.09% (184 runs sampled)
+
+> node benchmark/body1-1kb.js
+
+ 1KB body
+
+ 4 tests completed.
+
+ buffer - strong x 189,018 ops/sec ±1.12% (182 runs sampled)
+ buffer - weak x 190,586 ops/sec ±0.81% (186 runs sampled)
+ string - strong x 144,272 ops/sec ±0.96% (188 runs sampled)
+ string - weak x 145,380 ops/sec ±1.43% (187 runs sampled)
+
+> node benchmark/body2-5kb.js
+
+ 5KB body
+
+ 4 tests completed.
+
+ buffer - strong x 92,435 ops/sec ±0.42% (188 runs sampled)
+ buffer - weak x 92,373 ops/sec ±0.58% (189 runs sampled)
+ string - strong x 48,850 ops/sec ±0.56% (186 runs sampled)
+ string - weak x 49,380 ops/sec ±0.56% (190 runs sampled)
+
+> node benchmark/body3-10kb.js
+
+ 10KB body
+
+ 4 tests completed.
+
+ buffer - strong x 55,989 ops/sec ±0.93% (188 runs sampled)
+ buffer - weak x 56,148 ops/sec ±0.55% (190 runs sampled)
+ string - strong x 27,345 ops/sec ±0.43% (188 runs sampled)
+ string - weak x 27,496 ops/sec ±0.45% (190 runs sampled)
+
+> node benchmark/body4-100kb.js
+
+ 100KB body
+
+ 4 tests completed.
+
+ buffer - strong x 7,083 ops/sec ±0.22% (190 runs sampled)
+ buffer - weak x 7,115 ops/sec ±0.26% (191 runs sampled)
+ string - strong x 3,068 ops/sec ±0.34% (190 runs sampled)
+ string - weak x 3,096 ops/sec ±0.35% (190 runs sampled)
+
+> node benchmark/stats.js
+
+ stat
+
+ 4 tests completed.
+
+ real - strong x 871,642 ops/sec ±0.34% (189 runs sampled)
+ real - weak x 867,613 ops/sec ±0.39% (190 runs sampled)
+ fake - strong x 401,051 ops/sec ±0.40% (189 runs sampled)
+ fake - weak x 400,100 ops/sec ±0.47% (188 runs sampled)
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/etag.svg
+[npm-url]: https://npmjs.org/package/etag
+[node-version-image]: https://img.shields.io/node/v/etag.svg
+[node-version-url]: https://nodejs.org/en/download/
+[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg
+[travis-url]: https://travis-ci.org/jshttp/etag
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/etag.svg
+[downloads-url]: https://npmjs.org/package/etag
diff --git a/Restaurant/node_modules/etag/index.js b/Restaurant/node_modules/etag/index.js
new file mode 100644
index 0000000..2a585c9
--- /dev/null
+++ b/Restaurant/node_modules/etag/index.js
@@ -0,0 +1,131 @@
+/*!
+ * etag
+ * Copyright(c) 2014-2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = etag
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var crypto = require('crypto')
+var Stats = require('fs').Stats
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var toString = Object.prototype.toString
+
+/**
+ * Generate an entity tag.
+ *
+ * @param {Buffer|string} entity
+ * @return {string}
+ * @private
+ */
+
+function entitytag (entity) {
+ if (entity.length === 0) {
+ // fast-path empty
+ return '"0-2jmj7l5rSw0yVb/vlWAYkK/YBwk"'
+ }
+
+ // compute hash of entity
+ var hash = crypto
+ .createHash('sha1')
+ .update(entity, 'utf8')
+ .digest('base64')
+ .substring(0, 27)
+
+ // compute length of entity
+ var len = typeof entity === 'string'
+ ? Buffer.byteLength(entity, 'utf8')
+ : entity.length
+
+ return '"' + len.toString(16) + '-' + hash + '"'
+}
+
+/**
+ * Create a simple ETag.
