diff --git a/changelog/2452.feature.rst b/changelog/2452.feature.rst new file mode 100644 index 00000000000..847e9540f72 --- /dev/null +++ b/changelog/2452.feature.rst @@ -0,0 +1,5 @@ +Internal pytest warnings are now issued using the standard ``warnings`` module, making it possible to use +the standard warnings filters to manage those warnings. This introduces ``PytestWarning``, +``PytestDeprecationWarning`` and ``RemovedInPytest4Warning`` warning types as part of the public API. + +Consult `the documentation `_ for more info. diff --git a/changelog/2452.removal.rst b/changelog/2452.removal.rst new file mode 100644 index 00000000000..c2a02830389 --- /dev/null +++ b/changelog/2452.removal.rst @@ -0,0 +1,12 @@ +``Config.warn`` has been deprecated, it should be replaced by calls to the standard ``warnings.warn``. + +``Node.warn`` now supports two signatures: + +* ``node.warn(PytestWarning("some message"))``: is now the recommended way to call this function. The warning + instance must be a ``PytestWarning`` or subclass instance. + +* ``node.warn("CI", "some message")``: this code/message form is now deprecated and should be converted to + the warning instance form above. + +``RemovedInPytest4Warning`` and ``PytestExperimentalApiWarning`` are now part of the public API and should be accessed +using ``pytest.RemovedInPytest4Warning`` and ``pytest.PytestExperimentalApiWarning``. diff --git a/changelog/2908.feature.rst b/changelog/2908.feature.rst new file mode 100644 index 00000000000..e904a98de82 --- /dev/null +++ b/changelog/2908.feature.rst @@ -0,0 +1,5 @@ +``DeprecationWarning`` and ``PendingDeprecationWarning`` are now shown by default if no other warning filter is +configured. This makes pytest more compliant with +`PEP-0506 `_. See +`the docs `_ for +more info. diff --git a/changelog/3251.feture.rst b/changelog/3251.feture.rst new file mode 100644 index 00000000000..3ade3093dd1 --- /dev/null +++ b/changelog/3251.feture.rst @@ -0,0 +1 @@ +Warnings are now captured and displayed during test collection. diff --git a/changelog/3936.removal.rst b/changelog/3936.removal.rst new file mode 100644 index 00000000000..bf0ba0897b1 --- /dev/null +++ b/changelog/3936.removal.rst @@ -0,0 +1,5 @@ +``@pytest.mark.filterwarnings`` second parameter is no longer regex-escaped, +making it possible to actually use regular expressions to check the warning message. + +**Note**: regex-escaping the match string was an implementation oversight that might break test suites which depend +on the old behavior. diff --git a/doc/en/reference.rst b/doc/en/reference.rst index e19b5ae8765..52d83cf6ee3 100644 --- a/doc/en/reference.rst +++ b/doc/en/reference.rst @@ -611,6 +611,8 @@ Session related reporting hooks: .. autofunction:: pytest_terminal_summary .. autofunction:: pytest_fixture_setup .. autofunction:: pytest_fixture_post_finalizer +.. autofunction:: pytest_logwarning +.. autofunction:: pytest_warning_captured And here is the central hook for reporting about test execution: diff --git a/doc/en/warnings.rst b/doc/en/warnings.rst index d1c927dd067..a460ac121a4 100644 --- a/doc/en/warnings.rst +++ b/doc/en/warnings.rst @@ -36,8 +36,6 @@ Running pytest now produces this output:: -- Docs: https://docs.pytest.org/en/latest/warnings.html =================== 1 passed, 1 warnings in 0.12 seconds =================== -Pytest by default catches all warnings except for ``DeprecationWarning`` and ``PendingDeprecationWarning``. - The ``-W`` flag can be passed to control which warnings will be displayed or even turn them into errors:: @@ -78,6 +76,53 @@ Both ``-W`` command-line option and ``filterwarnings`` ini option are based on P `-W option`_ and `warnings.simplefilter`_, so please refer to those sections in the Python documentation for other examples and advanced usage. +Disabling warning summary +------------------------- + +Although not recommended, you can use the ``--disable-warnings`` command-line option to suppress the +warning summary entirely from the test run output. + +Disabling warning capture entirely +---------------------------------- + +This plugin is enabled by default but can be disabled entirely in your ``pytest.ini`` file with: + + .. code-block:: ini + + [pytest] + addopts = -p no:warnings + +Or passing ``-p no:warnings`` in the command-line. This might be useful if your test suites handles warnings +using an external system. + + +.. _`deprecation-warnings`: + +DeprecationWarning and PendingDeprecationWarning +------------------------------------------------ + +.. versionadded:: 3.8 + +By default pytest will display ``DeprecationWarning`` and ``PendingDeprecationWarning`` if no other warning filters +are configured. + +To disable showing ``DeprecationWarning`` and ``PendingDeprecationWarning`` warnings, you might define any warnings +filter either in the command-line or in the ini file, or you can use: + +.. code-block:: ini + + [pytest] + filterwarnings = + ignore::DeprecationWarning + ignore::PendingDeprecationWarning + +.. note:: + This makes pytest more compliant with `PEP-0506 `_ which suggests that those warnings should + be shown by default by test runners, but pytest doesn't follow ``PEP-0506`` completely because resetting all + warning filters like suggested in the PEP will break existing test suites that configure warning filters themselves + by calling ``warnings.simplefilter`` (see issue `#2430 `_ + for an example of that). + .. _`filterwarnings`: @@ -144,18 +189,6 @@ decorator or to all tests in a module by setting the ``pytestmark`` variable: .. _`pytest-warnings`: https://github.com/fschulze/pytest-warnings -Disabling warning capture -------------------------- - -This feature is enabled by default but can be disabled entirely in your ``pytest.ini`` file with: - - .. code-block:: ini - - [pytest] - addopts = -p no:warnings - -Or passing ``-p no:warnings`` in the command-line. - .. _`asserting warnings`: .. _assertwarnings: @@ -296,3 +329,53 @@ You can also use it as a contextmanager:: def test_global(): with pytest.deprecated_call(): myobject.deprecated_method() + + +Internal pytest warnings +------------------------ + +.. versionadded:: 3.8 + +pytest may generate its own warnings in some situations, such as improper usage or deprecated features. + +For example, pytest will emit a warning if it encounters a class that matches :confval:`python_classes` but also +defines an ``__init__`` constructor, as this prevents the class from being instantiated: + +.. code-block:: python + + # content of test_pytest_warnings.py + class Test: + def __init__(self): + pass + + def test_foo(self): + assert 1 == 1 + +:: + + $ pytest test_pytest_warnings.py -q + ======================================== warnings summary ========================================= + test_pytest_warnings.py:1 + $REGENDOC_TMPDIR/test_pytest_warnings.py:1: PytestWarning: cannot collect test class 'Test' because it has a __init__ constructor + class Test: + + -- Docs: http://doc.pytest.org/en/latest/warnings.html + 1 warnings in 0.01 seconds + + + +These warnings might be filtered using the same builtin mechanisms used to filter other types of warnings. + +Following our :ref:`backwards-compatibility`, deprecated features will be kept *at least* two minor releases. After that, +they will changed so they by default raise errors instead of just warnings, so users can adapt to it on their own time +if not having done so until now. In a later release the deprecated feature will be removed completely. + +The following warning types ares used by pytest and are part of the public API: + +.. autoclass:: pytest.PytestWarning + +.. autoclass:: pytest.PytestDeprecationWarning + +.. autoclass:: pytest.RemovedInPytest4Warning + +.. autoclass:: pytest.PytestExperimentalApiWarning diff --git a/doc/en/writing_plugins.rst b/doc/en/writing_plugins.rst index 27e13d93208..03bad31be40 100644 --- a/doc/en/writing_plugins.rst +++ b/doc/en/writing_plugins.rst @@ -419,7 +419,7 @@ additionally it is possible to copy examples for a example folder before running ============================= warnings summary ============================= test_example.py::test_plugin - $REGENDOC_TMPDIR/test_example.py:4: PytestExerimentalApiWarning: testdir.copy_example is an experimental api that may change over time + $REGENDOC_TMPDIR/test_example.py:4: PytestExperimentalApiWarning: testdir.copy_example is an experimental api that may change over time testdir.copy_example("test_example.py") -- Docs: https://docs.pytest.org/en/latest/warnings.html diff --git a/src/_pytest/assertion/rewrite.py b/src/_pytest/assertion/rewrite.py index a48a931ac1f..1f485eb8940 100644 --- a/src/_pytest/assertion/rewrite.py +++ b/src/_pytest/assertion/rewrite.py @@ -209,8 +209,12 @@ def mark_rewrite(self, *names): self._must_rewrite.update(names) def _warn_already_imported(self, name): - self.config.warn( - "P1", "Module already imported so cannot be rewritten: %s" % name + from _pytest.warning_types import PytestWarning + from _pytest.warnings import _issue_config_warning + + _issue_config_warning( + PytestWarning("Module already imported so cannot be rewritten: %s" % name), + self.config, ) def load_module(self, name): @@ -746,13 +750,17 @@ def visit_Assert(self, assert_): the expression is false. """ - if isinstance(assert_.test, ast.Tuple) and self.config is not None: - fslocation = (self.module_path, assert_.lineno) - self.config.warn( - "R1", - "assertion is always true, perhaps " "remove parentheses?", - fslocation=fslocation, + if isinstance(assert_.test, ast.Tuple) and len(assert_.test.elts) >= 1: + from _pytest.warning_types import PytestWarning + import warnings + + warnings.warn_explicit( + PytestWarning("assertion is always true, perhaps remove parentheses?"), + category=None, + filename=str(self.module_path), + lineno=assert_.lineno, ) + self.statements = [] self.variables = [] self.variable_counter = itertools.count() diff --git a/src/_pytest/cacheprovider.py b/src/_pytest/cacheprovider.py index 7cad246c86c..791cf3a33aa 100755 --- a/src/_pytest/cacheprovider.py +++ b/src/_pytest/cacheprovider.py @@ -33,7 +33,7 @@ @attr.s class Cache(object): _cachedir = attr.ib(repr=False) - _warn = attr.ib(repr=False) + _config = attr.ib(repr=False) @classmethod def for_config(cls, config): @@ -41,14 +41,19 @@ def for_config(cls, config): if config.getoption("cacheclear") and cachedir.exists(): shutil.rmtree(str(cachedir)) cachedir.mkdir() - return cls(cachedir, config.warn) + return cls(cachedir, config) @staticmethod def cache_dir_from_config(config): return paths.resolve_from_str(config.getini("cache_dir"), config.rootdir) def warn(self, fmt, **args): - self._warn(code="I9", message=fmt.format(**args) if args else fmt) + from _pytest.warnings import _issue_config_warning + from _pytest.warning_types import PytestWarning + + _issue_config_warning( + PytestWarning(fmt.format(**args) if args else fmt), self._config + ) def makedir(self, name): """ return a directory path object with the given name. If the diff --git a/src/_pytest/config/__init__.py b/src/_pytest/config/__init__.py index 2c4361407e1..993e091f265 100644 --- a/src/_pytest/config/__init__.py +++ b/src/_pytest/config/__init__.py @@ -176,7 +176,9 @@ def _prepareconfig(args=None, plugins=None): else: pluginmanager.register(plugin) if warning: - config.warn("C1", warning) + from _pytest.warnings import _issue_config_warning + + _issue_config_warning(warning, config=config) return pluginmanager.hook.pytest_cmdline_parse( pluginmanager=pluginmanager, args=args ) @@ -417,7 +419,12 @@ def _importconftest(self, conftestpath): PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST ) - warnings.warn(PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST) + warnings.warn_explicit( + PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST, + category=None, + filename=str(conftestpath), + lineno=0, + ) except Exception: raise ConftestImportFailure(conftestpath, sys.exc_info()) @@ -602,7 +609,29 @@ def _ensure_unconfigure(self): fin() def warn(self, code, message, fslocation=None, nodeid=None): - """ generate a warning for this test session. """ + """ + .. deprecated:: 3.8 + + Use :py:func:`warnings.warn` or :py:func:`warnings.warn_explicit` directly instead. + + Generate a warning for this test session. + """ + from _pytest.warning_types import RemovedInPytest4Warning + + if isinstance(fslocation, (tuple, list)) and len(fslocation) > 2: + filename, lineno = fslocation[:2] + else: + filename = "unknown file" + lineno = 0 + msg = "config.warn has been deprecated, use warnings.warn instead" + if nodeid: + msg = "{}: {}".format(nodeid, msg) + warnings.warn_explicit( + RemovedInPytest4Warning(msg), + category=None, + filename=filename, + lineno=lineno, + ) self.hook.pytest_logwarning.call_historic( kwargs=dict( code=code, message=message, fslocation=fslocation, nodeid=nodeid @@ -667,8 +696,8 @@ def _initini(self, args): r = determine_setup( ns.inifilename, ns.file_or_dir + unknown_args, - warnfunc=self.warn, rootdir_cmd_arg=ns.rootdir or None, + config=self, ) self.rootdir, self.inifile, self.inicfg = r self._parser.extra_info["rootdir"] = self.rootdir diff --git a/src/_pytest/config/findpaths.py b/src/_pytest/config/findpaths.py index 234aa69c734..7480603bece 100644 --- a/src/_pytest/config/findpaths.py +++ b/src/_pytest/config/findpaths.py @@ -10,15 +10,12 @@ def exists(path, ignore=EnvironmentError): return False -def getcfg(args, warnfunc=None): +def getcfg(args, config=None): """ Search the list of arguments for a valid ini-file for pytest, and return a tuple of (rootdir, inifile, cfg-dict). - note: warnfunc is an optional function used to warn - about ini-files that use deprecated features. - This parameter should be removed when pytest - adopts standard deprecation warnings (#1804). + note: config is optional and used only to issue warnings explicitly (#2891). """ from _pytest.deprecated import CFG_PYTEST_SECTION @@ -34,9 +31,15 @@ def getcfg(args, warnfunc=None): if exists(p): iniconfig = py.iniconfig.IniConfig(p) if "pytest" in iniconfig.sections: - if inibasename == "setup.cfg" and warnfunc: - warnfunc( - "C1", CFG_PYTEST_SECTION.format(filename=inibasename) + if inibasename == "setup.cfg" and config is not None: + from _pytest.warnings import _issue_config_warning + from _pytest.warning_types import RemovedInPytest4Warning + + _issue_config_warning( + RemovedInPytest4Warning( + CFG_PYTEST_SECTION.format(filename=inibasename) + ), + config=config, ) return base, p, iniconfig["pytest"] if ( @@ -95,7 +98,7 @@ def get_dir_from_path(path): return [get_dir_from_path(path) for path in possible_paths if path.exists()] -def determine_setup(inifile, args, warnfunc=None, rootdir_cmd_arg=None): +def determine_setup(inifile, args, rootdir_cmd_arg=None, config=None): dirs = get_dirs_from_args(args) if inifile: iniconfig = py.iniconfig.IniConfig(inifile) @@ -105,23 +108,30 @@ def determine_setup(inifile, args, warnfunc=None, rootdir_cmd_arg=None): for section in sections: try: inicfg = iniconfig[section] - if is_cfg_file and section == "pytest" and warnfunc: + if is_cfg_file and section == "pytest" and config is not None: from _pytest.deprecated import CFG_PYTEST_SECTION - - warnfunc("C1", CFG_PYTEST_SECTION.format(filename=str(inifile))) + from _pytest.warning_types import RemovedInPytest4Warning + from _pytest.warnings import _issue_config_warning + + _issue_config_warning( + RemovedInPytest4Warning( + CFG_PYTEST_SECTION.format(filename=str(inifile)) + ), + config, + ) break except KeyError: inicfg = None rootdir = get_common_ancestor(dirs) else: ancestor = get_common_ancestor(dirs) - rootdir, inifile, inicfg = getcfg([ancestor], warnfunc=warnfunc) + rootdir, inifile, inicfg = getcfg([ancestor], config=config) if rootdir is None: for rootdir in ancestor.parts(reverse=True): if rootdir.join("setup.py").exists(): break else: - rootdir, inifile, inicfg = getcfg(dirs, warnfunc=warnfunc) + rootdir, inifile, inicfg = getcfg(dirs, config=config) if rootdir is None: rootdir = get_common_ancestor([py.path.local(), ancestor]) is_fs_root = os.path.splitdrive(str(rootdir))[1] == "/" diff --git a/src/_pytest/deprecated.py b/src/_pytest/deprecated.py index 20f1cc25b45..dea8bbde867 100644 --- a/src/_pytest/deprecated.py +++ b/src/_pytest/deprecated.py @@ -7,14 +7,16 @@ """ from __future__ import absolute_import, division, print_function +from _pytest.warning_types import RemovedInPytest4Warning -class RemovedInPytest4Warning(DeprecationWarning): - """warning class for features removed in pytest 4.0""" - - -MAIN_STR_ARGS = "passing a string to pytest.main() is deprecated, " "pass a list of arguments instead." +MAIN_STR_ARGS = RemovedInPytest4Warning( + "passing a string to pytest.main() is deprecated, " + "pass a list of arguments instead." +) -YIELD_TESTS = "yield tests are deprecated, and scheduled to be removed in pytest 4.0" +YIELD_TESTS = RemovedInPytest4Warning( + "yield tests are deprecated, and scheduled to be removed in pytest 4.0" +) FUNCARG_PREFIX = ( '{name}: declaring fixtures using "pytest_funcarg__" prefix is deprecated ' @@ -23,7 +25,7 @@ class RemovedInPytest4Warning(DeprecationWarning): ) FIXTURE_FUNCTION_CALL = ( - "Fixture {name} called directly. Fixtures are not meant to be called directly, " + 'Fixture "{name}" called directly. Fixtures are not meant to be called directly, ' "are created automatically when test functions request them as parameters. " "See https://docs.pytest.org/en/latest/fixture.html for more information." ) @@ -32,7 +34,7 @@ class RemovedInPytest4Warning(DeprecationWarning): "[pytest] section in {filename} files is deprecated, use [tool:pytest] instead." ) -GETFUNCARGVALUE = "use of getfuncargvalue is deprecated, use getfixturevalue" +GETFUNCARGVALUE = "getfuncargvalue is deprecated, use getfixturevalue" RESULT_LOG = ( "--result-log is deprecated and scheduled for removal in pytest 4.0.\n" @@ -51,7 +53,11 @@ class RemovedInPytest4Warning(DeprecationWarning): "For more details, see: https://docs.pytest.org/en/latest/parametrize.html" ) -RECORD_XML_PROPERTY = ( +NODE_WARN = RemovedInPytest4Warning( + "Node.warn(code, message) form has been deprecated, use Node.warn(warning_instance) instead." +) + +RECORD_XML_PROPERTY = RemovedInPytest4Warning( 'Fixture renamed from "record_xml_property" to "record_property" as user ' "properties are now available to all reporters.\n" '"record_xml_property" is now deprecated.' @@ -61,7 +67,7 @@ class RemovedInPytest4Warning(DeprecationWarning): "pycollector makeitem was removed " "as it is an accidentially leaked internal api" ) -METAFUNC_ADD_CALL = ( +METAFUNC_ADD_CALL = RemovedInPytest4Warning( "Metafunc.addcall is deprecated and scheduled to be removed in pytest 4.0.\n" "Please use Metafunc.parametrize instead." ) diff --git a/src/_pytest/experiments.py b/src/_pytest/experiments.py deleted file mode 100644 index aa6b664462e..00000000000 --- a/src/_pytest/experiments.py +++ /dev/null @@ -1,13 +0,0 @@ -class PytestExerimentalApiWarning(FutureWarning): - "warning category used to denote experiments in pytest" - - @classmethod - def simple(cls, apiname): - return cls( - "{apiname} is an experimental api that may change over time".format( - apiname=apiname - ) - ) - - -PYTESTER_COPY_EXAMPLE = PytestExerimentalApiWarning.simple("testdir.copy_example") diff --git a/src/_pytest/fixtures.py b/src/_pytest/fixtures.py index bfbf7bb546f..068e6814c1d 100644 --- a/src/_pytest/fixtures.py +++ b/src/_pytest/fixtures.py @@ -1257,6 +1257,8 @@ def pytest_collection_modifyitems(self, items): items[:] = reorder_items(items) def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False): + from _pytest import deprecated + if nodeid is not NOTSET: holderobj = node_or_obj else: @@ -1279,10 +1281,15 @@ def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False): if not callable(obj): continue marker = defaultfuncargprefixmarker - from _pytest import deprecated - self.config.warn( - "C1", deprecated.FUNCARG_PREFIX.format(name=name), nodeid=nodeid + filename, lineno = getfslineno(obj) + warnings.warn_explicit( + RemovedInPytest4Warning( + deprecated.FUNCARG_PREFIX.format(name=name) + ), + category=None, + filename=str(filename), + lineno=lineno + 1, ) name = name[len(self._argprefix) :] elif not isinstance(marker, FixtureFunctionMarker): diff --git a/src/_pytest/hookspec.py b/src/_pytest/hookspec.py index e2969110aeb..1a932614938 100644 --- a/src/_pytest/hookspec.py +++ b/src/_pytest/hookspec.py @@ -526,7 +526,17 @@ def pytest_terminal_summary(terminalreporter, exitstatus): @hookspec(historic=True) def