+ *
+ * @param {string|Buffer|Stats} entity
+ * @param {object} [options]
+ * @param {boolean} [options.weak]
+ * @return {String}
+ * @public
+ */
+
+function etag (entity, options) {
+ if (entity == null) {
+ throw new TypeError('argument entity is required')
+ }
+
+ // support fs.Stats object
+ var isStats = isstats(entity)
+ var weak = options && typeof options.weak === 'boolean'
+ ? options.weak
+ : isStats
+
+ // validate argument
+ if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) {
+ throw new TypeError('argument entity must be string, Buffer, or fs.Stats')
+ }
+
+ // generate entity tag
+ var tag = isStats
+ ? stattag(entity)
+ : entitytag(entity)
+
+ return weak
+ ? 'W/' + tag
+ : tag
+}
+
+/**
+ * Determine if object is a Stats object.
+ *
+ * @param {object} obj
+ * @return {boolean}
+ * @api private
+ */
+
+function isstats (obj) {
+ // genuine fs.Stats
+ if (typeof Stats === 'function' && obj instanceof Stats) {
+ return true
+ }
+
+ // quack quack
+ return obj && typeof obj === 'object' &&
+ 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' &&
+ 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' &&
+ 'ino' in obj && typeof obj.ino === 'number' &&
+ 'size' in obj && typeof obj.size === 'number'
+}
+
+/**
+ * Generate a tag for a stat.
+ *
+ * @param {object} stat
+ * @return {string}
+ * @private
+ */
+
+function stattag (stat) {
+ var mtime = stat.mtime.getTime().toString(16)
+ var size = stat.size.toString(16)
+
+ return '"' + size + '-' + mtime + '"'
+}
diff --git a/Restaurant/node_modules/etag/package.json b/Restaurant/node_modules/etag/package.json
new file mode 100644
index 0000000..6de823a
--- /dev/null
+++ b/Restaurant/node_modules/etag/package.json
@@ -0,0 +1,86 @@
+{
+ "_from": "etag@~1.8.1",
+ "_id": "etag@1.8.1",
+ "_inBundle": false,
+ "_integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=",
+ "_location": "/etag",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "etag@~1.8.1",
+ "name": "etag",
+ "escapedName": "etag",
+ "rawSpec": "~1.8.1",
+ "saveSpec": null,
+ "fetchSpec": "~1.8.1"
+ },
+ "_requiredBy": [
+ "/express",
+ "/send"
+ ],
+ "_resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
+ "_shasum": "41ae2eeb65efa62268aebfea83ac7d79299b0887",
+ "_spec": "etag@~1.8.1",
+ "_where": "F:\\Restaurant\\node_modules\\express",
+ "bugs": {
+ "url": "https://github.com/jshttp/etag/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "David Björklund",
+ "email": "david.bjorklund@gmail.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "Create simple HTTP ETags",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.7.0",
+ "eslint-plugin-markdown": "1.0.0-beta.6",
+ "eslint-plugin-node": "5.1.1",
+ "eslint-plugin-promise": "3.5.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "1.21.5",
+ "safe-buffer": "5.1.1",
+ "seedrandom": "2.4.3"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/etag#readme",
+ "keywords": [
+ "etag",
+ "http",
+ "res"
+ ],
+ "license": "MIT",
+ "name": "etag",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/etag.git"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "version": "1.8.1"
+}
diff --git a/Restaurant/node_modules/express/History.md b/Restaurant/node_modules/express/History.md
new file mode 100644
index 0000000..6e62a6d
--- /dev/null
+++ b/Restaurant/node_modules/express/History.md
@@ -0,0 +1,3477 @@
+4.17.1 / 2019-05-25
+===================
+
+ * Revert "Improve error message for `null`/`undefined` to `res.status`"
+
+4.17.0 / 2019-05-16
+===================
+
+ * Add `express.raw` to parse bodies into `Buffer`
+ * Add `express.text` to parse bodies into string
+ * Improve error message for non-strings to `res.sendFile`
+ * Improve error message for `null`/`undefined` to `res.status`
+ * Support multiple hosts in `X-Forwarded-Host`
+ * deps: accepts@~1.3.7
+ * deps: body-parser@1.19.0
+ - Add encoding MIK