pytest_logwarning(message, code, nodeid, fslocation): - """ process a warning specified by a message, a code string, + """ + .. deprecated:: 3.8 + + This hook is will stop working in a future release. + + pytest no longer triggers this hook, but the + terminal writer still implements it to display warnings issued by + :meth:`_pytest.config.Config.warn` and :meth:`_pytest.nodes.Node.warn`. Calling those functions will be + an error in future releases. + + process a warning specified by a message, a code string, a nodeid and fslocation (both of which may be None if the warning is not tied to a particular node/location). @@ -535,6 +545,27 @@ def pytest_logwarning(message, code, nodeid, fslocation): """ +@hookspec(historic=True) +def pytest_warning_captured(warning_message, when, item): + """ + Process a warning captured by the internal pytest warnings plugin. + + :param warnings.WarningMessage warning_message: + The captured warning. This is the same object produced by :py:func:`warnings.catch_warnings`, and contains + the same attributes as the parameters of :py:func:`warnings.showwarning`. + + :param str when: + Indicates when the warning was captured. Possible values: + + * ``"config"``: during pytest configuration/initialization stage. + * ``"collect"``: during test collection. + * ``"runtest"``: during test execution. + + :param pytest.Item|None item: + The item being executed if ``when`` is ``"runtest"``, otherwise ``None``. + """ + + # ------------------------------------------------------------------------- # doctest hooks # ------------------------------------------------------------------------- diff --git a/src/_pytest/junitxml.py b/src/_pytest/junitxml.py index 86aad69bb6c..7fa49bc2876 100644 --- a/src/_pytest/junitxml.py +++ b/src/_pytest/junitxml.py @@ -258,12 +258,11 @@ def append_property(name, value): @pytest.fixture -def record_xml_property(record_property): +def record_xml_property(record_property, request): """(Deprecated) use record_property.""" - import warnings from _pytest import deprecated - warnings.warn(deprecated.RECORD_XML_PROPERTY, DeprecationWarning, stacklevel=2) + request.node.warn(deprecated.RECORD_XML_PROPERTY) return record_property @@ -274,9 +273,9 @@ def record_xml_attribute(request): The fixture is callable with ``(name, value)``, with value being automatically xml-encoded """ - request.node.warn( - code="C3", message="record_xml_attribute is an experimental feature" - ) + from _pytest.warning_types import PytestWarning + + request.node.warn(PytestWarning("record_xml_attribute is an experimental feature")) xml = getattr(request.config, "_xml", None) if xml is not None: node_reporter = xml.node_reporter(request.node.nodeid) diff --git a/src/_pytest/mark/structures.py b/src/_pytest/mark/structures.py index 9bd89c3c391..8e8937d592d 100644 --- a/src/_pytest/mark/structures.py +++ b/src/_pytest/mark/structures.py @@ -65,7 +65,7 @@ def param_extract_id(id=None): return cls(values, marks, id_) @classmethod - def extract_from(cls, parameterset, legacy_force_tuple=False): + def extract_from(cls, parameterset, belonging_definition, legacy_force_tuple=False): """ :param parameterset: a legacy style parameterset that may or may not be a tuple, @@ -75,6 +75,7 @@ def extract_from(cls, parameterset, legacy_force_tuple=False): enforce tuple wrapping so single argument tuple values don't get decomposed and break tests + :param belonging_definition: the item that we will be extracting the parameters from. """ if isinstance(parameterset, cls): @@ -93,20 +94,24 @@ def extract_from(cls, parameterset, legacy_force_tuple=False): if legacy_force_tuple: argval = (argval,) - if newmarks: - warnings.warn(MARK_PARAMETERSET_UNPACKING) + if newmarks and belonging_definition is not None: + belonging_definition.warn(MARK_PARAMETERSET_UNPACKING) return cls(argval, marks=newmarks, id=None) @classmethod - def _for_parametrize(cls, argnames, argvalues, func, config): + def _for_parametrize(cls, argnames, argvalues, func, config, function_definition): if not isinstance(argnames, (tuple, list)): argnames = [x.strip() for x in argnames.split(",") if x.strip()] force_tuple = len(argnames) == 1 else: force_tuple = False parameters = [ - ParameterSet.extract_from(x, legacy_force_tuple=force_tuple) + ParameterSet.extract_from( + x, + legacy_force_tuple=force_tuple, + belonging_definition=function_definition, + ) for x in argvalues ] del argvalues diff --git a/src/_pytest/nodes.py b/src/_pytest/nodes.py index 49c30e90354..29d1f0a871b 100644 --- a/src/_pytest/nodes.py +++ b/src/_pytest/nodes.py @@ -1,5 +1,6 @@ from __future__ import absolute_import, division, print_function import os +import warnings import six import py @@ -7,6 +8,7 @@ import _pytest import _pytest._code +from _pytest.compat import getfslineno from _pytest.mark.structures import NodeKeywords, MarkInfo @@ -134,19 +136,98 @@ def _getcustomclass(self, name): def __repr__(self): return "<%s %r>" % (self.__class__.__name__, getattr(self, "name", None)) - def warn(self, code, message): - """ generate a warning with the given code and message for this - item. """ + def warn(self, _code_or_warning=None, message=None, code=None): + """Issue a warning for this item. + + Warnings will be displayed after the test session, unless explicitly suppressed. + + This can be called in two forms: + + **Warning instance** + + This was introduced in pytest 3.8 and uses the standard warning mechanism to issue warnings. + + .. code-block:: python + + node.warn(PytestWarning("some message")) + + The warning instance must be a subclass of :class:`pytest.PytestWarning`. + + **code/message (deprecated)** + + This form was used in pytest prior to 3.8 and is considered deprecated. Using this form will emit another + warning about the deprecation: + + .. code-block:: python + + node.warn("CI", "some message") + + :param Union[Warning,str] _code_or_warning: + warning instance or warning code (legacy). This parameter receives an underscore for backward + compatibility with the legacy code/message form, and will be replaced for something + more usual when the legacy form is removed. + + :param Union[str,None] message: message to display when called in the legacy form. + :param str code: code for the warning, in legacy form when using keyword arguments. + :return: + """ + if message is None: + if _code_or_warning is None: + raise ValueError("code_or_warning must be given") + self._std_warn(_code_or_warning) + else: + if _code_or_warning and code: + raise ValueError( + "code_or_warning and code cannot both be passed to this function" + ) + code = _code_or_warning or code + self._legacy_warn(code, message) + + def _legacy_warn(self, code, message): + """ + .. deprecated:: 3.8 + + Use :meth:`Node.std_warn <_pytest.nodes.Node.std_warn>` instead. + + Generate a warning with the given code and message for this item. + """ + from _pytest.deprecated import NODE_WARN + + self._std_warn(NODE_WARN) + assert isinstance(code, str) - fslocation = getattr(self, "location", None) - if fslocation is None: - fslocation = getattr(self, "fspath", None) + fslocation = get_fslocation_from_item(self) self.ihook.pytest_logwarning.call_historic( kwargs=dict( code=code, message=message, nodeid=self.nodeid, fslocation=fslocation ) ) + def _std_warn(self, warning): + """Issue a warning for this item. + + Warnings will be displayed after the test session, unless explicitly suppressed + + :param Warning warning: the warning instance to issue. Must be a subclass of PytestWarning. + + :raise ValueError: if ``warning`` instance is not a subclass of PytestWarning. + """ + from _pytest.warning_types import PytestWarning + + if not isinstance(warning, PytestWarning): + raise ValueError( + "warning must be an instance of PytestWarning or subclass, got {!r}".format( + warning + ) + ) + path, lineno = get_fslocation_from_item(self) + warnings.warn_explicit( + warning, + category=None, + filename=str(path), + lineno=lineno + 1 if lineno is not None else None, + ) + # methods for ordering nodes @property def nodeid(self): @@ -310,6 +391,24 @@ def _repr_failure_py(self, excinfo, style=None): repr_failure = _repr_failure_py +def get_fslocation_from_item(item): + """Tries to extract the actual location from an item, depending on available attributes: + + * "fslocation": a pair (path, lineno) + * "obj": a Python object that the item wraps. + * "fspath": just a path + + :rtype: a tuple of (str|LocalPath, int) with filename and line number. + """ + result = getattr(item, "location", None) + if result is not None: + return result[:2] + obj = getattr(item, "obj", None) + if obj is not None: + return getfslineno(obj) + return getattr(item, "fspath", "unknown location"), -1 + + class Collector(Node): """ Collector instances create children through collect() and thus iteratively build a tree. diff --git a/src/_pytest/pytester.py b/src/_pytest/pytester.py index 5c412047cff..a5099917240 100644 --- a/src/_pytest/pytester.py +++ b/src/_pytest/pytester.py @@ -126,7 +126,7 @@ def pytest_runtest_protocol(self, item): error.append(error[0]) error.append("*** function %s:%s: %s " % item.location) error.append("See issue #2366") - item.warn("", "\n".join(error)) + item.warn(pytest.PytestWarning("\n".join(error))) # XXX copied from execnet's conftest.py - needs to be merged @@ -525,7 +525,6 @@ def preserve_module(name): def make_hook_recorder(self, pluginmanager): """Create a new :py:class:`HookRecorder` for a PluginManager.""" - assert not hasattr(pluginmanager, "reprec") pluginmanager.reprec = reprec = HookRecorder(pluginmanager) self.request.addfinalizer(reprec.finish_recording) return reprec @@ -643,10 +642,10 @@ def mkpydir(self, name): return p def copy_example(self, name=None): - from . import experiments import warnings + from _pytest.warning_types import PYTESTER_COPY_EXAMPLE - warnings.warn(experiments.PYTESTER_COPY_EXAMPLE, stacklevel=2) + warnings.warn(PYTESTER_COPY_EXAMPLE, stacklevel=2) example_dir = self.request.config.getini("pytester_example_dir") if example_dir is None: raise ValueError("pytester_example_dir is unset, can't copy examples") diff --git a/src/_pytest/python.py b/src/_pytest/python.py index f175394a8be..05165027231 100644 --- a/src/_pytest/python.py +++ b/src/_pytest/python.py @@ -44,7 +44,7 @@ get_unpacked_marks, normalize_mark_list, ) - +from _pytest.warning_types import RemovedInPytest4Warning, PytestWarning # relative paths that we use to filter traceback entries from appearing to the user; # see filter_traceback @@ -239,9 +239,14 @@ def pytest_pycollect_makeitem(collector, name, obj): # or a funtools.wrapped. # We musn't if it's been wrapped with mock.patch (python 2 only) if not (isfunction(obj) or isfunction(get_real_func(obj))): - collector.warn( - code="C2", - message="cannot collect %r because it is not a function." % name, + filename, lineno = getfslineno(obj) + warnings.warn_explicit( + message=PytestWarning( + "cannot collect %r because it is not a function." % name + ), + category=None, + filename=str(filename), + lineno=lineno + 1, ) elif getattr(obj, "__test__", True): if is_generator(obj): @@ -349,11 +354,6 @@ def istestfunction(self, obj, name): if isinstance(obj, staticmethod): # static methods need to be unwrapped obj = safe_getattr(obj, "__func__", False) - if obj is False: - # Python 2.6 wraps in a different way that we won't try to handle - msg = "cannot collect static method %r because it is not a function" - self.warn(code="C2", message=msg % name) - return False return ( safe_getattr(obj, "__call__", False) and fixtures.getfixturemarker(obj) is None @@ -662,16 +662,18 @@ def collect(self): return [] if hasinit(self.obj): self.warn( - "C1", - "cannot collect test class %r because it has a " - "__init__ constructor" % self.obj.__name__, + PytestWarning( + "cannot collect test class %r because it has a " + "__init__ constructor" % self.obj.__name__ + ) ) return [] elif hasnew(self.obj): self.warn( - "C1", - "cannot collect test class %r because it has a " - "__new__ constructor" % self.obj.__name__, + PytestWarning( + "cannot collect test class %r because it has a " + "__new__ constructor" % self.obj.__name__ + ) ) return [] return [self._getcustomclass("Instance")(name="()", parent=self)] @@ -799,7 +801,7 @@ def collect(self): ) seen[name] = True values.append(self.Function(name, self, args=args, callobj=call)) - self.warn("C1", deprecated.YIELD_TESTS) + self.warn(deprecated.YIELD_TESTS) return values def getcallargs(self, obj): @@ -966,7 +968,11 @@ def parametrize(self, argnames, argvalues, indirect=False, ids=None, scope=None) from _pytest.mark import ParameterSet argnames, parameters = ParameterSet._for_parametrize( - argnames, argvalues, self.function, self.config + argnames, + argvalues, + self.function, + self.config, + function_definition=self.definition, ) del argvalues @@ -977,7 +983,7 @@ def parametrize(self, argnames, argvalues, indirect=False, ids=None, scope=None) arg_values_types = self._resolve_arg_value_types(argnames, indirect) - ids = self._resolve_arg_ids(argnames, ids, parameters) + ids = self._resolve_arg_ids(argnames, ids, parameters, item=self.definition) scopenum = scope2index(scope, descr="call to {}".format(self.parametrize)) @@ -1000,13 +1006,14 @@ def parametrize(self, argnames, argvalues, indirect=False, ids=None, scope=None) newcalls.append(newcallspec) self._calls = newcalls - def _resolve_arg_ids(self, argnames, ids, parameters): + def _resolve_arg_ids(self, argnames, ids, parameters, item): """Resolves the actual ids for the given argnames, based on the ``ids`` parameter given to ``parametrize``. :param List[str] argnames: list of argument names passed to ``parametrize()``. :param ids: the ids parameter of the parametrized call (see docs). :param List[ParameterSet] parameters: the list of parameter values, same size as ``argnames``. + :param Item item: the item that generated this parametrized call. :rtype: List[str] :return: the list of ids for each argname given """ @@ -1027,7 +1034,7 @@ def _resolve_arg_ids(self, argnames, ids, parameters): raise ValueError( msg % (saferepr(id_value), type(id_value).__name__) ) - ids = idmaker(argnames, parameters, idfn, ids, self.config) + ids = idmaker(argnames, parameters, idfn, ids, self.config, item=item) return ids def _resolve_arg_value_types(self, argnames, indirect): @@ -1100,10 +1107,8 @@ def addcall(self, funcargs=None, id=NOTSET, param=NOTSET): :arg param: a parameter which will be exposed to a later fixture function invocation through the ``request.param`` attribute. """ - if self.config: - self.config.warn( - "C1", message=deprecated.METAFUNC_ADD_CALL, fslocation=None - ) + warnings.warn(deprecated.METAFUNC_ADD_CALL, stacklevel=2) + assert funcargs is None or isinstance(funcargs, dict) if funcargs is not None: for name in funcargs: @@ -1153,21 +1158,20 @@ def _find_parametrized_scope(argnames, arg2fixturedefs, indirect): return "function" -def _idval(val, argname, idx, idfn, config=None): +def _idval(val, argname, idx, idfn, item, config): if idfn: s = None try: s = idfn(val) - except Exception: + except Exception as e: # See issue https://github.com/pytest-dev/pytest/issues/2169 - import warnings - msg = ( - "Raised while trying to determine id of parameter %s at position %d." - % (argname, idx) + "While trying to determine id of parameter {} at position " + "{} the following exception was raised:\n".format(argname, idx) ) - msg += "\nUpdate your code as this will raise an error in pytest-4.0." - warnings.warn(msg, DeprecationWarning) + msg += " {}: {}\n".format(type(e).__name__, e) + msg += "This warning will be an error error in pytest-4.0." + item.warn(RemovedInPytest4Warning(msg)) if s: return ascii_escaped(s) @@ -1191,12 +1195,12 @@ def _idval(val, argname, idx, idfn, config=None): return str(argname) + str(idx) -def _idvalset(idx, parameterset, argnames, idfn, ids, config=None): +def _idvalset(idx, parameterset, argnames, idfn, ids, item, config): if parameterset.id is not None: return parameterset.id if ids is None or (idx >= len(ids) or ids[idx] is None): this_id = [ - _idval(val, argname, idx, idfn, config) + _idval(val, argname, idx, idfn, item=item, config=config) for val, argname in zip(parameterset.values, argnames) ] return "-".join(this_id) @@ -1204,9 +1208,9 @@ def _idvalset(idx, parameterset, argnames, idfn, ids, config=None): return ascii_escaped(ids[idx]) -def idmaker(argnames, parametersets, idfn=None, ids=None, config=None): +def idmaker(argnames, parametersets, idfn=None, ids=None, config=None, item=None): ids = [ - _idvalset(valindex, parameterset, argnames, idfn, ids, config) + _idvalset(valindex, parameterset, argnames, idfn, ids, config=config, item=item) for valindex, parameterset in enumerate(parametersets) ] if len(set(ids)) != len(ids): diff --git a/src/_pytest/resultlog.py b/src/_pytest/resultlog.py index 0ad31b8bc80..8a972eed736 100644 --- a/src/_pytest/resultlog.py +++ b/src/_pytest/resultlog.py @@ -31,8 +31,10 @@ def pytest_configure(config): config.pluginmanager.register(config._resultlog) from _pytest.deprecated import RESULT_LOG + from _pytest.warning_types import RemovedInPytest4Warning + from _pytest.warnings import _issue_config_warning - config.warn("C1", RESULT_LOG) + _issue_config_warning(RemovedInPytest4Warning(RESULT_LOG), config) def pytest_unconfigure(config): diff --git a/src/_pytest/terminal.py b/src/_pytest/terminal.py index cc83959fd84..4f6f0953710 100644 --- a/src/_pytest/terminal.py +++ b/src/_pytest/terminal.py @@ -9,6 +9,7 @@ import sys import time +import attr import pluggy import py import six @@ -184,23 +185,23 @@ def pytest_report_teststatus(report): return report.outcome, letter, report.outcome.upper() +@attr.s class WarningReport(object): """ - Simple structure to hold warnings information captured by ``pytest_logwarning``. + Simple structure to hold warnings information captured by ``pytest_logwarning`` and ``pytest_warning_captured``. + + :ivar str message: user friendly message about the warning + :ivar str|None nodeid: node id that generated the warning (see ``get_location``). + :ivar tuple|py.path.local fslocation: + file system location of the source of the warning (see ``get_location``). + + :ivar bool legacy: if this warning report was generated from the deprecated ``pytest_logwarning`` hook. """ - def __init__(self, code, message, nodeid=None, fslocation=None): - """ - :param code: unused - :param str message: user friendly message about the warning - :param str|None nodeid: node id that generated the warning (see ``get_location``). - :param tuple|py.path.local fslocation: - file system location of the source of the warning (see ``get_location``). - """ - self.code = code - self.message = message - self.nodeid = nodeid - self.fslocation = fslocation + message = attr.ib() + nodeid = attr.ib(default=None) + fslocation = attr.ib(default=None) + legacy = attr.ib(default=False) def get_location(self, config): """ @@ -213,6 +214,8 @@ def get_location(self, config): if isinstance(self.fslocation, tuple) and len(self.fslocation) >= 2: filename, linenum = self.fslocation[:2] relpath = py.path.local(filename).relto(config.invocation_dir) + if not relpath: + relpath = str(filename) return "%s:%s" % (relpath, linenum) else: return str(self.fslocation) @@ -327,13 +330,27 @@ def pytest_internalerror(self, excrepr): self.write_line("INTERNALERROR> " + line) return 1 - def pytest_logwarning(self, code, fslocation, message, nodeid): + def pytest_logwarning(self, fslocation, message, nodeid): warnings = self.stats.setdefault("warnings", []) warning = WarningReport( - code=code, fslocation=fslocation, message=message, nodeid=nodeid + fslocation=fslocation, message=message, nodeid=nodeid, legacy=True ) warnings.append(warning) + def pytest_warning_captured(self, warning_message, item): + # from _pytest.nodes import get_fslocation_from_item + from _pytest.warnings import warning_record_to_str + + warnings = self.stats.setdefault("warnings", []) + fslocation = warning_message.filename, warning_message.lineno + message = warning_record_to_str(warning_message) + + nodeid = item.nodeid if item is not None else "" + warning_report = WarningReport( + fslocation=fslocation, message=message, nodeid=nodeid + ) + warnings.append(warning_report) + def pytest_plugin_registered(self, plugin): if self.config.option.traceconfig: msg = "PLUGIN registered: %s" % (plugin,) @@ -697,11 +714,20 @@ def summary_warnings(self): self.write_sep("=", "warnings summary", yellow=True, bold=False) for location, warning_records in grouped: - self._tw.line(str(location) if location else "") + # legacy warnings