+ - Add petabyte (`pb`) support
+ - Fix parsing array brackets after index
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ - deps: qs@6.7.0
+ - deps: raw-body@2.4.0
+ - deps: type-is@~1.6.17
+ * deps: content-disposition@0.5.3
+ * deps: cookie@0.4.0
+ - Add `SameSite=None` support
+ * deps: finalhandler@~1.1.2
+ - Set stricter `Content-Security-Policy` header
+ - deps: parseurl@~1.3.3
+ - deps: statuses@~1.5.0
+ * deps: parseurl@~1.3.3
+ * deps: proxy-addr@~2.0.5
+ - deps: ipaddr.js@1.9.0
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: range-parser@~1.2.1
+ * deps: send@0.17.1
+ - Set stricter CSP header in redirect & error responses
+ - deps: http-errors@~1.7.2
+ - deps: mime@1.6.0
+ - deps: ms@2.1.1
+ - deps: range-parser@~1.2.1
+ - deps: statuses@~1.5.0
+ - perf: remove redundant `path.normalize` call
+ * deps: serve-static@1.14.1
+ - Set stricter CSP header in redirect response
+ - deps: parseurl@~1.3.3
+ - deps: send@0.17.1
+ * deps: setprototypeof@1.1.1
+ * deps: statuses@~1.5.0
+ - Add `103 Early Hints`
+ * deps: type-is@~1.6.18
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+4.16.4 / 2018-10-10
+===================
+
+ * Fix issue where `"Request aborted"` may be logged in `res.sendfile`
+ * Fix JSDoc for `Router` constructor
+ * deps: body-parser@1.18.3
+ - Fix deprecation warnings on Node.js 10+
+ - Fix stack trace for strict json parse error
+ - deps: depd@~1.1.2
+ - deps: http-errors@~1.6.3
+ - deps: iconv-lite@0.4.23
+ - deps: qs@6.5.2
+ - deps: raw-body@2.3.3
+ - deps: type-is@~1.6.16
+ * deps: proxy-addr@~2.0.4
+ - deps: ipaddr.js@1.8.0
+ * deps: qs@6.5.2
+ * deps: safe-buffer@5.1.2
+
+4.16.3 / 2018-03-12
+===================
+
+ * deps: accepts@~1.3.5
+ - deps: mime-types@~2.1.18
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: encodeurl@~1.0.2
+ - Fix encoding `%` as last character
+ * deps: finalhandler@1.1.1
+ - Fix 404 output for bad / missing pathnames
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: proxy-addr@~2.0.3
+ - deps: ipaddr.js@1.6.0
+ * deps: send@0.16.2
+ - Fix incorrect end tag in default error & redirects
+ - deps: depd@~1.1.2
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: serve-static@1.13.2
+ - Fix incorrect end tag in redirects
+ - deps: encodeurl@~1.0.2
+ - deps: send@0.16.2
+ * deps: statuses@~1.4.0
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+4.16.2 / 2017-10-09
+===================
+
+ * Fix `TypeError` in `res.send` when given `Buffer` and `ETag` header set
+ * perf: skip parsing of entire `X-Forwarded-Proto` header
+
+4.16.1 / 2017-09-29
+===================
+
+ * deps: send@0.16.1
+ * deps: serve-static@1.13.1
+ - Fix regression when `root` is incorrectly set to a file
+ - deps: send@0.16.1
+
+4.16.0 / 2017-09-28
+===================
+
+ * Add `"json escape"` setting for `res.json` and `res.jsonp`
+ * Add `express.json` and `express.urlencoded` to parse bodies
+ * Add `options` argument to `res.download`
+ * Improve error message when autoloading invalid view engine
+ * Improve error messages when non-function provided as middleware
+ * Skip `Buffer` encoding when not generating ETag for small response
+ * Use `safe-buffer` for improved Buffer API
+ * deps: accepts@~1.3.4
+ - deps: mime-types@~2.1.16
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: etag@~1.8.1
+ - perf: replace regular expression with substring
+ * deps: finalhandler@1.1.0
+ - Use `res.headersSent` when available
+ * deps: parseurl@~1.3.2
+ - perf: reduce overhead for full URLs
+ - perf: unroll the "fast-path" `RegExp`
+ * deps: proxy-addr@~2.0.2
+ - Fix trimming leading / trailing OWS in `X-Forwarded-For`
+ - deps: forwarded@~0.1.2
+ - deps: ipaddr.js@1.5.2
+ - perf: reduce overhead when no `X-Forwarded-For` header
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: send@0.16.0
+ - Add 70 new types for file extensions
+ - Add `immutable` option
+ - Fix missing ` 
+ 
+