show their location explicitly, while standard warnings look better without + # it because the location is already formatted into the message + warning_records = list(warning_records) + is_legacy = warning_records[0].legacy + if location and is_legacy: + self._tw.line(str(location)) for w in warning_records: - lines = w.message.splitlines() - indented = "\n".join(" " + x for x in lines) - self._tw.line(indented) + if is_legacy: + lines = w.message.splitlines() + indented = "\n".join(" " + x for x in lines) + message = indented.rstrip() + else: + message = w.message.rstrip() + self._tw.line(message) self._tw.line() self._tw.line("-- Docs: https://docs.pytest.org/en/latest/warnings.html") diff --git a/src/_pytest/warning_types.py b/src/_pytest/warning_types.py new file mode 100644 index 00000000000..8861f6f2b06 --- /dev/null +++ b/src/_pytest/warning_types.py @@ -0,0 +1,42 @@ +class PytestWarning(UserWarning): + """ + Bases: :class:`UserWarning`. + + Base class for all warnings emitted by pytest. + """ + + +class PytestDeprecationWarning(PytestWarning, DeprecationWarning): + """ + Bases: :class:`pytest.PytestWarning`, :class:`DeprecationWarning`. + + Warning class for features that will be removed in a future version. + """ + + +class RemovedInPytest4Warning(PytestDeprecationWarning): + """ + Bases: :class:`pytest.PytestDeprecationWarning`. + + Warning class for features scheduled to be removed in pytest 4.0. + """ + + +class PytestExperimentalApiWarning(PytestWarning, FutureWarning): + """ + Bases: :class:`pytest.PytestWarning`, :class:`FutureWarning`. + + Warning category used to denote experiments in pytest. Use sparingly as the API might change or even be + removed completely in future version + """ + + @classmethod + def simple(cls, apiname): + return cls( + "{apiname} is an experimental api that may change over time".format( + apiname=apiname + ) + ) + + +PYTESTER_COPY_EXAMPLE = PytestExperimentalApiWarning.simple("testdir.copy_example") diff --git a/src/_pytest/warnings.py b/src/_pytest/warnings.py index 3a93f92f3c4..6c4b921fa7d 100644 --- a/src/_pytest/warnings.py +++ b/src/_pytest/warnings.py @@ -1,5 +1,6 @@ from __future__ import absolute_import, division, print_function +import sys import warnings from contextlib import contextmanager @@ -58,62 +59,114 @@ def pytest_configure(config): @contextmanager -def catch_warnings_for_item(item): +def catch_warnings_for_item(config, ihook, when, item): """ - catches the warnings generated during setup/call/teardown execution - of the given item and after it is done posts them as warnings to this - item. + Context manager that catches warnings generated in the contained execution block. + + ``item`` can be None if we are not in the context of an item execution. + + Each warning captured triggers the ``pytest_warning_captured`` hook. """ - args = item.config.getoption("pythonwarnings") or [] - inifilters = item.config.getini("filterwarnings") + args = config.getoption("pythonwarnings") or [] + inifilters = config.getini("filterwarnings") with warnings.catch_warnings(record=True) as log: + filters_configured = args or inifilters or sys.warnoptions + for arg in args: warnings._setoption(arg) for arg in inifilters: _setoption(warnings, arg) - for mark in item.iter_markers(name="filterwarnings"): - for arg in mark.args: - warnings._setoption(arg) + if item is not None: + for mark in item.iter_markers(name="filterwarnings"): + for arg in mark.args: + _setoption(warnings, arg) + filters_configured = True + + if not filters_configured: + # if user is not explicitly configuring warning filters, show deprecation warnings by default (#2908) + warnings.filterwarnings("always", category=DeprecationWarning) + warnings.filterwarnings("always", category=PendingDeprecationWarning) yield - for warning in log: - warn_msg = warning.message - unicode_warning = False - - if compat._PY2 and any( - isinstance(m, compat.UNICODE_TYPES) for m in warn_msg.args - ): - new_args = [] - for m in warn_msg.args: - new_args.append( - compat.ascii_escaped(m) - if isinstance(m, compat.UNICODE_TYPES) - else m - ) - unicode_warning = list(warn_msg.args) != new_args - warn_msg.args = new_args - - msg = warnings.formatwarning( - warn_msg, - warning.category, - warning.filename, - warning.lineno, - warning.line, + for warning_message in log: + ihook.pytest_warning_captured.call_historic( + kwargs=dict(warning_message=warning_message, when=when, item=item) ) - item.warn("unused", msg) - if unicode_warning: - warnings.warn( - "Warning is using unicode non convertible to ascii, " - "converting to a safe representation:\n %s" % msg, - UnicodeWarning, - ) +def warning_record_to_str(warning_message): + """Convert a warnings.WarningMessage to a string, taking in account a lot of unicode shenaningans in Python 2. -@pytest.hookimpl(hookwrapper=True) + When Python 2 support is dropped this function can be greatly simplified. + """ + warn_msg = warning_message.message + unicode_warning = False + if compat._PY2 and any(isinstance(m, compat.UNICODE_TYPES) for m in warn_msg.args): + new_args = [] + for m in warn_msg.args: + new_args.append( + compat.ascii_escaped(m) if isinstance(m, compat.UNICODE_TYPES) else m + ) + unicode_warning = list(warn_msg.args) != new_args + warn_msg.args = new_args + + msg = warnings.formatwarning( + warn_msg, + warning_message.category, + warning_message.filename, + warning_message.lineno, + warning_message.line, + ) + if unicode_warning: + warnings.warn( + "Warning is using unicode non convertible to ascii, " + "converting to a safe representation:\n %s" % msg, + UnicodeWarning, + ) + return msg + + +@pytest.hookimpl(hookwrapper=True, tryfirst=True) def pytest_runtest_protocol(item): - with catch_warnings_for_item(item): + with catch_warnings_for_item( + config=item.config, ihook=item.ihook, when="runtest", item=item + ): yield + + +@pytest.hookimpl(hookwrapper=True, tryfirst=True) +def pytest_collection(session): + config = session.config + with catch_warnings_for_item( + config=config, ihook=config.hook, when="collect", item=None + ): + yield + + +@pytest.hookimpl(hookwrapper=True) +def pytest_terminal_summary(terminalreporter): + config = terminalreporter.config + with catch_warnings_for_item( + config=config, ihook=config.hook, when="config", item=None + ): + yield + + +def _issue_config_warning(warning, config): + """ + This function should be used instead of calling ``warnings.warn`` directly when we are in the "configure" stage: + at this point the actual options might not have been set, so we manually trigger the pytest_warning_captured + hook so we can display this warnings in the terminal. This is a hack until we can sort out #2891. + + :param warning: the warning instance. + :param config: + """ + with warnings.catch_warnings(record=True) as records: + warnings.simplefilter("always", type(warning)) + warnings.warn(warning, stacklevel=2) + config.hook.pytest_warning_captured.call_historic( + kwargs=dict(warning_message=records[0], when="config", item=None) + ) diff --git a/src/pytest.py b/src/pytest.py index ae542b76d94..e173fd3d4bb 100644 --- a/src/pytest.py +++ b/src/pytest.py @@ -19,45 +19,54 @@ from _pytest.nodes import Item, Collector, File from _pytest.fixtures import fillfixtures as _fillfuncargs from _pytest.python import Package, Module, Class, Instance, Function, Generator - from _pytest.python_api import approx, raises +from _pytest.warning_types import ( + PytestWarning, + PytestDeprecationWarning, + RemovedInPytest4Warning, + PytestExperimentalApiWarning, +) set_trace = __pytestPDB.set_trace __all__ = [ - "main", - "UsageError", - "cmdline", - "hookspec", - "hookimpl", "__version__", - "register_assert_rewrite", - "freeze_includes", - "set_trace", - "warns", + "_fillfuncargs", + "approx", + "Class", + "cmdline", + "Collector", "deprecated_call", - "fixture", - "yield_fixture", - "fail", - "skip", - "xfail", - "importorskip", "exit", - "mark", - "param", - "approx", - "_fillfuncargs", - "Item", + "fail", "File", - "Collector", - "Package", - "Session", - "Module", - "Class", - "Instance", + "fixture", + "freeze_includes", "Function", "Generator", + "hookimpl", + "hookspec", + "importorskip", + "Instance", + "Item", + "main", + "mark", + "Module", + "Package", + "param", + "PytestDeprecationWarning", + "PytestExperimentalApiWarning", + "PytestWarning", "raises", + "register_assert_rewrite", + "RemovedInPytest4Warning", + "Session", + "set_trace", + "skip", + "UsageError", + "warns", + "xfail", + "yield_fixture", ] if __name__ == "__main__": diff --git a/testing/deprecated_test.py b/testing/deprecated_test.py index 966de66b205..fbaca4e30fd 100644 --- a/testing/deprecated_test.py +++ b/testing/deprecated_test.py @@ -1,9 +1,11 @@ from __future__ import absolute_import, division, print_function +import os import pytest +@pytest.mark.filterwarnings("default") def test_yield_tests_deprecation(testdir): testdir.makepyfile( """ @@ -17,16 +19,18 @@ def test_gen2(): yield func1, 1, 1 """ ) - result = testdir.runpytest("-ra") + result = testdir.runpytest() result.stdout.fnmatch_lines( [ - "*yield tests are deprecated, and scheduled to be removed in pytest 4.0*", + "*test_yield_tests_deprecation.py:3:*yield tests are deprecated*", + "*test_yield_tests_deprecation.py:6:*yield tests are deprecated*", "*2 passed*", ] ) assert result.stdout.str().count("yield tests are deprecated") == 2 +@pytest.mark.filterwarnings("default") def test_funcarg_prefix_deprecation(testdir): testdir.makepyfile( """ @@ -41,16 +45,15 @@ def test_funcarg_prefix(value): result.stdout.fnmatch_lines( [ ( - "*pytest_funcarg__value: " - 'declaring fixtures using "pytest_funcarg__" prefix is deprecated ' - "and scheduled to be removed in pytest 4.0. " - "Please remove the prefix and use the @pytest.fixture decorator instead." + "*test_funcarg_prefix_deprecation.py:1: *pytest_funcarg__value: " + 'declaring fixtures using "pytest_funcarg__" prefix is deprecated*' ), "*1 passed*", ] ) +@pytest.mark.filterwarnings("default") def test_pytest_setup_cfg_deprecated(testdir): testdir.makefile( ".cfg", @@ -65,6 +68,7 @@ def test_pytest_setup_cfg_deprecated(testdir): ) +@pytest.mark.filterwarnings("default") def test_pytest_custom_cfg_deprecated(testdir): testdir.makefile( ".cfg", @@ -79,15 +83,15 @@ def test_pytest_custom_cfg_deprecated(testdir): ) -def test_str_args_deprecated(tmpdir, testdir): +def test_str_args_deprecated(tmpdir): """Deprecate passing strings to pytest.main(). Scheduled for removal in pytest-4.0.""" from _pytest.main import EXIT_NOTESTSCOLLECTED warnings = [] class Collect(object): - def pytest_logwarning(self, message): - warnings.append(message) + def pytest_warning_captured(self, warning_message): + warnings.append(str(warning_message.message)) ret = pytest.main("%s -x" % tmpdir, plugins=[Collect()]) msg = ( @@ -102,6 +106,7 @@ def test_getfuncargvalue_is_deprecated(request): pytest.deprecated_call(request.getfuncargvalue, "tmpdir") +@pytest.mark.filterwarnings("default") def test_resultlog_is_deprecated(testdir): result = testdir.runpytest("--help") result.stdout.fnmatch_lines(["*DEPRECATED path for machine-readable result log*"]) @@ -197,8 +202,11 @@ def test_func(): ) res = testdir.runpytest_subprocess() assert res.ret == 0 - res.stderr.fnmatch_lines( - "*" + str(PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST).splitlines()[0] + msg = str(PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST).splitlines()[0] + res.stdout.fnmatch_lines( + "*subdirectory{sep}conftest.py:0: RemovedInPytest4Warning: {msg}*".format( + sep=os.sep, msg=msg + ) ) @@ -227,8 +235,11 @@ def test_func(): res = testdir.runpytest_subprocess() assert res.ret == 0 - res.stderr.fnmatch_lines( - "*" + str(PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST).splitlines()[0] + msg = str(PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST).splitlines()[0] + res.stdout.fnmatch_lines( + "*subdirectory{sep}conftest.py:0: RemovedInPytest4Warning: {msg}*".format( + sep=os.sep, msg=msg + ) ) @@ -261,10 +272,8 @@ def test_func(): ) res = testdir.runpytest_subprocess() assert res.ret == 0 - assert ( - str(PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST).splitlines()[0] - not in res.stderr.str() - ) + msg = str(PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST).splitlines()[0] + assert msg not in res.stdout.str() def test_call_fixture_function_deprecated(): @@ -276,3 +285,23 @@ def fix(): with pytest.deprecated_call(): assert fix() == 1 + + +def test_pycollector_makeitem_is_deprecated(): + from _pytest.python import PyCollector + from _pytest.warning_types import RemovedInPytest4Warning + + class PyCollectorMock(PyCollector): + """evil hack""" + + def __init__(self): + self.called = False + + def _makeitem(self, *k): + """hack to disable the actual behaviour""" + self.called = True + + collector = PyCollectorMock() + with pytest.warns(RemovedInPytest4Warning): + collector.makeitem("foo", "bar") + assert collector.called diff --git a/testing/python/collect.py b/testing/python/collect.py index 8f4283e4072..c92de12a09c 100644 --- a/testing/python/collect.py +++ b/testing/python/collect.py @@ -8,10 +8,6 @@ from _pytest.main import EXIT_NOTESTSCOLLECTED from _pytest.nodes import Collector -ignore_parametrized_marks = pytest.mark.filterwarnings( - "ignore:Applying marks directly to parameters" -) - class TestModule(object): def test_failing_import(self, testdir): @@ -456,12 +452,20 @@ def test_setuplist(): class TestFunction(object): + @pytest.fixture + def ignore_parametrized_marks_args(self): + """Provides arguments to pytester.runpytest() to ignore the warning about marks being applied directly + to parameters. + """ + return ("-W", "ignore:Applying marks directly to parameters") + def test_getmodulecollector(self, testdir): item = testdir.getitem("def test_func(): pass") modcol = item.getparent(pytest.Module) assert isinstance(modcol, pytest.Module) assert hasattr(modcol.obj, "test_func") + @pytest.mark.filterwarnings("default") def test_function_as_object_instance_ignored(self, testdir): testdir.makepyfile( """ @@ -472,8 +476,14 @@ def __call__(self, tmpdir): test_a = A() """ ) - reprec = testdir.inline_run() - reprec.assertoutcome() + result = testdir.runpytest() + result.stdout.fnmatch_lines( + [ + "collected 0 items", + "*test_function_as_object_instance_ignored.py:2: " + "*cannot collect 'test_a' because it is not a function.", + ] + ) def test_function_equality(self, testdir, tmpdir): from _pytest.fixtures import FixtureManager @@ -662,7 +672,7 @@ def test_it(fix1): rec = testdir.inline_run() rec.assertoutcome(passed=1) - @ignore_parametrized_marks + @pytest.mark.filterwarnings("ignore:Applying marks directly to parameters") def test_parametrize_with_mark(self, testdir): items = testdir.getitems( """ @@ -748,8 +758,7 @@ def test2(self, x, y): assert colitems[2].name == "test2[a-c]" assert colitems[3].name == "test2[b-c]" - @ignore_parametrized_marks - def test_parametrize_skipif(self, testdir): + def test_parametrize_skipif(self, testdir, ignore_parametrized_marks_args): testdir.makepyfile( """ import pytest @@ -761,11 +770,10 @@ def test_skip_if(x): assert x < 2 """ ) - result = testdir.runpytest() + result = testdir.runpytest(*ignore_parametrized_marks_args) result.stdout.fnmatch_lines("* 2 passed, 1 skipped in *") - @ignore_parametrized_marks - def test_parametrize_skip(self, testdir): + def test_parametrize_skip(self, testdir, ignore_parametrized_marks_args): testdir.makepyfile( """ import pytest @@ -777,11 +785,10 @@ def test_skip(x): assert x < 2 """ ) - result = testdir.runpytest() + result = testdir.runpytest(*ignore_parametrized_marks_args) result.stdout.fnmatch_lines("* 2 passed, 1 skipped in *") - @ignore_parametrized_marks - def test_parametrize_skipif_no_skip(self, testdir): + def test_parametrize_skipif_no_skip(self, testdir, ignore_parametrized_marks_args): testdir.makepyfile( """ import pytest @@ -793,11 +800,10 @@ def test_skipif_no_skip(x): assert x < 2 """ ) - result = testdir.runpytest() + result = testdir.runpytest(*ignore_parametrized_marks_args) result.stdout.fnmatch_lines("* 1 failed, 2 passed in *") - @ignore_parametrized_marks - def test_parametrize_xfail(self, testdir): + def test_parametrize_xfail(self, testdir, ignore_parametrized_marks_args): testdir.makepyfile( """ import pytest @@ -809,11 +815,10 @@ def test_xfail(x): assert x < 2 """ ) - result = testdir.runpytest() + result = testdir.runpytest(*ignore_parametrized_marks_args) result.stdout.fnmatch_lines("* 2 passed, 1 xfailed in *") - @ignore_parametrized_marks - def test_parametrize_passed(self, testdir): + def test_parametrize_passed(self, testdir, ignore_parametrized_marks_args): testdir.makepyfile( """ import pytest @@ -825,11 +830,10 @@ def test_xfail(x): pass """ ) - result = testdir.runpytest() + result = testdir.runpytest(*ignore_parametrized_marks_args) result.stdout.fnmatch_lines("* 2 passed, 1 xpassed in *") - @ignore_parametrized_marks - def test_parametrize_xfail_passed(self, testdir): + def test_parametrize_xfail_passed(self, testdir, ignore_parametrized_marks_args): testdir.makepyfile( """ import pytest @@ -841,7 +845,7 @@ def test_passed(x): pass """ ) - result = testdir.runpytest() + result = testdir.runpytest(*ignore_parametrized_marks_args) result.stdout.fnmatch_lines("* 3 passed in *") def test_function_original_name(self, testdir): @@ -1468,6 +1472,7 @@ def check3(fix1, i, fix2): result.assertoutcome(passed=6, failed=2) +@pytest.mark.filterwarnings("default") def test_dont_collect_non_function_callable(testdir): """Test for issue https://github.com/pytest-dev/pytest/issues/331 @@ -1490,7 +1495,7 @@ def test_real(): result.stdout.fnmatch_lines( [ "*collected 1 item*", - "*cannot collect 'test_a' because it is not a function*", + "*test_dont_collect_non_function_callable.py:2: *cannot collect 'test_a' because it is not a function*", "*1 passed, 1 warnings in *", ] ) diff --git a/testing/python/metafunc.py b/testing/python/metafunc.py index f5d839f086e..36ef5041df0 100644 --- a/testing/python/metafunc.py +++ b/testing/python/metafunc.py @@ -217,7 +217,7 @@ class A(object): def test_idval_hypothesis(self, value): from _pytest.python import _idval - escaped = _idval(value, "a", 6, None) + escaped = _idval(value, "a", 6, None, item=None, config=None) assert isinstance(escaped, str) if PY3: escaped.encode("ascii") @@ -244,7 +244,7 @@ def test_unicode_idval(self): ), ] for val, expected in values: - assert _idval(val, "a", 6, None) == expected + assert _idval(val, "a", 6, None, item=None, config=None) == expected def test_bytes_idval(self): """unittest for the expected behavior to obtain ids for parametrized @@ -262,7 +262,7 @@ def test_bytes_idval(self): (u"αρά".encode("utf-8"), "\\xce\\xb1\\xcf\\x81\\xce\\xac"), ] for val, expected in values: - assert _idval(val, "a", 6, None) == expected + assert _idval(val, "a", 6, idfn=None, item=None, config=None) == expected def test_class_or_function_idval(self): """unittest for the expected behavior to obtain ids for parametrized @@ -278,7 +278,7 @@ def test_function(): values = [(TestClass, "TestClass"), (test_function, "test_function")] for val, expected in values: - assert _idval(val, "a", 6, None) == expected + assert _idval(val, "a", 6, None, item=None, config=None) == expected @pytest.mark.issue250 def test_idmaker_autoname(self): @@ -383,44 +383,7 @@ def ids(val): ) assert result == ["a-a0", "a-a1", "a-a2"] - @pytest.mark.issue351 - def test_idmaker_idfn_exception(self): - from _pytest.python import idmaker - from _pytest.recwarn import WarningsRecorder - - class BadIdsException(Exception): - pass - - def ids(val): - raise BadIdsException("ids raised") - - rec = WarningsRecorder() - with rec: - idmaker( - ("a", "b"), - [ - pytest.param(10.0, IndexError()), - pytest.param(20, KeyError()), - pytest.param("three", [1, 2, 3]), - ], - idfn=ids, - ) - - assert [str(i.message) for i in rec.list] == [ - "Raised while trying to determine id of parameter a at position 0." - "\nUpdate your code as this will raise an error in pytest-4.0.", - "Raised while trying to determine id of parameter b at position 0." - "\nUpdate your code as this will raise an error in pytest-4.0.", - "Raised while trying to determine id of parameter a at position 1." - "\nUpdate your code as this will raise an error in pytest-4.0.", - "Raised while trying to determine id of parameter b at position 1." - "\nUpdate your code as this will raise an error in pytest-4.0.", - "Raised while trying to determine id of parameter a at position 2." - "\nUpdate your code as this will raise an error in pytest-4.0.", - "Raised while trying to determine id of parameter b at position 2." - "\nUpdate your code as this will raise an error in pytest-4.0.", - ] - + @pytest.mark.filterwarnings("default") def test_parametrize_ids_exception(self, testdir): """ :param testdir: the instance of Testdir class, a temporary @@ -438,13 +401,14 @@ def test_foo(arg): pass """ ) - with pytest.warns(DeprecationWarning): - result = testdir.runpytest("--collect-only") + result = testdir.runpytest("--collect-only") result.stdout.fnmatch_lines( [ "", " ", " ", + "*test_parametrize_ids_exception.py:6: *parameter arg at position 0*", + "*test_parametrize_ids_exception.py:6: *parameter arg at position 1*", ] ) diff --git a/testing/python/test_deprecations.py b/testing/python/test_deprecations.py deleted file mode 100644 index b0c11f0b03b..00000000000 --- a/testing/python/test_deprecations.py +++ /dev/null @@ -1,22 +0,0 @@ -import pytest - -from _pytest.python import PyCollector - - -class PyCollectorMock(PyCollector): - """evil hack""" - - def __init__(self): - self.called = False - - def _makeitem(self, *k): - """hack to disable the actual behaviour""" - self.called = True - - -def test_pycollector_makeitem_is_deprecated(): - - collector = PyCollectorMock() - with pytest.deprecated_call(): - collector.makeitem("foo", "bar") - assert collector.called diff --git a/testing/test_assertion.py b/testing/test_assertion.py index a9e6247139d..6a2a1ed3856 100644 --- a/testing/test_assertion.py +++ b/testing/test_assertion.py @@ -1075,17 +1075,27 @@ def test_diff(): ) +@pytest.mark.filterwarnings("default") def test_assert_tuple_warning(testdir): + msg = "assertion is always true" testdir.makepyfile( """ def test_tuple(): assert(False, 'you shall not pass') """ ) - result = testdir.runpytest("-rw") - result.stdout.fnmatch_lines( - ["*test_assert_tuple_warning.py:2", "*assertion is always true*"] + result = testdir.runpytest() + result.stdout.fnmatch_lines(["*test_assert_tuple_warning.py:2:*{}*".format(msg)]) + + # tuples with size != 2 should not trigger the warning + testdir.makepyfile( + """ + def test_tuple(): + assert () + """ ) + result = testdir.runpytest() + assert msg not in result.stdout.str() def test_assert_indirect_tuple_no_warning(testdir): diff --git a/testing/test_assertrewrite.py b/testing/test_assertrewrite.py index c436ab0decd..c4cafcaab8b 100644 --- a/testing/test_assertrewrite.py +++ b/testing/test_assertrewrite.py @@ -759,16 +759,16 @@ def test_package_without__init__py(self, testdir): testdir.makepyfile("import a_package_without_init_py.module") assert testdir.runpytest().ret == EXIT_NOTESTSCOLLECTED - def test_rewrite_warning(self, pytestconfig, monkeypatch): - hook = AssertionRewritingHook(pytestconfig) - warnings = [] - - def mywarn(code, msg): - warnings.append((code, msg)) - - monkeypatch.setattr(hook.config, "warn", mywarn) - hook.mark_rewrite("_pytest") - assert "_pytest" in warnings[0][1] + def test_rewrite_warning(self, testdir): + testdir.makeconftest( + """ + import pytest + pytest.register_assert_rewrite("_pytest") + """ + ) + # needs to be a subprocess because pytester explicitly disables this warning + result = testdir.runpytest_subprocess() + result.stdout.fnmatch_lines("*Module already imported*: _pytest") def test_rewrite_module_imported_from_conftest(self, testdir): testdir.makeconftest( diff --git a/testing/test_cacheprovider.py b/testing/test_cacheprovider.py index 23ec7359906..6d425f95b03 100644 --- a/testing/test_cacheprovider.py +++ b/testing/test_cacheprovider.py @@ -31,6 +31,7 @@ def test_config_cache_dataerror(self, testdir): val = config.cache.get("key/name", -2) assert val == -2 + @pytest.mark.filterwarnings("default") def test_cache_writefail_cachfile_silent(self, testdir): testdir.makeini("[pytest]") testdir.tmpdir.join(".pytest_cache").write("gone wrong") @@ -39,6 +40,9 @@ def test_cache_writefail_cachfile_silent(self, testdir): cache.set("test/broken", []) @pytest.mark.skipif(sys.platform.startswith("win"), reason="no chmod on windows") + @pytest.mark.filterwarnings( + "ignore:could not create cache path:pytest.PytestWarning" + ) def test_cache_writefail_permissions(self, testdir): testdir.makeini("[pytest]") testdir.tmpdir.ensure_dir(".pytest_cache").chmod(0) @@ -47,6 +51,7 @@ def test_cache_writefail_permissions(self, testdir): cache.set("test/broken", []) @pytest.mark.skipif(sys.platform.startswith("win"), reason="no chmod on windows") + @pytest.mark.filterwarnings("default") def test_cache_failure_warns(self, testdir): testdir.tmpdir.ensure_dir(".pytest_cache").chmod(0) testdir.makepyfile( diff --git a/testing/test_capture.py b/testing/test_capture.py index 75d82ecde56..3dc422efe61 100644 --- a/testing/test_capture.py +++ b/testing/test_capture.py @@ -18,7 +18,9 @@ from _pytest.main import EXIT_NOTESTSCOLLECTED -needsosdup = pytest.mark.xfail("not hasattr(os, 'dup')") +needsosdup = pytest.mark.skipif( + not hasattr(os, "dup"), reason="test needs os.dup, not available on this platform" +) def tobytes(obj): @@ -61,9 +63,8 @@ def test_getmethod_default_no_fd(self, monkeypatch): pytest_addoption(parser) assert parser._groups[0].options[0].default == "sys" - @needsosdup @pytest.mark.parametrize( - "method", ["no", "sys", pytest.mark.skipif('not hasattr(os, "dup")', "fd")] + "method", ["no", "sys", pytest.param("fd", marks=needsosdup)] ) def test_capturing_basic_api(self, method): capouter = StdCaptureFD() diff --git a/testing/test_config.py b/testing/test_config.py index ad7f35b574d..8d67d7e9d19 100644 --- a/testing/test_config.py +++ b/testing/test_config.py @@ -135,13 +135,13 @@ def pytest_addoption(parser): """ ) testdir.makefile( - ".cfg", + ".ini", custom=""" [pytest] custom = 1 """, ) - config = testdir.parseconfig("-c", "custom.cfg") + config = testdir.parseconfig("-c", "custom.ini") assert config.getini("custom") == "1" testdir.makefile( @@ -155,8 +155,8 @@ def pytest_addoption(parser): assert config.getini("custom") == "1" def test_absolute_win32_path(self, testdir): - temp_cfg_file = testdir.makefile( - ".cfg", + temp_ini_file = testdir.makefile( + ".ini", custom=""" [pytest] addopts = --version @@ -164,8 +164,8 @@ def test_absolute_win32_path(self, testdir): ) from os.path import normpath - temp_cfg_file = normpath(str(temp_cfg_file)) - ret = pytest.main("-c " + temp_cfg_file) + temp_ini_file = normpath(str(temp_ini_file)) + ret = pytest.main(["-c", temp_ini_file]) assert ret == _pytest.main.EXIT_OK @@ -783,13 +783,14 @@ class pytest_something(object): assert pm.parse_hookimpl_opts(Dummy(), "pytest_something") is None -class TestWarning(object): +class TestLegacyWarning(object): + @pytest.mark.filterwarnings("default") def test_warn_config(self, testdir): testdir.makeconftest( """ values = [] - def pytest_configure(config): - config.warn("C1", "hello") + def pytest_runtest_setup(item): + item.config.warn("C1", "hello") def pytest_logwarning(code, message): if message == "hello" and code == "C1": values.append(1) @@ -802,24 +803,31 @@ def test_proper(pytestconfig): assert conftest.values == [1] """ ) - reprec = testdir.inline_run() - reprec.assertoutcome(passed=1) + result = testdir.runpytest() + result.stdout.fnmatch_lines( + ["*hello", "*config.warn has been deprecated*", "*1 passed*"] + ) - def test_warn_on_test_item_from_request(self, testdir, request): + @pytest.mark.filterwarnings("default") + @pytest.mark.parametrize("use_kw", [True, False]) + def test_warn_on_test_item_from_request(self, testdir, use_kw): + code_kw = "code=" if use_kw else "" + message_kw = "message=" if use_kw else "" testdir.makepyfile( """ import pytest @pytest.fixture def fix(request): - request.node.warn("T1", "hello") + request.node.warn({code_kw}"T1", {message_kw}"hello") def test_hello(fix): pass - """ + """.format( + code_kw=code_kw, message_kw=message_kw + ) ) result = testdir.runpytest("--disable-pytest-warnings") - assert result.parseoutcomes()["warnings"] > 0 assert "hello" not in result.stdout.str() result = testdir.runpytest() @@ -828,6 +836,7 @@ def test_hello(fix): ===*warnings summary*=== *test_warn_on_test_item_from_request.py::test_hello* *hello* + *test_warn_on_test_item_from_request.py:7:*Node.warn(code, message) form has been deprecated* """ ) @@ -847,7 +856,7 @@ def test_simple_noini(self, tmpdir): @pytest.mark.parametrize("name", "setup.cfg tox.ini pytest.ini".split()) def test_with_ini(self, tmpdir, name): inifile = tmpdir.join(name) - inifile.write("[pytest]\n") + inifile.write("[pytest]\n" if name != "setup.cfg" else "[tool:pytest]\n") a = tmpdir.mkdir("a") b = a.mkdir("b") @@ -893,11 +902,14 @@ def test_with_specific_inifile(self, tmpdir): class TestOverrideIniArgs(object): @pytest.mark.parametrize("name", "setup.cfg tox.ini pytest.ini".split()) def test_override_ini_names(self, testdir, name): + section = "[pytest]" if name != "setup.cfg" else "[tool:pytest]" testdir.tmpdir.join(name).write( textwrap.dedent( """ - [pytest] - custom = 1.0""" + {section} + custom = 1.0""".format( + section=section + ) ) ) testdir.makeconftest( diff --git a/testing/test_junitxml.py b/testing/test_junitxml.py index 0678d59e80d..3928548a8e4 100644 --- a/testing/test_junitxml.py +++ b/testing/test_junitxml.py @@ -1005,6 +1005,7 @@ def test_record_with_same_name(record_property): pnodes[1].assert_attr(name="foo", value="baz") +@pytest.mark.filterwarnings("default") def test_record_attribute(testdir): testdir.makepyfile( """ @@ -1023,7 +1024,7 @@ def test_record(record_xml_attribute, other): tnode.assert_attr(bar="1") tnode.assert_attr(foo="<1") result.stdout.fnmatch_lines( - ["test_record_attribute.py::test_record", "*record_xml_attribute*experimental*"] + ["*test_record_attribute.py:6:*record_xml_attribute is an experimental feature"] ) diff --git a/testing/test_mark.py b/testing/test_mark.py index e47981aca97..9dad7a16509 100644 --- a/testing/test_mark.py +++ b/testing/test_mark.py @@ -16,7 +16,7 @@ from _pytest.nodes import Node ignore_markinfo = pytest.mark.filterwarnings( - "ignore:MarkInfo objects:_pytest.deprecated.RemovedInPytest4Warning" + "ignore:MarkInfo objects:pytest.RemovedInPytest4Warning" ) @@ -1039,10 +1039,19 @@ def assert_test_is_not_selected(keyword): ), ], ) -@pytest.mark.filterwarnings("ignore") +@pytest.mark.filterwarnings("default") def test_parameterset_extractfrom(argval, expected): - extracted = ParameterSet.extract_from(argval) + from _pytest.deprecated import MARK_PARAMETERSET_UNPACKING + + warn_called = [] + + class DummyItem: + def warn(self, warning): + warn_called.append(warning) + + extracted = ParameterSet.extract_from(argval, belonging_definition=DummyItem()) assert extracted == expected + assert warn_called == [MARK_PARAMETERSET_UNPACKING] def test_legacy_transfer(): diff --git a/testing/test_nodes.py b/testing/test_nodes.py index eee3ac8e9e4..9219f45e517 100644 --- a/testing/test_nodes.py +++ b/testing/test_nodes.py @@ -19,3 +19,14 @@ def test_ischildnode(baseid, nodeid, expected): result = nodes.ischildnode(baseid, nodeid) assert result is expected + + +def test_std_warn_not_pytestwarning(testdir): + items = testdir.getitems( + """ + def test(): + pass + """ + ) + with pytest.raises(ValueError, match=".*instance of PytestWarning.*"): + items[0].warn(UserWarning("some warning")) diff --git a/testing/test_recwarn.py b/testing/test_recwarn.py index f81d278895e..82bd66c555c 100644 --- a/testing/test_recwarn.py +++ b/testing/test_recwarn.py @@ -7,7 +7,7 @@ def test_recwarn_functional(testdir): - reprec = testdir.inline_runsource( + testdir.makepyfile( """ import warnings def test_method(recwarn): @@ -16,8 +16,8 @@ def test_method(recwarn): assert isinstance(warn.message, UserWarning) """ ) - res = reprec.countoutcomes() - assert tuple(res) == (1, 0, 0), res + reprec = testdir.inline_run() + reprec.assertoutcome(passed=1) class TestWarningsRecorderChecker(object): diff --git a/testing/test_resultlog.py b/testing/test_resultlog.py index 173384ffb30..1bb0cca48cd 100644 --- a/testing/test_resultlog.py +++ b/testing/test_resultlog.py @@ -13,6 +13,9 @@ ) +pytestmark = pytest.mark.filterwarnings("ignore:--result-log is deprecated") + + def test_generic_path(testdir): from _pytest.main import Session diff --git a/testing/test_terminal.py b/testing/test_terminal.py index 02e2824d97a..cca704c4cd5 100644 --- a/testing/test_terminal.py +++ b/testing/test_terminal.py @@ -1047,20 +1047,21 @@ def pytest_terminal_summary(terminalreporter, exitstatus): ) +@pytest.mark.filterwarnings("default") def test_terminal_summary_warnings_are_displayed(testdir): """Test that warnings emitted during pytest_terminal_summary are displayed. (#1305). """ testdir.makeconftest( """ + import warnings def pytest_terminal_summary(terminalreporter): - config = terminalreporter.config - config.warn('C1', 'internal warning') + warnings.warn(UserWarning('internal warning')) """ ) - result = testdir.runpytest("-rw") + result = testdir.runpytest() result.stdout.fnmatch_lines( - ["", "*internal warning", "*== 1 warnings in *"] + ["*conftest.py:3:*internal warning", "*== 1 warnings in *"] ) assert "None" not in result.stdout.str() diff --git a/testing/test_warnings.py b/testing/test_warnings.py index a26fb459776..3f748d666d9 100644 --- a/testing/test_warnings.py +++ b/testing/test_warnings.py @@ -37,17 +37,15 @@ def test_func(): ) -@pytest.mark.filterwarnings("always") +@pytest.mark.filterwarnings("default") def test_normal_flow(testdir, pyfile_with_warnings): """ - Check that the warnings section is displayed, containing test node ids followed by - all warnings generated by that test node. + Check that the warnings section is displayed. """ result = testdir.runpytest() result.stdout.fnmatch_lines( [ "*== %s ==*" % WARNINGS_SUMMARY_HEADER, - "*test_normal_flow.py::test_func", "*normal_flow_module.py:3: UserWarning: user warning", '* warnings.warn(UserWarning("user warning"))', "*normal_flow_module.py:4: RuntimeWarning: runtime warning", @@ -55,7 +53,6 @@ def test_normal_flow(testdir, pyfile_with_warnings): "* 1 passed, 2 warnings*", ] ) - assert result.stdout.str().count("test_normal_flow.py::test_func") == 1 @pytest.mark.filterwarnings("always") @@ -302,3 +299,204 @@ def test_func(): ) result = testdir.runpytest("--strict") assert result.ret == 0 + + +@pytest.mark.filterwarnings("always") +def test_warning_captured_hook(testdir): + testdir.makeconftest( + """ + from _pytest.warnings import _issue_config_warning + def pytest_configure(config): + _issue_config_warning(UserWarning("config warning"), config) + """ + ) + testdir.makepyfile( + """ + import pytest, warnings + + warnings.warn(UserWarning("collect warning")) + + @pytest.fixture + def fix(): + warnings.warn(UserWarning("setup warning")) + yield 1 + warnings.warn(UserWarning("teardown warning")) + + def test_func(fix): + warnings.warn(UserWarning("call warning")) + assert fix == 1 + """ + ) + + collected = [] + + class WarningCollector: + def pytest_warning_captured(self, warning_message, when, item): + imge_name = item.name if item is not None else "" + collected.append((str(warning_message.message), when, imge_name)) + + result = testdir.runpytest(plugins=[WarningCollector()]) + result.stdout.fnmatch_lines(["*1 passed*"]) + + expected = [ + ("config warning", "config", ""), + ("collect warning", "collect", ""), + ("setup warning", "runtest", "test_func"), + ("call warning", "runtest", "test_func"), + ("teardown warning", "runtest", "test_func"), + ] + assert collected == expected + + +@pytest.mark.filterwarnings("always") +def test_collection_warnings(testdir): + """ + Check that we also capture warnings issued during test collection (#3251). + """ + testdir.makepyfile( + """ + import warnings + + warnings.warn(UserWarning("collection warning")) + + def test_foo(): + pass + """ + ) + result = testdir.runpytest() + result.stdout.fnmatch_lines( + [ + "*== %s ==*" % WARNINGS_SUMMARY_HEADER, + "*collection_warnings.py:3: UserWarning: collection warning", + ' warnings.warn(UserWarning("collection warning"))', + "* 1 passed, 1 warnings*", + ] + ) + + +@pytest.mark.filterwarnings("always") +def test_mark_regex_escape(testdir): + """@pytest.mark.filterwarnings should not try to escape regex characters (#3936)""" + testdir.makepyfile( + r""" + import pytest, warnings + + @pytest.mark.filterwarnings(r"ignore:some \(warning\)") + def test_foo(): + warnings.warn(UserWarning("some (warning)")) + """ + ) + result = testdir.runpytest() + assert WARNINGS_SUMMARY_HEADER not in result.stdout.str() + + +@pytest.mark.filterwarnings("default") +@pytest.mark.parametrize("ignore_pytest_warnings", ["no", "ini", "cmdline"]) +def test_hide_pytest_internal_warnings(testdir, ignore_pytest_warnings): + """Make sure we can ignore internal pytest warnings using a warnings filter.""" + testdir.makepyfile( + """ + import pytest + import warnings + + warnings.warn(pytest.PytestWarning("some internal warning")) + + def test_bar(): + pass + """ + ) + if ignore_pytest_warnings == "ini": + testdir.makeini( + """ + [pytest] + filterwarnings = ignore::pytest.PytestWarning + """ + ) + args = ( + ["-W", "ignore::pytest.PytestWarning"] + if ignore_pytest_warnings == "cmdline" + else [] + ) + result = testdir.runpytest(*args) + if ignore_pytest_warnings != "no": + assert WARNINGS_SUMMARY_HEADER not in result.stdout.str() + else: + result.stdout.fnmatch_lines( + [ + "*== %s ==*" % WARNINGS_SUMMARY_HEADER, + "*test_hide_pytest_internal_warnings.py:4: PytestWarning: some internal warning", + "* 1 passed, 1 warnings *", + ] + ) + + +class TestDeprecationWarningsByDefault: + """ + Note: all pytest runs are executed in a subprocess so we don't inherit warning filters + from pytest's own test suite + """ + + def create_file(self, testdir, mark=""): + testdir.makepyfile( + """ + import pytest, warnings + + warnings.warn(DeprecationWarning("collection")) + + {mark} + def test_foo(): + warnings.warn(PendingDeprecationWarning("test run")) + """.format( + mark=mark + ) + ) + + def test_shown_by_default(self, testdir): + self.create_file(testdir) + result = testdir.runpytest_subprocess() + result.stdout.fnmatch_lines( + [ + "*== %s ==*" % WARNINGS_SUMMARY_HEADER, + "*test_shown_by_default.py:3: DeprecationWarning: collection", + "*test_shown_by_default.py:7: PendingDeprecationWarning: test run", + "* 1 passed, 2 warnings*", + ] + ) + + def test_hidden_by_ini(self, testdir): + self.create_file(testdir) + testdir.makeini( + """ + [pytest] + filterwarnings = once::UserWarning + """ + ) + result = testdir.runpytest_subprocess() + assert WARNINGS_SUMMARY_HEADER not in result.stdout.str() + + def test_hidden_by_mark(self, testdir): + """Should hide the deprecation warning from the function, but the warning during collection should + be displayed normally. + """ + self.create_file( + testdir, mark='@pytest.mark.filterwarnings("once::UserWarning")' + ) + result = testdir.runpytest_subprocess() + result.stdout.fnmatch_lines( + [ + "*== %s ==*" % WARNINGS_SUMMARY_HEADER, + "*test_hidden_by_mark.py:3: DeprecationWarning: collection", + "* 1 passed, 1 warnings*", + ] + ) + + def test_hidden_by_cmdline(self, testdir): + self.create_file(testdir) + result = testdir.runpytest_subprocess("-W", "once::UserWarning") + assert WARNINGS_SUMMARY_HEADER not in result.stdout.str() + + def test_hidden_by_system(self, testdir, monkeypatch): + self.create_file(testdir) + monkeypatch.setenv(str("PYTHONWARNINGS"), str("once::UserWarning")) + result = testdir.runpytest_subprocess() + assert WARNINGS_SUMMARY_HEADER not in result.stdout.str() diff --git a/tox.ini b/tox.ini index fbc5d4779d6..0b6e89aa6eb 100644 --- a/tox.ini +++ b/tox.ini @@ -218,6 +218,9 @@ norecursedirs = .tox ja .hg cx_freeze_source testing/example_scripts xfail_strict=true filterwarnings = error + ignore:yield tests are deprecated, and scheduled to be removed in pytest 4.0:pytest.RemovedInPytest4Warning + ignore:Metafunc.addcall is deprecated and scheduled to be removed in pytest 4.0:pytest.RemovedInPytest4Warning + ignore:Module already imported so cannot be rewritten:pytest.PytestWarning # produced by path.local ignore:bad escape.*:DeprecationWarning:re # produced by path.readlines @@ -226,8 +229,8 @@ filterwarnings = ignore:.*type argument to addoption.*:DeprecationWarning # produced by python >=3.5 on execnet (pytest-xdist) ignore:.*inspect.getargspec.*deprecated, use inspect.signature.*:DeprecationWarning - #pytests own futurewarnings - ignore::_pytest.experiments.PytestExerimentalApiWarning + # pytest's own futurewarnings + ignore::pytest.PytestExperimentalApiWarning pytester_example_dir = testing/example_scripts [flake8] max-line-length = 120